diff --git a/.nojekyll b/.nojekyll
new file mode 100644
index 0000000..e69de29
diff --git a/.stamp b/.stamp
new file mode 100644
index 0000000..e69de29
diff --git a/404.html b/404.html
new file mode 100644
index 0000000..6cbcc91
--- /dev/null
+++ b/404.html
@@ -0,0 +1,30 @@
+
+
+
+
+ Semi.Avalonia.Demo.Web
+
+
+
+
+
+
+
+
+
+
+
+
+
+

+
+
+
+
+
+
\ No newline at end of file
diff --git a/Logo.svg b/Logo.svg
new file mode 100644
index 0000000..9685a23
--- /dev/null
+++ b/Logo.svg
@@ -0,0 +1,5 @@
+
diff --git a/Semi.Avalonia.Demo.Web.runtimeconfig.json b/Semi.Avalonia.Demo.Web.runtimeconfig.json
new file mode 100644
index 0000000..f4e2e90
--- /dev/null
+++ b/Semi.Avalonia.Demo.Web.runtimeconfig.json
@@ -0,0 +1,34 @@
+{
+ "runtimeOptions": {
+ "tfm": "net7.0",
+ "includedFrameworks": [
+ {
+ "name": "Microsoft.NETCore.App",
+ "version": "7.0.9"
+ }
+ ],
+ "wasmHostProperties": {
+ "perHostConfig": [
+ {
+ "name": "browser",
+ "html-path": "index.html",
+ "Host": "browser"
+ }
+ ],
+ "runtimeArgs": [],
+ "mainAssembly": "Semi.Avalonia.Demo.Web.dll"
+ },
+ "configProperties": {
+ "Microsoft.Extensions.DependencyInjection.VerifyOpenGenericServiceTrimmability": true,
+ "System.ComponentModel.TypeConverter.EnableUnsafeBinaryFormatterInDesigntimeLicenseContextSerialization": false,
+ "System.Resources.ResourceManager.AllowCustomResourceTypes": false,
+ "System.Runtime.InteropServices.BuiltInComInterop.IsSupported": false,
+ "System.Runtime.InteropServices.EnableConsumingManagedCodeFromNativeHosting": false,
+ "System.Runtime.InteropServices.EnableCppCLIHostActivation": false,
+ "System.Runtime.Serialization.EnableUnsafeBinaryFormatterSerialization": false,
+ "System.StartupHookProvider.IsSupported": false,
+ "System.Threading.Thread.EnableAutoreleasePool": false,
+ "System.Text.Encoding.EnableUnsafeUTF7Encoding": false
+ }
+ }
+}
\ No newline at end of file
diff --git a/app.css b/app.css
new file mode 100644
index 0000000..a424538
--- /dev/null
+++ b/app.css
@@ -0,0 +1,74 @@
+:root {
+ --sat: env(safe-area-inset-top);
+ --sar: env(safe-area-inset-right);
+ --sab: env(safe-area-inset-bottom);
+ --sal: env(safe-area-inset-left);
+}
+
+/* HTML styles for the splash screen */
+
+.highlight {
+ color: white;
+ font-size: 2.5rem;
+ display: block;
+}
+
+.purple {
+ color: #8b44ac;
+}
+
+.icon {
+ opacity: 0.05;
+ height: 35%;
+ width: 35%;
+ position: absolute;
+ background-repeat: no-repeat;
+ right: 0px;
+ bottom: 0px;
+ margin-right: 3%;
+ margin-bottom: 5%;
+ z-index: 5000;
+ background-position: right bottom;
+ pointer-events: none;
+}
+
+#avalonia-splash a {
+ color: whitesmoke;
+ text-decoration: none;
+}
+
+.center {
+ display: flex;
+ justify-content: center;
+ align-items: center;
+ height: 100vh;
+}
+
+#avalonia-splash {
+ position: relative;
+ height: 100%;
+ width: 100%;
+ color: whitesmoke;
+ background: #1b2a4e;
+ font-family: 'Nunito', sans-serif;
+ background-position: center;
+ background-size: cover;
+ background-repeat: no-repeat;
+ justify-content: center;
+ align-items: center;
+}
+
+.splash-close {
+ animation: fadeout 0.25s linear forwards;
+}
+
+@keyframes fadeout {
+ 0% {
+ opacity: 100%;
+ }
+
+ 100% {
+ opacity: 0;
+ visibility: collapse;
+ }
+}
diff --git a/avalonia.js b/avalonia.js
new file mode 100755
index 0000000..f8390e9
--- /dev/null
+++ b/avalonia.js
@@ -0,0 +1,2 @@
+var b=class{constructor(e,t,n){this.renderLoopEnabled=!1;this.renderLoopRequest=0;if(this.htmlCanvas=t,this.renderFrameCallback=n,e){let i=b.createWebGLContext(t);if(!i){console.error("Failed to create WebGL context");return}let o=globalThis.AvaloniaGL;o.makeContextCurrent(i);let a=o.currentContext.GLctx,s=a.getParameter(a.FRAMEBUFFER_BINDING);this.glInfo={context:i,fboId:s?s.id:0,stencil:a.getParameter(a.STENCIL_BITS),sample:0,depth:a.getParameter(a.DEPTH_BITS)}}}static initGL(e,t,n){let i=b.init(!0,e,t,n);return!i||!i.glInfo?null:i.glInfo}static init(e,t,n,i){let o=t;if(!o)return console.error("No canvas element was provided."),null;b.elements||(b.elements=new Map),b.elements.set(n,t);let a=new b(e,t,i);return o.Canvas=a,a}setEnableRenderLoop(e){this.renderLoopEnabled=e,e?this.requestAnimationFrame():this.renderLoopRequest!==0&&(window.cancelAnimationFrame(this.renderLoopRequest),this.renderLoopRequest=0)}requestAnimationFrame(e){e!==void 0&&this.renderLoopEnabled!==e&&this.setEnableRenderLoop(e),this.renderLoopRequest===0&&(this.renderLoopRequest=window.requestAnimationFrame(()=>{var t,n;this.htmlCanvas.width!==this.newWidth&&(this.htmlCanvas.width=(t=this.newWidth)!=null?t:0),this.htmlCanvas.height!==this.newHeight&&(this.htmlCanvas.height=(n=this.newHeight)!=null?n:0),this.renderFrameCallback(),this.renderLoopRequest=0,this.renderLoopEnabled&&this.requestAnimationFrame()}))}setCanvasSize(e,t){this.renderLoopRequest!==0&&(window.cancelAnimationFrame(this.renderLoopRequest),this.renderLoopRequest=0),this.newWidth=e,this.newHeight=t,this.htmlCanvas.width!==this.newWidth&&(this.htmlCanvas.width=this.newWidth),this.htmlCanvas.height!==this.newHeight&&(this.htmlCanvas.height=this.newHeight),this.requestAnimationFrame()}static setCanvasSize(e,t,n){let i=e;!i||!i.Canvas||i.Canvas.setCanvasSize(t,n)}static requestAnimationFrame(e,t){let n=e;!n||!n.Canvas||n.Canvas.requestAnimationFrame(t)}static createWebGLContext(e){let t={alpha:1,depth:1,stencil:8,antialias:0,premultipliedAlpha:1,preserveDrawingBuffer:0,preferLowPowerToHighPerformance:0,failIfMajorPerformanceCaveat:0,majorVersion:2,minorVersion:0,enableExtensionsByDefault:1,explicitSwapControl:0,renderViaOffscreenBackBuffer:1},n=globalThis.AvaloniaGL,i=n.createContext(e,t);return!i&&t.majorVersion>1&&(console.warn("Falling back to WebGL 1.0"),t.majorVersion=1,t.minorVersion=0,i=n.createContext(e,t)),i}},l=class{static observe(e,t,n){if(!e||!n)return;l.lastMove=Date.now(),n(e.clientWidth,e.clientHeight);let i=o=>{Date.now()-l.lastMove>33&&(n(e.clientWidth,e.clientHeight),l.lastMove=Date.now())};window.addEventListener("resize",i)}static unobserve(e){if(!e||!l.observer)return;let t=l.elements.get(e);t&&(l.elements.delete(e),l.observer.unobserve(t))}static init(){l.observer||(l.elements=new Map,l.observer=new ResizeObserver(e=>{for(let t of e)l.invoke(t.target)}))}static invoke(e){let n=e.SizeWatcher;if(!(!n||!n.callback))return n.callback(e.clientWidth,e.clientHeight)}},d=class{static getDpi(){return window.devicePixelRatio}static start(e){return d.lastDpi=window.devicePixelRatio,d.timerId=window.setInterval(d.update,1e3),d.callback=e,d.lastDpi}static stop(){window.clearInterval(d.timerId)}static update(){if(!d.callback)return;let e=window.devicePixelRatio,t=d.lastDpi;d.lastDpi=e,Math.abs(t-e)>.001&&d.callback(t,e)}};var y=class{static getCaretCoordinates(e,t,n){var v,r;if(!M)throw new Error("textarea-caret-position#getCaretCoordinates should only be called in a browser");let i=(v=n==null?void 0:n.debug)!=null?v:!1;if(i){let c=document.querySelector("#input-textarea-caret-position-mirror-div");c&&((r=c.parentNode)==null||r.removeChild(c))}let o=document.createElement("div");o.id="input-textarea-caret-position-mirror-div",document.body.appendChild(o);let a=o.style,s=window.getComputedStyle?window.getComputedStyle(e):e.currentStyle,u=e.nodeName==="INPUT";a.whiteSpace="pre-wrap",u||(a.wordWrap="break-word"),a.position="absolute",i||(a.visibility="hidden"),F.forEach(c=>{if(u&&c==="lineHeight")if(s.boxSizing==="border-box"){let h=parseInt(s.height),f=parseInt(s.paddingTop)+parseInt(s.paddingBottom)+parseInt(s.borderTopWidth)+parseInt(s.borderBottomWidth),S=f+parseInt(s.lineHeight);h>S?a.lineHeight=`${h-f}px`:h===S?a.lineHeight=s.lineHeight:a.lineHeight="0"}else a.lineHeight=s.height;else a[c]=s[c]}),A?e.scrollHeight>parseInt(s.height)&&(a.overflowY="scroll"):a.overflow="hidden",o.textContent=e.value.substring(0,t),u&&(o.textContent=o.textContent.replace(/\s/g,"\xA0"));let m=document.createElement("span");m.textContent=e.value.substring(t)||".",o.appendChild(m);let g={top:m.offsetTop+parseInt(s.borderTopWidth),left:m.offsetLeft+parseInt(s.borderLeftWidth),height:parseInt(s.lineHeight)};return i?m.style.backgroundColor="#aaa":document.body.removeChild(o),g}},F=["direction","boxSizing","width","height","overflowX","overflowY","borderTopWidth","borderRightWidth","borderBottomWidth","borderLeftWidth","borderStyle","paddingTop","paddingRight","paddingBottom","paddingLeft","fontStyle","fontVariant","fontWeight","fontStretch","fontSize","fontSizeAdjust","lineHeight","fontFamily","textAlign","textTransform","textIndent","textDecoration","letterSpacing","wordSpacing","tabSize","MozTabSize"],M=typeof window!="undefined",A=M&&window.mozInnerScreenX!=null;var E=class{static initializeBackgroundHandlers(){this.clipboardState===0&&(globalThis.addEventListener("paste",e=>{this.clipboardState===2&&this.resolveClipboard(e.clipboardData.getData("text"))}),this.clipboardState=1)}static async readClipboardText(){if(globalThis.navigator.clipboard.readText)return await globalThis.navigator.clipboard.readText();try{return await new Promise((e,t)=>{this.clipboardState=2,this.resolveClipboard=e,this.rejectClipboard=t})}finally{this.clipboardState=1,this.resolveClipboard=null,this.rejectClipboard=null}}static subscribeKeyEvents(e,t,n){let i=a=>{t(a.code,a.key,this.getModifiers(a))&&this.clipboardState!==2&&a.preventDefault()};e.addEventListener("keydown",i);let o=a=>{n(a.code,a.key,this.getModifiers(a))&&a.preventDefault(),this.rejectClipboard&&this.rejectClipboard()};return e.addEventListener("keyup",o),()=>{e.removeEventListener("keydown",i),e.removeEventListener("keyup",o)}}static subscribeTextEvents(e,t,n,i,o,a){let s=r=>{let c=r;n(c.type,c.data)&&r.preventDefault()};e.addEventListener("input",s);let u=r=>{i(r)&&r.preventDefault()};e.addEventListener("compositionstart",u);let m=r=>{let c=r.getTargetRanges(),h=-1,f=-1;c.length>0&&(h=c[0].startOffset,f=c[0].endOffset),r.inputType==="insertCompositionText"&&(h=2,f=h+2),t(r,h,f)&&r.preventDefault()};e.addEventListener("beforeinput",m);let g=r=>{o(r)&&r.preventDefault()};e.addEventListener("compositionupdate",g);let v=r=>{a(r)&&r.preventDefault()};return e.addEventListener("compositionend",v),()=>{e.removeEventListener("input",s),e.removeEventListener("compositionstart",u),e.removeEventListener("compositionupdate",g),e.removeEventListener("compositionend",v)}}static subscribePointerEvents(e,t,n,i,o,a){let s=r=>{t(r),r.preventDefault()},u=r=>{n(r),r.preventDefault()},m=r=>{i(r),r.preventDefault()},g=r=>{o(r),r.preventDefault()},v=r=>{a(r),r.preventDefault()};return e.addEventListener("pointermove",s),e.addEventListener("pointerdown",u),e.addEventListener("pointerup",m),e.addEventListener("wheel",v),e.addEventListener("pointercancel",g),()=>{e.removeEventListener("pointerover",s),e.removeEventListener("pointerdown",u),e.removeEventListener("pointerup",m),e.removeEventListener("pointercancel",g),e.removeEventListener("wheel",v)}}static subscribeInputEvents(e,t){let n=i=>{t(i.value)&&i.preventDefault()};return e.addEventListener("input",n),()=>{e.removeEventListener("input",n)}}static subscribeDropEvents(e,t){let n=i=>{t(i)&&i.preventDefault()};return e.addEventListener("dragover",n),e.addEventListener("dragenter",n),e.addEventListener("dragleave",n),e.addEventListener("drop",n),()=>{e.removeEventListener("dragover",n),e.removeEventListener("dragenter",n),e.removeEventListener("dragleave",n),e.removeEventListener("drop",n)}}static getCoalescedEvents(e){return e.getCoalescedEvents()}static clearInput(e){e.value=""}static focusElement(e){e.focus()}static setCursor(e,t){t==="default"?e.style.removeProperty("cursor"):e.style.cursor=t}static setBounds(e,t,n,i,o,a){e.style.left=t.toFixed(0)+"px",e.style.top=n.toFixed(0)+"px";let{left:s,top:u}=y.getCaretCoordinates(e,a);e.style.left=(t-s).toFixed(0)+"px",e.style.top=(n-u).toFixed(0)+"px"}static hide(e){e.style.display="none"}static show(e){e.style.display="block"}static setSurroundingText(e,t,n,i){!e||(e.value=t,e.setSelectionRange(n,i),e.style.width="20px",e.style.width=`${e.scrollWidth}px`)}static getModifiers(e){let t=0;return e.ctrlKey&&(t|=2),e.altKey&&(t|=1),e.shiftKey&&(t|=4),e.metaKey&&(t|=8),t}};E.clipboardState=0;var w=class{static addClass(e,t){e.classList.add(t)}static observeDarkMode(e){if(globalThis.matchMedia===void 0)return!1;let t=globalThis.matchMedia("(prefers-color-scheme: dark)"),n=globalThis.matchMedia("(prefers-contrast: more)");return t.addEventListener("change",i=>{e(i.matches,n.matches)}),n.addEventListener("change",i=>{e(t.matches,i.matches)}),{isDarkMode:t.matches,isHighContrast:n.matches}}static createAvaloniaHost(e){let t=Math.random().toString(36).replace(/[^a-z]+/g,"").substr(2,10);e.classList.add("avalonia-container"),e.tabIndex=0,e.oncontextmenu=function(){return!1},e.style.overflow="hidden",e.style.touchAction="none";let n=document.createElement("canvas");n.id=`canvas${t}`,n.classList.add("avalonia-canvas"),n.style.width="100%",n.style.position="absolute";let i=document.createElement("div");i.id=`nativeHost${t}`,i.classList.add("avalonia-native-host"),i.style.left="0px",i.style.top="0px",i.style.width="100%",i.style.height="100%",i.style.position="absolute";let o=document.createElement("input");return o.id=`inputElement${t}`,o.classList.add("avalonia-input-element"),o.autocapitalize="none",o.type="text",o.spellcheck=!1,o.style.padding="0",o.style.margin="0",o.style.position="absolute",o.style.overflow="hidden",o.style.borderStyle="hidden",o.style.outline="none",o.style.background="transparent",o.style.color="transparent",o.style.display="none",o.style.height="20px",o.style.zIndex="-1",o.onpaste=function(){return!1},o.oncopy=function(){return!1},o.oncut=function(){return!1},e.prepend(o),e.prepend(i),e.prepend(n),{host:e,canvas:n,nativeHost:i,inputElement:o}}static isFullscreen(){return document.fullscreenElement!=null}static async setFullscreen(e){e?await document.documentElement.requestFullscreen():await document.exitFullscreen()}static getSafeAreaPadding(){let e=parseFloat(getComputedStyle(document.documentElement).getPropertyValue("--sat")),t=parseFloat(getComputedStyle(document.documentElement).getPropertyValue("--sab")),n=parseFloat(getComputedStyle(document.documentElement).getPropertyValue("--sal")),i=parseFloat(getComputedStyle(document.documentElement).getPropertyValue("--sar"));return[n,e,t,i]}};var L=class{static hasNativeFilePicker(){return"showSaveFilePicker"in globalThis}static isMobile(){var o;let e=(o=globalThis.navigator)==null?void 0:o.userAgentData;if(e)return e.mobile;let t=navigator.userAgent,n=/(android|bb\d+|meego).+mobile|avantgo|bada\/|blackberry|blazer|compal|elaine|fennec|hiptop|iemobile|ip(hone|od)|iris|kindle|lge |maemo|midp|mmp|mobile.+firefox|netfront|opera m(ob|in)i|palm( os)?|phone|p(ixi|re)\/|plucker|pocket|psp|series(4|6)0|symbian|treo|up\.(browser|link)|vodafone|wap|windows ce|xda|xiino/i,i=/1207|6310|6590|3gso|4thp|50[1-6]i|770s|802s|a wa|abac|ac(er|oo|s)|ai(ko|rn)|al(av|ca|co)|amoi|an(ex|ny|yw)|aptu|ar(ch|go)|as(te|us)|attw|au(di|m|r |s )|avan|be(ck|ll|nq)|bi(lb|rd)|bl(ac|az)|br(e|v)w|bumb|bw(n|u)|c55\/|capi|ccwa|cdm|cell|chtm|cldc|cmd|co(mp|nd)|craw|da(it|ll|ng)|dbte|dcs|devi|dica|dmob|do(c|p)o|ds(12|d)|el(49|ai)|em(l2|ul)|er(ic|k0)|esl8|ez([4-7]0|os|wa|ze)|fetc|fly(|_)|g1 u|g560|gene|gf5|gmo|go(\.w|od)|gr(ad|un)|haie|hcit|hd(m|p|t)|hei|hi(pt|ta)|hp( i|ip)|hsc|ht(c(| |_|a|g|p|s|t)|tp)|hu(aw|tc)|i(20|go|ma)|i230|iac( ||\/)|ibro|idea|ig01|ikom|im1k|inno|ipaq|iris|ja(t|v)a|jbro|jemu|jigs|kddi|keji|kgt( |\/)|klon|kpt |kwc|kyo(c|k)|le(no|xi)|lg( g|\/(k|l|u)|50|54|[a-w])|libw|lynx|m1w|m3ga|m50\/|ma(te|ui|xo)|mc(01|21|ca)|mcr|me(rc|ri)|mi(o8|oa|ts)|mmef|mo(01|02|bi|de|do|t(| |o|v)|zz)|mt(50|p1|v )|mwbp|mywa|n10[0-2]|n20[2-3]|n30(0|2)|n50(0|2|5)|n7(0(0|1)|10)|ne((c|m)|on|tf|wf|wg|wt)|nok(6|i)|nzph|o2im|op(ti|wv)|oran|owg1|p800|pan(a|d|t)|pdxg|pg(13|([1-8]|c))|phil|pire|pl(ay|uc)|pn2|po(ck|rt|se)|prox|psio|ptg|qaa|qc(07|12|21|32|60|[2-7]|i)|qtek|r380|r600|raks|rim9|ro(ve|zo)|s55\/|sa(ge|ma|mm|ms|ny|va)|sc(01|h|oo|p)|sdk\/|se(c(|0|1)|47|mc|nd|ri)|sgh|shar|sie(|m)|sk0|sl(45|id)|sm(al|ar|b3|it|t5)|so(ft|ny)|sp(01|h|v|v )|sy(01|mb)|t2(18|50)|t6(00|10|18)|ta(gt|lk)|tcl|tdg|tel(i|m)|tim|tmo|to(pl|sh)|ts(70|m|m3|m5)|tx9|up(\.b|g1|si)|utst|v400|v750|veri|vi(rg|te)|vk(40|5[0-3]|v)|vm40|voda|vulc|vx(52|53|60|61|70|80|81|83|85|98)|w3c(| )|webc|whit|wi(g |nc|nw)|wmlb|wonu|x700|yas|your|zeto|zte/i;return n.test(t)||i.test(t.substr(0,4))}};var C=class{static async seek(e,t){return await e.seek(t)}static async truncate(e,t){return await e.truncate(t)}static async close(e){return await e.close()}static async write(e,t){let n=new Uint8Array(t.byteLength);return t.copyTo(n),await e.write(n)}static byteLength(e){return e.size}static async sliceArrayBuffer(e,t,n){let i=await e.slice(t,t+n).arrayBuffer();return new Uint8Array(i)}static toMemoryView(e){return e}};var x=class{},H=class{static createDefaultChild(e){return document.createElement("div")}static createAttachment(){return new x}static initializeWithChildHandle(e,t){e._child=t,e._child.style.position="absolute"}static attachTo(e,t){e._host&&e._child&&e._host.removeChild(e._child),e._host=t,e._host&&e._child&&e._host.appendChild(e._child)}static showInBounds(e,t,n,i,o){e._child&&(e._child.style.top=`${n}px`,e._child.style.left=`${t}px`,e._child.style.width=`${i}px`,e._child.style.height=`${o}px`,e._child.style.display="block")}static hideWithSize(e,t,n){e._child&&(e._child.style.width=`${t}px`,e._child.style.height=`${n}px`,e._child.style.display="none")}static releaseChild(e){e._child&&(e._child=void 0)}};var T=class{static addBackHandler(e){history.pushState(null,"",window.location.href),window.onpopstate=()=>{e()?history.forward():history.back()}}};var k=class{static itemsArrayAt(e,t){let n=e[t];if(!n)return[];let i=[];for(let o=0;o;\r\n\r\n htmlCanvas: HTMLCanvasElement;\r\n glInfo?: SKGLViewInfo;\r\n renderFrameCallback: () => void;\r\n renderLoopEnabled: boolean = false;\r\n renderLoopRequest: number = 0;\r\n newWidth?: number;\r\n newHeight?: number;\r\n\r\n public static initGL(element: HTMLCanvasElement, elementId: string, renderFrameCallback: () => void): SKGLViewInfo | null {\r\n const view = Canvas.init(true, element, elementId, renderFrameCallback);\r\n if (!view || !view.glInfo) {\r\n return null;\r\n }\r\n\r\n return view.glInfo;\r\n }\r\n\r\n static init(useGL: boolean, element: HTMLCanvasElement, elementId: string, renderFrameCallback: () => void): Canvas | null {\r\n const htmlCanvas = element as CanvasElement;\r\n if (!htmlCanvas) {\r\n console.error(\"No canvas element was provided.\");\r\n return null;\r\n }\r\n\r\n if (!Canvas.elements) {\r\n Canvas.elements = new Map();\r\n }\r\n Canvas.elements.set(elementId, element);\r\n\r\n const view = new Canvas(useGL, element, renderFrameCallback);\r\n\r\n htmlCanvas.Canvas = view;\r\n\r\n return view;\r\n }\r\n\r\n public constructor(useGL: boolean, element: HTMLCanvasElement, renderFrameCallback: () => void) {\r\n this.htmlCanvas = element;\r\n this.renderFrameCallback = renderFrameCallback;\r\n\r\n if (useGL) {\r\n const ctx = Canvas.createWebGLContext(element);\r\n if (!ctx) {\r\n console.error(\"Failed to create WebGL context\");\r\n return;\r\n }\r\n\r\n const GL = (globalThis as any).AvaloniaGL;\r\n\r\n // make current\r\n GL.makeContextCurrent(ctx);\r\n\r\n const GLctx = GL.currentContext.GLctx as WebGLRenderingContext;\r\n\r\n // read values\r\n const fbo = GLctx.getParameter(GLctx.FRAMEBUFFER_BINDING);\r\n\r\n this.glInfo = {\r\n context: ctx,\r\n fboId: fbo ? fbo.id : 0,\r\n stencil: GLctx.getParameter(GLctx.STENCIL_BITS),\r\n sample: 0, // TODO: GLctx.getParameter(GLctx.SAMPLES)\r\n depth: GLctx.getParameter(GLctx.DEPTH_BITS)\r\n };\r\n }\r\n }\r\n\r\n public setEnableRenderLoop(enable: boolean): void {\r\n this.renderLoopEnabled = enable;\r\n\r\n // either start the new frame or cancel the existing one\r\n if (enable) {\r\n // console.info(`Enabling render loop with callback ${this.renderFrameCallback._id}...`);\r\n this.requestAnimationFrame();\r\n } else if (this.renderLoopRequest !== 0) {\r\n window.cancelAnimationFrame(this.renderLoopRequest);\r\n this.renderLoopRequest = 0;\r\n }\r\n }\r\n\r\n public requestAnimationFrame(renderLoop?: boolean): void {\r\n // optionally update the render loop\r\n if (renderLoop !== undefined && this.renderLoopEnabled !== renderLoop) {\r\n this.setEnableRenderLoop(renderLoop);\r\n }\r\n\r\n // skip because we have a render loop\r\n if (this.renderLoopRequest !== 0) {\r\n return;\r\n }\r\n\r\n // add the draw to the next frame\r\n this.renderLoopRequest = window.requestAnimationFrame(() => {\r\n if (this.htmlCanvas.width !== this.newWidth) {\r\n this.htmlCanvas.width = this.newWidth ?? 0;\r\n }\r\n\r\n if (this.htmlCanvas.height !== this.newHeight) {\r\n this.htmlCanvas.height = this.newHeight ?? 0;\r\n }\r\n\r\n this.renderFrameCallback();\r\n this.renderLoopRequest = 0;\r\n\r\n // we may want to draw the next frame\r\n if (this.renderLoopEnabled) {\r\n this.requestAnimationFrame();\r\n }\r\n });\r\n }\r\n\r\n public setCanvasSize(width: number, height: number): void {\r\n if (this.renderLoopRequest !== 0) {\r\n window.cancelAnimationFrame(this.renderLoopRequest);\r\n this.renderLoopRequest = 0;\r\n }\r\n\r\n this.newWidth = width;\r\n this.newHeight = height;\r\n\r\n if (this.htmlCanvas.width !== this.newWidth) {\r\n this.htmlCanvas.width = this.newWidth;\r\n }\r\n\r\n if (this.htmlCanvas.height !== this.newHeight) {\r\n this.htmlCanvas.height = this.newHeight;\r\n }\r\n\r\n this.requestAnimationFrame();\r\n }\r\n\r\n public static setCanvasSize(element: HTMLCanvasElement, width: number, height: number): void {\r\n const htmlCanvas = element as CanvasElement;\r\n if (!htmlCanvas || !htmlCanvas.Canvas) {\r\n return;\r\n }\r\n\r\n htmlCanvas.Canvas.setCanvasSize(width, height);\r\n }\r\n\r\n public static requestAnimationFrame(element: HTMLCanvasElement, renderLoop?: boolean): void {\r\n const htmlCanvas = element as CanvasElement;\r\n if (!htmlCanvas || !htmlCanvas.Canvas) {\r\n return;\r\n }\r\n\r\n htmlCanvas.Canvas.requestAnimationFrame(renderLoop);\r\n }\r\n\r\n static createWebGLContext(htmlCanvas: HTMLCanvasElement): WebGLRenderingContext | WebGL2RenderingContext {\r\n const contextAttributes = {\r\n alpha: 1,\r\n depth: 1,\r\n stencil: 8,\r\n antialias: 0,\r\n premultipliedAlpha: 1,\r\n preserveDrawingBuffer: 0,\r\n preferLowPowerToHighPerformance: 0,\r\n failIfMajorPerformanceCaveat: 0,\r\n majorVersion: 2,\r\n minorVersion: 0,\r\n enableExtensionsByDefault: 1,\r\n explicitSwapControl: 0,\r\n renderViaOffscreenBackBuffer: 1\r\n };\r\n\r\n const GL = (globalThis as any).AvaloniaGL;\r\n\r\n let ctx: WebGLRenderingContext = GL.createContext(htmlCanvas, contextAttributes);\r\n\r\n if (!ctx && contextAttributes.majorVersion > 1) {\r\n console.warn(\"Falling back to WebGL 1.0\");\r\n contextAttributes.majorVersion = 1;\r\n contextAttributes.minorVersion = 0;\r\n ctx = GL.createContext(htmlCanvas, contextAttributes);\r\n }\r\n\r\n return ctx;\r\n }\r\n}\r\n\r\ntype SizeWatcherElement = {\r\n SizeWatcher: SizeWatcherInstance;\r\n} & HTMLElement;\r\n\r\ninterface SizeWatcherInstance {\r\n callback: (width: number, height: number) => void;\r\n}\r\n\r\nexport class SizeWatcher {\r\n static observer: ResizeObserver;\r\n static elements: Map;\r\n private static lastMove: number;\r\n\r\n public static observe(element: HTMLElement, elementId: string | undefined, callback: (width: number, height: number) => void): void {\r\n if (!element || !callback) {\r\n return;\r\n }\r\n\r\n SizeWatcher.lastMove = Date.now();\r\n\r\n callback(element.clientWidth, element.clientHeight);\r\n\r\n const handleResize = (args: UIEvent) => {\r\n if (Date.now() - SizeWatcher.lastMove > 33) {\r\n callback(element.clientWidth, element.clientHeight);\r\n SizeWatcher.lastMove = Date.now();\r\n }\r\n };\r\n\r\n window.addEventListener(\"resize\", handleResize);\r\n }\r\n\r\n public static unobserve(elementId: string): void {\r\n if (!elementId || !SizeWatcher.observer) {\r\n return;\r\n }\r\n\r\n const element = SizeWatcher.elements.get(elementId);\r\n if (element) {\r\n SizeWatcher.elements.delete(elementId);\r\n SizeWatcher.observer.unobserve(element);\r\n }\r\n }\r\n\r\n static init(): void {\r\n if (SizeWatcher.observer) {\r\n return;\r\n }\r\n\r\n SizeWatcher.elements = new Map();\r\n SizeWatcher.observer = new ResizeObserver((entries) => {\r\n for (const entry of entries) {\r\n SizeWatcher.invoke(entry.target);\r\n }\r\n });\r\n }\r\n\r\n static invoke(element: Element): void {\r\n const watcherElement = element as SizeWatcherElement;\r\n const instance = watcherElement.SizeWatcher;\r\n\r\n if (!instance || !instance.callback) {\r\n return;\r\n }\r\n\r\n return instance.callback(element.clientWidth, element.clientHeight);\r\n }\r\n}\r\n\r\nexport class DpiWatcher {\r\n static lastDpi: number;\r\n static timerId: number;\r\n static callback: (old: number, newdpi: number) => void;\r\n\r\n public static getDpi(): number {\r\n return window.devicePixelRatio;\r\n }\r\n\r\n public static start(callback: (old: number, newdpi: number) => void): number {\r\n DpiWatcher.lastDpi = window.devicePixelRatio;\r\n DpiWatcher.timerId = window.setInterval(DpiWatcher.update, 1000);\r\n DpiWatcher.callback = callback;\r\n\r\n return DpiWatcher.lastDpi;\r\n }\r\n\r\n public static stop(): void {\r\n window.clearInterval(DpiWatcher.timerId);\r\n }\r\n\r\n static update(): void {\r\n if (!DpiWatcher.callback) {\r\n return;\r\n }\r\n\r\n const currentDpi = window.devicePixelRatio;\r\n const lastDpi = DpiWatcher.lastDpi;\r\n DpiWatcher.lastDpi = currentDpi;\r\n\r\n if (Math.abs(lastDpi - currentDpi) > 0.001) {\r\n DpiWatcher.callback(lastDpi, currentDpi);\r\n }\r\n }\r\n}\r\n", "// Based on https://github.com/component/textarea-caret-position/blob/master/index.js\r\nexport class CaretHelper {\r\n public static getCaretCoordinates(\r\n element: HTMLInputElement | HTMLTextAreaElement,\r\n position: number,\r\n options?: { debug: boolean }\r\n ) {\r\n if (!isBrowser) {\r\n throw new Error(\r\n \"textarea-caret-position#getCaretCoordinates should only be called in a browser\"\r\n );\r\n }\r\n\r\n const debug = options?.debug ?? false;\r\n if (debug) {\r\n const el = document.querySelector(\r\n \"#input-textarea-caret-position-mirror-div\"\r\n );\r\n if (el) el.parentNode?.removeChild(el);\r\n }\r\n\r\n // The mirror div will replicate the textarea's style\r\n const div = document.createElement(\"div\");\r\n div.id = \"input-textarea-caret-position-mirror-div\";\r\n document.body.appendChild(div);\r\n\r\n const style = div.style;\r\n const computed = window.getComputedStyle\r\n ? window.getComputedStyle(element)\r\n : ((element as any).currentStyle as CSSStyleDeclaration); // currentStyle for IE < 9\r\n const isInput = element.nodeName === \"INPUT\";\r\n\r\n // Default textarea styles\r\n style.whiteSpace = \"pre-wrap\";\r\n if (!isInput) style.wordWrap = \"break-word\"; // only for textarea-s\r\n\r\n // Position off-screen\r\n style.position = \"absolute\"; // required to return coordinates properly\r\n if (!debug) style.visibility = \"hidden\"; // not 'display: none' because we want rendering\r\n\r\n // Transfer the element's properties to the div\r\n properties.forEach((prop: string) => {\r\n if (isInput && prop === \"lineHeight\") {\r\n // Special case for s because text is rendered centered and line height may be != height\r\n if (computed.boxSizing === \"border-box\") {\r\n const height = parseInt(computed.height);\r\n const outerHeight =\r\n parseInt(computed.paddingTop) +\r\n parseInt(computed.paddingBottom) +\r\n parseInt(computed.borderTopWidth) +\r\n parseInt(computed.borderBottomWidth);\r\n const targetHeight = outerHeight + parseInt(computed.lineHeight);\r\n if (height > targetHeight) {\r\n style.lineHeight = `${height - outerHeight}px`;\r\n } else if (height === targetHeight) {\r\n style.lineHeight = computed.lineHeight;\r\n } else {\r\n style.lineHeight = \"0\";\r\n }\r\n } else {\r\n style.lineHeight = computed.height;\r\n }\r\n } else {\r\n (style as any)[prop] = (computed as any)[prop];\r\n }\r\n });\r\n\r\n if (isFirefox) {\r\n // Firefox lies about the overflow property for textareas: https://bugzilla.mozilla.org/show_bug.cgi?id=984275\r\n if (element.scrollHeight > parseInt(computed.height)) {\r\n style.overflowY = \"scroll\";\r\n }\r\n } else {\r\n style.overflow = \"hidden\"; // for Chrome to not render a scrollbar; IE keeps overflowY = 'scroll'\r\n }\r\n\r\n div.textContent = element.value.substring(0, position);\r\n // The second special handling for input type=\"text\" vs textarea:\r\n // spaces need to be replaced with non-breaking spaces - http://stackoverflow.com/a/13402035/1269037\r\n if (isInput) div.textContent = div.textContent.replace(/\\s/g, \"\\u00a0\");\r\n\r\n const span = document.createElement(\"span\");\r\n // Wrapping must be replicated *exactly*, including when a long word gets\r\n // onto the next line, with whitespace at the end of the line before (#7).\r\n // The *only* reliable way to do that is to copy the *entire* rest of the\r\n // textarea's content into the created at the caret position.\r\n // For inputs, just '.' would be enough, but no need to bother.\r\n span.textContent = element.value.substring(position) || \".\"; // || because a completely empty faux span doesn't render at all\r\n div.appendChild(span);\r\n\r\n const coordinates = {\r\n top: span.offsetTop + parseInt(computed.borderTopWidth),\r\n left: span.offsetLeft + parseInt(computed.borderLeftWidth),\r\n height: parseInt(computed.lineHeight)\r\n };\r\n\r\n if (debug) {\r\n span.style.backgroundColor = \"#aaa\";\r\n } else {\r\n document.body.removeChild(div);\r\n }\r\n\r\n return coordinates;\r\n }\r\n}\r\n\r\nconst properties = [\r\n \"direction\", // RTL support\r\n \"boxSizing\",\r\n \"width\", // on Chrome and IE, exclude the scrollbar, so the mirror div wraps exactly as the textarea does\r\n \"height\",\r\n \"overflowX\",\r\n \"overflowY\", // copy the scrollbar for IE\r\n\r\n \"borderTopWidth\",\r\n \"borderRightWidth\",\r\n \"borderBottomWidth\",\r\n \"borderLeftWidth\",\r\n \"borderStyle\",\r\n\r\n \"paddingTop\",\r\n \"paddingRight\",\r\n \"paddingBottom\",\r\n \"paddingLeft\",\r\n\r\n // https://developer.mozilla.org/en-US/docs/Web/CSS/font\r\n \"fontStyle\",\r\n \"fontVariant\",\r\n \"fontWeight\",\r\n \"fontStretch\",\r\n \"fontSize\",\r\n \"fontSizeAdjust\",\r\n \"lineHeight\",\r\n \"fontFamily\",\r\n\r\n \"textAlign\",\r\n \"textTransform\",\r\n \"textIndent\",\r\n \"textDecoration\", // might not make a difference, but better be safe\r\n\r\n \"letterSpacing\",\r\n \"wordSpacing\",\r\n\r\n \"tabSize\",\r\n \"MozTabSize\"\r\n];\r\n\r\nconst isBrowser = typeof window !== \"undefined\";\r\nconst isFirefox = isBrowser && (window as any).mozInnerScreenX != null;\r\n", "import { CaretHelper } from \"./caretHelper\";\r\n\r\nenum RawInputModifiers {\r\n None = 0,\r\n Alt = 1,\r\n Control = 2,\r\n Shift = 4,\r\n Meta = 8,\r\n\r\n LeftMouseButton = 16,\r\n RightMouseButton = 32,\r\n MiddleMouseButton = 64,\r\n XButton1MouseButton = 128,\r\n XButton2MouseButton = 256,\r\n KeyboardMask = Alt | Control | Shift | Meta,\r\n\r\n PenInverted = 512,\r\n PenEraser = 1024,\r\n PenBarrelButton = 2048\r\n}\r\n\r\n/*\r\n* This is a hack to handle Mozilla clipboard events in a more convinient way for framework users.\r\n* In the browser, events go in order KeyDown -> Paste -> KeyUp.\r\n* On KeyDown we trigger Avalonia handlers, which might execute readClipboardText.\r\n* When readClipboardText was executed, we mark ClipboardState as Pending and setup clipboard promise,\r\n* which will un-handle KeyDown event, basically allowing browser to pass a Paste event properly.\r\n* On actual Paste event we execute promise callbacks, resuming async operation, and returning pasted text to the app.\r\n* Note #1, on every KeyUp event we will reset all the state and reject pending promises if any, as this event it expected to come after Paste.\r\n* Note #2, whole this code will be executed only on legacy browsers like Mozilla, where clipboard.readText is not available.\r\n* Note #3, with all of these hacks Clipboard.ReadText will still work only on actual \"paste\" gesture initiated by user.\r\n* */\r\nenum ClipboardState {\r\n None,\r\n Ready,\r\n Pending\r\n}\r\n\r\nexport class InputHelper {\r\n static clipboardState: ClipboardState = ClipboardState.None;\r\n static resolveClipboard?: any;\r\n static rejectClipboard?: any;\r\n\r\n public static initializeBackgroundHandlers() {\r\n if (this.clipboardState !== ClipboardState.None) {\r\n return;\r\n }\r\n\r\n globalThis.addEventListener(\"paste\", (args: any) => {\r\n if (this.clipboardState === ClipboardState.Pending) {\r\n this.resolveClipboard(args.clipboardData.getData(\"text\"));\r\n }\r\n });\r\n this.clipboardState = ClipboardState.Ready;\r\n }\r\n\r\n public static async readClipboardText(): Promise {\r\n if (globalThis.navigator.clipboard.readText) {\r\n return await globalThis.navigator.clipboard.readText();\r\n } else {\r\n try {\r\n return await new Promise((resolve, reject) => {\r\n this.clipboardState = ClipboardState.Pending;\r\n this.resolveClipboard = resolve;\r\n this.rejectClipboard = reject;\r\n });\r\n } finally {\r\n this.clipboardState = ClipboardState.Ready;\r\n this.resolveClipboard = null;\r\n this.rejectClipboard = null;\r\n }\r\n }\r\n }\r\n\r\n public static subscribeKeyEvents(\r\n element: HTMLInputElement,\r\n keyDownCallback: (code: string, key: string, modifiers: RawInputModifiers) => boolean,\r\n keyUpCallback: (code: string, key: string, modifiers: RawInputModifiers) => boolean) {\r\n const keyDownHandler = (args: KeyboardEvent) => {\r\n if (keyDownCallback(args.code, args.key, this.getModifiers(args))) {\r\n if (this.clipboardState !== ClipboardState.Pending) {\r\n args.preventDefault();\r\n }\r\n }\r\n };\r\n element.addEventListener(\"keydown\", keyDownHandler);\r\n\r\n const keyUpHandler = (args: KeyboardEvent) => {\r\n if (keyUpCallback(args.code, args.key, this.getModifiers(args))) {\r\n args.preventDefault();\r\n }\r\n if (this.rejectClipboard) {\r\n this.rejectClipboard();\r\n }\r\n };\r\n\r\n element.addEventListener(\"keyup\", keyUpHandler);\r\n\r\n return () => {\r\n element.removeEventListener(\"keydown\", keyDownHandler);\r\n element.removeEventListener(\"keyup\", keyUpHandler);\r\n };\r\n }\r\n\r\n public static subscribeTextEvents(\r\n element: HTMLInputElement,\r\n beforeInputCallback: (args: InputEvent, start: number, end: number) => boolean,\r\n inputCallback: (type: string, data: string | null) => boolean,\r\n compositionStartCallback: (args: CompositionEvent) => boolean,\r\n compositionUpdateCallback: (args: CompositionEvent) => boolean,\r\n compositionEndCallback: (args: CompositionEvent) => boolean) {\r\n const inputHandler = (args: Event) => {\r\n const inputEvent = args as InputEvent;\r\n\r\n // todo check cast\r\n if (inputCallback(inputEvent.type, inputEvent.data)) {\r\n args.preventDefault();\r\n }\r\n };\r\n element.addEventListener(\"input\", inputHandler);\r\n\r\n const compositionStartHandler = (args: CompositionEvent) => {\r\n if (compositionStartCallback(args)) {\r\n args.preventDefault();\r\n }\r\n };\r\n element.addEventListener(\"compositionstart\", compositionStartHandler);\r\n\r\n const beforeInputHandler = (args: InputEvent) => {\r\n const ranges = args.getTargetRanges();\r\n let start = -1;\r\n let end = -1;\r\n if (ranges.length > 0) {\r\n start = ranges[0].startOffset;\r\n end = ranges[0].endOffset;\r\n }\r\n\r\n if (args.inputType === \"insertCompositionText\") {\r\n start = 2;\r\n end = start + 2;\r\n }\r\n if (beforeInputCallback(args, start, end)) {\r\n args.preventDefault();\r\n }\r\n };\r\n element.addEventListener(\"beforeinput\", beforeInputHandler);\r\n\r\n const compositionUpdateHandler = (args: CompositionEvent) => {\r\n if (compositionUpdateCallback(args)) {\r\n args.preventDefault();\r\n }\r\n };\r\n element.addEventListener(\"compositionupdate\", compositionUpdateHandler);\r\n\r\n const compositionEndHandler = (args: CompositionEvent) => {\r\n if (compositionEndCallback(args)) {\r\n args.preventDefault();\r\n }\r\n };\r\n element.addEventListener(\"compositionend\", compositionEndHandler);\r\n\r\n return () => {\r\n element.removeEventListener(\"input\", inputHandler);\r\n element.removeEventListener(\"compositionstart\", compositionStartHandler);\r\n element.removeEventListener(\"compositionupdate\", compositionUpdateHandler);\r\n element.removeEventListener(\"compositionend\", compositionEndHandler);\r\n };\r\n }\r\n\r\n public static subscribePointerEvents(\r\n element: HTMLInputElement,\r\n pointerMoveCallback: (args: PointerEvent) => boolean,\r\n pointerDownCallback: (args: PointerEvent) => boolean,\r\n pointerUpCallback: (args: PointerEvent) => boolean,\r\n pointerCancelCallback: (args: PointerEvent) => boolean,\r\n wheelCallback: (args: WheelEvent) => boolean\r\n ) {\r\n const pointerMoveHandler = (args: PointerEvent) => {\r\n pointerMoveCallback(args);\r\n args.preventDefault();\r\n };\r\n\r\n const pointerDownHandler = (args: PointerEvent) => {\r\n pointerDownCallback(args);\r\n args.preventDefault();\r\n };\r\n\r\n const pointerUpHandler = (args: PointerEvent) => {\r\n pointerUpCallback(args);\r\n args.preventDefault();\r\n };\r\n\r\n const pointerCancelHandler = (args: PointerEvent) => {\r\n pointerCancelCallback(args);\r\n args.preventDefault();\r\n };\r\n\r\n const wheelHandler = (args: WheelEvent) => {\r\n wheelCallback(args);\r\n args.preventDefault();\r\n };\r\n\r\n element.addEventListener(\"pointermove\", pointerMoveHandler);\r\n element.addEventListener(\"pointerdown\", pointerDownHandler);\r\n element.addEventListener(\"pointerup\", pointerUpHandler);\r\n element.addEventListener(\"wheel\", wheelHandler);\r\n element.addEventListener(\"pointercancel\", pointerCancelHandler);\r\n\r\n return () => {\r\n element.removeEventListener(\"pointerover\", pointerMoveHandler);\r\n element.removeEventListener(\"pointerdown\", pointerDownHandler);\r\n element.removeEventListener(\"pointerup\", pointerUpHandler);\r\n element.removeEventListener(\"pointercancel\", pointerCancelHandler);\r\n element.removeEventListener(\"wheel\", wheelHandler);\r\n };\r\n }\r\n\r\n public static subscribeInputEvents(\r\n element: HTMLInputElement,\r\n inputCallback: (value: string) => boolean\r\n ) {\r\n const inputHandler = (args: Event) => {\r\n if (inputCallback((args as any).value)) {\r\n args.preventDefault();\r\n }\r\n };\r\n element.addEventListener(\"input\", inputHandler);\r\n\r\n return () => {\r\n element.removeEventListener(\"input\", inputHandler);\r\n };\r\n }\r\n\r\n public static subscribeDropEvents(\r\n element: HTMLInputElement,\r\n dragEvent: (args: any) => boolean\r\n ) {\r\n const dragHandler = (args: Event) => {\r\n if (dragEvent(args as any)) {\r\n args.preventDefault();\r\n }\r\n };\r\n element.addEventListener(\"dragover\", dragHandler);\r\n element.addEventListener(\"dragenter\", dragHandler);\r\n element.addEventListener(\"dragleave\", dragHandler);\r\n element.addEventListener(\"drop\", dragHandler);\r\n\r\n return () => {\r\n element.removeEventListener(\"dragover\", dragHandler);\r\n element.removeEventListener(\"dragenter\", dragHandler);\r\n element.removeEventListener(\"dragleave\", dragHandler);\r\n element.removeEventListener(\"drop\", dragHandler);\r\n };\r\n }\r\n\r\n public static getCoalescedEvents(pointerEvent: PointerEvent): PointerEvent[] {\r\n return pointerEvent.getCoalescedEvents();\r\n }\r\n\r\n public static clearInput(inputElement: HTMLInputElement) {\r\n inputElement.value = \"\";\r\n }\r\n\r\n public static focusElement(inputElement: HTMLElement) {\r\n inputElement.focus();\r\n }\r\n\r\n public static setCursor(inputElement: HTMLInputElement, kind: string) {\r\n if (kind === \"default\") {\r\n inputElement.style.removeProperty(\"cursor\");\r\n } else {\r\n inputElement.style.cursor = kind;\r\n }\r\n }\r\n\r\n public static setBounds(inputElement: HTMLInputElement, x: number, y: number, caretWidth: number, caretHeight: number, caret: number) {\r\n inputElement.style.left = (x).toFixed(0) + \"px\";\r\n inputElement.style.top = (y).toFixed(0) + \"px\";\r\n\r\n const { left, top } = CaretHelper.getCaretCoordinates(inputElement, caret);\r\n\r\n inputElement.style.left = (x - left).toFixed(0) + \"px\";\r\n inputElement.style.top = (y - top).toFixed(0) + \"px\";\r\n }\r\n\r\n public static hide(inputElement: HTMLInputElement) {\r\n inputElement.style.display = \"none\";\r\n }\r\n\r\n public static show(inputElement: HTMLInputElement) {\r\n inputElement.style.display = \"block\";\r\n }\r\n\r\n public static setSurroundingText(inputElement: HTMLInputElement, text: string, start: number, end: number) {\r\n if (!inputElement) {\r\n return;\r\n }\r\n\r\n inputElement.value = text;\r\n inputElement.setSelectionRange(start, end);\r\n inputElement.style.width = \"20px\";\r\n inputElement.style.width = `${inputElement.scrollWidth}px`;\r\n }\r\n\r\n private static getModifiers(args: KeyboardEvent): RawInputModifiers {\r\n let modifiers = RawInputModifiers.None;\r\n\r\n if (args.ctrlKey) { modifiers |= RawInputModifiers.Control; }\r\n if (args.altKey) { modifiers |= RawInputModifiers.Alt; }\r\n if (args.shiftKey) { modifiers |= RawInputModifiers.Shift; }\r\n if (args.metaKey) { modifiers |= RawInputModifiers.Meta; }\r\n\r\n return modifiers;\r\n }\r\n}\r\n", "export class AvaloniaDOM {\r\n public static addClass(element: HTMLElement, className: string): void {\r\n element.classList.add(className);\r\n }\r\n\r\n static observeDarkMode(observer: (isDarkMode: boolean, isHighContrast: boolean) => boolean) {\r\n if (globalThis.matchMedia === undefined) {\r\n return false;\r\n }\r\n\r\n const colorShemeMedia = globalThis.matchMedia(\"(prefers-color-scheme: dark)\");\r\n const prefersContrastMedia = globalThis.matchMedia(\"(prefers-contrast: more)\");\r\n\r\n colorShemeMedia.addEventListener(\"change\", (args: MediaQueryListEvent) => {\r\n observer(args.matches, prefersContrastMedia.matches);\r\n });\r\n prefersContrastMedia.addEventListener(\"change\", (args: MediaQueryListEvent) => {\r\n observer(colorShemeMedia.matches, args.matches);\r\n });\r\n\r\n return {\r\n isDarkMode: colorShemeMedia.matches,\r\n isHighContrast: prefersContrastMedia.matches\r\n };\r\n }\r\n\r\n static createAvaloniaHost(host: HTMLElement) {\r\n const randomIdPart = Math.random().toString(36).replace(/[^a-z]+/g, \"\").substr(2, 10);\r\n\r\n // Root element\r\n host.classList.add(\"avalonia-container\");\r\n host.tabIndex = 0;\r\n host.oncontextmenu = function () { return false; };\r\n host.style.overflow = \"hidden\";\r\n host.style.touchAction = \"none\";\r\n\r\n // Rendering target canvas\r\n const canvas = document.createElement(\"canvas\");\r\n canvas.id = `canvas${randomIdPart}`;\r\n canvas.classList.add(\"avalonia-canvas\");\r\n canvas.style.width = \"100%\";\r\n canvas.style.position = \"absolute\";\r\n\r\n // Native controls host\r\n const nativeHost = document.createElement(\"div\");\r\n nativeHost.id = `nativeHost${randomIdPart}`;\r\n nativeHost.classList.add(\"avalonia-native-host\");\r\n nativeHost.style.left = \"0px\";\r\n nativeHost.style.top = \"0px\";\r\n nativeHost.style.width = \"100%\";\r\n nativeHost.style.height = \"100%\";\r\n nativeHost.style.position = \"absolute\";\r\n\r\n // IME\r\n const inputElement = document.createElement(\"input\");\r\n inputElement.id = `inputElement${randomIdPart}`;\r\n inputElement.classList.add(\"avalonia-input-element\");\r\n inputElement.autocapitalize = \"none\";\r\n inputElement.type = \"text\";\r\n inputElement.spellcheck = false;\r\n inputElement.style.padding = \"0\";\r\n inputElement.style.margin = \"0\";\r\n inputElement.style.position = \"absolute\";\r\n inputElement.style.overflow = \"hidden\";\r\n inputElement.style.borderStyle = \"hidden\";\r\n inputElement.style.outline = \"none\";\r\n inputElement.style.background = \"transparent\";\r\n inputElement.style.color = \"transparent\";\r\n inputElement.style.display = \"none\";\r\n inputElement.style.height = \"20px\";\r\n inputElement.style.zIndex = \"-1\";\r\n inputElement.onpaste = function () { return false; };\r\n inputElement.oncopy = function () { return false; };\r\n inputElement.oncut = function () { return false; };\r\n\r\n host.prepend(inputElement);\r\n host.prepend(nativeHost);\r\n host.prepend(canvas);\r\n\r\n return {\r\n host,\r\n canvas,\r\n nativeHost,\r\n inputElement\r\n };\r\n }\r\n\r\n public static isFullscreen(): boolean {\r\n return document.fullscreenElement != null;\r\n }\r\n\r\n public static async setFullscreen(isFullscreen: boolean) {\r\n if (isFullscreen) {\r\n const doc = document.documentElement;\r\n await doc.requestFullscreen();\r\n } else {\r\n await document.exitFullscreen();\r\n }\r\n }\r\n\r\n public static getSafeAreaPadding(): number[] {\r\n const top = parseFloat(getComputedStyle(document.documentElement).getPropertyValue(\"--sat\"));\r\n const bottom = parseFloat(getComputedStyle(document.documentElement).getPropertyValue(\"--sab\"));\r\n const left = parseFloat(getComputedStyle(document.documentElement).getPropertyValue(\"--sal\"));\r\n const right = parseFloat(getComputedStyle(document.documentElement).getPropertyValue(\"--sar\"));\r\n\r\n return [left, top, bottom, right];\r\n }\r\n}\r\n", "export class Caniuse {\r\n public static hasNativeFilePicker(): boolean {\r\n return \"showSaveFilePicker\" in globalThis;\r\n }\r\n\r\n public static isMobile(): boolean {\r\n const userAgentData = (globalThis.navigator as any)?.userAgentData;\r\n if (userAgentData) {\r\n return userAgentData.mobile;\r\n }\r\n\r\n const userAgent = navigator.userAgent;\r\n const regex1 = /(android|bb\\d+|meego).+mobile|avantgo|bada\\/|blackberry|blazer|compal|elaine|fennec|hiptop|iemobile|ip(hone|od)|iris|kindle|lge |maemo|midp|mmp|mobile.+firefox|netfront|opera m(ob|in)i|palm( os)?|phone|p(ixi|re)\\/|plucker|pocket|psp|series(4|6)0|symbian|treo|up\\.(browser|link)|vodafone|wap|windows ce|xda|xiino/i;\r\n const regex2 = /1207|6310|6590|3gso|4thp|50[1-6]i|770s|802s|a wa|abac|ac(er|oo|s)|ai(ko|rn)|al(av|ca|co)|amoi|an(ex|ny|yw)|aptu|ar(ch|go)|as(te|us)|attw|au(di|m|r |s )|avan|be(ck|ll|nq)|bi(lb|rd)|bl(ac|az)|br(e|v)w|bumb|bw(n|u)|c55\\/|capi|ccwa|cdm|cell|chtm|cldc|cmd|co(mp|nd)|craw|da(it|ll|ng)|dbte|dcs|devi|dica|dmob|do(c|p)o|ds(12|d)|el(49|ai)|em(l2|ul)|er(ic|k0)|esl8|ez([4-7]0|os|wa|ze)|fetc|fly(|_)|g1 u|g560|gene|gf5|gmo|go(\\.w|od)|gr(ad|un)|haie|hcit|hd(m|p|t)|hei|hi(pt|ta)|hp( i|ip)|hsc|ht(c(| |_|a|g|p|s|t)|tp)|hu(aw|tc)|i(20|go|ma)|i230|iac( ||\\/)|ibro|idea|ig01|ikom|im1k|inno|ipaq|iris|ja(t|v)a|jbro|jemu|jigs|kddi|keji|kgt( |\\/)|klon|kpt |kwc|kyo(c|k)|le(no|xi)|lg( g|\\/(k|l|u)|50|54|[a-w])|libw|lynx|m1w|m3ga|m50\\/|ma(te|ui|xo)|mc(01|21|ca)|mcr|me(rc|ri)|mi(o8|oa|ts)|mmef|mo(01|02|bi|de|do|t(| |o|v)|zz)|mt(50|p1|v )|mwbp|mywa|n10[0-2]|n20[2-3]|n30(0|2)|n50(0|2|5)|n7(0(0|1)|10)|ne((c|m)|on|tf|wf|wg|wt)|nok(6|i)|nzph|o2im|op(ti|wv)|oran|owg1|p800|pan(a|d|t)|pdxg|pg(13|([1-8]|c))|phil|pire|pl(ay|uc)|pn2|po(ck|rt|se)|prox|psio|ptg|qaa|qc(07|12|21|32|60|[2-7]|i)|qtek|r380|r600|raks|rim9|ro(ve|zo)|s55\\/|sa(ge|ma|mm|ms|ny|va)|sc(01|h|oo|p)|sdk\\/|se(c(|0|1)|47|mc|nd|ri)|sgh|shar|sie(|m)|sk0|sl(45|id)|sm(al|ar|b3|it|t5)|so(ft|ny)|sp(01|h|v|v )|sy(01|mb)|t2(18|50)|t6(00|10|18)|ta(gt|lk)|tcl|tdg|tel(i|m)|tim|tmo|to(pl|sh)|ts(70|m|m3|m5)|tx9|up(\\.b|g1|si)|utst|v400|v750|veri|vi(rg|te)|vk(40|5[0-3]|v)|vm40|voda|vulc|vx(52|53|60|61|70|80|81|83|85|98)|w3c(| )|webc|whit|wi(g |nc|nw)|wmlb|wonu|x700|yas|your|zeto|zte/i;\r\n return regex1.test(userAgent) || regex2.test(userAgent.substr(0, 4));\r\n }\r\n}\r\n", "import FileSystemWritableFileStream from \"native-file-system-adapter/types/src/FileSystemWritableFileStream\";\r\nimport { IMemoryView } from \"../../types/dotnet\";\r\n\r\nexport class StreamHelper {\r\n public static async seek(stream: FileSystemWritableFileStream, position: number) {\r\n return await stream.seek(position);\r\n }\r\n\r\n public static async truncate(stream: FileSystemWritableFileStream, size: number) {\r\n return await stream.truncate(size);\r\n }\r\n\r\n public static async close(stream: FileSystemWritableFileStream) {\r\n return await stream.close();\r\n }\r\n\r\n public static async write(stream: FileSystemWritableFileStream, span: IMemoryView) {\r\n const array = new Uint8Array(span.byteLength);\r\n span.copyTo(array);\r\n\r\n return await stream.write(array);\r\n }\r\n\r\n public static byteLength(stream: Blob) {\r\n return stream.size;\r\n }\r\n\r\n public static async sliceArrayBuffer(stream: Blob, offset: number, count: number) {\r\n const buffer = await stream.slice(offset, offset + count).arrayBuffer();\r\n return new Uint8Array(buffer);\r\n }\r\n\r\n public static toMemoryView(buffer: Uint8Array): Uint8Array {\r\n return buffer;\r\n }\r\n}\r\n", "class NativeControlHostTopLevelAttachment {\r\n _child?: HTMLElement;\r\n _host?: HTMLElement;\r\n}\r\n\r\nexport class NativeControlHost {\r\n public static createDefaultChild(parent?: HTMLElement): HTMLElement {\r\n return document.createElement(\"div\");\r\n }\r\n\r\n public static createAttachment(): NativeControlHostTopLevelAttachment {\r\n return new NativeControlHostTopLevelAttachment();\r\n }\r\n\r\n public static initializeWithChildHandle(element: NativeControlHostTopLevelAttachment, child: HTMLElement): void {\r\n element._child = child;\r\n element._child.style.position = \"absolute\";\r\n }\r\n\r\n public static attachTo(element: NativeControlHostTopLevelAttachment, host?: HTMLElement): void {\r\n if (element._host && element._child) {\r\n element._host.removeChild(element._child);\r\n }\r\n\r\n element._host = host;\r\n\r\n if (element._host && element._child) {\r\n element._host.appendChild(element._child);\r\n }\r\n }\r\n\r\n public static showInBounds(element: NativeControlHostTopLevelAttachment, x: number, y: number, width: number, height: number): void {\r\n if (element._child) {\r\n element._child.style.top = `${y}px`;\r\n element._child.style.left = `${x}px`;\r\n element._child.style.width = `${width}px`;\r\n element._child.style.height = `${height}px`;\r\n element._child.style.display = \"block\";\r\n }\r\n }\r\n\r\n public static hideWithSize(element: NativeControlHostTopLevelAttachment, width: number, height: number): void {\r\n if (element._child) {\r\n element._child.style.width = `${width}px`;\r\n element._child.style.height = `${height}px`;\r\n element._child.style.display = \"none\";\r\n }\r\n }\r\n\r\n public static releaseChild(element: NativeControlHostTopLevelAttachment): void {\r\n if (element._child) {\r\n element._child = undefined;\r\n }\r\n }\r\n}\r\n", "export class NavigationHelper {\r\n public static addBackHandler(backHandlerCallback: () => Boolean) {\r\n history.pushState(null, \"\", window.location.href);\r\n window.onpopstate = () => {\r\n const handled = backHandlerCallback();\r\n\r\n if (!handled) {\r\n history.back();\r\n } else {\r\n history.forward();\r\n }\r\n };\r\n }\r\n}\r\n", "export class GeneralHelpers {\r\n public static itemsArrayAt(instance: any, key: any): any[] {\r\n const items = instance[key];\r\n if (!items) {\r\n return [];\r\n }\r\n\r\n const retItems = [];\r\n for (let i = 0; i < items.length; i++) {\r\n retItems[i] = items[i];\r\n }\r\n return retItems;\r\n }\r\n\r\n public static itemAt(instance: any, key: any): any {\r\n const item = instance[key];\r\n return item;\r\n }\r\n\r\n public static callMethod(instance: any, name: string /*, args */): any {\r\n const args = Array.prototype.slice.call(arguments, 2);\r\n return instance[name].apply(instance, args);\r\n }\r\n}\r\n", "import { SizeWatcher, DpiWatcher, Canvas } from \"./avalonia/canvas\";\r\nimport { InputHelper } from \"./avalonia/input\";\r\nimport { AvaloniaDOM } from \"./avalonia/dom\";\r\nimport { Caniuse } from \"./avalonia/caniuse\";\r\nimport { StreamHelper } from \"./avalonia/stream\";\r\nimport { NativeControlHost } from \"./avalonia/nativeControlHost\";\r\nimport { NavigationHelper } from \"./avalonia/navigationHelper\";\r\nimport { GeneralHelpers } from \"./avalonia/generalHelpers\";\r\n\r\nasync function registerServiceWorker(path: string, scope: string | undefined) {\r\n if (\"serviceWorker\" in navigator) {\r\n await globalThis.navigator.serviceWorker.register(path, scope ? { scope } : undefined);\r\n }\r\n}\r\n\r\nexport {\r\n Caniuse,\r\n Canvas,\r\n InputHelper,\r\n SizeWatcher,\r\n DpiWatcher,\r\n AvaloniaDOM,\r\n StreamHelper,\r\n NativeControlHost,\r\n NavigationHelper,\r\n GeneralHelpers,\r\n registerServiceWorker\r\n};\r\n"],
+ "mappings": "AAYO,IAAMA,EAAN,KAAa,CAuCT,YAAYC,EAAgBC,EAA4BC,EAAiC,CAjChG,uBAA6B,GAC7B,uBAA4B,EAoCxB,GAHA,KAAK,WAAaD,EAClB,KAAK,oBAAsBC,EAEvBF,EAAO,CACP,IAAMG,EAAMJ,EAAO,mBAAmBE,CAAO,EAC7C,GAAI,CAACE,EAAK,CACN,QAAQ,MAAM,gCAAgC,EAC9C,MACJ,CAEA,IAAMC,EAAM,WAAmB,WAG/BA,EAAG,mBAAmBD,CAAG,EAEzB,IAAME,EAAQD,EAAG,eAAe,MAG1BE,EAAMD,EAAM,aAAaA,EAAM,mBAAmB,EAExD,KAAK,OAAS,CACV,QAASF,EACT,MAAOG,EAAMA,EAAI,GAAK,EACtB,QAASD,EAAM,aAAaA,EAAM,YAAY,EAC9C,OAAQ,EACR,MAAOA,EAAM,aAAaA,EAAM,UAAU,CAC9C,CACJ,CACJ,CAzDA,OAAc,OAAOJ,EAA4BM,EAAmBL,EAAsD,CACtH,IAAMM,EAAOT,EAAO,KAAK,GAAME,EAASM,EAAWL,CAAmB,EACtE,MAAI,CAACM,GAAQ,CAACA,EAAK,OACR,KAGJA,EAAK,MAChB,CAEA,OAAO,KAAKR,EAAgBC,EAA4BM,EAAmBL,EAAgD,CACvH,IAAMO,EAAaR,EACnB,GAAI,CAACQ,EACD,eAAQ,MAAM,iCAAiC,EACxC,KAGNV,EAAO,WACRA,EAAO,SAAW,IAAI,KAE1BA,EAAO,SAAS,IAAIQ,EAAWN,CAAO,EAEtC,IAAMO,EAAO,IAAIT,EAAOC,EAAOC,EAASC,CAAmB,EAE3D,OAAAO,EAAW,OAASD,EAEbA,CACX,CAiCO,oBAAoBE,EAAuB,CAC9C,KAAK,kBAAoBA,EAGrBA,EAEA,KAAK,sBAAsB,EACpB,KAAK,oBAAsB,IAClC,OAAO,qBAAqB,KAAK,iBAAiB,EAClD,KAAK,kBAAoB,EAEjC,CAEO,sBAAsBC,EAA4B,CAEjDA,IAAe,QAAa,KAAK,oBAAsBA,GACvD,KAAK,oBAAoBA,CAAU,EAInC,KAAK,oBAAsB,IAK/B,KAAK,kBAAoB,OAAO,sBAAsB,IAAM,CA3GpE,IAAAC,EAAAC,EA4GgB,KAAK,WAAW,QAAU,KAAK,WAC/B,KAAK,WAAW,OAAQD,EAAA,KAAK,WAAL,KAAAA,EAAiB,GAGzC,KAAK,WAAW,SAAW,KAAK,YAChC,KAAK,WAAW,QAASC,EAAA,KAAK,YAAL,KAAAA,EAAkB,GAG/C,KAAK,oBAAoB,EACzB,KAAK,kBAAoB,EAGrB,KAAK,mBACL,KAAK,sBAAsB,CAEnC,CAAC,EACL,CAEO,cAAcC,EAAeC,EAAsB,CAClD,KAAK,oBAAsB,IAC3B,OAAO,qBAAqB,KAAK,iBAAiB,EAClD,KAAK,kBAAoB,GAG7B,KAAK,SAAWD,EAChB,KAAK,UAAYC,EAEb,KAAK,WAAW,QAAU,KAAK,WAC/B,KAAK,WAAW,MAAQ,KAAK,UAG7B,KAAK,WAAW,SAAW,KAAK,YAChC,KAAK,WAAW,OAAS,KAAK,WAGlC,KAAK,sBAAsB,CAC/B,CAEA,OAAc,cAAcd,EAA4Ba,EAAeC,EAAsB,CACzF,IAAMN,EAAaR,EACf,CAACQ,GAAc,CAACA,EAAW,QAI/BA,EAAW,OAAO,cAAcK,EAAOC,CAAM,CACjD,CAEA,OAAc,sBAAsBd,EAA4BU,EAA4B,CACxF,IAAMF,EAAaR,EACf,CAACQ,GAAc,CAACA,EAAW,QAI/BA,EAAW,OAAO,sBAAsBE,CAAU,CACtD,CAEA,OAAO,mBAAmBF,EAA+E,CACrG,IAAMO,EAAoB,CACtB,MAAO,EACP,MAAO,EACP,QAAS,EACT,UAAW,EACX,mBAAoB,EACpB,sBAAuB,EACvB,gCAAiC,EACjC,6BAA8B,EAC9B,aAAc,EACd,aAAc,EACd,0BAA2B,EAC3B,oBAAqB,EACrB,6BAA8B,CAClC,EAEMZ,EAAM,WAAmB,WAE3BD,EAA6BC,EAAG,cAAcK,EAAYO,CAAiB,EAE/E,MAAI,CAACb,GAAOa,EAAkB,aAAe,IACzC,QAAQ,KAAK,2BAA2B,EACxCA,EAAkB,aAAe,EACjCA,EAAkB,aAAe,EACjCb,EAAMC,EAAG,cAAcK,EAAYO,CAAiB,GAGjDb,CACX,CACJ,EAUac,EAAN,KAAkB,CAKrB,OAAc,QAAQhB,EAAsBM,EAA+BW,EAAyD,CAChI,GAAI,CAACjB,GAAW,CAACiB,EACb,OAGJD,EAAY,SAAW,KAAK,IAAI,EAEhCC,EAASjB,EAAQ,YAAaA,EAAQ,YAAY,EAElD,IAAMkB,EAAgBC,GAAkB,CAChC,KAAK,IAAI,EAAIH,EAAY,SAAW,KACpCC,EAASjB,EAAQ,YAAaA,EAAQ,YAAY,EAClDgB,EAAY,SAAW,KAAK,IAAI,EAExC,EAEA,OAAO,iBAAiB,SAAUE,CAAY,CAClD,CAEA,OAAc,UAAUZ,EAAyB,CAC7C,GAAI,CAACA,GAAa,CAACU,EAAY,SAC3B,OAGJ,IAAMhB,EAAUgB,EAAY,SAAS,IAAIV,CAAS,EAC9CN,IACAgB,EAAY,SAAS,OAAOV,CAAS,EACrCU,EAAY,SAAS,UAAUhB,CAAO,EAE9C,CAEA,OAAO,MAAa,CACZgB,EAAY,WAIhBA,EAAY,SAAW,IAAI,IAC3BA,EAAY,SAAW,IAAI,eAAgBI,GAAY,CACnD,QAAWC,KAASD,EAChBJ,EAAY,OAAOK,EAAM,MAAM,CAEvC,CAAC,EACL,CAEA,OAAO,OAAOrB,EAAwB,CAElC,IAAMsB,EADiBtB,EACS,YAEhC,GAAI,GAACsB,GAAY,CAACA,EAAS,UAI3B,OAAOA,EAAS,SAAStB,EAAQ,YAAaA,EAAQ,YAAY,CACtE,CACJ,EAEauB,EAAN,KAAiB,CAKpB,OAAc,QAAiB,CAC3B,OAAO,OAAO,gBAClB,CAEA,OAAc,MAAMN,EAAyD,CACzE,OAAAM,EAAW,QAAU,OAAO,iBAC5BA,EAAW,QAAU,OAAO,YAAYA,EAAW,OAAQ,GAAI,EAC/DA,EAAW,SAAWN,EAEfM,EAAW,OACtB,CAEA,OAAc,MAAa,CACvB,OAAO,cAAcA,EAAW,OAAO,CAC3C,CAEA,OAAO,QAAe,CAClB,GAAI,CAACA,EAAW,SACZ,OAGJ,IAAMC,EAAa,OAAO,iBACpBC,EAAUF,EAAW,QAC3BA,EAAW,QAAUC,EAEjB,KAAK,IAAIC,EAAUD,CAAU,EAAI,MACjCD,EAAW,SAASE,EAASD,CAAU,CAE/C,CACJ,EC1SO,IAAME,EAAN,KAAkB,CACrB,OAAc,oBACVC,EACAC,EACAC,EACF,CANN,IAAAC,EAAAC,EAOQ,GAAI,CAACC,EACD,MAAM,IAAI,MACN,gFACJ,EAGJ,IAAMC,GAAQH,EAAAD,GAAA,YAAAA,EAAS,QAAT,KAAAC,EAAkB,GAChC,GAAIG,EAAO,CACP,IAAMC,EAAK,SAAS,cAChB,2CACJ,EACIA,KAAIH,EAAAG,EAAG,aAAH,MAAAH,EAAe,YAAYG,GACvC,CAGA,IAAMC,EAAM,SAAS,cAAc,KAAK,EACxCA,EAAI,GAAK,2CACT,SAAS,KAAK,YAAYA,CAAG,EAE7B,IAAMC,EAAQD,EAAI,MACZE,EAAW,OAAO,iBAClB,OAAO,iBAAiBV,CAAO,EAC7BA,EAAgB,aAClBW,EAAUX,EAAQ,WAAa,QAGrCS,EAAM,WAAa,WACdE,IAASF,EAAM,SAAW,cAG/BA,EAAM,SAAW,WACZH,IAAOG,EAAM,WAAa,UAG/BG,EAAW,QAASC,GAAiB,CACjC,GAAIF,GAAWE,IAAS,aAEpB,GAAIH,EAAS,YAAc,aAAc,CACrC,IAAMI,EAAS,SAASJ,EAAS,MAAM,EACjCK,EACF,SAASL,EAAS,UAAU,EAC5B,SAASA,EAAS,aAAa,EAC/B,SAASA,EAAS,cAAc,EAChC,SAASA,EAAS,iBAAiB,EACjCM,EAAeD,EAAc,SAASL,EAAS,UAAU,EAC3DI,EAASE,EACTP,EAAM,WAAa,GAAGK,EAASC,MACxBD,IAAWE,EAClBP,EAAM,WAAaC,EAAS,WAE5BD,EAAM,WAAa,GAE3B,MACIA,EAAM,WAAaC,EAAS,YAG/BD,EAAcI,GAASH,EAAiBG,EAEjD,CAAC,EAEGI,EAEIjB,EAAQ,aAAe,SAASU,EAAS,MAAM,IAC/CD,EAAM,UAAY,UAGtBA,EAAM,SAAW,SAGrBD,EAAI,YAAcR,EAAQ,MAAM,UAAU,EAAGC,CAAQ,EAGjDU,IAASH,EAAI,YAAcA,EAAI,YAAY,QAAQ,MAAO,MAAQ,GAEtE,IAAMU,EAAO,SAAS,cAAc,MAAM,EAM1CA,EAAK,YAAclB,EAAQ,MAAM,UAAUC,CAAQ,GAAK,IACxDO,EAAI,YAAYU,CAAI,EAEpB,IAAMC,EAAc,CAChB,IAAKD,EAAK,UAAY,SAASR,EAAS,cAAc,EACtD,KAAMQ,EAAK,WAAa,SAASR,EAAS,eAAe,EACzD,OAAQ,SAASA,EAAS,UAAU,CACxC,EAEA,OAAIJ,EACAY,EAAK,MAAM,gBAAkB,OAE7B,SAAS,KAAK,YAAYV,CAAG,EAG1BW,CACX,CACJ,EAEMP,EAAa,CACf,YACA,YACA,QACA,SACA,YACA,YAEA,iBACA,mBACA,oBACA,kBACA,cAEA,aACA,eACA,gBACA,cAGA,YACA,cACA,aACA,cACA,WACA,iBACA,aACA,aAEA,YACA,gBACA,aACA,iBAEA,gBACA,cAEA,UACA,YACJ,EAEMP,EAAY,OAAO,QAAW,YAC9BY,EAAYZ,GAAc,OAAe,iBAAmB,KC9G3D,IAAMe,EAAN,KAAkB,CAKrB,OAAc,8BAA+B,CACrC,KAAK,iBAAmB,IAI5B,WAAW,iBAAiB,QAAUC,GAAc,CAC5C,KAAK,iBAAmB,GACxB,KAAK,iBAAiBA,EAAK,cAAc,QAAQ,MAAM,CAAC,CAEhE,CAAC,EACD,KAAK,eAAiB,EAC1B,CAEA,aAAoB,mBAAqC,CACrD,GAAI,WAAW,UAAU,UAAU,SAC/B,OAAO,MAAM,WAAW,UAAU,UAAU,SAAS,EAErD,GAAI,CACA,OAAO,MAAM,IAAI,QAAa,CAACC,EAASC,IAAW,CAC/C,KAAK,eAAiB,EACtB,KAAK,iBAAmBD,EACxB,KAAK,gBAAkBC,CAC3B,CAAC,CACL,QAAE,CACE,KAAK,eAAiB,EACtB,KAAK,iBAAmB,KACxB,KAAK,gBAAkB,IAC3B,CAER,CAEA,OAAc,mBACVC,EACAC,EACAC,EAAqF,CACrF,IAAMC,EAAkBN,GAAwB,CACxCI,EAAgBJ,EAAK,KAAMA,EAAK,IAAK,KAAK,aAAaA,CAAI,CAAC,GACxD,KAAK,iBAAmB,GACxBA,EAAK,eAAe,CAGhC,EACAG,EAAQ,iBAAiB,UAAWG,CAAc,EAElD,IAAMC,EAAgBP,GAAwB,CACtCK,EAAcL,EAAK,KAAMA,EAAK,IAAK,KAAK,aAAaA,CAAI,CAAC,GAC1DA,EAAK,eAAe,EAEpB,KAAK,iBACL,KAAK,gBAAgB,CAE7B,EAEA,OAAAG,EAAQ,iBAAiB,QAASI,CAAY,EAEvC,IAAM,CACTJ,EAAQ,oBAAoB,UAAWG,CAAc,EACrDH,EAAQ,oBAAoB,QAASI,CAAY,CACrD,CACJ,CAEA,OAAc,oBACVJ,EACAK,EACAC,EACAC,EACAC,EACAC,EAA6D,CAC7D,IAAMC,EAAgBb,GAAgB,CAClC,IAAMc,EAAad,EAGfS,EAAcK,EAAW,KAAMA,EAAW,IAAI,GAC9Cd,EAAK,eAAe,CAE5B,EACAG,EAAQ,iBAAiB,QAASU,CAAY,EAE9C,IAAME,EAA2Bf,GAA2B,CACpDU,EAAyBV,CAAI,GAC7BA,EAAK,eAAe,CAE5B,EACAG,EAAQ,iBAAiB,mBAAoBY,CAAuB,EAEpE,IAAMC,EAAsBhB,GAAqB,CAC7C,IAAMiB,EAASjB,EAAK,gBAAgB,EAChCkB,EAAQ,GACRC,EAAM,GACNF,EAAO,OAAS,IAChBC,EAAQD,EAAO,GAAG,YAClBE,EAAMF,EAAO,GAAG,WAGhBjB,EAAK,YAAc,0BACnBkB,EAAQ,EACRC,EAAMD,EAAQ,GAEdV,EAAoBR,EAAMkB,EAAOC,CAAG,GACpCnB,EAAK,eAAe,CAE5B,EACAG,EAAQ,iBAAiB,cAAea,CAAkB,EAE1D,IAAMI,EAA4BpB,GAA2B,CACrDW,EAA0BX,CAAI,GAC9BA,EAAK,eAAe,CAE5B,EACAG,EAAQ,iBAAiB,oBAAqBiB,CAAwB,EAEtE,IAAMC,EAAyBrB,GAA2B,CAClDY,EAAuBZ,CAAI,GAC3BA,EAAK,eAAe,CAE5B,EACA,OAAAG,EAAQ,iBAAiB,iBAAkBkB,CAAqB,EAEzD,IAAM,CACTlB,EAAQ,oBAAoB,QAASU,CAAY,EACjDV,EAAQ,oBAAoB,mBAAoBY,CAAuB,EACvEZ,EAAQ,oBAAoB,oBAAqBiB,CAAwB,EACzEjB,EAAQ,oBAAoB,iBAAkBkB,CAAqB,CACvE,CACJ,CAEA,OAAc,uBACVlB,EACAmB,EACAC,EACAC,EACAC,EACAC,EACF,CACE,IAAMC,EAAsB3B,GAAuB,CAC/CsB,EAAoBtB,CAAI,EACxBA,EAAK,eAAe,CACxB,EAEM4B,EAAsB5B,GAAuB,CAC/CuB,EAAoBvB,CAAI,EACxBA,EAAK,eAAe,CACxB,EAEM6B,EAAoB7B,GAAuB,CAC7CwB,EAAkBxB,CAAI,EACtBA,EAAK,eAAe,CACxB,EAEM8B,EAAwB9B,GAAuB,CACjDyB,EAAsBzB,CAAI,EAC1BA,EAAK,eAAe,CACxB,EAEM+B,EAAgB/B,GAAqB,CACvC0B,EAAc1B,CAAI,EAClBA,EAAK,eAAe,CACxB,EAEA,OAAAG,EAAQ,iBAAiB,cAAewB,CAAkB,EAC1DxB,EAAQ,iBAAiB,cAAeyB,CAAkB,EAC1DzB,EAAQ,iBAAiB,YAAa0B,CAAgB,EACtD1B,EAAQ,iBAAiB,QAAS4B,CAAY,EAC9C5B,EAAQ,iBAAiB,gBAAiB2B,CAAoB,EAEvD,IAAM,CACT3B,EAAQ,oBAAoB,cAAewB,CAAkB,EAC7DxB,EAAQ,oBAAoB,cAAeyB,CAAkB,EAC7DzB,EAAQ,oBAAoB,YAAa0B,CAAgB,EACzD1B,EAAQ,oBAAoB,gBAAiB2B,CAAoB,EACjE3B,EAAQ,oBAAoB,QAAS4B,CAAY,CACrD,CACJ,CAEA,OAAc,qBACV5B,EACAM,EACF,CACE,IAAMI,EAAgBb,GAAgB,CAC9BS,EAAeT,EAAa,KAAK,GACjCA,EAAK,eAAe,CAE5B,EACA,OAAAG,EAAQ,iBAAiB,QAASU,CAAY,EAEvC,IAAM,CACTV,EAAQ,oBAAoB,QAASU,CAAY,CACrD,CACJ,CAEA,OAAc,oBACVV,EACA6B,EACF,CACE,IAAMC,EAAejC,GAAgB,CAC7BgC,EAAUhC,CAAW,GACrBA,EAAK,eAAe,CAE5B,EACA,OAAAG,EAAQ,iBAAiB,WAAY8B,CAAW,EAChD9B,EAAQ,iBAAiB,YAAa8B,CAAW,EACjD9B,EAAQ,iBAAiB,YAAa8B,CAAW,EACjD9B,EAAQ,iBAAiB,OAAQ8B,CAAW,EAErC,IAAM,CACT9B,EAAQ,oBAAoB,WAAY8B,CAAW,EACnD9B,EAAQ,oBAAoB,YAAa8B,CAAW,EACpD9B,EAAQ,oBAAoB,YAAa8B,CAAW,EACpD9B,EAAQ,oBAAoB,OAAQ8B,CAAW,CACnD,CACJ,CAEA,OAAc,mBAAmBC,EAA4C,CACzE,OAAOA,EAAa,mBAAmB,CAC3C,CAEA,OAAc,WAAWC,EAAgC,CACrDA,EAAa,MAAQ,EACzB,CAEA,OAAc,aAAaA,EAA2B,CAClDA,EAAa,MAAM,CACvB,CAEA,OAAc,UAAUA,EAAgCC,EAAc,CAC9DA,IAAS,UACTD,EAAa,MAAM,eAAe,QAAQ,EAE1CA,EAAa,MAAM,OAASC,CAEpC,CAEA,OAAc,UAAUD,EAAgCE,EAAWC,EAAWC,EAAoBC,EAAqBC,EAAe,CAClIN,EAAa,MAAM,KAAQE,EAAG,QAAQ,CAAC,EAAI,KAC3CF,EAAa,MAAM,IAAOG,EAAG,QAAQ,CAAC,EAAI,KAE1C,GAAM,CAAE,KAAAI,EAAM,IAAAC,CAAI,EAAIC,EAAY,oBAAoBT,EAAcM,CAAK,EAEzEN,EAAa,MAAM,MAAQE,EAAIK,GAAM,QAAQ,CAAC,EAAI,KAClDP,EAAa,MAAM,KAAOG,EAAIK,GAAK,QAAQ,CAAC,EAAI,IACpD,CAEA,OAAc,KAAKR,EAAgC,CAC/CA,EAAa,MAAM,QAAU,MACjC,CAEA,OAAc,KAAKA,EAAgC,CAC/CA,EAAa,MAAM,QAAU,OACjC,CAEA,OAAc,mBAAmBA,EAAgCU,EAAc3B,EAAeC,EAAa,CACnG,CAACgB,IAILA,EAAa,MAAQU,EACrBV,EAAa,kBAAkBjB,EAAOC,CAAG,EACzCgB,EAAa,MAAM,MAAQ,OAC3BA,EAAa,MAAM,MAAQ,GAAGA,EAAa,gBAC/C,CAEA,OAAe,aAAanC,EAAwC,CAChE,IAAI8C,EAAY,EAEhB,OAAI9C,EAAK,UAAW8C,GAAa,GAC7B9C,EAAK,SAAU8C,GAAa,GAC5B9C,EAAK,WAAY8C,GAAa,GAC9B9C,EAAK,UAAW8C,GAAa,GAE1BA,CACX,CACJ,EApRa/C,EACF,eAAiC,ECvCrC,IAAMgD,EAAN,KAAkB,CACrB,OAAc,SAASC,EAAsBC,EAAyB,CAClED,EAAQ,UAAU,IAAIC,CAAS,CACnC,CAEA,OAAO,gBAAgBC,EAAqE,CACxF,GAAI,WAAW,aAAe,OAC1B,MAAO,GAGX,IAAMC,EAAkB,WAAW,WAAW,8BAA8B,EACtEC,EAAuB,WAAW,WAAW,0BAA0B,EAE7E,OAAAD,EAAgB,iBAAiB,SAAWE,GAA8B,CACtEH,EAASG,EAAK,QAASD,EAAqB,OAAO,CACvD,CAAC,EACDA,EAAqB,iBAAiB,SAAWC,GAA8B,CAC3EH,EAASC,EAAgB,QAASE,EAAK,OAAO,CAClD,CAAC,EAEM,CACH,WAAYF,EAAgB,QAC5B,eAAgBC,EAAqB,OACzC,CACJ,CAEA,OAAO,mBAAmBE,EAAmB,CACzC,IAAMC,EAAe,KAAK,OAAO,EAAE,SAAS,EAAE,EAAE,QAAQ,WAAY,EAAE,EAAE,OAAO,EAAG,EAAE,EAGpFD,EAAK,UAAU,IAAI,oBAAoB,EACvCA,EAAK,SAAW,EAChBA,EAAK,cAAgB,UAAY,CAAE,MAAO,EAAO,EACjDA,EAAK,MAAM,SAAW,SACtBA,EAAK,MAAM,YAAc,OAGzB,IAAME,EAAS,SAAS,cAAc,QAAQ,EAC9CA,EAAO,GAAK,SAASD,IACrBC,EAAO,UAAU,IAAI,iBAAiB,EACtCA,EAAO,MAAM,MAAQ,OACrBA,EAAO,MAAM,SAAW,WAGxB,IAAMC,EAAa,SAAS,cAAc,KAAK,EAC/CA,EAAW,GAAK,aAAaF,IAC7BE,EAAW,UAAU,IAAI,sBAAsB,EAC/CA,EAAW,MAAM,KAAO,MACxBA,EAAW,MAAM,IAAM,MACvBA,EAAW,MAAM,MAAQ,OACzBA,EAAW,MAAM,OAAS,OAC1BA,EAAW,MAAM,SAAW,WAG5B,IAAMC,EAAe,SAAS,cAAc,OAAO,EACnD,OAAAA,EAAa,GAAK,eAAeH,IACjCG,EAAa,UAAU,IAAI,wBAAwB,EACnDA,EAAa,eAAiB,OAC9BA,EAAa,KAAO,OACpBA,EAAa,WAAa,GAC1BA,EAAa,MAAM,QAAU,IAC7BA,EAAa,MAAM,OAAS,IAC5BA,EAAa,MAAM,SAAW,WAC9BA,EAAa,MAAM,SAAW,SAC9BA,EAAa,MAAM,YAAc,SACjCA,EAAa,MAAM,QAAU,OAC7BA,EAAa,MAAM,WAAa,cAChCA,EAAa,MAAM,MAAQ,cAC3BA,EAAa,MAAM,QAAU,OAC7BA,EAAa,MAAM,OAAS,OAC5BA,EAAa,MAAM,OAAS,KAC5BA,EAAa,QAAU,UAAY,CAAE,MAAO,EAAO,EACnDA,EAAa,OAAS,UAAY,CAAE,MAAO,EAAO,EAClDA,EAAa,MAAQ,UAAY,CAAE,MAAO,EAAO,EAEjDJ,EAAK,QAAQI,CAAY,EACzBJ,EAAK,QAAQG,CAAU,EACvBH,EAAK,QAAQE,CAAM,EAEZ,CACH,KAAAF,EACA,OAAAE,EACA,WAAAC,EACA,aAAAC,CACJ,CACJ,CAEA,OAAc,cAAwB,CAClC,OAAO,SAAS,mBAAqB,IACzC,CAEA,aAAoB,cAAcC,EAAuB,CACjDA,EAEA,MADY,SAAS,gBACX,kBAAkB,EAE5B,MAAM,SAAS,eAAe,CAEtC,CAEA,OAAc,oBAA+B,CACzC,IAAMC,EAAM,WAAW,iBAAiB,SAAS,eAAe,EAAE,iBAAiB,OAAO,CAAC,EACrFC,EAAS,WAAW,iBAAiB,SAAS,eAAe,EAAE,iBAAiB,OAAO,CAAC,EACxFC,EAAO,WAAW,iBAAiB,SAAS,eAAe,EAAE,iBAAiB,OAAO,CAAC,EACtFC,EAAQ,WAAW,iBAAiB,SAAS,eAAe,EAAE,iBAAiB,OAAO,CAAC,EAE7F,MAAO,CAACD,EAAMF,EAAKC,EAAQE,CAAK,CACpC,CACJ,EC5GO,IAAMC,EAAN,KAAc,CACjB,OAAc,qBAA+B,CACzC,MAAO,uBAAwB,UACnC,CAEA,OAAc,UAAoB,CALtC,IAAAC,EAMQ,IAAMC,GAAiBD,EAAA,WAAW,YAAX,YAAAA,EAA8B,cACrD,GAAIC,EACA,OAAOA,EAAc,OAGzB,IAAMC,EAAY,UAAU,UACtBC,EAAS,2TACTC,EAAS,8+CACf,OAAOD,EAAO,KAAKD,CAAS,GAAKE,EAAO,KAAKF,EAAU,OAAO,EAAG,CAAC,CAAC,CACvE,CACJ,ECbO,IAAMG,EAAN,KAAmB,CACtB,aAAoB,KAAKC,EAAsCC,EAAkB,CAC7E,OAAO,MAAMD,EAAO,KAAKC,CAAQ,CACrC,CAEA,aAAoB,SAASD,EAAsCE,EAAc,CAC7E,OAAO,MAAMF,EAAO,SAASE,CAAI,CACrC,CAEA,aAAoB,MAAMF,EAAsC,CAC5D,OAAO,MAAMA,EAAO,MAAM,CAC9B,CAEA,aAAoB,MAAMA,EAAsCG,EAAmB,CAC/E,IAAMC,EAAQ,IAAI,WAAWD,EAAK,UAAU,EAC5C,OAAAA,EAAK,OAAOC,CAAK,EAEV,MAAMJ,EAAO,MAAMI,CAAK,CACnC,CAEA,OAAc,WAAWJ,EAAc,CACnC,OAAOA,EAAO,IAClB,CAEA,aAAoB,iBAAiBA,EAAcK,EAAgBC,EAAe,CAC9E,IAAMC,EAAS,MAAMP,EAAO,MAAMK,EAAQA,EAASC,CAAK,EAAE,YAAY,EACtE,OAAO,IAAI,WAAWC,CAAM,CAChC,CAEA,OAAc,aAAaA,EAAgC,CACvD,OAAOA,CACX,CACJ,ECnCA,IAAMC,EAAN,KAA0C,CAG1C,EAEaC,EAAN,KAAwB,CAC3B,OAAc,mBAAmBC,EAAmC,CAChE,OAAO,SAAS,cAAc,KAAK,CACvC,CAEA,OAAc,kBAAwD,CAClE,OAAO,IAAIF,CACf,CAEA,OAAc,0BAA0BG,EAA8CC,EAA0B,CAC5GD,EAAQ,OAASC,EACjBD,EAAQ,OAAO,MAAM,SAAW,UACpC,CAEA,OAAc,SAASA,EAA8CE,EAA0B,CACvFF,EAAQ,OAASA,EAAQ,QACzBA,EAAQ,MAAM,YAAYA,EAAQ,MAAM,EAG5CA,EAAQ,MAAQE,EAEZF,EAAQ,OAASA,EAAQ,QACzBA,EAAQ,MAAM,YAAYA,EAAQ,MAAM,CAEhD,CAEA,OAAc,aAAaA,EAA8CG,EAAWC,EAAWC,EAAeC,EAAsB,CAC5HN,EAAQ,SACRA,EAAQ,OAAO,MAAM,IAAM,GAAGI,MAC9BJ,EAAQ,OAAO,MAAM,KAAO,GAAGG,MAC/BH,EAAQ,OAAO,MAAM,MAAQ,GAAGK,MAChCL,EAAQ,OAAO,MAAM,OAAS,GAAGM,MACjCN,EAAQ,OAAO,MAAM,QAAU,QAEvC,CAEA,OAAc,aAAaA,EAA8CK,EAAeC,EAAsB,CACtGN,EAAQ,SACRA,EAAQ,OAAO,MAAM,MAAQ,GAAGK,MAChCL,EAAQ,OAAO,MAAM,OAAS,GAAGM,MACjCN,EAAQ,OAAO,MAAM,QAAU,OAEvC,CAEA,OAAc,aAAaA,EAAoD,CACvEA,EAAQ,SACRA,EAAQ,OAAS,OAEzB,CACJ,ECtDO,IAAMO,EAAN,KAAuB,CAC1B,OAAc,eAAeC,EAAoC,CAC7D,QAAQ,UAAU,KAAM,GAAI,OAAO,SAAS,IAAI,EAChD,OAAO,WAAa,IAAM,CACNA,EAAoB,EAKhC,QAAQ,QAAQ,EAFhB,QAAQ,KAAK,CAIrB,CACJ,CACJ,ECbO,IAAMC,EAAN,KAAqB,CACxB,OAAc,aAAaC,EAAeC,EAAiB,CACvD,IAAMC,EAAQF,EAASC,GACvB,GAAI,CAACC,EACD,MAAO,CAAC,EAGZ,IAAMC,EAAW,CAAC,EAClB,QAASC,EAAI,EAAGA,EAAIF,EAAM,OAAQE,IAC9BD,EAASC,GAAKF,EAAME,GAExB,OAAOD,CACX,CAEA,OAAc,OAAOH,EAAeC,EAAe,CAE/C,OADaD,EAASC,EAE1B,CAEA,OAAc,WAAWD,EAAeK,EAA+B,CACnE,IAAMC,EAAO,MAAM,UAAU,MAAM,KAAK,UAAW,CAAC,EACpD,OAAON,EAASK,GAAM,MAAML,EAAUM,CAAI,CAC9C,CACJ,ECdA,eAAeC,EAAsBC,EAAcC,EAA2B,CACtE,kBAAmB,WACnB,MAAM,WAAW,UAAU,cAAc,SAASD,EAAMC,EAAQ,CAAE,MAAAA,CAAM,EAAI,MAAS,CAE7F",
+ "names": ["Canvas", "useGL", "element", "renderFrameCallback", "ctx", "GL", "GLctx", "fbo", "elementId", "view", "htmlCanvas", "enable", "renderLoop", "_a", "_b", "width", "height", "contextAttributes", "SizeWatcher", "callback", "handleResize", "args", "entries", "entry", "instance", "DpiWatcher", "currentDpi", "lastDpi", "CaretHelper", "element", "position", "options", "_a", "_b", "isBrowser", "debug", "el", "div", "style", "computed", "isInput", "properties", "prop", "height", "outerHeight", "targetHeight", "isFirefox", "span", "coordinates", "InputHelper", "args", "resolve", "reject", "element", "keyDownCallback", "keyUpCallback", "keyDownHandler", "keyUpHandler", "beforeInputCallback", "inputCallback", "compositionStartCallback", "compositionUpdateCallback", "compositionEndCallback", "inputHandler", "inputEvent", "compositionStartHandler", "beforeInputHandler", "ranges", "start", "end", "compositionUpdateHandler", "compositionEndHandler", "pointerMoveCallback", "pointerDownCallback", "pointerUpCallback", "pointerCancelCallback", "wheelCallback", "pointerMoveHandler", "pointerDownHandler", "pointerUpHandler", "pointerCancelHandler", "wheelHandler", "dragEvent", "dragHandler", "pointerEvent", "inputElement", "kind", "x", "y", "caretWidth", "caretHeight", "caret", "left", "top", "CaretHelper", "text", "modifiers", "AvaloniaDOM", "element", "className", "observer", "colorShemeMedia", "prefersContrastMedia", "args", "host", "randomIdPart", "canvas", "nativeHost", "inputElement", "isFullscreen", "top", "bottom", "left", "right", "Caniuse", "_a", "userAgentData", "userAgent", "regex1", "regex2", "StreamHelper", "stream", "position", "size", "span", "array", "offset", "count", "buffer", "NativeControlHostTopLevelAttachment", "NativeControlHost", "parent", "element", "child", "host", "x", "y", "width", "height", "NavigationHelper", "backHandlerCallback", "GeneralHelpers", "instance", "key", "items", "retItems", "i", "name", "args", "registerServiceWorker", "path", "scope"]
+}
diff --git a/dotnet.js b/dotnet.js
new file mode 100644
index 0000000..2d21fee
--- /dev/null
+++ b/dotnet.js
@@ -0,0 +1,9571 @@
+//! Licensed to the .NET Foundation under one or more agreements.
+//! The .NET Foundation licenses this file to you under the MIT license.
+var __dotnet_runtime=function(e){"use strict";var t="7.0.9",n=false,r="Release";let o,s,i,a,c,u,l,f;const _={},d={};let m;function g(e,t){s=t.internal,i=t.marshaled_imports,o=t.module,w(e),a=e.isNode,c=e.isShell,u=e.isWeb,l=e.isWorker,f=e.isPThread,b.quit=e.quit_,b.ExitStatus=e.ExitStatus,b.requirePromise=e.requirePromise}function w(e){a=e.isNode,c=e.isShell,u=e.isWeb,l=e.isWorker,f=e.isPThread}function h(e){m=e}const p=undefined,b={javaScriptExports:{},mono_wasm_load_runtime_done:false,mono_wasm_bindings_is_ready:false,maxParallelDownloads:16,config:{environmentVariables:{}},diagnosticTracing:false},y=0,v=0,E=0,A=0,S=0,O=0,x=-1,j=0,$=0,N=0,k=0;function T(e){return void 0===e||null===e}const R=[[true,"mono_wasm_register_root","number",["number","number","string"]],[true,"mono_wasm_deregister_root",null,["number"]],[true,"mono_wasm_string_get_data",null,["number","number","number","number"]],[true,"mono_wasm_string_get_data_ref",null,["number","number","number","number"]],[true,"mono_wasm_set_is_debugger_attached","void",["bool"]],[true,"mono_wasm_send_dbg_command","bool",["number","number","number","number","number"]],[true,"mono_wasm_send_dbg_command_with_parms","bool",["number","number","number","number","number","number","string"]],[true,"mono_wasm_setenv",null,["string","string"]],[true,"mono_wasm_parse_runtime_options",null,["number","number"]],[true,"mono_wasm_strdup","number",["string"]],[true,"mono_background_exec",null,[]],[true,"mono_set_timeout_exec",null,[]],[true,"mono_wasm_load_icu_data","number",["number"]],[true,"mono_wasm_get_icudt_name","string",["string"]],[false,"mono_wasm_add_assembly","number",["string","number","number"]],[true,"mono_wasm_add_satellite_assembly","void",["string","string","number","number"]],[false,"mono_wasm_load_runtime",null,["string","number"]],[true,"mono_wasm_change_debugger_log_level","void",["number"]],[true,"mono_wasm_get_corlib","number",[]],[true,"mono_wasm_assembly_load","number",["string"]],[true,"mono_wasm_find_corlib_class","number",["string","string"]],[true,"mono_wasm_assembly_find_class","number",["number","string","string"]],[true,"mono_wasm_runtime_run_module_cctor","void",["number"]],[true,"mono_wasm_find_corlib_type","number",["string","string"]],[true,"mono_wasm_assembly_find_type","number",["number","string","string"]],[true,"mono_wasm_assembly_find_method","number",["number","string","number"]],[true,"mono_wasm_invoke_method","number",["number","number","number","number"]],[false,"mono_wasm_invoke_method_ref","void",["number","number","number","number","number"]],[true,"mono_wasm_string_get_utf8","number",["number"]],[true,"mono_wasm_string_from_utf16_ref","void",["number","number","number"]],[true,"mono_wasm_get_obj_type","number",["number"]],[true,"mono_wasm_array_length","number",["number"]],[true,"mono_wasm_array_get","number",["number","number"]],[true,"mono_wasm_array_get_ref","void",["number","number","number"]],[false,"mono_wasm_obj_array_new","number",["number"]],[false,"mono_wasm_obj_array_new_ref","void",["number","number"]],[false,"mono_wasm_obj_array_set","void",["number","number","number"]],[false,"mono_wasm_obj_array_set_ref","void",["number","number","number"]],[true,"mono_wasm_register_bundled_satellite_assemblies","void",[]],[false,"mono_wasm_try_unbox_primitive_and_get_type_ref","number",["number","number","number"]],[true,"mono_wasm_box_primitive_ref","void",["number","number","number","number"]],[true,"mono_wasm_intern_string_ref","void",["number"]],[true,"mono_wasm_assembly_get_entry_point","number",["number"]],[true,"mono_wasm_get_delegate_invoke_ref","number",["number"]],[true,"mono_wasm_string_array_new_ref","void",["number","number"]],[true,"mono_wasm_typed_array_new_ref","void",["number","number","number","number","number"]],[true,"mono_wasm_class_get_type","number",["number"]],[true,"mono_wasm_type_get_class","number",["number"]],[true,"mono_wasm_get_type_name","string",["number"]],[true,"mono_wasm_get_type_aqn","string",["number"]],[true,"mono_wasm_event_pipe_enable","bool",["string","number","number","string","bool","number"]],[true,"mono_wasm_event_pipe_session_start_streaming","bool",["number"]],[true,"mono_wasm_event_pipe_session_disable","bool",["number"]],[true,"mono_wasm_diagnostic_server_create_thread","bool",["string","number"]],[true,"mono_wasm_diagnostic_server_thread_attach_to_runtime","void",[]],[true,"mono_wasm_diagnostic_server_post_resume_runtime","void",[]],[true,"mono_wasm_diagnostic_server_create_stream","number",[]],[true,"mono_wasm_string_from_js","number",["string"]],[false,"mono_wasm_exit","void",["number"]],[true,"mono_wasm_getenv","number",["string"]],[true,"mono_wasm_set_main_args","void",["number","number"]],[false,"mono_wasm_enable_on_demand_gc","void",["number"]],[false,"mono_profiler_init_aot","void",["number"]],[false,"mono_wasm_exec_regression","number",["number","string"]],[false,"mono_wasm_invoke_method_bound","number",["number","number"]],[true,"mono_wasm_write_managed_pointer_unsafe","void",["number","number"]],[true,"mono_wasm_copy_managed_pointer","void",["number","number"]],[true,"mono_wasm_i52_to_f64","number",["number","number"]],[true,"mono_wasm_u52_to_f64","number",["number","number"]],[true,"mono_wasm_f64_to_i52","number",["number","number"]],[true,"mono_wasm_f64_to_u52","number",["number","number"]]],M={};function I(){const e=!!f;for(const t of R){const n=M,[r,s,i,a,c]=t;if(r||e)n[s]=function(...e){const t=o.cwrap(s,i,a,c);return n[s]=t,t(...e)};else{const e=o.cwrap(s,i,a,c);n[s]=e}}}function D(e,t,n){const r=C(e,t,n);let o="",s=0,i=0,a=0,c=0,u=0,l=0;const f=16777215,_=262143,d=4095,m=63,g=18,w=12,h=6,p=0;for(;s=r.read(),i=r.read(),a=r.read(),null!==s;)null===i&&(i=0,u+=1),null===a&&(a=0,u+=1),l=s<<16|i<<8|a<<0,c=(l&f)>>g,o+=U[c],c=(l&_)>>w,o+=U[c],u<2&&(c=(l&d)>>6,o+=U[c]),2===u?o+="==":1===u?o+="=":(c=(l&m)>>0,o+=U[c]);return o}const U=["A","B","C","D","E","F","G","H","I","J","K","L","M","N","O","P","Q","R","S","T","U","V","W","X","Y","Z","a","b","c","d","e","f","g","h","i","j","k","l","m","n","o","p","q","r","s","t","u","v","w","x","y","z","0","1","2","3","4","5","6","7","8","9","+","/"];function C(e,t,n){let r="number"===typeof t?t:0,o;o="number"===typeof n?r+n:e.length-r;const s={read:function(){if(r>=o)return null;const t=e[r];return r+=1,t}};return Object.defineProperty(s,"eof",{get:function(){return r>=o},configurable:true,enumerable:true}),s}const P=new Map;P.remove=function(e){const t=this.get(e);return this.delete(e),t};let W={},F=0,B=-1,V,H,z;function mono_wasm_runtime_ready(){if(s.mono_wasm_runtime_is_ready=b.mono_wasm_runtime_is_ready=true,F=0,W={},B=-1,globalThis.dotnetDebugger)debugger;else console.debug("mono_wasm_runtime_ready","fe00e07a-5519-4dfe-b35a-f867dbaf2e28")}function mono_wasm_fire_debugger_agent_message(){debugger}function L(e,t,n,r){const s=undefined,i=undefined,a={res_ok:e,res:{id:t,value:D(new Uint8Array(o.HEAPU8.buffer,n,r))}};P.has(t)&&console.warn(`MONO_WASM: Adding an id (${t}) that already exists in commands_received`),P.set(t,a)}function J(e){e.length>B&&(V&&o._free(V),B=Math.max(e.length,B,256),V=o._malloc(B));const t=atob(e);for(let e=0;e{const t=setInterval((()=>{1==b.waitForDebugger&&(clearInterval(t),e())}),100)}))}function te(){-1==b.waitForDebugger&&(b.waitForDebugger=1),M.mono_wasm_set_is_debugger_attached(true)}function ne(e,t){H=o.UTF8ToString(e).concat(".dll"),z=t,console.assert(true,`Adding an entrypoint breakpoint ${H} at method token ${z}`);debugger}function re(e,t){if(e.startsWith("dotnet:array:")){let e;if(void 0===t.items)return e=t.map((e=>e.value)),e;if(void 0===t.dimensionsDetails||1===t.dimensionsDetails.length)return e=t.items.map((e=>e.value)),e}const n={};return Object.keys(t).forEach((e=>{const r=t[e];void 0!==r.get?Object.defineProperty(n,r.name,{get(){return G(r.get.id,r.get.commandSet,r.get.command,r.get.buffer)},set:function(e){return q(r.set.id,r.set.commandSet,r.set.command,r.set.buffer,r.set.length,r.set.valtype,e),true}}):void 0!==r.set?Object.defineProperty(n,r.name,{get(){return r.value},set:function(e){return q(r.set.id,r.set.commandSet,r.set.command,r.set.buffer,r.set.length,r.set.valtype,e),true}}):n[r.name]=r.value})),n}function oe(e){if(void 0!=e.arguments&&!Array.isArray(e.arguments))throw new Error(`"arguments" should be an array, but was ${e.arguments}`);const t=e.objectId,n=e.details;let r={};if(t.startsWith("dotnet:cfo_res:")){if(!(t in W))throw new Error(`Unknown object id ${t}`);r=W[t]}else r=re(t,n);const o=void 0!=e.arguments?e.arguments.map((e=>JSON.stringify(e.value))):[],s=`const fn = ${e.functionDeclaration}; return fn.apply(proxy, [${o}]);`,i=undefined,a=new Function("proxy",s)(r);if(void 0===a)return{type:"undefined"};if(Object(a)!==a)return"object"==typeof a&&null==a?{type:typeof a,subtype:`${a}`,value:null}:{type:typeof a,description:`${a}`,value:`${a}`};if(e.returnByValue&&void 0==a.subtype)return{type:"object",value:a};if(Object.getPrototypeOf(a)==Array.prototype){const e=ae(a);return{type:"object",subtype:"array",className:"Array",description:`Array(${a.length})`,objectId:e}}if(void 0!==a.value||void 0!==a.subtype)return a;if(a==r)return{type:"object",className:"Object",description:"Object",objectId:t};const c=undefined;return{type:"object",className:"Object",description:"Object",objectId:ae(a)}}function se(e,t){if(!(e in W))throw new Error(`Could not find any object with id ${e}`);const n=W[e],r=Object.getOwnPropertyDescriptors(n);t.accessorPropertiesOnly&&Object.keys(r).forEach((e=>{void 0===r[e].get&&Reflect.deleteProperty(r,e)}));const o=[];return Object.keys(r).forEach((e=>{let t;const n=r[e];t="object"==typeof n.value?Object.assign({name:e},n):void 0!==n.value?{name:e,value:Object.assign({type:typeof n.value,description:""+n.value},n)}:void 0!==n.get?{name:e,get:{className:"Function",description:`get ${e} () {}`,type:"function"}}:{name:e,value:{type:"symbol",value:"",description:""}},o.push(t)})),{__value_as_json_string__:JSON.stringify(o)}}function ie(e,t={}){return se(`dotnet:cfo_res:${e}`,t)}function ae(e){const t="dotnet:cfo_res:"+F++;return W[t]=e,t}function ce(e){e in W&&delete W[e]}function ue(e,t){const n=o.UTF8ToString(t);if(s.logging&&"function"===typeof s.logging.debugger)return s.logging.debugger(e,n),void 0}let le=0;function fe(e){const t=1===M.mono_wasm_load_icu_data(e);return t&&le++,t}function _e(e){return M.mono_wasm_get_icudt_name(e)}function de(){const e=b.config;let t=false;if(e.globalizationMode||(e.globalizationMode="auto"),"invariant"===e.globalizationMode&&(t=true),!t)if(le>0)b.diagnosticTracing&&console.debug("MONO_WASM: ICU data archive(s) loaded, disabling invariant mode");else{if("icu"===e.globalizationMode){const e="invariant globalization mode is inactive and no ICU data archives were loaded";throw o.printErr(`MONO_WASM: ERROR: ${e}`),new Error(e)}b.diagnosticTracing&&console.debug("MONO_WASM: ICU data archive(s) not loaded, using invariant globalization mode"),t=true}t&&M.mono_wasm_setenv("DOTNET_SYSTEM_GLOBALIZATION_INVARIANT","1"),M.mono_wasm_setenv("DOTNET_SYSTEM_GLOBALIZATION_PREDEFINED_CULTURES_ONLY","1")}function me(e){null==e&&(e={}),"writeAt"in e||(e.writeAt="System.Runtime.InteropServices.JavaScript.JavaScriptExports::StopProfile"),"sendTo"in e||(e.sendTo="Interop/Runtime::DumpAotProfileData");const t="aot:write-at-method="+e.writeAt+",send-to-method="+e.sendTo;o.ccall("mono_wasm_load_profiler_aot",null,["string"],[t])}function ge(e){null==e&&(e={}),"writeAt"in e||(e.writeAt="WebAssembly.Runtime::StopProfile"),"sendTo"in e||(e.sendTo="WebAssembly.Runtime::DumpCoverageProfileData");const t="coverage:write-at-method="+e.writeAt+",send-to-method="+e.sendTo;o.ccall("mono_wasm_load_profiler_coverage",null,["string"],[t])}const we=new Map,he=new Map;let pe=0;function be(e){if(we.has(e))return we.get(e);const t=M.mono_wasm_assembly_load(e);return we.set(e,t),t}function ye(e,t,n){let r=he.get(e);r||he.set(e,r=new Map);let o=r.get(t);return o||(o=new Map,r.set(t,o)),o.get(n)}function ve(e,t,n,r){const o=he.get(e);if(!o)throw new Error("internal error");const s=o.get(t);if(!s)throw new Error("internal error");s.set(n,r)}function Ee(e,t,n){pe||(pe=M.mono_wasm_get_corlib());let r=ye(pe,e,t);if(void 0!==r)return r;if(r=M.mono_wasm_assembly_find_class(pe,e,t),n&&!r)throw new Error(`Failed to find corlib class ${e}.${t}`);return ve(pe,e,t,r),r}
+//! Licensed to the .NET Foundation under one or more agreements.
+const Ae=new Map,Se=[];function Oe(e){try{if(0==Ae.size)return e;const t=e;for(let n=0;n{const n=t.find((e=>"object"==typeof e&&void 0!==e.replaceSection));if(void 0===n)return e;const r=n.funcNum,o=n.replaceSection,s=Ae.get(Number(r));return void 0===s?e:e.replace(o,`${s} (${o})`)}));if(r!==t)return r}return t}catch(t){return console.debug(`MONO_WASM: failed to symbolicate: ${t}`),e}}function xe(e){let t=e;return t instanceof Error||(t=new Error(t)),Oe(t.stack)}function je(e,t,n,r,i){const a=o.UTF8ToString(n),c=!!r,u=o.UTF8ToString(e),l=i,f=o.UTF8ToString(t),_=`[MONO] ${a}`;if(s.logging&&"function"===typeof s.logging.trace)return s.logging.trace(u,f,_,c,l),void 0;switch(f){case"critical":case"error":console.error(xe(_));break;case"warning":console.warn(_);break;case"message":console.log(_);break;case"info":console.info(_);break;case"debug":console.debug(_);break;default:console.log(_);break}}let $e;function Ne(e,t,n){const r={log:t.log,error:t.error},o=t;function s(t,n,o){return function(...s){try{let r=s[0];if(void 0===r)r="undefined";else if(null===r)r="null";else if("function"===typeof r)r=r.toString();else if("string"!==typeof r)try{r=JSON.stringify(r)}catch(e){r=r.toString()}"string"===typeof r&&"main"!==e&&(r=`[${e}] ${r}`),n(o?JSON.stringify({method:t,payload:r,arguments:s}):[t+r,...s.slice(1)])}catch(e){r.error(`proxyConsole failed: ${e}`)}}}const i=["debug","trace","warn","info","error"];for(const e of i)"function"!==typeof o[e]&&(o[e]=s(`console.${e}: `,t.log,false));const a=`${n}/console`.replace("https://","wss://").replace("http://","ws://");$e=new WebSocket(a),$e.addEventListener("open",(()=>{r.log(`browser: [${e}] Console websocket connected.`)})),$e.addEventListener("error",(t=>{r.error(`[${e}] websocket error: ${t}`,t)})),$e.addEventListener("close",(t=>{r.error(`[${e}] websocket closed: ${t}`,t)}));const c=e=>{$e.readyState===WebSocket.OPEN?$e.send(e):r.log(e)};for(const e of["log",...i])o[e]=s(`console.${e}`,c,true)}function ke(e){if(!b.mono_wasm_symbols_are_ready){b.mono_wasm_symbols_are_ready=true;try{const t=undefined;o.FS_readFile(e,{flags:"r",encoding:"utf8"}).split(/[\r\n]/).forEach((e=>{const t=e.split(/:/);t.length<2||(t[1]=t.splice(1).join(":"),Ae.set(Number(t[0]),t[1]))}))}catch(t){return 44==t.errno||console.log(`MONO_WASM: Error loading symbol file ${e}: ${JSON.stringify(t)}`),void 0}}}async function Te(e,t){try{const n=await Re(e,t);return De(n),n}catch(e){return e instanceof b.ExitStatus?e.status:(De(1,e),1)}}async function Re(e,t){Ic(e,t),-1==b.waitForDebugger&&(console.log("MONO_WASM: waiting for debugger..."),await ee());const n=Me(e);return b.javaScriptExports.call_entry_point(n,t)}function Me(e){if(!b.mono_wasm_bindings_is_ready)throw new Error("Assert failed: The runtime must be initialized.");const t=be(e);if(!t)throw new Error("Could not find assembly: "+e);let n=0;1==b.waitForDebugger&&(n=1);const r=M.mono_wasm_assembly_get_entry_point(t,n);if(!r)throw new Error("Could not find entry point for assembly: "+e);return r}function Ie(e){bc(e,false),De(1,e)}function De(e,t){if(b.config.asyncFlushOnExit&&0===e)throw(async()=>{try{await Ue()}finally{Ce(e,t)}})(),b.ExitStatus?new b.ExitStatus(e):t||new Error("Stop with exit code "+e);Ce(e,t)}async function Ue(){try{const e=await import("process"),t=e=>new Promise(((t,n)=>{e.on("error",(e=>n(e))),e.write("",(function(){t()}))})),n=t(e.stderr),r=t(e.stdout);await Promise.all([r,n])}catch(e){console.error(`flushing std* streams failed: ${e}`)}}function Ce(e,t){if(b.ExitStatus&&(!t||t instanceof b.ExitStatus?t=new b.ExitStatus(e):t instanceof Error?o.printErr(s.mono_wasm_stringify_as_error_with_stack(t)):"string"==typeof t?o.printErr(t):o.printErr(JSON.stringify(t))),We(e,t),Pe(e),0!==e||!u){if(!b.quit)throw t;b.quit(e,t)}}function Pe(e){if(u&&b.config.appendElementOnExit){const t=document.createElement("label");t.id="tests_done",e&&(t.style.background="red"),t.innerHTML=e.toString(),document.body.appendChild(t)}}function We(e,t){if(b.config.logExitCode)if(0!=e&&t&&(t instanceof Error?console.error(xe(t)):"string"==typeof t?console.error(t):console.error(JSON.stringify(t))),$e){const t=()=>{0==$e.bufferedAmount?console.log("WASM EXIT "+e):setTimeout(t,100)};t()}else console.log("WASM EXIT "+e)}Se.push(/at (?[^:()]+:wasm-function\[(?\d+)\]:0x[a-fA-F\d]+)((?![^)a-fA-F\d])|$)/),Se.push(/(?:WASM \[[\da-zA-Z]+\], (?function #(?[\d]+) \(''\)))/),Se.push(/(?[a-z]+:\/\/[^ )]*:wasm-function\[(?\d+)\]:0x[a-fA-F\d]+)/),Se.push(/(?<[^ >]+>[.:]wasm-function\[(?[0-9]+)\])/);const Fe="function"===typeof globalThis.WeakRef;function Be(e){return Fe?new WeakRef(e):{deref:()=>e}}const Ve="function"===typeof globalThis.FinalizationRegistry;let He;const ze=[],Le=[];let Je=1;const qe=new Map;Ve&&(He=new globalThis.FinalizationRegistry(rt));const Ge=Symbol.for("wasm js_owned_gc_handle"),Ye=Symbol.for("wasm cs_owned_js_handle");function Ze(e){return 0!==e&&e!==x?ze[e]:null}function Xe(e){return 0!==e&&e!==x?Ze(e):null}function Qe(e){if(e[Ye])return e[Ye];const t=Le.length?Le.pop():Je++;return ze[t]=e,Object.isExtensible(e)&&(e[Ye]=t),t}function Ke(e){const t=ze[e];if("undefined"!==typeof t&&null!==t){if(globalThis===t)return;"undefined"!==typeof t[Ye]&&(t[Ye]=void 0),ze[e]=void 0,Le.push(e)}}function et(e,t){e[Ge]=t,Ve&&He.register(e,t,e);const n=Be(e);qe.set(t,n)}function tt(e,t){e&&(t=e[Ge],e[Ge]=0,Ve&&He.unregister(e)),0!==t&&qe.delete(t)&&b.javaScriptExports.release_js_owned_object_by_gc_handle(t)}function nt(e){const t=e[Ge];if(!(0!=t))throw new Error("Assert failed: ObjectDisposedException");return t}function rt(e){tt(null,e)}function ot(e){if(!e)return null;const t=qe.get(e);return t?t.deref():null}const st=Symbol.for("wasm promise_control");function it(e,t){let n=null;const r=new Promise((function(r,o){n={isDone:false,promise:null,resolve:t=>{n.isDone||(n.isDone=true,r(t),e&&e())},reject:e=>{n.isDone||(n.isDone=true,o(e),t&&t())}}}));n.promise=r;const o=r;return o[st]=n,{promise:o,promise_control:n}}function at(e){return e[st]}function ct(e){return void 0!==e[st]}function ut(e){if(!ct(e))throw new Error("Assert failed: Promise is not controllable")}const lt=("object"===typeof Promise||"function"===typeof Promise)&&"function"===typeof Promise.resolve;function ft(e){return Promise.resolve(e)===e||("object"===typeof e||"function"===typeof e)&&"function"===typeof e.then}function _t(e){const{promise:t,promise_control:n}=it(),r=undefined;return e().then((e=>n.resolve(e))).catch((e=>n.reject(e))),t}function dt(e){const t=ot(e);if(!t)return;const n=t.promise;if(!!!n)throw new Error(`Assert failed: Expected Promise for GCHandle ${e}`);ut(n);const r=undefined;at(n).reject("OperationCanceledException")}const mt=[],gt=32768;let wt,ht,pt=null;function bt(){wt||(wt=o._malloc(gt),ht=wt)}const yt="undefined"!==typeof BigInt&&"undefined"!==typeof BigInt64Array;function vt(){bt(),mt.push(ht)}function Et(){if(!mt.length)throw new Error("No temp frames have been created at this point");ht=mt.pop()}function At(e,t,n){if(!Number.isSafeInteger(e))throw new Error(`Assert failed: Value is not an integer: ${e} (${typeof e})`);if(!(e>=t&&e<=n))throw new Error(`Assert failed: Overflow: value ${e} is out of ${t} ${n} range`)}function St(e,t){o.HEAP8.fill(0,e,t+e)}function Ot(e,t){const n=!!t;"number"===typeof t&&At(t,0,1),o.HEAP32[e>>>2]=n?1:0}function xt(e,t){At(t,0,255),o.HEAPU8[e]=t}function jt(e,t){At(t,0,65535),o.HEAPU16[e>>>1]=t}function $t(e,t){o.HEAPU32[e>>>2]=t}function Nt(e,t){At(t,0,4294967295),o.HEAPU32[e>>>2]=t}function kt(e,t){At(t,-128,127),o.HEAP8[e]=t}function Tt(e,t){At(t,-32768,32767),o.HEAP16[e>>>1]=t}function Rt(e,t){o.HEAP32[e>>>2]=t}function Mt(e,t){At(t,-2147483648,2147483647),o.HEAP32[e>>>2]=t}function It(e){if(0!==e)switch(e){case 1:throw new Error("value was not an integer");case 2:throw new Error("value out of range");default:throw new Error("unknown internal error")}}function Dt(e,t){if(!Number.isSafeInteger(t))throw new Error(`Assert failed: Value is not a safe integer: ${t} (${typeof t})`);const n=undefined;It(M.mono_wasm_f64_to_i52(e,t))}function Ut(e,t){if(!Number.isSafeInteger(t))throw new Error(`Assert failed: Value is not a safe integer: ${t} (${typeof t})`);if(!(t>=0))throw new Error("Assert failed: Can't convert negative Number into UInt64");const n=undefined;It(M.mono_wasm_f64_to_u52(e,t))}function Ct(e,t){if(!yt)throw new Error("Assert failed: BigInt is not supported.");if(!("bigint"===typeof t))throw new Error(`Assert failed: Value is not an bigint: ${t} (${typeof t})`);if(!(t>=Kt&&t<=Qt))throw new Error(`Assert failed: Overflow: value ${t} is out of ${Kt} ${Qt} range`);pt[e>>>3]=t}function Pt(e,t){if(!("number"===typeof t))throw new Error(`Assert failed: Value is not a Number: ${t} (${typeof t})`);o.HEAPF32[e>>>2]=t}function Wt(e,t){if(!("number"===typeof t))throw new Error(`Assert failed: Value is not a Number: ${t} (${typeof t})`);o.HEAPF64[e>>>3]=t}function Ft(e){return!!o.HEAP32[e>>>2]}function Bt(e){return o.HEAPU8[e]}function Vt(e){return o.HEAPU16[e>>>1]}function Ht(e){return o.HEAPU32[e>>>2]}function zt(e){return o.HEAP8[e]}function Lt(e){return o.HEAP16[e>>>1]}function Jt(e){return o.HEAP32[e>>>2]}function qt(e){const t=M.mono_wasm_i52_to_f64(e,b._i52_error_scratch_buffer),n=undefined;return It(Jt(b._i52_error_scratch_buffer)),t}function Gt(e){const t=M.mono_wasm_u52_to_f64(e,b._i52_error_scratch_buffer),n=undefined;return It(Jt(b._i52_error_scratch_buffer)),t}function Yt(e){if(!yt)throw new Error("Assert failed: BigInt is not supported.");return pt[e>>>3]}function Zt(e){return o.HEAPF32[e>>>2]}function Xt(e){return o.HEAPF64[e>>>3]}let Qt,Kt;function en(e){yt&&(Qt=BigInt("9223372036854775807"),Kt=BigInt("-9223372036854775808"),pt=new BigInt64Array(e))}function tn(e){const t=o._malloc(e.length),n=undefined;return new Uint8Array(o.HEAPU8.buffer,t,e.length).set(e),t}const nn=8192;let rn=null,on=null,sn=0;const an=[],cn=[];function un(e,t){if(e<=0)throw new Error("capacity >= 1");const n=4*(e|=0),r=o._malloc(n);if(r%4!==0)throw new Error("Malloc returned an unaligned offset");return St(r,n),new WasmRootBufferImpl(r,e,true,t)}function ln(e){let t;if(!e)throw new Error("address must be a location in the native heap");return cn.length>0?(t=cn.pop(),t._set_address(e)):t=new wn(e),t}function fn(e){let t;if(an.length>0)t=an.pop();else{const e=mn(),n=undefined;t=new gn(rn,e)}if(void 0!==e){if("number"!==typeof e)throw new Error("value must be an address in the managed heap");t.set(e)}else t.set(0);return t}function _n(...e){for(let t=0;t>>2,this.__count=t,this.length=t,this.__handle=M.mono_wasm_register_root(e,o,r||"noname"),this.__ownsAllocation=n}_throw_index_out_of_range(){throw new Error("index out of range")}_check_in_range(e){(e>=this.__count||e<0)&&this._throw_index_out_of_range()}get_address(e){return this._check_in_range(e),this.__offset+4*e}get_address_32(e){return this._check_in_range(e),this.__offset32+e}get(e){this._check_in_range(e);const t=this.get_address_32(e);return o.HEAPU32[t]}set(e,t){const n=this.get_address(e);return M.mono_wasm_write_managed_pointer_unsafe(n,t),t}copy_value_from_address(e,t){const n=this.get_address(e);M.mono_wasm_copy_managed_pointer(n,t)}_unsafe_get(e){return o.HEAPU32[this.__offset32+e]}_unsafe_set(e,t){const n=this.__offset+e;M.mono_wasm_write_managed_pointer_unsafe(n,t)}clear(){this.__offset&&St(this.__offset,4*this.__count)}release(){this.__offset&&this.__ownsAllocation&&(M.mono_wasm_deregister_root(this.__offset),St(this.__offset,4*this.__count),o._free(this.__offset)),this.__handle=this.__offset=this.__count=this.__offset32=0}toString(){return`[root buffer @${this.get_address(0)}, size ${this.__count} ]`}}class gn{constructor(e,t){this.__buffer=e,this.__index=t}get_address(){return this.__buffer.get_address(this.__index)}get_address_32(){return this.__buffer.get_address_32(this.__index)}get address(){return this.__buffer.get_address(this.__index)}get(){const e=undefined;return this.__buffer._unsafe_get(this.__index)}set(e){const t=this.__buffer.get_address(this.__index);return M.mono_wasm_write_managed_pointer_unsafe(t,e),e}copy_from(e){const t=e.address,n=this.address;M.mono_wasm_copy_managed_pointer(n,t)}copy_to(e){const t=this.address,n=e.address;M.mono_wasm_copy_managed_pointer(n,t)}copy_from_address(e){const t=this.address;M.mono_wasm_copy_managed_pointer(t,e)}copy_to_address(e){const t=this.address;M.mono_wasm_copy_managed_pointer(e,t)}get value(){return this.get()}set value(e){this.set(e)}valueOf(){throw new Error("Implicit conversion of roots to pointers is no longer supported. Use .value or .address as appropriate")}clear(){this.set(0)}release(){if(!this.__buffer)throw new Error("No buffer");const e=128;an.length>e?(dn(this.__index),this.__buffer=null,this.__index=0):(this.set(0),an.push(this))}toString(){return`[root @${this.address}]`}}class wn{constructor(e){this.__external_address=0,this.__external_address_32=0,this._set_address(e)}_set_address(e){this.__external_address=e,this.__external_address_32=e>>>2}get address(){return this.__external_address}get_address(){return this.__external_address}get_address_32(){return this.__external_address_32}get(){const e=undefined;return o.HEAPU32[this.__external_address_32]}set(e){return M.mono_wasm_write_managed_pointer_unsafe(this.__external_address,e),e}copy_from(e){const t=e.address,n=this.__external_address;M.mono_wasm_copy_managed_pointer(n,t)}copy_to(e){const t=this.__external_address,n=e.address;M.mono_wasm_copy_managed_pointer(n,t)}copy_from_address(e){const t=this.__external_address;M.mono_wasm_copy_managed_pointer(t,e)}copy_to_address(e){const t=this.__external_address;M.mono_wasm_copy_managed_pointer(e,t)}get value(){return this.get()}set value(e){this.set(e)}valueOf(){throw new Error("Implicit conversion of roots to pointers is no longer supported. Use .value or .address as appropriate")}clear(){this.set(0)}release(){const e=128;cn.length=r&&(vr=null),vr||(vr=un(r,"interned strings"),Er=0);const o=vr,s=Er++;if(n&&(M.mono_wasm_intern_string_ref(t.address),!t.value))throw new Error("mono_wasm_intern_string_ref produced a null pointer");br.set(e,t.value),pr.set(t.value,e),0!==e.length||yr||(yr=t.value),o.copy_value_from_address(s,t.address)}function Nr(e,t){let n;if("symbol"===typeof e?(n=e.description,"string"!==typeof n&&(n=Symbol.keyFor(e)),"string"!==typeof n&&(n="")):"string"===typeof e&&(n=e),"string"!==typeof n)throw new Error(`Argument to js_string_to_mono_string_interned must be a string but was ${e}`);if(0===n.length&&yr)return t.set(yr),void 0;const r=br.get(n);if(r)return t.set(r),void 0;Tr(n,t),$r(n,t,true)}function kr(e,t){if(t.clear(),null!==e)if("symbol"===typeof e)Nr(e,t);else{if("string"!==typeof e)throw new Error("Expected string argument, got "+typeof e);if(0===e.length)Nr(e,t);else{if(e.length<=256){const n=br.get(e);if(n)return t.set(n),void 0}Tr(e,t)}}}function Tr(e,t){const n=o._malloc(2*(e.length+1)),r=n>>>1|0;for(let t=0;t{const n=On(e,0),a=On(e,1),c=On(e,2),u=On(e,3),l=On(e,4);try{let e,n,f;o&&(e=o(c)),s&&(n=s(u)),i&&(f=i(l));const _=t(e,n,f);r&&r(a,_)}catch(e){eo(n,e)}};a[yn]=true;const c=undefined;cr(e,Qe(a)),Cn(e,wr.Function)}class Qr{constructor(e){this.promise=e}dispose(){tt(this,0)}get isDisposed(){return 0===this[Ge]}}function Kr(e,t,n,r){if(null===t||void 0===t)return Cn(e,wr.None),void 0;if(!ft(t))throw new Error("Assert failed: Value is not a Promise");const o=b.javaScriptExports.create_task_callback();lr(e,o),Cn(e,wr.Task);const s=new Qr(t);et(s,o),t.then((e=>{b.javaScriptExports.complete_task(o,null,e,r||no),tt(s,o)})).catch((e=>{b.javaScriptExports.complete_task(o,e,null,void 0),tt(s,o)}))}function eo(e,t){if(null===t||void 0===t)Cn(e,wr.None);else if(t instanceof ManagedError){Cn(e,wr.Exception);const n=undefined;lr(e,nt(t))}else{if(!("object"===typeof t||"string"===typeof t))throw new Error("Assert failed: Value is not an Error "+typeof t);Cn(e,wr.JSException);const n=undefined;Yr(e,t.toString());const r=t[Ye];if(r)cr(e,r);else{const n=undefined;cr(e,Qe(t))}}}function to(e,t){if(void 0===t||null===t)Cn(e,wr.None);else{if(!(void 0===t[Ge]))throw new Error("Assert failed: JSObject proxy of ManagedObject proxy is not supported");if(!("function"===typeof t||"object"===typeof t))throw new Error(`Assert failed: JSObject proxy of ${typeof t} is not supported`);Cn(e,wr.JSObject);const n=undefined;cr(e,Qe(t))}}function no(e,t){if(void 0===t||null===t)Cn(e,wr.None);else{const n=t[Ge],r=typeof t;if(void 0===n)if("string"===r||"symbol"===r)Cn(e,wr.String),Yr(e,t);else if("number"===r)Cn(e,wr.Double),sr(e,t);else{if("bigint"===r)throw new Error("NotImplementedException: bigint");if("boolean"===r)Cn(e,wr.Boolean),Zn(e,t);else if(t instanceof Date)Cn(e,wr.DateTime),or(e,t);else if(t instanceof Error)eo(e,t);else if(t instanceof Uint8Array)oo(e,t,wr.Byte);else if(t instanceof Float64Array)oo(e,t,wr.Double);else if(t instanceof Int32Array)oo(e,t,wr.Int32);else if(Array.isArray(t))oo(e,t,wr.Object);else{if(t instanceof Int16Array||t instanceof Int8Array||t instanceof Uint8ClampedArray||t instanceof Uint16Array||t instanceof Uint32Array||t instanceof Float32Array)throw new Error("NotImplementedException: TypedArray");if(ft(t))Kr(e,t);else{if(t instanceof Span)throw new Error("NotImplementedException: Span");if("object"!=r)throw new Error(`JSObject proxy is not supported for ${r} ${t}`);{const n=Qe(t);Cn(e,wr.JSObject),cr(e,n)}}}}else{if(nt(t),t instanceof ArraySegment)throw new Error("NotImplementedException: ArraySegment");if(t instanceof ManagedError)Cn(e,wr.Exception),lr(e,n);else{if(!(t instanceof ManagedObject))throw new Error("NotImplementedException "+r);Cn(e,wr.Object),lr(e,n)}}}}function ro(e,t,n){if(!!!n)throw new Error("Assert failed: Expected valid sig parameter");const r=undefined;oo(e,t,kn(n))}function oo(e,t,n){if(null===t||void 0===t)Cn(e,wr.None);else{const r=mr(n);if(!(-1!=r))throw new Error(`Assert failed: Element type ${wr[n]} not supported`);const s=t.length,i=r*s,a=o._malloc(i);if(n==wr.String){if(!Array.isArray(t))throw new Error("Assert failed: Value is not an Array");St(a,i),M.mono_wasm_register_root(a,i,"marshal_array_to_cs");for(let e=0;e>2,(a>>2)+s).set(t)}else{if(n!=wr.Double)throw new Error("not implemented");{if(!(Array.isArray(t)||t instanceof Float64Array))throw new Error("Assert failed: Value is not an Array or Float64Array");const e=undefined;o.HEAPF64.subarray(a>>3,(a>>3)+s).set(t)}}tr(e,a),Cn(e,wr.Array),Pn(e,n),dr(e,t.length)}}function so(e,t,n){if(!!!n)throw new Error("Assert failed: Expected valid sig parameter");if(!!t.isDisposed)throw new Error("Assert failed: ObjectDisposedException");ao(n,t._viewType),Cn(e,wr.Span),tr(e,t._pointer),dr(e,t.length)}function io(e,t,n){if(!!!n)throw new Error("Assert failed: Expected valid sig parameter");const r=nt(t);if(!r)throw new Error("Assert failed: Only roundtrip of ArraySegment instance created by C#");ao(n,t._viewType),Cn(e,wr.ArraySegment),tr(e,t._pointer),dr(e,t.length),lr(e,r)}function ao(e,t){const n=kn(e);if(n==wr.Byte){if(!(0==t))throw new Error("Assert failed: Expected MemoryViewType.Byte")}else if(n==wr.Int32){if(!(1==t))throw new Error("Assert failed: Expected MemoryViewType.Int32")}else{if(n!=wr.Double)throw new Error(`NotImplementedException ${wr[n]} `);if(!(2==t))throw new Error("Assert failed: Expected MemoryViewType.Double")}}function co(){0==hn.size&&(hn.set(wr.Array,ko),hn.set(wr.Span,Ro),hn.set(wr.ArraySegment,Mo),hn.set(wr.Boolean,lo),hn.set(wr.Byte,fo),hn.set(wr.Char,_o),hn.set(wr.Int16,mo),hn.set(wr.Int32,go),hn.set(wr.Int52,wo),hn.set(wr.BigInt64,ho),hn.set(wr.Single,po),hn.set(wr.IntPtr,yo),hn.set(wr.Double,bo),hn.set(wr.String,xo),hn.set(wr.Exception,jo),hn.set(wr.JSException,jo),hn.set(wr.JSObject,$o),hn.set(wr.Object,No),hn.set(wr.DateTime,Eo),hn.set(wr.DateTimeOffset,Eo),hn.set(wr.Task,So),hn.set(wr.Action,Ao),hn.set(wr.Function,Ao),hn.set(wr.None,vo),hn.set(wr.Void,vo),hn.set(wr.Discard,vo))}function uo(e,t,n,r,o,s){let i="",a="",c="";const u="converter"+t;let l="null",f="null",_="null",d="null",m=$n(e);if(m===wr.None||m===wr.Void)return{converters:i,call_body:c,marshaler_type:m};const g=Nn(e);if(g!==wr.None){const e=hn.get(g);if(!(e&&"function"===typeof e))throw new Error(`Assert failed: Unknow converter for type ${g} at ${t}`);m!=wr.Nullable?(d="converter"+t+"_res",i+=", "+d,a+=" "+wr[g],s[d]=e):m=g}const w=kn(e);if(w!==wr.None){const e=pn.get(w);if(!(e&&"function"===typeof e))throw new Error(`Assert failed: Unknow converter for type ${w} at ${t}`);l="converter"+t+"_arg1",i+=", "+l,a+=" "+wr[w],s[l]=e}const h=Tn(e);if(h!==wr.None){const e=pn.get(h);if(!(e&&"function"===typeof e))throw new Error(`Assert failed: Unknow converter for type ${h} at ${t}`);f="converter"+t+"_arg2",i+=", "+f,a+=" "+wr[h],s[f]=e}const p=Rn(e);if(p!==wr.None){const e=pn.get(p);if(!(e&&"function"===typeof e))throw new Error(`Assert failed: Unknow converter for type ${p} at ${t}`);_="converter"+t+"_arg3",i+=", "+_,a+=" "+wr[p],s[_]=e}const b=hn.get(m);if(!(b&&"function"===typeof b))throw new Error(`Assert failed: Unknow converter for type ${m} at ${t} `);return i+=", "+u,a+=" "+wr[m],s[u]=b,c=m==wr.Task?` const ${o} = ${u}(args + ${n}, signature + ${r}, ${d}); // ${a} \n`:m==wr.Action||m==wr.Function?` const ${o} = ${u}(args + ${n}, signature + ${r}, ${d}, ${l}, ${f}, ${_}); // ${a} \n`:` const ${o} = ${u}(args + ${n}, signature + ${r}); // ${a} \n`,{converters:i,call_body:c,marshaler_type:m}}function lo(e){const t=undefined;return Dn(e)==wr.None?null:Wn(e)}function fo(e){const t=undefined;return Dn(e)==wr.None?null:Fn(e)}function _o(e){const t=undefined;return Dn(e)==wr.None?null:Bn(e)}function mo(e){const t=undefined;return Dn(e)==wr.None?null:Vn(e)}function go(e){const t=undefined;return Dn(e)==wr.None?null:Hn(e)}function wo(e){const t=undefined;return Dn(e)==wr.None?null:Ln(e)}function ho(e){const t=undefined;return Dn(e)==wr.None?null:Jn(e)}function po(e){const t=undefined;return Dn(e)==wr.None?null:Gn(e)}function bo(e){const t=undefined;return Dn(e)==wr.None?null:Yn(e)}function yo(e){const t=undefined;return Dn(e)==wr.None?null:zn(e)}function vo(){return null}function Eo(e){const t=undefined;return Dn(e)===wr.None?null:qn(e)}function Ao(e,t,n,r,o,s){const i=undefined;if(Dn(e)===wr.None)return null;const a=ur(e);let c=ot(a);return null!==c&&void 0!==c||(c=(e,t,i)=>b.javaScriptExports.call_delegate(a,e,t,i,n,r,o,s),et(c,a)),c}function So(e,t,n){const r=Dn(e);if(r===wr.None)return null;if(r!==wr.Task){if(n||(n=hn.get(r)),!n)throw new Error(`Assert failed: Unknow sub_converter for type ${wr[r]} `);const t=n(e);return new Promise((e=>e(t)))}const o=ar(e);if(0==o)return new Promise((e=>e(void 0)));const s=Ze(o);if(!!!s)throw new Error(`Assert failed: ERR28: promise not found for js_handle: ${o} `);ut(s);const i=at(s),a=i.resolve;return i.resolve=e=>{const t=Dn(e);if(t===wr.None)return a(null),void 0;if(n||(n=hn.get(t)),!n)throw new Error(`Assert failed: Unknow sub_converter for type ${wr[t]}`);const r=n(e);a(r)},s}function Oo(e){const t=On(e,0),n=On(e,1),r=On(e,2),o=On(e,3),s=Dn(t),i=Dn(o),a=ar(r);if(0===a){const{promise:e,promise_control:r}=it(),a=undefined;if(cr(n,Qe(e)),s!==wr.None){const e=jo(t);r.reject(e)}else if(i!==wr.Task){const e=hn.get(i);if(!e)throw new Error(`Assert failed: Unknow sub_converter for type ${wr[i]} `);const t=e(o);r.resolve(t)}}else{const e=Ze(a);if(!!!e)throw new Error(`Assert failed: ERR25: promise not found for js_handle: ${a} `);ut(e);const n=at(e);if(s!==wr.None){const e=jo(t);n.reject(e)}else i!==wr.Task&&n.resolve(o)}Cn(n,wr.Task),Cn(t,wr.None)}function xo(e){const t=undefined;if(Dn(e)==wr.None)return null;const n=fr(e);try{const e=undefined;return xr(n)}finally{n.release()}}function jo(e){const t=Dn(e);if(t==wr.None)return null;if(t==wr.JSException){const t=undefined,n=undefined;return Ze(ar(e))}const n=ur(e);let r=ot(n);if(null===r||void 0===r){const t=xo(e);r=new ManagedError(t),et(r,n)}return r}function $o(e){const t=undefined;if(Dn(e)==wr.None)return null;const n=undefined,r=undefined;return Ze(ar(e))}function No(e){const t=Dn(e);if(t==wr.None)return null;if(t==wr.JSObject){const t=undefined,n=undefined;return Ze(ar(e))}if(t==wr.Array){const t=undefined;return To(e,Un(e))}if(t==wr.Object){const t=ur(e);if(0===t)return null;let n=ot(t);return n||(n=new ManagedObject,et(n,t)),n}const n=hn.get(t);if(!n)throw new Error(`Assert failed: Unknow converter for type ${wr[t]}`);return n(e)}function ko(e,t){if(!!!t)throw new Error("Assert failed: Expected valid sig parameter");const n=undefined;return To(e,kn(t))}function To(e,t){const n=undefined;if(Dn(e)==wr.None)return null;const r=undefined;if(!(-1!=mr(t)))throw new Error(`Assert failed: Element type ${wr[t]} not supported`);const s=zn(e),i=_r(e);let a=null;if(t==wr.String){a=new Array(i);for(let e=0;e>2,(s>>2)+i).slice()}else{if(t!=wr.Double)throw new Error(`NotImplementedException ${wr[t]} `);{const e=undefined;a=o.HEAPF64.subarray(s>>3,(s>>3)+i).slice()}}return o._free(s),a}function Ro(e,t){if(!!!t)throw new Error("Assert failed: Expected valid sig parameter");const n=kn(t),r=zn(e),o=_r(e);let s=null;if(n==wr.Byte)s=new Span(r,o,0);else if(n==wr.Int32)s=new Span(r,o,1);else{if(n!=wr.Double)throw new Error(`NotImplementedException ${wr[n]} `);s=new Span(r,o,2)}return s}function Mo(e,t){if(!!!t)throw new Error("Assert failed: Expected valid sig parameter");const n=kn(t),r=zn(e),o=_r(e);let s=null;if(n==wr.Byte)s=new ArraySegment(r,o,0);else if(n==wr.Int32)s=new ArraySegment(r,o,1);else{if(n!=wr.Double)throw new Error(`NotImplementedException ${wr[n]} `);s=new ArraySegment(r,o,2)}const i=undefined;return et(s,ur(e)),s}let Io,Do;const Uo={};function Co(e){Io=e.mono,Do=e.binding}const Po=Symbol.for("wasm type");function Wo(e){return new Promise((t=>setTimeout(t,e)))}const Fo=it(),Bo=it();let Vo=0,Ho=0,zo=0,Lo=0;const Jo=[],qo=Object.create(null);let Go=0,Yo;const Zo={"js-module-threads":true},Xo={dotnetwasm:true},Qo={"js-module-threads":true,dotnetwasm:true};function Ko(e){var t;const n=null===(t=b.config.assets)||void 0===t?void 0:t.find((t=>t.behavior==e));if(!n)throw new Error(`Assert failed: Can't find asset for ${e}`);return n.resolvedUrl||(n.resolvedUrl=os(n,"")),n}async function es(){b.diagnosticTracing&&console.debug("MONO_WASM: mono_download_assets"),b.maxParallelDownloads=b.config.maxParallelDownloads||b.maxParallelDownloads;try{const e=[];for(const t of b.config.assets){const n=t;if(Qo[n.behavior]||Lo++,!Zo[n.behavior]){const t=Xo[n.behavior];if(zo++,n.pendingDownload){n.pendingDownloadInternal=n.pendingDownload;const r=async()=>{const e=await n.pendingDownloadInternal.response;return t||(n.buffer=await e.arrayBuffer()),++Vo,{asset:n,buffer:n.buffer}};e.push(r())}else{const r=async()=>(n.buffer=await ts(n,!t),{asset:n,buffer:n.buffer});e.push(r())}}}Bo.promise_control.resolve();const t=[];for(const n of e)t.push((async()=>{const e=await n,t=e.asset;if(e.buffer){if(!Qo[t.behavior]){const n=t.pendingDownloadInternal.url,r=new Uint8Array(t.buffer);t.pendingDownloadInternal=null,t.pendingDownload=null,t.buffer=null,e.buffer=null,await lc.promise,is(t,n,r)}}else{const e=undefined;if(Xo[t.behavior])Xo[t.behavior]&&++Vo;else{if(!t.isOptional)throw new Error("Assert failed: Expected asset to have the downloaded buffer");Zo[t.behavior]||zo--,Qo[t.behavior]||Lo--}}})());Promise.all(t).then((()=>{Fo.promise_control.resolve()})).catch((e=>{o.printErr("MONO_WASM: Error in mono_download_assets: "+e),bc(e,true)}))}catch(e){throw o.printErr("MONO_WASM: Error in mono_download_assets: "+e),e}}async function ts(e,t){try{return await ns(e,t)}catch(n){if(c||a)throw n;if(e.pendingDownload&&e.pendingDownloadInternal==e.pendingDownload)throw n;if(e.resolvedUrl&&-1!=e.resolvedUrl.indexOf("file://"))throw n;if(n&&404==n.status)throw n;e.pendingDownloadInternal=void 0,await Bo.promise;try{return await ns(e,t)}catch(n){return e.pendingDownloadInternal=void 0,await Wo(100),await ns(e,t)}}}async function ns(e,t){for(;Yo;)await Yo.promise;try{++Go,Go==b.maxParallelDownloads&&(b.diagnosticTracing&&console.debug("MONO_WASM: Throttling further parallel downloads"),Yo=it());const n=await rs(e);if(!t||!n)return;const r=await n.arrayBuffer();return++Vo,r}finally{if(--Go,Yo&&Go==b.maxParallelDownloads-1){b.diagnosticTracing&&console.debug("MONO_WASM: Resuming more parallel downloads");const e=Yo;Yo=void 0,e.promise_control.resolve()}}}async function rs(e){if(e.buffer){const t=e.buffer;return e.buffer=null,e.pendingDownloadInternal={url:"undefined://"+e.name,name:e.name,response:Promise.resolve({arrayBuffer:()=>t,headers:{get:()=>{}}})},e.pendingDownloadInternal.response}if(e.pendingDownloadInternal&&e.pendingDownloadInternal.response){const t=undefined;return await e.pendingDownloadInternal.response}const t=e.loadRemote&&b.config.remoteSources?b.config.remoteSources:[""];let n;for(let r of t){r=r.trim(),"./"===r&&(r="");const t=os(e,r);e.name===t?b.diagnosticTracing&&console.debug(`MONO_WASM: Attempting to download '${t}'`):b.diagnosticTracing&&console.debug(`MONO_WASM: Attempting to download '${t}' for ${e.name}`);try{const r=ss({name:e.name,resolvedUrl:t,hash:e.hash,behavior:e.behavior});if(e.pendingDownloadInternal=r,n=await r.response,!n.ok)continue;return n}catch(e){continue}}const r=e.isOptional||e.name.match(/\.pdb$/)&&b.config.ignorePdbLoadErrors;if(!n)throw new Error(`Assert failed: Response undefined ${e.name}`);if(r)return o.print(`MONO_WASM: optional download '${n.url}' for ${e.name} failed ${n.status} ${n.statusText}`),void 0;{const t=new Error(`MONO_WASM: download '${n.url}' for ${e.name} failed ${n.status} ${n.statusText}`);throw t.status=n.status,t}}function os(e,t){if(!(null!==t&&void 0!==t))throw new Error(`Assert failed: sourcePrefix must be provided for ${e.name}`);let n;const r=b.config.assemblyRootFolder;if(e.resolvedUrl)n=e.resolvedUrl;else{if(""===t)if("assembly"===e.behavior||"pdb"===e.behavior)n=r?r+"/"+e.name:e.name;else if("resource"===e.behavior){const t=e.culture&&""!==e.culture?`${e.culture}/${e.name}`:e.name;n=r?r+"/"+t:t}else n=e.name;else n=t+e.name;n=b.locateFile(n)}if(!(n&&"string"==typeof n))throw new Error("Assert failed: attemptUrl need to be path or url string");return n}function ss(e){try{if("function"===typeof o.downloadResource){const t=o.downloadResource(e);if(t)return t}const t={};e.hash&&(t.integrity=e.hash);const n=b.fetch_like(e.resolvedUrl,t);return{name:e.name,url:e.resolvedUrl,response:n}}catch(t){const n={ok:false,url:e.resolvedUrl,status:500,statusText:"ERR29: "+t,arrayBuffer:()=>{throw t},json:()=>{throw t}};return{name:e.name,url:e.resolvedUrl,response:Promise.resolve(n)}}}function is(e,t,n){b.diagnosticTracing&&console.debug(`MONO_WASM: Loaded:${e.name} as ${e.behavior} size ${n.length} from ${t}`);const r="string"===typeof e.virtualPath?e.virtualPath:e.name;let s=null;switch(e.behavior){case"dotnetwasm":case"js-module-threads":break;case"resource":case"assembly":case"pdb":Jo.push({url:t,file:r});case"heap":case"icu":s=tn(n),qo[r]=[s,n.length];break;case"vfs":{const e=r.lastIndexOf("/");let t=e>0?r.substr(0,e):null,s=e>0?r.substr(e+1):r;s.startsWith("/")&&(s=s.substr(1)),t?(b.diagnosticTracing&&console.debug(`MONO_WASM: Creating directory '${t}'`),o.FS_createPath("/",t,true,true)):t="/",b.diagnosticTracing&&console.debug(`MONO_WASM: Creating file '${s}' in directory '${t}'`),cs(n,t)||o.FS_createDataFile(t,s,n,true,true,true);break}default:throw new Error(`Unrecognized asset behavior:${e.behavior}, for asset ${e.name}`)}if("assembly"===e.behavior){const e=undefined;if(!M.mono_wasm_add_assembly(r,s,n.length)){const e=Jo.findIndex((e=>e.file==r));Jo.splice(e,1)}}else"icu"===e.behavior?fe(s)||o.printErr(`MONO_WASM: Error loading ICU asset ${e.name}`):"resource"===e.behavior&&M.mono_wasm_add_satellite_assembly(r,e.culture||"",s,n.length);++Ho}async function as(e,t,n){if(!(e&&e.pendingDownloadInternal&&e.pendingDownloadInternal.response))throw new Error("Assert failed: Can't load dotnet.wasm");const r=await e.pendingDownloadInternal.response,o=r.headers&&r.headers.get?r.headers.get("Content-Type"):void 0;let s,i;if("function"===typeof WebAssembly.instantiateStreaming&&"application/wasm"===o){b.diagnosticTracing&&console.debug("MONO_WASM: instantiate_wasm_module streaming");const e=await WebAssembly.instantiateStreaming(r,t);s=e.instance,i=e.module}else{u&&"application/wasm"!==o&&console.warn('MONO_WASM: WebAssembly resource does not have the expected content type "application/wasm", so falling back to slower ArrayBuffer instantiation.');const e=await r.arrayBuffer();b.diagnosticTracing&&console.debug("MONO_WASM: instantiate_wasm_module buffered");const n=await WebAssembly.instantiate(e,t);s=n.instance,i=n.module}n(s,i)}function cs(e,t){if(e.length<8)return false;const n=new DataView(e.buffer),r=undefined;if(1651270004!=n.getUint32(0,true))return false;const s=n.getUint32(4,true);if(0==s||e.length{const t=e[0],n=t.lastIndexOf("/"),r=t.slice(0,n+1);a.add(r)})),a.forEach((e=>{o.FS_createPath(t,e,true,true)}));for(const n of i){const r=n[0],s=n[1],i=e.slice(0,s);o.FS_createDataFile(t,r,i,true,true),e=e.slice(s)}return true}async function us(){if(await Fo.promise,b.config.assets){if(!(Vo==zo))throw new Error(`Assert failed: Expected ${zo} assets to be downloaded, but only finished ${Vo}`);if(!(Ho==Lo))throw new Error(`Assert failed: Expected ${Lo} assets to be in memory, but only instantiated ${Ho}`);Jo.forEach((e=>Io.loaded_files.push(e.url))),b.diagnosticTracing&&console.debug("MONO_WASM: all assets are loaded in wasm memory")}}function ls(){return Io.loaded_files}let fs,_s;function ds(e){const t=o;"undefined"===typeof globalThis.performance&&(globalThis.performance=gs),"undefined"===typeof globalThis.URL&&(globalThis.URL=class e{constructor(e){this.url=e}toString(){return this.url}});const n=t.imports=o.imports||{},r=e=>t=>{const n=o.imports[t];return n||e(t)};n.require?b.requirePromise=e.requirePromise=Promise.resolve(r(n.require)):e.require?b.requirePromise=e.requirePromise=Promise.resolve(r(e.require)):e.requirePromise?b.requirePromise=e.requirePromise.then((e=>r(e))):b.requirePromise=e.requirePromise=Promise.resolve(r((e=>{throw new Error(`Please provide Module.imports.${e} or Module.imports.require`)}))),b.scriptDirectory=e.scriptDirectory=bs(e),t.mainScriptUrlOrBlob=e.scriptUrl,t.__locateFile===t.locateFile?t.locateFile=b.locateFile=e=>Es(e)?e:b.scriptDirectory+e:b.locateFile=t.locateFile,n.fetch?e.fetch=b.fetch_like=n.fetch:e.fetch=b.fetch_like=ws,e.noExitRuntime=u;const s=e.updateGlobalBufferAndViews;e.updateGlobalBufferAndViews=e=>{s(e),en(e)}}async function ms(){if(a){if(s.require=await b.requirePromise,globalThis.performance===gs){const{performance:e}=s.require("perf_hooks");globalThis.performance=e}if(globalThis.crypto||(globalThis.crypto={}),!globalThis.crypto.getRandomValues){let e;try{e=s.require("node:crypto")}catch(e){}e?e.webcrypto?globalThis.crypto=e.webcrypto:e.randomBytes&&(globalThis.crypto.getRandomValues=t=>{t&&t.set(e.randomBytes(t.length))}):globalThis.crypto.getRandomValues=()=>{throw new Error("Using node without crypto support. To enable current operation, either provide polyfill for 'globalThis.crypto.getRandomValues' or enable 'node:crypto' module.")}}}}const gs={now:function(){return Date.now()}};async function ws(e,t){try{if(a){if(!fs){const e=await b.requirePromise;_s=e("url"),fs=e("fs")}e.startsWith("file://")&&(e=_s.fileURLToPath(e));const t=await fs.promises.readFile(e);return{ok:true,url:e,arrayBuffer:()=>t,json:()=>JSON.parse(t)}}if("function"===typeof globalThis.fetch)return globalThis.fetch(e,t||{credentials:"same-origin"});if("function"===typeof read){const t=new Uint8Array(read(e,"binary"));return{ok:true,url:e,arrayBuffer:()=>t,json:()=>JSON.parse(o.UTF8ArrayToString(t,0,t.length))}}}catch(t){return{ok:false,url:e,status:500,statusText:"ERR28: "+t,arrayBuffer:()=>{throw t},json:()=>{throw t}}}throw new Error("No fetch implementation available")}function hs(e){return e.replace(/\\/g,"/").replace(/[?#].*/,"")}function ps(e){return e.slice(0,e.lastIndexOf("/"))+"/"}function bs(e){return l&&(e.scriptUrl=self.location.href),e.scriptUrl||(e.scriptUrl="./dotnet.js"),e.scriptUrl=hs(e.scriptUrl),ps(e.scriptUrl)}const ys=/^[a-zA-Z][a-zA-Z\d+\-.]*?:\/\//,vs=/[a-zA-Z]:[\\/]/;function Es(e){return a||c?e.startsWith("/")||e.startsWith("\\")||-1!==e.indexOf("///")||vs.test(e):ys.test(e)}function As(e,t,n,r,o,s){const i=ln(e),a=ln(t),c=ln(s);try{const e=In(n);if(!(1===e))throw new Error(`Assert failed: Signature version ${e} mismatch.`);const t=xr(i),o=xr(a);b.diagnosticTracing&&console.debug(`MONO_WASM: Binding [JSImport] ${t} from ${o}`);const s=xs(t,o),u=Mn(n),l={fn:s,marshal_exception_to_cs:eo,signature:n},f="_bound_js_"+t.replace(/\./g,"_");let _=`//# sourceURL=https://dotnet.generated.invalid/${f} \n`,d="",m="",g="";for(let e=0;e{const o=await n;return r&&(Ms.set(e,o),b.diagnosticTracing&&console.debug(`MONO_WASM: imported ES6 module '${e}' from '${t}'`)),o}))}function Ds(e,t){let n="unknown exception";if(t){n=t.toString();const e=t.stack;e&&(e.startsWith(n)?n=e:n+="\n"+e),n=Oe(n)}return e&&o.setValue(e,1,"i32"),n}function Us(e,t,n){const r=undefined;kr(Ds(e,t),n)}const Cs=new Map;function Ps(e,t,n,r,s){const i=ln(e),a=ln(s),c=o;try{const e=In(n);if(!(1===e))throw new Error(`Assert failed: Signature version ${e} mismatch.`);const r=Mn(n),o=xr(i);if(!o)throw new Error("Assert failed: fully_qualified_name must be string");b.diagnosticTracing&&console.debug(`MONO_WASM: Binding [JSExport] ${o}`);const{assembly:s,namespace:u,classname:l,methodname:f}=Hs(o),_=be(s);if(!_)throw new Error("Could not find assembly: "+s);const d=M.mono_wasm_assembly_find_class(_,u,l);if(!d)throw new Error("Could not find class: "+u+":"+l+" in assembly "+s);const m=`__Wrapper_${f}_${t}`,g=M.mono_wasm_assembly_find_method(d,m,-1);if(!g)throw new Error(`Could not find method: ${m} in ${d} [${s}]`);const w={method:g,signature:n,stackSave:c.stackSave,stackRestore:c.stackRestore,alloc_stack_frame:Sn,invoke_method_and_handle_exception:Ws},h="_bound_cs_"+`${u}_${l}_${f}`.replace(/\./g,"_").replace(/\//g,"_");let p=`//# sourceURL=https://dotnet.generated.invalid/${h} \n`,y="",v="";for(let e=0;e{const o=e.stackSave();try{const s=Sn(4),i=On(s,1),a=On(s,2),c=On(s,3);Lr(a,t),n&&0==n.length&&(n=void 0),oo(c,n,wr.String),Ws(r,s);const u=So(i,void 0,go);return u||Promise.resolve(0)}finally{e.stackRestore(o)}},b.javaScriptExports.release_js_owned_object_by_gc_handle=t=>{if(!t)throw new Error("Assert failed: Must be valid gc_handle");const n=e.stackSave();try{const r=Sn(3),o=On(r,2);Cn(o,wr.Object),lr(o,t),Ws(s,r)}finally{e.stackRestore(n)}},b.javaScriptExports.create_task_callback=()=>{const t=e.stackSave();try{const n=Sn(2);Ws(i,n);const r=undefined;return ur(On(n,1))}finally{e.stackRestore(t)}},b.javaScriptExports.complete_task=(t,n,r,o)=>{const s=e.stackSave();try{const i=Sn(5),c=On(i,2);Cn(c,wr.Object),lr(c,t);const u=On(i,3);if(n)eo(u,n);else{Cn(u,wr.None);const e=On(i,4);if(!o)throw new Error("Assert failed: res_converter missing");o(e,r)}Ws(a,i)}finally{e.stackRestore(s)}},b.javaScriptExports.call_delegate=(t,n,r,o,s,i,a,u)=>{const l=e.stackSave();try{const f=Sn(6),_=On(f,2);if(Cn(_,wr.Object),lr(_,t),i){const e=undefined;i(On(f,3),n)}if(a){const e=undefined;a(On(f,4),r)}if(u){const e=undefined;u(On(f,5),o)}if(Ws(c,f),s){const e=undefined;return s(On(f,1))}}finally{e.stackRestore(l)}},b.javaScriptExports.get_managed_stack_trace=t=>{const n=e.stackSave();try{const r=Sn(3),o=On(r,2);Cn(o,wr.Exception),lr(o,t),Ws(u,r);const s=undefined;return xo(On(r,1))}finally{e.stackRestore(n)}},n&&(b.javaScriptExports.install_synchronization_context=()=>{const t=e.stackSave();try{const r=Sn(2);Ws(n,r)}finally{e.stackRestore(t)}},f||b.javaScriptExports.install_synchronization_context())}function Ls(e){const t=M.mono_wasm_assembly_find_method(b.runtime_interop_exports_class,e,-1);if(!t)throw"Can't find method "+b.runtime_interop_namespace+"."+b.runtime_interop_exports_classname+"."+e;return t}function Js(e,t,n,r,o,s,i){const a=ln(i);try{const s=undefined;Qs(qs(e,t,n,r,o),a,true)}catch(e){Us(s,String(e),a)}finally{a.release()}}function qs(e,t,n,r,o){let s=null;switch(o){case 5:s=new Int8Array(n-t);break;case 6:s=new Uint8Array(n-t);break;case 7:s=new Int16Array(n-t);break;case 8:s=new Uint16Array(n-t);break;case 9:s=new Int32Array(n-t);break;case 10:s=new Uint32Array(n-t);break;case 13:s=new Float32Array(n-t);break;case 14:s=new Float64Array(n-t);break;case 15:s=new Uint8ClampedArray(n-t);break;default:throw new Error("Unknown array type "+o)}return Gs(s,e,t,n,r),s}function Gs(e,t,n,r,s){if(Ys(e)&&e.BYTES_PER_ELEMENT){if(s!==e.BYTES_PER_ELEMENT)throw new Error("Inconsistent element sizes: TypedArray.BYTES_PER_ELEMENT '"+e.BYTES_PER_ELEMENT+"' sizeof managed element: '"+s+"'");let i=(r-n)*s;const a=e.length*e.BYTES_PER_ELEMENT;i>a&&(i=a);const c=undefined,u=n*s;return new Uint8Array(e.buffer,0,i).set(o.HEAPU8.subarray(t+u,t+u+i)),i}throw new Error("Object '"+e+"' is not a typed array")}function Ys(e){return"undefined"!==typeof SharedArrayBuffer?e.buffer instanceof ArrayBuffer||e.buffer instanceof SharedArrayBuffer:e.buffer instanceof ArrayBuffer}function Zs(e,t,n){switch(true){case null===t:case"undefined"===typeof t:return n.clear(),void 0;case"symbol"===typeof t:case"string"===typeof t:return Xi._create_uri_ref(t,n.address),void 0;default:return Ks(e,t,n),void 0}}function Xs(e){const t=fn();try{return Qs(e,t,false),t.value}finally{t.release()}}function Qs(e,t,n){if(T(t))throw new Error("Expected (value, WasmRoot, boolean)");switch(true){case null===e:case"undefined"===typeof e:return t.clear(),void 0;case"number"===typeof e:{let n;return(0|e)===e?(Rt(Uo._box_buffer,e),n=Uo._class_int32):e>>>0===e?($t(Uo._box_buffer,e),n=Uo._class_uint32):(Wt(Uo._box_buffer,e),n=Uo._class_double),M.mono_wasm_box_primitive_ref(n,Uo._box_buffer,8,t.address),void 0}case"string"===typeof e:return kr(e,t),void 0;case"symbol"===typeof e:return Nr(e,t),void 0;case"boolean"===typeof e:return Ot(Uo._box_buffer,e),M.mono_wasm_box_primitive_ref(Uo._class_boolean,Uo._box_buffer,4,t.address),void 0;case true===ft(e):return si(e,t),void 0;case"Date"===e.constructor.name:return Xi._create_date_time_ref(e.getTime(),t.address),void 0;default:return Ks(n,e,t),void 0}}function Ks(e,t,n){if(n.clear(),null!==t&&"undefined"!==typeof t){if(void 0!==t[Ge]){const e=undefined;return Ei(nt(t),n.address),void 0}if(t[Ye]&&(ai(t[Ye],e,n.address),n.value||delete t[Ye]),!n.value){const r=t[Po],o="undefined"===typeof r?0:r,s=Qe(t);Xi._create_cs_owned_proxy_ref(s,o,e?1:0,n.address)}}}function ei(e){const t=e.length*e.BYTES_PER_ELEMENT,n=o._malloc(t),r=new Uint8Array(o.HEAPU8.buffer,n,t);return r.set(new Uint8Array(e.buffer,e.byteOffset,t)),r}function ti(e,t){if(!Ys(e)||!e.BYTES_PER_ELEMENT)throw new Error("Object '"+e+"' is not a typed array");{const n=e[Po],r=ei(e);M.mono_wasm_typed_array_new_ref(r.byteOffset,e.length,e.BYTES_PER_ELEMENT,n,t.address),o._free(r.byteOffset)}}function ni(e){const t=fn();try{return ti(e,t),t.value}finally{t.release()}}function ri(e,t,n){if("number"!==typeof e)throw new Error(`Expected numeric value for enum argument, got '${e}'`);return 0|e}function oi(e,t,n){const r=fn();t?M.mono_wasm_string_array_new_ref(e.length,r.address):M.mono_wasm_obj_array_new_ref(e.length,r.address);const o=fn(0),s=r.address,i=o.address;try{for(let r=0;r{Xi._set_tcs_result_ref(r,e)}),(e=>{Xi._set_tcs_failure(r,e?e.toString():"")})).finally((()=>{Ke(n),tt(o,r)})),Xi._get_tcs_task_ref(r,t.address),{then_js_handle:n}}function ii(e,t,n){const r=ln(n);try{const n=Ze(e);if(T(n))return Us(t,"ERR06: Invalid JS object handle '"+e+"'",r),void 0;ti(n,r)}catch(e){Us(t,String(e),r)}finally{r.release()}}function ai(e,t,n){if(0===e||e===x)return Rt(n,0),void 0;Xi._get_cs_owned_object_by_js_handle_ref(e,t?1:0,n)}const ci=Symbol.for("wasm delegate_invoke");function ui(e){if(0===e)return;const t=fn(e);try{return di(t)}finally{t.release()}}function li(e){const t=undefined,n=undefined;return Ze(Xi._get_cs_owned_object_js_handle_ref(e.address,0))}function fi(e,t,n,r){switch(t){case 0:return null;case 26:case 27:throw new Error("int64 not available");case 3:case 29:return xr(e);case 4:throw new Error("no idea on how to unbox value types");case 5:return hi(e);case 6:return yi(e);case 7:return vi(e);case 10:case 11:case 12:case 13:case 14:case 15:case 16:case 17:case 18:throw new Error("Marshaling of primitive arrays are not supported.");case 20:return new Date(Xi._get_date_value_ref(e.address));case 21:return Xi._object_to_string_ref(e.address);case 22:return Xi._object_to_string_ref(e.address);case 23:return li(e);case 30:return;default:throw new Error(`no idea on how to unbox object of MarshalType ${t} at offset ${e.value} (root address is ${e.address})`)}}function _i(e,t,n){if(t>=512)throw new Error(`Got marshaling error ${t} when attempting to unbox object at address ${e.value} (root located at ${e.address})`);let r=0;if((4===t||7==t)&&(r=Ht(n),r<1024))throw new Error(`Got invalid MonoType ${r} for object at address ${e.value} (root located at ${e.address})`);return fi(e,t)}function di(e){if(0===e.value)return;const t=Uo._unbox_buffer,n=M.mono_wasm_try_unbox_primitive_and_get_type_ref(e.address,t,Uo._unbox_buffer_size);switch(n){case 1:return Jt(t);case 25:return Ht(t);case 32:return Ht(t);case 24:return Zt(t);case 2:return Xt(t);case 8:return 0!==Jt(t);case 28:return String.fromCharCode(Jt(t));case 0:return null;default:return _i(e,n,t)}}function mi(e){if(0===e)return null;const t=fn(e);try{return wi(t)}finally{t.release()}}function gi(e){return Xi._is_simple_array_ref(e.address)}function wi(e){if(0===e.value)return null;const t=e.address,n=fn(),r=n.address;try{const o=M.mono_wasm_array_length(e.value),s=new Array(o);for(let e=0;ett(n,t),{promise:o,promise_control:s}=it(r,r);n=o,Xi._setup_js_cont_ref(e.address,s),et(n,t)}return n}function vi(e){if(0===e.value)return null;const t=Xi._try_get_cs_owned_object_js_handle_ref(e.address,0);if(t){if(t===x)throw new Error("Cannot access a disposed JSObject at "+e.value);return Ze(t)}const n=Xi._get_js_owned_object_gc_handle_ref(e.address);let r=ot(n);return T(r)&&(r=new ManagedObject,et(r,n)),r}function Ei(e,t){if(!e)return Rt(t,0),void 0;Xi._get_js_owned_object_by_gc_handle_ref(e,t)}const Ai=new Map;function Si(e,t,n,r,s,i,a){Et(),o.stackRestore(a),"object"===typeof r&&(r.clear(),null!==t&&null===t.scratchResultRoot?t.scratchResultRoot=r:r.release()),"object"===typeof s&&(s.clear(),null!==t&&null===t.scratchExceptionRoot?t.scratchExceptionRoot=s:s.release()),"object"===typeof i&&(i.clear(),null!==t&&null===t.scratchThisArgRoot?t.scratchThisArgRoot=i:i.release())}function Oi(e,t){if(!b.mono_wasm_bindings_is_ready)throw new Error("Assert failed: The runtime must be initialized.");const n=`${e}-${t}`;let r=Ai.get(n);if(void 0===r){const o=Gi(e);"undefined"===typeof t&&(t=Yi(o,void 0)),r=Li(o,t,false,e),Ai.set(n,r)}return r}function xi(e,t){const n=Me(e);"string"!==typeof t&&(t=Yi(n,void 0));const r=Li(n,t,false,"_"+e+"__entrypoint");return async function(...e){return e.length>0&&Array.isArray(e[0])&&(e[0]=oi(e[0],true,false)),r(...e)}}function ji(e,t,n){if(!b.mono_wasm_bindings_is_ready)throw new Error("Assert failed: The runtime must be initialized.");return t||(t=[[]]),xi(e,n)(...t)}function $i(e,t,n,r,o){const s=ln(n),i=ln(t),a=ln(o);try{const t=xr(i);if(!t||"string"!==typeof t)return Us(r,"ERR12: Invalid method name object @"+i.value,a),void 0;const n=Xe(e);if(T(n))return Us(r,"ERR13: Invalid JS object handle '"+e+"' while invoking '"+t+"'",a),void 0;const o=wi(s);try{const e=n[t];if("undefined"===typeof e)throw new Error("Method: '"+t+"' not found for: '"+Object.prototype.toString.call(n)+"'");const r=undefined;Qs(e.apply(n,o),a,true)}catch(e){Us(r,e,a)}}finally{s.release(),i.release(),a.release()}}function Ni(e,t,n,r){const o=ln(t),s=ln(r);try{const t=xr(o);if(!t)return Us(n,"Invalid property name object '"+o.value+"'",s),void 0;const r=Ze(e);if(T(r))return Us(n,"ERR01: Invalid JS object handle '"+e+"' while geting '"+t+"'",s),void 0;const i=undefined;Qs(r[t],s,true)}catch(e){Us(n,e,s)}finally{s.release(),o.release()}}function ki(e,t,n,r,o,s,i){const a=ln(n),c=ln(t),u=ln(i);try{const n=xr(c);if(!n)return Us(s,"Invalid property name object '"+t+"'",u),void 0;const i=Ze(e);if(T(i))return Us(s,"ERR02: Invalid JS object handle '"+e+"' while setting '"+n+"'",u),void 0;let l=false;const f=di(a);if(r)i[n]=f,l=true;else{if(l=false,!r&&!Object.prototype.hasOwnProperty.call(i,n))return Qs(false,u,false),void 0;true===o?Object.prototype.hasOwnProperty.call(i,n)&&(i[n]=f,l=true):(i[n]=f,l=true)}Qs(l,u,false)}catch(e){Us(s,e,u)}finally{u.release(),c.release(),a.release()}}function Ti(e,t,n,r){const o=ln(r);try{const r=Ze(e);if(T(r))return Us(n,"ERR03: Invalid JS object handle '"+e+"' while getting ["+t+"]",o),void 0;const s=undefined;Qs(r[t],o,true)}catch(e){Us(n,e,o)}finally{o.release()}}function Ri(e,t,n,r,o){const s=ln(n),i=ln(o);try{const n=Ze(e);if(T(n))return Us(r,"ERR04: Invalid JS object handle '"+e+"' while setting ["+t+"]",i),void 0;const o=di(s);n[t]=o,i.clear()}catch(e){Us(r,e,i)}finally{i.release(),s.release()}}function Mi(e,t,n){const r=ln(e),i=ln(n);try{const e=xr(r);let n;if(n=e?"Module"==e?o:"INTERNAL"==e?s:globalThis[e]:globalThis,null===n||void 0===typeof n)return Us(t,"Global object '"+e+"' not found.",i),void 0;Qs(n,i,true)}catch(e){Us(t,e,i)}finally{i.release(),r.release()}}function Ii(e,t,n,r,o){try{const e=globalThis.Blazor;if(!e)throw new Error("The blazor.webassembly.js library is not loaded.");return e._internal.invokeJSFromDotNet(t,n,r,o)}catch(t){const n=t.message+"\n"+t.stack,r=fn();return kr(n,r),r.copy_to_address(e),r.release(),0}}const Di=/[^A-Za-z0-9_$]/g,Ui=new Map,Ci=new Map,Pi=new Map;function Wi(e,t,n,r){let o=null,s=null,i=null;if(r){i=Object.keys(r),s=new Array(i.length);for(let e=0,t=i.length;e{e&&"AbortError"!==e.name&&o.printErr("MONO_WASM: Error in http_wasm_abort_response: "+e)}))}function sa(e,t,n,r,o,s,i,a){const c=undefined,u=undefined;return ia(e,t,n,r,o,s,new Span(i,a,0).slice())}function ia(e,t,n,r,o,s,i){if(!(e&&"string"===typeof e))throw new Error("Assert failed: expected url string");if(!(t&&n&&Array.isArray(t)&&Array.isArray(n)&&t.length===n.length))throw new Error("Assert failed: expected headerNames and headerValues arrays");if(!(r&&o&&Array.isArray(r)&&Array.isArray(o)&&r.length===o.length))throw new Error("Assert failed: expected headerNames and headerValues arrays");const a=new Headers;for(let e=0;e{const t=await fetch(e,c);return t.__abort_controller=s,t}))}function aa(e){if(!e.__headerNames){e.__headerNames=[],e.__headerValues=[];const t=e.headers.entries();for(const n of t)e.__headerNames.push(n[0]),e.__headerValues.push(n[1])}}function ca(e){return aa(e),e.__headerNames}function ua(e){return aa(e),e.__headerValues}function la(e){return _t((async()=>{const t=await e.arrayBuffer();return e.__buffer=t,e.__source_offset=0,t.byteLength}))}function fa(e,t){if(!e.__buffer)throw new Error("Assert failed: expected resoved arrayBuffer");if(e.__source_offset==e.__buffer.byteLength)return 0;const n=new Uint8Array(e.__buffer,e.__source_offset);t.set(n,0);const r=Math.min(t.byteLength,n.byteLength);return e.__source_offset+=r,r}function _a(e,t,n){const r=new Span(t,n,0);return _t((async()=>{if(e.__reader||(e.__reader=e.body.getReader()),e.__chunk||(e.__chunk=await e.__reader.read(),e.__source_offset=0),e.__chunk.done)return 0;const t=e.__chunk.value.byteLength-e.__source_offset;if(!(t>0))throw new Error("Assert failed: expected remaining_source to be greater than 0");const n=Math.min(t,r.byteLength),o=e.__chunk.value.subarray(e.__source_offset,e.__source_offset+n);return r.set(o,0),e.__source_offset+=n,t==n&&(e.__chunk=void 0),n}))}let da=0,ma=false,ga=0,wa;if(globalThis.navigator){const e=globalThis.navigator;e.userAgentData&&e.userAgentData.brands?ma=e.userAgentData.brands.some((e=>"Chromium"==e.brand)):e.userAgent&&(ma=e.userAgent.includes("Chrome"))}function ha(){for(;ga>0;)--ga,M.mono_background_exec()}function pa(){if(!ma)return;const e=(new Date).valueOf(),t=e+36e4,n=undefined,r=1e3;for(let n=Math.max(e+1e3,da);n{M.mono_set_timeout_exec(),ga++,ha()}),n-e)}da=t}function ba(){++ga,setTimeout(ha,0)}function ya(e){function mono_wasm_set_timeout_exec(){M.mono_set_timeout_exec()}wa&&(clearTimeout(wa),wa=void 0),wa=setTimeout(mono_wasm_set_timeout_exec,e)}class va{constructor(){this.queue=[],this.offset=0}getLength(){return this.queue.length-this.offset}isEmpty(){return 0==this.queue.length}enqueue(e){this.queue.push(e)}dequeue(){if(0===this.queue.length)return;const e=this.queue[this.offset];return this.queue[this.offset]=null,2*++this.offset>=this.queue.length&&(this.queue=this.queue.slice(this.offset),this.offset=0),e}peek(){return this.queue.length>0?this.queue[this.offset]:void 0}drain(e){for(;this.getLength();){const t=undefined;e(this.dequeue())}}}const Ea=Symbol.for("wasm ws_pending_send_buffer"),Aa=Symbol.for("wasm ws_pending_send_buffer_offset"),Sa=Symbol.for("wasm ws_pending_send_buffer_type"),Oa=Symbol.for("wasm ws_pending_receive_event_queue"),xa=Symbol.for("wasm ws_pending_receive_promise_queue"),ja=Symbol.for("wasm ws_pending_open_promise"),$a=Symbol.for("wasm ws_pending_close_promises"),Na=Symbol.for("wasm ws_pending_send_promises"),ka=Symbol.for("wasm ws_is_aborted"),Ta=Symbol.for("wasm ws_receive_status_ptr");let Ra=false,Ma,Ia;const Da=65536,Ua=new Uint8Array;function Ca(e,t,n,r){if(!(e&&"string"===typeof e))throw new Error("Assert failed: ERR12: Invalid uri "+typeof e);const o=new globalThis.WebSocket(e,t||void 0),{promise_control:s}=it();o[Oa]=new va,o[xa]=new va,o[ja]=s,o[Na]=[],o[$a]=[],o[Ta]=n,o.binaryType="arraybuffer";const i=()=>{o[ka]||(s.resolve(o),pa())},a=e=>{o[ka]||(za(o,e),pa())},c=e=>{if(o.removeEventListener("message",a),o[ka])return;r&&r(e.code,e.reason),s.reject(e.reason);for(const e of o[$a])e.resolve();const t=undefined;o[xa].drain((e=>{Mt(n,0),Mt(n+4,2),Mt(n+8,1),e.resolve()}))},u=e=>{s.reject(e.message||"WebSocket error")};return o.addEventListener("message",a),o.addEventListener("open",i,{once:true}),o.addEventListener("close",c,{once:true}),o.addEventListener("error",u,{once:true}),o}function Pa(e){if(!!!e)throw new Error("Assert failed: ERR17: expected ws instance");const t=undefined;return e[ja].promise}function Wa(e,t,n,r,s){if(!!!e)throw new Error("Assert failed: ERR17: expected ws instance");const i=undefined,a=Ja(e,new Uint8Array(o.HEAPU8.buffer,t,n),r,s);return s&&a?Ha(e,a):null}function Fa(e,t,n){if(!!!e)throw new Error("Assert failed: ERR18: expected ws instance");const r=e[Oa],o=e[xa],s=e.readyState;if(s!=WebSocket.OPEN&&s!=WebSocket.CLOSING)throw new Error("InvalidState: The WebSocket is not connected.");if(r.getLength()){if(!(0==o.getLength()))throw new Error("Assert failed: ERR20: Invalid WS state");return La(e,r,t,n),null}const{promise:i,promise_control:a}=it(),c=a;return c.buffer_ptr=t,c.buffer_length=n,o.enqueue(c),i}function Ba(e,t,n,r){if(!!!e)throw new Error("Assert failed: ERR19: expected ws instance");if(e.readyState==WebSocket.CLOSED)return null;if(r){const{promise:r,promise_control:o}=it();return e[$a].push(o),"string"===typeof n?e.close(t,n):e.close(t),r}return Ra||(Ra=true,console.warn("WARNING: Web browsers do not support closing the output side of a WebSocket. CloseOutputAsync has closed the socket and discarded any incoming messages.")),"string"===typeof n?e.close(t,n):e.close(t),null}function Va(e){if(!!!e)throw new Error("Assert failed: ERR18: expected ws instance");e[ka]=true;const t=e[ja];t&&t.reject("OperationCanceledException");for(const t of e[$a])t.reject("OperationCanceledException");for(const t of e[Na])t.reject("OperationCanceledException");e[xa].drain((e=>{e.reject("OperationCanceledException")})),e.close(1e3,"Connection was aborted.")}function Ha(e,t){if(e.send(t),e[Ea]=null,e.bufferedAmount{if(0===e.bufferedAmount)r.resolve();else if(e.readyState!=WebSocket.OPEN)r.reject("InvalidState: The WebSocket is not connected.");else if(!r.isDone)return globalThis.setTimeout(i,s),s=Math.min(1.5*s,1e3),void 0;const t=o.indexOf(r);t>-1&&o.splice(t,1)};return globalThis.setTimeout(i,0),n}function za(e,t){const n=e[Oa],r=e[xa];if("string"===typeof t.data)void 0===Ia&&(Ia=new TextEncoder),n.enqueue({type:0,data:Ia.encode(t.data),offset:0});else{if("ArrayBuffer"!==t.data.constructor.name)throw new Error("ERR19: WebSocket receive expected ArrayBuffer");n.enqueue({type:1,data:new Uint8Array(t.data),offset:0})}if(r.getLength()&&n.getLength()>1)throw new Error("ERR21: Invalid WS state");for(;r.getLength()&&n.getLength();){const t=r.dequeue();La(e,n,t.buffer_ptr,t.buffer_length),t.resolve()}pa()}function La(e,t,n,r){const s=t.peek(),i=Math.min(r,s.data.length-s.offset);if(i>0){const e=s.data.subarray(s.offset,s.offset+i),t=undefined;new Uint8Array(o.HEAPU8.buffer,n,r).set(e,0),s.offset+=i}const a=s.data.length===s.offset?1:0;a&&t.dequeue();const c=e[Ta];Mt(c,i),Mt(c+4,s.type),Mt(c+8,a)}function Ja(e,t,n,r){let o=e[Ea],s=0;const i=t.byteLength;if(o){if(s=e[Aa],n=e[Sa],0!==i){if(s+i>o.length){const n=new Uint8Array(1.5*(s+i+50));n.set(o,0),n.subarray(s).set(t),e[Ea]=o=n}else o.subarray(s).set(t);s+=i,e[Aa]=s}}else r?0!==i&&(o=t,s=i):(0!==i&&(o=t.slice(),s=i,e[Aa]=s,e[Ea]=o),e[Sa]=n);if(r){if(0==s||null==o)return Ua;if(0===n){void 0===Ma&&(Ma=new TextDecoder("utf-8",{fatal:false}));const e="undefined"!==typeof SharedArrayBuffer&&o instanceof SharedArrayBuffer?o.slice(0,s):o.subarray(0,s);return Ma.decode(e)}return o.subarray(0,s)}return null}function qa(){return{mono_wasm_exit:e=>{o.printErr("MONO_WASM: early exit "+e)},mono_wasm_enable_on_demand_gc:M.mono_wasm_enable_on_demand_gc,mono_profiler_init_aot:M.mono_profiler_init_aot,mono_wasm_exec_regression:M.mono_wasm_exec_regression,mono_method_resolve:Gi,mono_intern_string:jr,logging:void 0,mono_wasm_stringify_as_error_with_stack:xe,mono_wasm_get_loaded_files:ls,mono_wasm_send_dbg_command_with_parms:q,mono_wasm_send_dbg_command:G,mono_wasm_get_dbg_command_info:Y,mono_wasm_get_details:ie,mono_wasm_release_object:ce,mono_wasm_call_function_on:oe,mono_wasm_debugger_resume:Z,mono_wasm_detach_debugger:X,mono_wasm_raise_debug_event:K,mono_wasm_change_debugger_log_level:Q,mono_wasm_debugger_attached:te,mono_wasm_runtime_is_ready:b.mono_wasm_runtime_is_ready,get_property:$s,set_property:js,has_property:Ns,get_typeof_property:ks,get_global_this:Ts,get_dotnet_instance:()=>_,dynamic_import:Is,mono_wasm_cancel_promise:dt,ws_wasm_create:Ca,ws_wasm_open:Pa,ws_wasm_send:Wa,ws_wasm_receive:Fa,ws_wasm_close:Ba,ws_wasm_abort:Va,http_wasm_supports_streaming_response:ta,http_wasm_create_abort_controler:na,http_wasm_abort_request:ra,http_wasm_abort_response:oa,http_wasm_fetch:ia,http_wasm_fetch_bytes:sa,http_wasm_get_response_header_names:ca,http_wasm_get_response_header_values:ua,http_wasm_get_response_bytes:fa,http_wasm_get_response_length:la,http_wasm_get_streamed_response_bytes:_a}}function Ga(e){Object.assign(e,{mono_wasm_exit:M.mono_wasm_exit,mono_wasm_enable_on_demand_gc:M.mono_wasm_enable_on_demand_gc,mono_profiler_init_aot:M.mono_profiler_init_aot,mono_wasm_exec_regression:M.mono_wasm_exec_regression})}function Ya(){return{mono_wasm_setenv:xc,mono_wasm_load_bytes_into_heap:tn,mono_wasm_load_icu_data:fe,mono_wasm_runtime_ready:mono_wasm_runtime_ready,mono_wasm_load_data_archive:cs,mono_wasm_load_config:Rc,mono_load_runtime_and_bcl_args:Dc,mono_wasm_new_root_buffer:un,mono_wasm_new_root:fn,mono_wasm_new_external_root:ln,mono_wasm_release_roots:_n,mono_run_main:Re,mono_run_main_and_exit:Te,mono_wasm_add_assembly:null,mono_wasm_load_runtime:kc,config:b.config,loaded_files:[],setB32:Ot,setI8:kt,setI16:Tt,setI32:Mt,setI52:Dt,setU52:Ut,setI64Big:Ct,setU8:xt,setU16:jt,setU32:Nt,setF32:Pt,setF64:Wt,getB32:Ft,getI8:zt,getI16:Lt,getI32:Jt,getI52:qt,getU52:Gt,getI64Big:Yt,getU8:Bt,getU16:Vt,getU32:Ht,getF32:Zt,getF64:Xt}}function Za(e){Object.assign(e,{mono_wasm_add_assembly:M.mono_wasm_add_assembly})}function Xa(){return{bind_static_method:Oi,call_assembly_entry_point:ji,mono_obj_array_new:null,mono_obj_array_set:null,js_string_to_mono_string:Mr,js_typed_array_to_array:ni,mono_array_to_js_array:mi,js_to_mono_obj:Xs,conv_string:Or,unbox_mono_obj:ui,mono_obj_array_new_ref:null,mono_obj_array_set_ref:null,js_string_to_mono_string_root:kr,js_typed_array_to_array_root:ti,js_to_mono_obj_root:Qs,conv_string_root:xr,unbox_mono_obj_root:di,mono_array_root_to_js_array:wi}}function Qa(e){Object.assign(e,{mono_obj_array_new:M.mono_wasm_obj_array_new,mono_obj_array_set:M.mono_wasm_obj_array_set,mono_obj_array_new_ref:M.mono_wasm_obj_array_new_ref,mono_obj_array_set_ref:M.mono_wasm_obj_array_set_ref})}function Ka(){}async function ec(){return console.warn("MONO_WASM: ignoring diagnostics options because this runtime does not support diagnostics"),void 0}let tc,nc=false,rc=false;const oc=it(),sc=it(),ic=it(),ac=it(),cc=it(),uc=it(),lc=it(),fc=it(),_c=it();function dc(e,t){const n=e.instantiateWasm,r=e.preInit?"function"===typeof e.preInit?[e.preInit]:e.preInit:[],o=e.preRun?"function"===typeof e.preRun?[e.preRun]:e.preRun:[],s=e.postRun?"function"===typeof e.postRun?[e.postRun]:e.postRun:[],i=e.onRuntimeInitialized?e.onRuntimeInitialized:()=>{};rc=!e.configSrc&&(!e.config||!e.config.assets||-1==e.config.assets.findIndex((e=>"assembly"===e.behavior))),e.instantiateWasm=(e,t)=>mc(e,t,n),e.preInit=[()=>gc(r)],e.preRun=[()=>wc(o)],e.onRuntimeInitialized=()=>hc(i),e.postRun=[()=>pc(s)],e.ready.then((async()=>{await _c.promise,oc.promise_control.resolve(t)})).catch((e=>{oc.promise_control.reject(e)})),e.ready=oc.promise,e.onAbort||(e.onAbort=()=>Ie)}function mc(e,t,n){if(o.configSrc||o.config||n||o.print("MONO_WASM: configSrc nor config was specified"),tc=o.config?b.config=o.config:b.config=o.config={},b.diagnosticTracing=!!tc.diagnosticTracing,n){const r=undefined;return n(e,((e,n)=>{ic.promise_control.resolve(),t(e,n)}))}return $c(e,t),[]}function gc(e){o.addRunDependency("mono_pre_init");try{yc(),b.diagnosticTracing&&console.debug("MONO_WASM: preInit"),ac.promise_control.resolve(),e.forEach((e=>e()))}catch(e){throw Oc("MONO_WASM: user preInint() failed",e),bc(e,true),e}(async()=>{try{await vc(),rc||await Ec()}catch(e){throw bc(e,true),e}cc.promise_control.resolve(),o.removeRunDependency("mono_pre_init")})()}async function wc(e){o.addRunDependency("mono_pre_run_async"),await ic.promise,await cc.promise,b.diagnosticTracing&&console.debug("MONO_WASM: preRunAsync");try{e.map((e=>e()))}catch(e){throw Oc("MONO_WASM: user callback preRun() failed",e),bc(e,true),e}uc.promise_control.resolve(),o.removeRunDependency("mono_pre_run_async")}async function hc(e){await uc.promise,b.diagnosticTracing&&console.debug("MONO_WASM: onRuntimeInitialized"),lc.promise_control.resolve();try{rc||(await us(),await Ac()),tc.runtimeOptions&&jc(tc.runtimeOptions);try{e()}catch(e){throw Oc("MONO_WASM: user callback onRuntimeInitialized() failed",e),e}await Sc()}catch(e){throw Oc("MONO_WASM: onRuntimeInitializedAsync() failed",e),bc(e,true),e}fc.promise_control.resolve()}async function pc(e){await fc.promise,b.diagnosticTracing&&console.debug("MONO_WASM: postRunAsync");try{e.map((e=>e()))}catch(e){throw Oc("MONO_WASM: user callback posRun() failed",e),bc(e,true),e}_c.promise_control.resolve()}function bc(e,t){b.diagnosticTracing&&console.trace("MONO_WASM: abort_startup"),oc.promise_control.reject(e),ic.promise_control.reject(e),ac.promise_control.reject(e),cc.promise_control.reject(e),uc.promise_control.reject(e),lc.promise_control.reject(e),fc.promise_control.reject(e),_c.promise_control.reject(e),t&&De(1,e)}function yc(){o.addRunDependency("mono_wasm_pre_init_essential"),b.diagnosticTracing&&console.debug("MONO_WASM: mono_wasm_pre_init_essential"),I(),Ga(s),Za(Io),Qa(Do),o.removeRunDependency("mono_wasm_pre_init_essential")}async function vc(){b.diagnosticTracing&&console.debug("MONO_WASM: mono_wasm_pre_init_essential_async"),o.addRunDependency("mono_wasm_pre_init_essential_async"),await ms(),await Rc(o.configSrc),o.removeRunDependency("mono_wasm_pre_init_essential_async")}async function Ec(){b.diagnosticTracing&&console.debug("MONO_WASM: mono_wasm_pre_init_full"),o.addRunDependency("mono_wasm_pre_init_full"),await es(),o.removeRunDependency("mono_wasm_pre_init_full")}async function Ac(){b.diagnosticTracing&&console.debug("MONO_WASM: mono_wasm_before_user_runtime_initialized");try{await Nc(),de(),b.mono_wasm_load_runtime_done||kc("unused",tc.debugLevel),b.mono_wasm_runtime_is_ready||mono_wasm_runtime_ready(),b.mono_wasm_symbols_are_ready||ke("dotnet.js.symbols"),setTimeout((()=>{Ar.init_fields()}))}catch(e){throw Oc("MONO_WASM: Error in mono_wasm_before_user_runtime_initialized",e),e}}async function Sc(){b.diagnosticTracing&&console.debug("MONO_WASM: mono_wasm_after_user_runtime_initialized");try{if(!o.disableDotnet6Compatibility&&o.exports){const e=globalThis;for(let t=0;tb.config,setHeapB32:Ot,setHeapU8:xt,setHeapU16:jt,setHeapU32:Nt,setHeapI8:kt,setHeapI16:Tt,setHeapI32:Mt,setHeapI52:Dt,setHeapU52:Ut,setHeapI64Big:Ct,setHeapF32:Pt,setHeapF64:Wt,getHeapB32:Ft,getHeapU8:Bt,getHeapU16:Vt,getHeapU32:Ht,getHeapI8:zt,getHeapI16:Lt,getHeapI32:Jt,getHeapI52:qt,getHeapU52:Gt,getHeapI64Big:Yt,getHeapF32:Zt,getHeapF64:Xt}}function Hc(){const e=undefined;return{dotnet:Bc,exit:De}}const zc=Jc,Lc=Gc;function Jc(n,o,s,i){const a=o.module,c=globalThis;g(n,o),Co(o),ds(s),Object.assign(o.mono,Ya()),Object.assign(o.binding,Xa()),Object.assign(o.internal,qa()),Object.assign(o.internal,qa());const u=Vc();if(e.__linker_exports=Wc(),Object.assign(_,{MONO:o.mono,BINDING:o.binding,INTERNAL:o.internal,IMPORTS:o.marshaled_imports,Module:a,runtimeBuildInfo:{productVersion:t,buildConfiguration:r},...u}),Object.assign(i,u),o.module.__undefinedConfig&&(a.disableDotnet6Compatibility=true,a.configSrc="./mono-config.json"),a.print||(a.print=console.log.bind(console)),a.printErr||(a.printErr=console.error.bind(console)),"undefined"===typeof a.disableDotnet6Compatibility&&(a.disableDotnet6Compatibility=true),n.isGlobal||!a.disableDotnet6Compatibility){Object.assign(a,_),a.mono_bind_static_method=(e,t)=>(console.warn("MONO_WASM: Module.mono_bind_static_method is obsolete, please use [JSExportAttribute] interop instead"),Oi(e,t));const e=(e,t)=>{if("undefined"!==typeof c[e])return;let n;Object.defineProperty(globalThis,e,{get:()=>{if(T(n)){const r=(new Error).stack,o=r?r.substr(r.indexOf("\n",8)+1):"";console.warn(`MONO_WASM: global ${e} is obsolete, please use Module.${e} instead ${o}`),n=t()}return n}})};c.MONO=o.mono,c.BINDING=o.binding,c.INTERNAL=o.internal,n.isGlobal||(c.Module=a),e("cwrap",(()=>a.cwrap)),e("addRunDependency",(()=>a.addRunDependency)),e("removeRunDependency",(()=>a.removeRunDependency))}let l;return c.getDotnetRuntime?l=c.getDotnetRuntime.__list:(c.getDotnetRuntime=e=>c.getDotnetRuntime.__list.getRuntime(e),c.getDotnetRuntime.__list=l=new qc),l.registerRuntime(_),dc(a,_),_}e.__linker_exports=null;class qc{constructor(){this.list={}}registerRuntime(e){return e.runtimeId=Object.keys(this.list).length,this.list[e.runtimeId]=Be(e),e.runtimeId}getRuntime(e){const t=this.list[e];return t?t.deref():void 0}}function Gc(e,t){w(t),Object.assign(d,Hc()),h(e)}return e.__initializeImportsAndExports=zc,e.__setEmscriptenEntrypoint=Lc,e.moduleExports=d,Object.defineProperty(e,"__esModule",{value:true}),e}({});
+
+var createDotnetRuntime = (() => {
+ var _scriptDir = import.meta.url;
+
+ return (
+function(createDotnetRuntime) {
+ createDotnetRuntime = createDotnetRuntime || {};
+
+
+
+"use strict";
+
+// The Module object: Our interface to the outside world. We import
+// and export values on it. There are various ways Module can be used:
+// 1. Not defined. We create it here
+// 2. A function parameter, function(Module) { ..generated code.. }
+// 3. pre-run appended it, var Module = {}; ..generated code..
+// 4. External script tag defines var Module.
+// We need to check if Module already exists (e.g. case 3 above).
+// Substitution will be replaced with actual code on later stage of the build,
+// this way Closure Compiler will not mangle it (e.g. case 4. above).
+// Note that if you want to run closure, and also to use Module
+// after the generated code, you will need to define var Module = {};
+// before the code. Then that object will be used in the code, and you
+// can continue to use Module afterwards as well.
+var Module = typeof createDotnetRuntime != 'undefined' ? createDotnetRuntime : {};
+
+// See https://caniuse.com/mdn-javascript_builtins_object_assign
+
+// Set up the promise that indicates the Module is initialized
+var readyPromiseResolve, readyPromiseReject;
+Module['ready'] = new Promise(function(resolve, reject) {
+ readyPromiseResolve = resolve;
+ readyPromiseReject = reject;
+});
+
+// --pre-jses are emitted after the Module integration code, so that they can
+// refer to Module (if they choose; they can also define Module)
+let ENVIRONMENT_IS_GLOBAL = false;
+var require = require || undefined;
+var __dirname = __dirname || '';
+var __callbackAPI = { MONO, BINDING, INTERNAL, IMPORTS };
+if (typeof createDotnetRuntime === "function") {
+ __callbackAPI.Module = Module = { ready: Module.ready };
+ const extension = createDotnetRuntime(__callbackAPI)
+ if (extension.ready) {
+ throw new Error("MONO_WASM: Module.ready couldn't be redefined.")
+ }
+ Object.assign(Module, extension);
+ createDotnetRuntime = Module;
+ if (!createDotnetRuntime.locateFile) createDotnetRuntime.locateFile = createDotnetRuntime.__locateFile = (path) => scriptDirectory + path;
+}
+else if (typeof createDotnetRuntime === "object") {
+ __callbackAPI.Module = Module = { ready: Module.ready, __undefinedConfig: Object.keys(createDotnetRuntime).length === 1 };
+ Object.assign(Module, createDotnetRuntime);
+ createDotnetRuntime = Module;
+ if (!createDotnetRuntime.locateFile) createDotnetRuntime.locateFile = createDotnetRuntime.__locateFile = (path) => scriptDirectory + path;
+}
+else {
+ throw new Error("MONO_WASM: Can't use moduleFactory callback of createDotnetRuntime function.")
+}
+
+// Sometimes an existing Module object exists with properties
+// meant to overwrite the default module functionality. Here
+// we collect those properties and reapply _after_ we configure
+// the current environment's defaults to avoid having to be so
+// defensive during initialization.
+var moduleOverrides = Object.assign({}, Module);
+
+var arguments_ = [];
+var thisProgram = './this.program';
+var quit_ = (status, toThrow) => {
+ throw toThrow;
+};
+
+// Determine the runtime environment we are in. You can customize this by
+// setting the ENVIRONMENT setting at compile time (see settings.js).
+
+// Attempt to auto-detect the environment
+var ENVIRONMENT_IS_WEB = typeof window == 'object';
+var ENVIRONMENT_IS_WORKER = typeof importScripts == 'function';
+// N.b. Electron.js environment is simultaneously a NODE-environment, but
+// also a web environment.
+var ENVIRONMENT_IS_NODE = typeof process == 'object' && typeof process.versions == 'object' && typeof process.versions.node == 'string';
+var ENVIRONMENT_IS_SHELL = !ENVIRONMENT_IS_WEB && !ENVIRONMENT_IS_NODE && !ENVIRONMENT_IS_WORKER;
+
+// `/` should be present at the end if `scriptDirectory` is not empty
+var scriptDirectory = '';
+function locateFile(path) {
+ if (Module['locateFile']) {
+ return Module['locateFile'](path, scriptDirectory);
+ }
+ return scriptDirectory + path;
+}
+
+// Hooks that are implemented differently in different runtime environments.
+var read_,
+ readAsync,
+ readBinary,
+ setWindowTitle;
+
+// Normally we don't log exceptions but instead let them bubble out the top
+// level where the embedding environment (e.g. the browser) can handle
+// them.
+// However under v8 and node we sometimes exit the process direcly in which case
+// its up to use us to log the exception before exiting.
+// If we fix https://github.com/emscripten-core/emscripten/issues/15080
+// this may no longer be needed under node.
+function logExceptionOnExit(e) {
+ if (e instanceof ExitStatus) return;
+ let toLog = e;
+ err('exiting due to exception: ' + toLog);
+}
+
+var fs;
+var nodePath;
+var requireNodeFS;
+
+if (ENVIRONMENT_IS_NODE) {
+ if (ENVIRONMENT_IS_WORKER) {
+ scriptDirectory = require('path').dirname(scriptDirectory) + '/';
+ } else {
+ scriptDirectory = __dirname + '/';
+ }
+
+// include: node_shell_read.js
+
+
+requireNodeFS = () => {
+ // Use nodePath as the indicator for these not being initialized,
+ // since in some environments a global fs may have already been
+ // created.
+ if (!nodePath) {
+ fs = require('fs');
+ nodePath = require('path');
+ }
+};
+
+read_ = function shell_read(filename, binary) {
+ requireNodeFS();
+ filename = nodePath['normalize'](filename);
+ return fs.readFileSync(filename, binary ? undefined : 'utf8');
+};
+
+readBinary = (filename) => {
+ var ret = read_(filename, true);
+ if (!ret.buffer) {
+ ret = new Uint8Array(ret);
+ }
+ return ret;
+};
+
+readAsync = (filename, onload, onerror) => {
+ requireNodeFS();
+ filename = nodePath['normalize'](filename);
+ fs.readFile(filename, function(err, data) {
+ if (err) onerror(err);
+ else onload(data.buffer);
+ });
+};
+
+// end include: node_shell_read.js
+ if (process['argv'].length > 1) {
+ thisProgram = process['argv'][1].replace(/\\/g, '/');
+ }
+
+ arguments_ = process['argv'].slice(2);
+
+ // MODULARIZE will export the module in the proper place outside, we don't need to export here
+
+ process['on']('uncaughtException', function(ex) {
+ // suppress ExitStatus exceptions from showing an error
+ if (!(ex instanceof ExitStatus)) {
+ throw ex;
+ }
+ });
+
+ // Without this older versions of node (< v15) will log unhandled rejections
+ // but return 0, which is not normally the desired behaviour. This is
+ // not be needed with node v15 and about because it is now the default
+ // behaviour:
+ // See https://nodejs.org/api/cli.html#cli_unhandled_rejections_mode
+ process['on']('unhandledRejection', function(reason) { throw reason; });
+
+ quit_ = (status, toThrow) => {
+ if (keepRuntimeAlive()) {
+ process['exitCode'] = status;
+ throw toThrow;
+ }
+ logExceptionOnExit(toThrow);
+ process['exit'](status);
+ };
+
+ Module['inspect'] = function () { return '[Emscripten Module object]'; };
+
+} else
+if (ENVIRONMENT_IS_SHELL) {
+
+ if (typeof read != 'undefined') {
+ read_ = function shell_read(f) {
+ return read(f);
+ };
+ }
+
+ readBinary = function readBinary(f) {
+ let data;
+ if (typeof readbuffer == 'function') {
+ return new Uint8Array(readbuffer(f));
+ }
+ data = read(f, 'binary');
+ assert(typeof data == 'object');
+ return data;
+ };
+
+ readAsync = function readAsync(f, onload, onerror) {
+ setTimeout(() => onload(readBinary(f)), 0);
+ };
+
+ if (typeof scriptArgs != 'undefined') {
+ arguments_ = scriptArgs;
+ } else if (typeof arguments != 'undefined') {
+ arguments_ = arguments;
+ }
+
+ if (typeof quit == 'function') {
+ quit_ = (status, toThrow) => {
+ logExceptionOnExit(toThrow);
+ quit(status);
+ };
+ }
+
+ if (typeof print != 'undefined') {
+ // Prefer to use print/printErr where they exist, as they usually work better.
+ if (typeof console == 'undefined') console = /** @type{!Console} */({});
+ console.log = /** @type{!function(this:Console, ...*): undefined} */ (print);
+ console.warn = console.error = /** @type{!function(this:Console, ...*): undefined} */ (typeof printErr != 'undefined' ? printErr : print);
+ }
+
+} else
+
+// Note that this includes Node.js workers when relevant (pthreads is enabled).
+// Node.js workers are detected as a combination of ENVIRONMENT_IS_WORKER and
+// ENVIRONMENT_IS_NODE.
+if (ENVIRONMENT_IS_WEB || ENVIRONMENT_IS_WORKER) {
+ if (ENVIRONMENT_IS_WORKER) { // Check worker, not web, since window could be polyfilled
+ scriptDirectory = self.location.href;
+ } else if (typeof document != 'undefined' && document.currentScript) { // web
+ scriptDirectory = document.currentScript.src;
+ }
+ // When MODULARIZE, this JS may be executed later, after document.currentScript
+ // is gone, so we saved it, and we use it here instead of any other info.
+ if (_scriptDir) {
+ scriptDirectory = _scriptDir;
+ }
+ // blob urls look like blob:http://site.com/etc/etc and we cannot infer anything from them.
+ // otherwise, slice off the final part of the url to find the script directory.
+ // if scriptDirectory does not contain a slash, lastIndexOf will return -1,
+ // and scriptDirectory will correctly be replaced with an empty string.
+ // If scriptDirectory contains a query (starting with ?) or a fragment (starting with #),
+ // they are removed because they could contain a slash.
+ if (scriptDirectory.indexOf('blob:') !== 0) {
+ scriptDirectory = scriptDirectory.substr(0, scriptDirectory.replace(/[?#].*/, "").lastIndexOf('/')+1);
+ } else {
+ scriptDirectory = '';
+ }
+
+ // Differentiate the Web Worker from the Node Worker case, as reading must
+ // be done differently.
+ {
+// include: web_or_worker_shell_read.js
+
+
+ read_ = (url) => {
+ var xhr = new XMLHttpRequest();
+ xhr.open('GET', url, false);
+ xhr.send(null);
+ return xhr.responseText;
+ }
+
+ if (ENVIRONMENT_IS_WORKER) {
+ readBinary = (url) => {
+ var xhr = new XMLHttpRequest();
+ xhr.open('GET', url, false);
+ xhr.responseType = 'arraybuffer';
+ xhr.send(null);
+ return new Uint8Array(/** @type{!ArrayBuffer} */(xhr.response));
+ };
+ }
+
+ readAsync = (url, onload, onerror) => {
+ var xhr = new XMLHttpRequest();
+ xhr.open('GET', url, true);
+ xhr.responseType = 'arraybuffer';
+ xhr.onload = () => {
+ if (xhr.status == 200 || (xhr.status == 0 && xhr.response)) { // file URLs can return 0
+ onload(xhr.response);
+ return;
+ }
+ onerror();
+ };
+ xhr.onerror = onerror;
+ xhr.send(null);
+ }
+
+// end include: web_or_worker_shell_read.js
+ }
+
+ setWindowTitle = (title) => document.title = title;
+} else
+{
+}
+
+var out = Module['print'] || console.log.bind(console);
+var err = Module['printErr'] || console.warn.bind(console);
+
+// Merge back in the overrides
+Object.assign(Module, moduleOverrides);
+// Free the object hierarchy contained in the overrides, this lets the GC
+// reclaim data used e.g. in memoryInitializerRequest, which is a large typed array.
+moduleOverrides = null;
+
+// Emit code to handle expected values on the Module object. This applies Module.x
+// to the proper local x. This has two benefits: first, we only emit it if it is
+// expected to arrive, and second, by using a local everywhere else that can be
+// minified.
+
+if (Module['arguments']) arguments_ = Module['arguments'];
+
+if (Module['thisProgram']) thisProgram = Module['thisProgram'];
+
+if (Module['quit']) quit_ = Module['quit'];
+
+// perform assertions in shell.js after we set up out() and err(), as otherwise if an assertion fails it cannot print the message
+
+
+
+
+var STACK_ALIGN = 16;
+var POINTER_SIZE = 4;
+
+function getNativeTypeSize(type) {
+ switch (type) {
+ case 'i1': case 'i8': case 'u8': return 1;
+ case 'i16': case 'u16': return 2;
+ case 'i32': case 'u32': return 4;
+ case 'i64': case 'u64': return 8;
+ case 'float': return 4;
+ case 'double': return 8;
+ default: {
+ if (type[type.length - 1] === '*') {
+ return POINTER_SIZE;
+ } else if (type[0] === 'i') {
+ const bits = Number(type.substr(1));
+ assert(bits % 8 === 0, 'getNativeTypeSize invalid bits ' + bits + ', type ' + type);
+ return bits / 8;
+ } else {
+ return 0;
+ }
+ }
+ }
+}
+
+function warnOnce(text) {
+ if (!warnOnce.shown) warnOnce.shown = {};
+ if (!warnOnce.shown[text]) {
+ warnOnce.shown[text] = 1;
+ err(text);
+ }
+}
+
+// include: runtime_functions.js
+
+
+// This gives correct answers for everything less than 2^{14} = 16384
+// I hope nobody is contemplating functions with 16384 arguments...
+function uleb128Encode(n) {
+ if (n < 128) {
+ return [n];
+ }
+ return [(n % 128) | 128, n >> 7];
+}
+
+// Wraps a JS function as a wasm function with a given signature.
+function convertJsFunctionToWasm(func, sig) {
+
+ // If the type reflection proposal is available, use the new
+ // "WebAssembly.Function" constructor.
+ // Otherwise, construct a minimal wasm module importing the JS function and
+ // re-exporting it.
+ if (typeof WebAssembly.Function == "function") {
+ var typeNames = {
+ 'i': 'i32',
+ 'j': 'i64',
+ 'f': 'f32',
+ 'd': 'f64',
+ 'p': 'i32',
+ };
+ var type = {
+ parameters: [],
+ results: sig[0] == 'v' ? [] : [typeNames[sig[0]]]
+ };
+ for (var i = 1; i < sig.length; ++i) {
+ type.parameters.push(typeNames[sig[i]]);
+ }
+ return new WebAssembly.Function(type, func);
+ }
+
+ // The module is static, with the exception of the type section, which is
+ // generated based on the signature passed in.
+ var typeSection = [
+ 0x01, // count: 1
+ 0x60, // form: func
+ ];
+ var sigRet = sig.slice(0, 1);
+ var sigParam = sig.slice(1);
+ var typeCodes = {
+ 'i': 0x7f, // i32
+ 'p': 0x7f, // i32
+ 'j': 0x7e, // i64
+ 'f': 0x7d, // f32
+ 'd': 0x7c, // f64
+ };
+
+ // Parameters, length + signatures
+ typeSection = typeSection.concat(uleb128Encode(sigParam.length));
+ for (var i = 0; i < sigParam.length; ++i) {
+ typeSection.push(typeCodes[sigParam[i]]);
+ }
+
+ // Return values, length + signatures
+ // With no multi-return in MVP, either 0 (void) or 1 (anything else)
+ if (sigRet == 'v') {
+ typeSection.push(0x00);
+ } else {
+ typeSection = typeSection.concat([0x01, typeCodes[sigRet]]);
+ }
+
+ // Write the section code and overall length of the type section into the
+ // section header
+ typeSection = [0x01 /* Type section code */].concat(
+ uleb128Encode(typeSection.length),
+ typeSection
+ );
+
+ // Rest of the module is static
+ var bytes = new Uint8Array([
+ 0x00, 0x61, 0x73, 0x6d, // magic ("\0asm")
+ 0x01, 0x00, 0x00, 0x00, // version: 1
+ ].concat(typeSection, [
+ 0x02, 0x07, // import section
+ // (import "e" "f" (func 0 (type 0)))
+ 0x01, 0x01, 0x65, 0x01, 0x66, 0x00, 0x00,
+ 0x07, 0x05, // export section
+ // (export "f" (func 0 (type 0)))
+ 0x01, 0x01, 0x66, 0x00, 0x00,
+ ]));
+
+ // We can compile this wasm module synchronously because it is very small.
+ // This accepts an import (at "e.f"), that it reroutes to an export (at "f")
+ var module = new WebAssembly.Module(bytes);
+ var instance = new WebAssembly.Instance(module, {
+ 'e': {
+ 'f': func
+ }
+ });
+ var wrappedFunc = instance.exports['f'];
+ return wrappedFunc;
+}
+
+var freeTableIndexes = [];
+
+// Weak map of functions in the table to their indexes, created on first use.
+var functionsInTableMap;
+
+function getEmptyTableSlot() {
+ // Reuse a free index if there is one, otherwise grow.
+ if (freeTableIndexes.length) {
+ return freeTableIndexes.pop();
+ }
+ // Grow the table
+ try {
+ wasmTable.grow(1);
+ } catch (err) {
+ if (!(err instanceof RangeError)) {
+ throw err;
+ }
+ throw 'Unable to grow wasm table. Set ALLOW_TABLE_GROWTH.';
+ }
+ return wasmTable.length - 1;
+}
+
+function updateTableMap(offset, count) {
+ for (var i = offset; i < offset + count; i++) {
+ var item = getWasmTableEntry(i);
+ // Ignore null values.
+ if (item) {
+ functionsInTableMap.set(item, i);
+ }
+ }
+}
+
+/**
+ * Add a function to the table.
+ * 'sig' parameter is required if the function being added is a JS function.
+ * @param {string=} sig
+ */
+function addFunction(func, sig) {
+
+ // Check if the function is already in the table, to ensure each function
+ // gets a unique index. First, create the map if this is the first use.
+ if (!functionsInTableMap) {
+ functionsInTableMap = new WeakMap();
+ updateTableMap(0, wasmTable.length);
+ }
+ if (functionsInTableMap.has(func)) {
+ return functionsInTableMap.get(func);
+ }
+
+ // It's not in the table, add it now.
+
+ var ret = getEmptyTableSlot();
+
+ // Set the new value.
+ try {
+ // Attempting to call this with JS function will cause of table.set() to fail
+ setWasmTableEntry(ret, func);
+ } catch (err) {
+ if (!(err instanceof TypeError)) {
+ throw err;
+ }
+ var wrapped = convertJsFunctionToWasm(func, sig);
+ setWasmTableEntry(ret, wrapped);
+ }
+
+ functionsInTableMap.set(func, ret);
+
+ return ret;
+}
+
+function removeFunction(index) {
+ functionsInTableMap.delete(getWasmTableEntry(index));
+ freeTableIndexes.push(index);
+}
+
+// end include: runtime_functions.js
+// include: runtime_debug.js
+
+
+// end include: runtime_debug.js
+var tempRet0 = 0;
+var setTempRet0 = (value) => { tempRet0 = value; };
+var getTempRet0 = () => tempRet0;
+
+
+
+// === Preamble library stuff ===
+
+// Documentation for the public APIs defined in this file must be updated in:
+// site/source/docs/api_reference/preamble.js.rst
+// A prebuilt local version of the documentation is available at:
+// site/build/text/docs/api_reference/preamble.js.txt
+// You can also build docs locally as HTML or other formats in site/
+// An online HTML version (which may be of a different version of Emscripten)
+// is up at http://kripken.github.io/emscripten-site/docs/api_reference/preamble.js.html
+
+var wasmBinary;
+if (Module['wasmBinary']) wasmBinary = Module['wasmBinary'];
+var noExitRuntime = Module['noExitRuntime'] || true;
+
+if (typeof WebAssembly != 'object') {
+ abort('no native wasm support detected');
+}
+
+// Wasm globals
+
+var wasmMemory;
+
+//========================================
+// Runtime essentials
+//========================================
+
+// whether we are quitting the application. no code should run after this.
+// set in exit() and abort()
+var ABORT = false;
+
+// set by exit() and abort(). Passed to 'onExit' handler.
+// NOTE: This is also used as the process return code code in shell environments
+// but only when noExitRuntime is false.
+var EXITSTATUS;
+
+/** @type {function(*, string=)} */
+function assert(condition, text) {
+ if (!condition) {
+ // This build was created without ASSERTIONS defined. `assert()` should not
+ // ever be called in this configuration but in case there are callers in
+ // the wild leave this simple abort() implemenation here for now.
+ abort(text);
+ }
+}
+
+// Returns the C function with a specified identifier (for C++, you need to do manual name mangling)
+function getCFunc(ident) {
+ var func = Module['_' + ident]; // closure exported function
+ return func;
+}
+
+// C calling interface.
+/** @param {string|null=} returnType
+ @param {Array=} argTypes
+ @param {Arguments|Array=} args
+ @param {Object=} opts */
+function ccall(ident, returnType, argTypes, args, opts) {
+ // For fast lookup of conversion functions
+ var toC = {
+ 'string': function(str) {
+ var ret = 0;
+ if (str !== null && str !== undefined && str !== 0) { // null string
+ // at most 4 bytes per UTF-8 code point, +1 for the trailing '\0'
+ var len = (str.length << 2) + 1;
+ ret = stackAlloc(len);
+ stringToUTF8(str, ret, len);
+ }
+ return ret;
+ },
+ 'array': function(arr) {
+ var ret = stackAlloc(arr.length);
+ writeArrayToMemory(arr, ret);
+ return ret;
+ }
+ };
+
+ function convertReturnValue(ret) {
+ if (returnType === 'string') {
+
+ return UTF8ToString(ret);
+ }
+ if (returnType === 'boolean') return Boolean(ret);
+ return ret;
+ }
+
+ var func = getCFunc(ident);
+ var cArgs = [];
+ var stack = 0;
+ if (args) {
+ for (var i = 0; i < args.length; i++) {
+ var converter = toC[argTypes[i]];
+ if (converter) {
+ if (stack === 0) stack = stackSave();
+ cArgs[i] = converter(args[i]);
+ } else {
+ cArgs[i] = args[i];
+ }
+ }
+ }
+ var ret = func.apply(null, cArgs);
+ function onDone(ret) {
+ if (stack !== 0) stackRestore(stack);
+ return convertReturnValue(ret);
+ }
+
+ ret = onDone(ret);
+ return ret;
+}
+
+/** @param {string=} returnType
+ @param {Array=} argTypes
+ @param {Object=} opts */
+function cwrap(ident, returnType, argTypes, opts) {
+ argTypes = argTypes || [];
+ // When the function takes numbers and returns a number, we can just return
+ // the original function
+ var numericArgs = argTypes.every(function(type){ return type === 'number'});
+ var numericRet = returnType !== 'string';
+ if (numericRet && numericArgs && !opts) {
+ return getCFunc(ident);
+ }
+ return function() {
+ return ccall(ident, returnType, argTypes, arguments, opts);
+ }
+}
+
+// include: runtime_legacy.js
+
+
+var ALLOC_NORMAL = 0; // Tries to use _malloc()
+var ALLOC_STACK = 1; // Lives for the duration of the current function call
+
+/**
+ * allocate(): This function is no longer used by emscripten but is kept around to avoid
+ * breaking external users.
+ * You should normally not use allocate(), and instead allocate
+ * memory using _malloc()/stackAlloc(), initialize it with
+ * setValue(), and so forth.
+ * @param {(Uint8Array|Array)} slab: An array of data.
+ * @param {number=} allocator : How to allocate memory, see ALLOC_*
+ */
+function allocate(slab, allocator) {
+ var ret;
+
+ if (allocator == ALLOC_STACK) {
+ ret = stackAlloc(slab.length);
+ } else {
+ ret = _malloc(slab.length);
+ }
+
+ if (!slab.subarray && !slab.slice) {
+ slab = new Uint8Array(slab);
+ }
+ HEAPU8.set(slab, ret);
+ return ret;
+}
+
+// end include: runtime_legacy.js
+// include: runtime_strings.js
+
+
+// runtime_strings.js: Strings related runtime functions that are part of both MINIMAL_RUNTIME and regular runtime.
+
+var UTF8Decoder = typeof TextDecoder != 'undefined' ? new TextDecoder('utf8') : undefined;
+
+// Given a pointer 'ptr' to a null-terminated UTF8-encoded string in the given array that contains uint8 values, returns
+// a copy of that string as a Javascript String object.
+/**
+ * heapOrArray is either a regular array, or a JavaScript typed array view.
+ * @param {number} idx
+ * @param {number=} maxBytesToRead
+ * @return {string}
+ */
+function UTF8ArrayToString(heapOrArray, idx, maxBytesToRead) {
+ var endIdx = idx + maxBytesToRead;
+ var endPtr = idx;
+ // TextDecoder needs to know the byte length in advance, it doesn't stop on null terminator by itself.
+ // Also, use the length info to avoid running tiny strings through TextDecoder, since .subarray() allocates garbage.
+ // (As a tiny code save trick, compare endPtr against endIdx using a negation, so that undefined means Infinity)
+ while (heapOrArray[endPtr] && !(endPtr >= endIdx)) ++endPtr;
+
+ if (endPtr - idx > 16 && heapOrArray.buffer && UTF8Decoder) {
+ return UTF8Decoder.decode(heapOrArray.subarray(idx, endPtr));
+ } else {
+ var str = '';
+ // If building with TextDecoder, we have already computed the string length above, so test loop end condition against that
+ while (idx < endPtr) {
+ // For UTF8 byte structure, see:
+ // http://en.wikipedia.org/wiki/UTF-8#Description
+ // https://www.ietf.org/rfc/rfc2279.txt
+ // https://tools.ietf.org/html/rfc3629
+ var u0 = heapOrArray[idx++];
+ if (!(u0 & 0x80)) { str += String.fromCharCode(u0); continue; }
+ var u1 = heapOrArray[idx++] & 63;
+ if ((u0 & 0xE0) == 0xC0) { str += String.fromCharCode(((u0 & 31) << 6) | u1); continue; }
+ var u2 = heapOrArray[idx++] & 63;
+ if ((u0 & 0xF0) == 0xE0) {
+ u0 = ((u0 & 15) << 12) | (u1 << 6) | u2;
+ } else {
+ u0 = ((u0 & 7) << 18) | (u1 << 12) | (u2 << 6) | (heapOrArray[idx++] & 63);
+ }
+
+ if (u0 < 0x10000) {
+ str += String.fromCharCode(u0);
+ } else {
+ var ch = u0 - 0x10000;
+ str += String.fromCharCode(0xD800 | (ch >> 10), 0xDC00 | (ch & 0x3FF));
+ }
+ }
+ }
+ return str;
+}
+
+// Given a pointer 'ptr' to a null-terminated UTF8-encoded string in the emscripten HEAP, returns a
+// copy of that string as a Javascript String object.
+// maxBytesToRead: an optional length that specifies the maximum number of bytes to read. You can omit
+// this parameter to scan the string until the first \0 byte. If maxBytesToRead is
+// passed, and the string at [ptr, ptr+maxBytesToReadr[ contains a null byte in the
+// middle, then the string will cut short at that byte index (i.e. maxBytesToRead will
+// not produce a string of exact length [ptr, ptr+maxBytesToRead[)
+// N.B. mixing frequent uses of UTF8ToString() with and without maxBytesToRead may
+// throw JS JIT optimizations off, so it is worth to consider consistently using one
+// style or the other.
+/**
+ * @param {number} ptr
+ * @param {number=} maxBytesToRead
+ * @return {string}
+ */
+function UTF8ToString(ptr, maxBytesToRead) {
+ return ptr ? UTF8ArrayToString(HEAPU8, ptr, maxBytesToRead) : '';
+}
+
+// Copies the given Javascript String object 'str' to the given byte array at address 'outIdx',
+// encoded in UTF8 form and null-terminated. The copy will require at most str.length*4+1 bytes of space in the HEAP.
+// Use the function lengthBytesUTF8 to compute the exact number of bytes (excluding null terminator) that this function will write.
+// Parameters:
+// str: the Javascript string to copy.
+// heap: the array to copy to. Each index in this array is assumed to be one 8-byte element.
+// outIdx: The starting offset in the array to begin the copying.
+// maxBytesToWrite: The maximum number of bytes this function can write to the array.
+// This count should include the null terminator,
+// i.e. if maxBytesToWrite=1, only the null terminator will be written and nothing else.
+// maxBytesToWrite=0 does not write any bytes to the output, not even the null terminator.
+// Returns the number of bytes written, EXCLUDING the null terminator.
+
+function stringToUTF8Array(str, heap, outIdx, maxBytesToWrite) {
+ if (!(maxBytesToWrite > 0)) // Parameter maxBytesToWrite is not optional. Negative values, 0, null, undefined and false each don't write out any bytes.
+ return 0;
+
+ var startIdx = outIdx;
+ var endIdx = outIdx + maxBytesToWrite - 1; // -1 for string null terminator.
+ for (var i = 0; i < str.length; ++i) {
+ // Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code unit, not a Unicode code point of the character! So decode UTF16->UTF32->UTF8.
+ // See http://unicode.org/faq/utf_bom.html#utf16-3
+ // For UTF8 byte structure, see http://en.wikipedia.org/wiki/UTF-8#Description and https://www.ietf.org/rfc/rfc2279.txt and https://tools.ietf.org/html/rfc3629
+ var u = str.charCodeAt(i); // possibly a lead surrogate
+ if (u >= 0xD800 && u <= 0xDFFF) {
+ var u1 = str.charCodeAt(++i);
+ u = 0x10000 + ((u & 0x3FF) << 10) | (u1 & 0x3FF);
+ }
+ if (u <= 0x7F) {
+ if (outIdx >= endIdx) break;
+ heap[outIdx++] = u;
+ } else if (u <= 0x7FF) {
+ if (outIdx + 1 >= endIdx) break;
+ heap[outIdx++] = 0xC0 | (u >> 6);
+ heap[outIdx++] = 0x80 | (u & 63);
+ } else if (u <= 0xFFFF) {
+ if (outIdx + 2 >= endIdx) break;
+ heap[outIdx++] = 0xE0 | (u >> 12);
+ heap[outIdx++] = 0x80 | ((u >> 6) & 63);
+ heap[outIdx++] = 0x80 | (u & 63);
+ } else {
+ if (outIdx + 3 >= endIdx) break;
+ heap[outIdx++] = 0xF0 | (u >> 18);
+ heap[outIdx++] = 0x80 | ((u >> 12) & 63);
+ heap[outIdx++] = 0x80 | ((u >> 6) & 63);
+ heap[outIdx++] = 0x80 | (u & 63);
+ }
+ }
+ // Null-terminate the pointer to the buffer.
+ heap[outIdx] = 0;
+ return outIdx - startIdx;
+}
+
+// Copies the given Javascript String object 'str' to the emscripten HEAP at address 'outPtr',
+// null-terminated and encoded in UTF8 form. The copy will require at most str.length*4+1 bytes of space in the HEAP.
+// Use the function lengthBytesUTF8 to compute the exact number of bytes (excluding null terminator) that this function will write.
+// Returns the number of bytes written, EXCLUDING the null terminator.
+
+function stringToUTF8(str, outPtr, maxBytesToWrite) {
+ return stringToUTF8Array(str, HEAPU8,outPtr, maxBytesToWrite);
+}
+
+// Returns the number of bytes the given Javascript string takes if encoded as a UTF8 byte array, EXCLUDING the null terminator byte.
+function lengthBytesUTF8(str) {
+ var len = 0;
+ for (var i = 0; i < str.length; ++i) {
+ // Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code unit, not a Unicode code point of the character! So decode UTF16->UTF32->UTF8.
+ // See http://unicode.org/faq/utf_bom.html#utf16-3
+ var u = str.charCodeAt(i); // possibly a lead surrogate
+ if (u >= 0xD800 && u <= 0xDFFF) u = 0x10000 + ((u & 0x3FF) << 10) | (str.charCodeAt(++i) & 0x3FF);
+ if (u <= 0x7F) ++len;
+ else if (u <= 0x7FF) len += 2;
+ else if (u <= 0xFFFF) len += 3;
+ else len += 4;
+ }
+ return len;
+}
+
+// end include: runtime_strings.js
+// include: runtime_strings_extra.js
+
+
+// runtime_strings_extra.js: Strings related runtime functions that are available only in regular runtime.
+
+// Given a pointer 'ptr' to a null-terminated ASCII-encoded string in the emscripten HEAP, returns
+// a copy of that string as a Javascript String object.
+
+function AsciiToString(ptr) {
+ var str = '';
+ while (1) {
+ var ch = HEAPU8[((ptr++)>>0)];
+ if (!ch) return str;
+ str += String.fromCharCode(ch);
+ }
+}
+
+// Copies the given Javascript String object 'str' to the emscripten HEAP at address 'outPtr',
+// null-terminated and encoded in ASCII form. The copy will require at most str.length+1 bytes of space in the HEAP.
+
+function stringToAscii(str, outPtr) {
+ return writeAsciiToMemory(str, outPtr, false);
+}
+
+// Given a pointer 'ptr' to a null-terminated UTF16LE-encoded string in the emscripten HEAP, returns
+// a copy of that string as a Javascript String object.
+
+var UTF16Decoder = typeof TextDecoder != 'undefined' ? new TextDecoder('utf-16le') : undefined;
+
+function UTF16ToString(ptr, maxBytesToRead) {
+ var endPtr = ptr;
+ // TextDecoder needs to know the byte length in advance, it doesn't stop on null terminator by itself.
+ // Also, use the length info to avoid running tiny strings through TextDecoder, since .subarray() allocates garbage.
+ var idx = endPtr >> 1;
+ var maxIdx = idx + maxBytesToRead / 2;
+ // If maxBytesToRead is not passed explicitly, it will be undefined, and this
+ // will always evaluate to true. This saves on code size.
+ while (!(idx >= maxIdx) && HEAPU16[idx]) ++idx;
+ endPtr = idx << 1;
+
+ if (endPtr - ptr > 32 && UTF16Decoder) {
+ return UTF16Decoder.decode(HEAPU8.subarray(ptr, endPtr));
+ } else {
+ var str = '';
+
+ // If maxBytesToRead is not passed explicitly, it will be undefined, and the for-loop's condition
+ // will always evaluate to true. The loop is then terminated on the first null char.
+ for (var i = 0; !(i >= maxBytesToRead / 2); ++i) {
+ var codeUnit = HEAP16[(((ptr)+(i*2))>>1)];
+ if (codeUnit == 0) break;
+ // fromCharCode constructs a character from a UTF-16 code unit, so we can pass the UTF16 string right through.
+ str += String.fromCharCode(codeUnit);
+ }
+
+ return str;
+ }
+}
+
+// Copies the given Javascript String object 'str' to the emscripten HEAP at address 'outPtr',
+// null-terminated and encoded in UTF16 form. The copy will require at most str.length*4+2 bytes of space in the HEAP.
+// Use the function lengthBytesUTF16() to compute the exact number of bytes (excluding null terminator) that this function will write.
+// Parameters:
+// str: the Javascript string to copy.
+// outPtr: Byte address in Emscripten HEAP where to write the string to.
+// maxBytesToWrite: The maximum number of bytes this function can write to the array. This count should include the null
+// terminator, i.e. if maxBytesToWrite=2, only the null terminator will be written and nothing else.
+// maxBytesToWrite<2 does not write any bytes to the output, not even the null terminator.
+// Returns the number of bytes written, EXCLUDING the null terminator.
+
+function stringToUTF16(str, outPtr, maxBytesToWrite) {
+ // Backwards compatibility: if max bytes is not specified, assume unsafe unbounded write is allowed.
+ if (maxBytesToWrite === undefined) {
+ maxBytesToWrite = 0x7FFFFFFF;
+ }
+ if (maxBytesToWrite < 2) return 0;
+ maxBytesToWrite -= 2; // Null terminator.
+ var startPtr = outPtr;
+ var numCharsToWrite = (maxBytesToWrite < str.length*2) ? (maxBytesToWrite / 2) : str.length;
+ for (var i = 0; i < numCharsToWrite; ++i) {
+ // charCodeAt returns a UTF-16 encoded code unit, so it can be directly written to the HEAP.
+ var codeUnit = str.charCodeAt(i); // possibly a lead surrogate
+ HEAP16[((outPtr)>>1)] = codeUnit;
+ outPtr += 2;
+ }
+ // Null-terminate the pointer to the HEAP.
+ HEAP16[((outPtr)>>1)] = 0;
+ return outPtr - startPtr;
+}
+
+// Returns the number of bytes the given Javascript string takes if encoded as a UTF16 byte array, EXCLUDING the null terminator byte.
+
+function lengthBytesUTF16(str) {
+ return str.length*2;
+}
+
+function UTF32ToString(ptr, maxBytesToRead) {
+ var i = 0;
+
+ var str = '';
+ // If maxBytesToRead is not passed explicitly, it will be undefined, and this
+ // will always evaluate to true. This saves on code size.
+ while (!(i >= maxBytesToRead / 4)) {
+ var utf32 = HEAP32[(((ptr)+(i*4))>>2)];
+ if (utf32 == 0) break;
+ ++i;
+ // Gotcha: fromCharCode constructs a character from a UTF-16 encoded code (pair), not from a Unicode code point! So encode the code point to UTF-16 for constructing.
+ // See http://unicode.org/faq/utf_bom.html#utf16-3
+ if (utf32 >= 0x10000) {
+ var ch = utf32 - 0x10000;
+ str += String.fromCharCode(0xD800 | (ch >> 10), 0xDC00 | (ch & 0x3FF));
+ } else {
+ str += String.fromCharCode(utf32);
+ }
+ }
+ return str;
+}
+
+// Copies the given Javascript String object 'str' to the emscripten HEAP at address 'outPtr',
+// null-terminated and encoded in UTF32 form. The copy will require at most str.length*4+4 bytes of space in the HEAP.
+// Use the function lengthBytesUTF32() to compute the exact number of bytes (excluding null terminator) that this function will write.
+// Parameters:
+// str: the Javascript string to copy.
+// outPtr: Byte address in Emscripten HEAP where to write the string to.
+// maxBytesToWrite: The maximum number of bytes this function can write to the array. This count should include the null
+// terminator, i.e. if maxBytesToWrite=4, only the null terminator will be written and nothing else.
+// maxBytesToWrite<4 does not write any bytes to the output, not even the null terminator.
+// Returns the number of bytes written, EXCLUDING the null terminator.
+
+function stringToUTF32(str, outPtr, maxBytesToWrite) {
+ // Backwards compatibility: if max bytes is not specified, assume unsafe unbounded write is allowed.
+ if (maxBytesToWrite === undefined) {
+ maxBytesToWrite = 0x7FFFFFFF;
+ }
+ if (maxBytesToWrite < 4) return 0;
+ var startPtr = outPtr;
+ var endPtr = startPtr + maxBytesToWrite - 4;
+ for (var i = 0; i < str.length; ++i) {
+ // Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code unit, not a Unicode code point of the character! We must decode the string to UTF-32 to the heap.
+ // See http://unicode.org/faq/utf_bom.html#utf16-3
+ var codeUnit = str.charCodeAt(i); // possibly a lead surrogate
+ if (codeUnit >= 0xD800 && codeUnit <= 0xDFFF) {
+ var trailSurrogate = str.charCodeAt(++i);
+ codeUnit = 0x10000 + ((codeUnit & 0x3FF) << 10) | (trailSurrogate & 0x3FF);
+ }
+ HEAP32[((outPtr)>>2)] = codeUnit;
+ outPtr += 4;
+ if (outPtr + 4 > endPtr) break;
+ }
+ // Null-terminate the pointer to the HEAP.
+ HEAP32[((outPtr)>>2)] = 0;
+ return outPtr - startPtr;
+}
+
+// Returns the number of bytes the given Javascript string takes if encoded as a UTF16 byte array, EXCLUDING the null terminator byte.
+
+function lengthBytesUTF32(str) {
+ var len = 0;
+ for (var i = 0; i < str.length; ++i) {
+ // Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code unit, not a Unicode code point of the character! We must decode the string to UTF-32 to the heap.
+ // See http://unicode.org/faq/utf_bom.html#utf16-3
+ var codeUnit = str.charCodeAt(i);
+ if (codeUnit >= 0xD800 && codeUnit <= 0xDFFF) ++i; // possibly a lead surrogate, so skip over the tail surrogate.
+ len += 4;
+ }
+
+ return len;
+}
+
+// Allocate heap space for a JS string, and write it there.
+// It is the responsibility of the caller to free() that memory.
+function allocateUTF8(str) {
+ var size = lengthBytesUTF8(str) + 1;
+ var ret = _malloc(size);
+ if (ret) stringToUTF8Array(str, HEAP8, ret, size);
+ return ret;
+}
+
+// Allocate stack space for a JS string, and write it there.
+function allocateUTF8OnStack(str) {
+ var size = lengthBytesUTF8(str) + 1;
+ var ret = stackAlloc(size);
+ stringToUTF8Array(str, HEAP8, ret, size);
+ return ret;
+}
+
+// Deprecated: This function should not be called because it is unsafe and does not provide
+// a maximum length limit of how many bytes it is allowed to write. Prefer calling the
+// function stringToUTF8Array() instead, which takes in a maximum length that can be used
+// to be secure from out of bounds writes.
+/** @deprecated
+ @param {boolean=} dontAddNull */
+function writeStringToMemory(string, buffer, dontAddNull) {
+ warnOnce('writeStringToMemory is deprecated and should not be called! Use stringToUTF8() instead!');
+
+ var /** @type {number} */ lastChar, /** @type {number} */ end;
+ if (dontAddNull) {
+ // stringToUTF8Array always appends null. If we don't want to do that, remember the
+ // character that existed at the location where the null will be placed, and restore
+ // that after the write (below).
+ end = buffer + lengthBytesUTF8(string);
+ lastChar = HEAP8[end];
+ }
+ stringToUTF8(string, buffer, Infinity);
+ if (dontAddNull) HEAP8[end] = lastChar; // Restore the value under the null character.
+}
+
+function writeArrayToMemory(array, buffer) {
+ HEAP8.set(array, buffer);
+}
+
+/** @param {boolean=} dontAddNull */
+function writeAsciiToMemory(str, buffer, dontAddNull) {
+ for (var i = 0; i < str.length; ++i) {
+ HEAP8[((buffer++)>>0)] = str.charCodeAt(i);
+ }
+ // Null-terminate the pointer to the HEAP.
+ if (!dontAddNull) HEAP8[((buffer)>>0)] = 0;
+}
+
+// end include: runtime_strings_extra.js
+// Memory management
+
+var HEAP,
+/** @type {!ArrayBuffer} */
+ buffer,
+/** @type {!Int8Array} */
+ HEAP8,
+/** @type {!Uint8Array} */
+ HEAPU8,
+/** @type {!Int16Array} */
+ HEAP16,
+/** @type {!Uint16Array} */
+ HEAPU16,
+/** @type {!Int32Array} */
+ HEAP32,
+/** @type {!Uint32Array} */
+ HEAPU32,
+/** @type {!Float32Array} */
+ HEAPF32,
+/** @type {!Float64Array} */
+ HEAPF64;
+
+function updateGlobalBufferAndViews(buf) {
+ buffer = buf;
+ Module['HEAP8'] = HEAP8 = new Int8Array(buf);
+ Module['HEAP16'] = HEAP16 = new Int16Array(buf);
+ Module['HEAP32'] = HEAP32 = new Int32Array(buf);
+ Module['HEAPU8'] = HEAPU8 = new Uint8Array(buf);
+ Module['HEAPU16'] = HEAPU16 = new Uint16Array(buf);
+ Module['HEAPU32'] = HEAPU32 = new Uint32Array(buf);
+ Module['HEAPF32'] = HEAPF32 = new Float32Array(buf);
+ Module['HEAPF64'] = HEAPF64 = new Float64Array(buf);
+}
+
+var TOTAL_STACK = 5242880;
+
+var INITIAL_MEMORY = Module['INITIAL_MEMORY'] || 16384000;
+
+// include: runtime_init_table.js
+// In regular non-RELOCATABLE mode the table is exported
+// from the wasm module and this will be assigned once
+// the exports are available.
+var wasmTable;
+
+// end include: runtime_init_table.js
+// include: runtime_stack_check.js
+
+
+// end include: runtime_stack_check.js
+// include: runtime_assertions.js
+
+
+// end include: runtime_assertions.js
+var __ATPRERUN__ = []; // functions called before the runtime is initialized
+var __ATINIT__ = []; // functions called during startup
+var __ATEXIT__ = []; // functions called during shutdown
+var __ATPOSTRUN__ = []; // functions called after the main() is called
+
+var runtimeInitialized = false;
+
+function keepRuntimeAlive() {
+ return noExitRuntime;
+}
+
+function preRun() {
+
+ if (Module['preRun']) {
+ if (typeof Module['preRun'] == 'function') Module['preRun'] = [Module['preRun']];
+ while (Module['preRun'].length) {
+ addOnPreRun(Module['preRun'].shift());
+ }
+ }
+
+ callRuntimeCallbacks(__ATPRERUN__);
+}
+
+function initRuntime() {
+ runtimeInitialized = true;
+
+
+if (!Module["noFSInit"] && !FS.init.initialized)
+ FS.init();
+FS.ignorePermissions = false;
+
+TTY.init();
+SOCKFS.root = FS.mount(SOCKFS, {}, null);
+ callRuntimeCallbacks(__ATINIT__);
+}
+
+function postRun() {
+
+ if (Module['postRun']) {
+ if (typeof Module['postRun'] == 'function') Module['postRun'] = [Module['postRun']];
+ while (Module['postRun'].length) {
+ addOnPostRun(Module['postRun'].shift());
+ }
+ }
+
+ callRuntimeCallbacks(__ATPOSTRUN__);
+}
+
+function addOnPreRun(cb) {
+ __ATPRERUN__.unshift(cb);
+}
+
+function addOnInit(cb) {
+ __ATINIT__.unshift(cb);
+}
+
+function addOnExit(cb) {
+}
+
+function addOnPostRun(cb) {
+ __ATPOSTRUN__.unshift(cb);
+}
+
+// include: runtime_math.js
+
+
+// https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Math/imul
+
+// https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Math/fround
+
+// https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Math/clz32
+
+// https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Math/trunc
+
+// end include: runtime_math.js
+// A counter of dependencies for calling run(). If we need to
+// do asynchronous work before running, increment this and
+// decrement it. Incrementing must happen in a place like
+// Module.preRun (used by emcc to add file preloading).
+// Note that you can add dependencies in preRun, even though
+// it happens right before run - run will be postponed until
+// the dependencies are met.
+var runDependencies = 0;
+var runDependencyWatcher = null;
+var dependenciesFulfilled = null; // overridden to take different actions when all run dependencies are fulfilled
+
+function getUniqueRunDependency(id) {
+ return id;
+}
+
+function addRunDependency(id) {
+ runDependencies++;
+
+ if (Module['monitorRunDependencies']) {
+ Module['monitorRunDependencies'](runDependencies);
+ }
+
+}
+
+function removeRunDependency(id) {
+ runDependencies--;
+
+ if (Module['monitorRunDependencies']) {
+ Module['monitorRunDependencies'](runDependencies);
+ }
+
+ if (runDependencies == 0) {
+ if (runDependencyWatcher !== null) {
+ clearInterval(runDependencyWatcher);
+ runDependencyWatcher = null;
+ }
+ if (dependenciesFulfilled) {
+ var callback = dependenciesFulfilled;
+ dependenciesFulfilled = null;
+ callback(); // can add another dependenciesFulfilled
+ }
+ }
+}
+
+/** @param {string|number=} what */
+function abort(what) {
+ {
+ if (Module['onAbort']) {
+ Module['onAbort'](what);
+ }
+ }
+
+ what = 'Aborted(' + what + ')';
+ // TODO(sbc): Should we remove printing and leave it up to whoever
+ // catches the exception?
+ err(what);
+
+ ABORT = true;
+ EXITSTATUS = 1;
+
+ what += '. Build with -sASSERTIONS for more info.';
+
+ // Use a wasm runtime error, because a JS error might be seen as a foreign
+ // exception, which means we'd run destructors on it. We need the error to
+ // simply make the program stop.
+ // FIXME This approach does not work in Wasm EH because it currently does not assume
+ // all RuntimeErrors are from traps; it decides whether a RuntimeError is from
+ // a trap or not based on a hidden field within the object. So at the moment
+ // we don't have a way of throwing a wasm trap from JS. TODO Make a JS API that
+ // allows this in the wasm spec.
+
+ // Suppress closure compiler warning here. Closure compiler's builtin extern
+ // defintion for WebAssembly.RuntimeError claims it takes no arguments even
+ // though it can.
+ // TODO(https://github.com/google/closure-compiler/pull/3913): Remove if/when upstream closure gets fixed.
+ /** @suppress {checkTypes} */
+ var e = new WebAssembly.RuntimeError(what);
+
+ readyPromiseReject(e);
+ // Throw the error whether or not MODULARIZE is set because abort is used
+ // in code paths apart from instantiation where an exception is expected
+ // to be thrown when abort is called.
+ throw e;
+}
+
+// {{MEM_INITIALIZER}}
+
+// include: memoryprofiler.js
+
+
+// end include: memoryprofiler.js
+// include: URIUtils.js
+
+
+// Prefix of data URIs emitted by SINGLE_FILE and related options.
+var dataURIPrefix = 'data:application/octet-stream;base64,';
+
+// Indicates whether filename is a base64 data URI.
+function isDataURI(filename) {
+ // Prefix of data URIs emitted by SINGLE_FILE and related options.
+ return filename.startsWith(dataURIPrefix);
+}
+
+// Indicates whether filename is delivered via file protocol (as opposed to http/https)
+function isFileURI(filename) {
+ return filename.startsWith('file://');
+}
+
+// end include: URIUtils.js
+var wasmBinaryFile;
+if (Module['locateFile']) {
+ wasmBinaryFile = 'dotnet.wasm';
+ if (!isDataURI(wasmBinaryFile)) {
+ wasmBinaryFile = locateFile(wasmBinaryFile);
+ }
+} else {
+ // Use bundler-friendly `new URL(..., import.meta.url)` pattern; works in browsers too.
+ wasmBinaryFile = new URL('dotnet.wasm', import.meta.url).toString();
+}
+
+function getBinary(file) {
+ try {
+ if (file == wasmBinaryFile && wasmBinary) {
+ return new Uint8Array(wasmBinary);
+ }
+ if (readBinary) {
+ return readBinary(file);
+ } else {
+ throw "both async and sync fetching of the wasm failed";
+ }
+ }
+ catch (err) {
+ abort(err);
+ }
+}
+
+function getBinaryPromise() {
+ // If we don't have the binary yet, try to to load it asynchronously.
+ // Fetch has some additional restrictions over XHR, like it can't be used on a file:// url.
+ // See https://github.com/github/fetch/pull/92#issuecomment-140665932
+ // Cordova or Electron apps are typically loaded from a file:// url.
+ // So use fetch if it is available and the url is not a file, otherwise fall back to XHR.
+ if (!wasmBinary && (ENVIRONMENT_IS_WEB || ENVIRONMENT_IS_WORKER)) {
+ if (typeof fetch == 'function'
+ && !isFileURI(wasmBinaryFile)
+ ) {
+ return fetch(wasmBinaryFile, { credentials: 'same-origin' }).then(function(response) {
+ if (!response['ok']) {
+ throw "failed to load wasm binary file at '" + wasmBinaryFile + "'";
+ }
+ return response['arrayBuffer']();
+ }).catch(function () {
+ return getBinary(wasmBinaryFile);
+ });
+ }
+ else {
+ if (readAsync) {
+ // fetch is not available or url is file => try XHR (readAsync uses XHR internally)
+ return new Promise(function(resolve, reject) {
+ readAsync(wasmBinaryFile, function(response) { resolve(new Uint8Array(/** @type{!ArrayBuffer} */(response))) }, reject)
+ });
+ }
+ }
+ }
+
+ // Otherwise, getBinary should be able to get it synchronously
+ return Promise.resolve().then(function() { return getBinary(wasmBinaryFile); });
+}
+
+// Create the wasm instance.
+// Receives the wasm imports, returns the exports.
+function createWasm() {
+ // prepare imports
+ var info = {
+ 'env': asmLibraryArg,
+ 'wasi_snapshot_preview1': asmLibraryArg,
+ };
+ // Load the wasm module and create an instance of using native support in the JS engine.
+ // handle a generated wasm instance, receiving its exports and
+ // performing other necessary setup
+ /** @param {WebAssembly.Module=} module*/
+ function receiveInstance(instance, module) {
+ var exports = instance.exports;
+
+ Module['asm'] = exports;
+
+ wasmMemory = Module['asm']['memory'];
+ updateGlobalBufferAndViews(wasmMemory.buffer);
+
+ wasmTable = Module['asm']['__indirect_function_table'];
+
+ addOnInit(Module['asm']['__wasm_call_ctors']);
+
+ removeRunDependency('wasm-instantiate');
+
+ }
+ // we can't run yet (except in a pthread, where we have a custom sync instantiator)
+ addRunDependency('wasm-instantiate');
+
+ // Prefer streaming instantiation if available.
+ function receiveInstantiationResult(result) {
+ // 'result' is a ResultObject object which has both the module and instance.
+ // receiveInstance() will swap in the exports (to Module.asm) so they can be called
+ // TODO: Due to Closure regression https://github.com/google/closure-compiler/issues/3193, the above line no longer optimizes out down to the following line.
+ // When the regression is fixed, can restore the above USE_PTHREADS-enabled path.
+ receiveInstance(result['instance']);
+ }
+
+ function instantiateArrayBuffer(receiver) {
+ return getBinaryPromise().then(function(binary) {
+ return WebAssembly.instantiate(binary, info);
+ }).then(function (instance) {
+ return instance;
+ }).then(receiver, function(reason) {
+ err('failed to asynchronously prepare wasm: ' + reason);
+
+ abort(reason);
+ });
+ }
+
+ function instantiateAsync() {
+ if (!wasmBinary &&
+ typeof WebAssembly.instantiateStreaming == 'function' &&
+ !isDataURI(wasmBinaryFile) &&
+ // Don't use streaming for file:// delivered objects in a webview, fetch them synchronously.
+ !isFileURI(wasmBinaryFile) &&
+ typeof fetch == 'function') {
+ return fetch(wasmBinaryFile, { credentials: 'same-origin' }).then(function(response) {
+ // Suppress closure warning here since the upstream definition for
+ // instantiateStreaming only allows Promise rather than
+ // an actual Response.
+ // TODO(https://github.com/google/closure-compiler/pull/3913): Remove if/when upstream closure is fixed.
+ /** @suppress {checkTypes} */
+ var result = WebAssembly.instantiateStreaming(response, info);
+
+ return result.then(
+ receiveInstantiationResult,
+ function(reason) {
+ // We expect the most common failure cause to be a bad MIME type for the binary,
+ // in which case falling back to ArrayBuffer instantiation should work.
+ err('wasm streaming compile failed: ' + reason);
+ err('falling back to ArrayBuffer instantiation');
+ return instantiateArrayBuffer(receiveInstantiationResult);
+ });
+ });
+ } else {
+ return instantiateArrayBuffer(receiveInstantiationResult);
+ }
+ }
+
+ // User shell pages can write their own Module.instantiateWasm = function(imports, successCallback) callback
+ // to manually instantiate the Wasm module themselves. This allows pages to run the instantiation parallel
+ // to any other async startup actions they are performing.
+ // Also pthreads and wasm workers initialize the wasm instance through this path.
+ if (Module['instantiateWasm']) {
+ try {
+ var exports = Module['instantiateWasm'](info, receiveInstance);
+ return exports;
+ } catch(e) {
+ err('Module.instantiateWasm callback failed with error: ' + e);
+ return false;
+ }
+ }
+
+ // If instantiation fails, reject the module ready promise.
+ instantiateAsync().catch(readyPromiseReject);
+ return {}; // no exports yet; we'll fill them in later
+}
+
+// Globals used by JS i64 conversions (see makeSetValue)
+var tempDouble;
+var tempI64;
+
+// === Body ===
+
+var ASM_CONSTS = {
+
+};
+
+
+
+
+
+
+ function callRuntimeCallbacks(callbacks) {
+ while (callbacks.length > 0) {
+ var callback = callbacks.shift();
+ if (typeof callback == 'function') {
+ callback(Module); // Pass the module as the first argument.
+ continue;
+ }
+ var func = callback.func;
+ if (typeof func == 'number') {
+ if (callback.arg === undefined) {
+ // Run the wasm function ptr with signature 'v'. If no function
+ // with such signature was exported, this call does not need
+ // to be emitted (and would confuse Closure)
+ getWasmTableEntry(func)();
+ } else {
+ // If any function with signature 'vi' was exported, run
+ // the callback with that signature.
+ getWasmTableEntry(func)(callback.arg);
+ }
+ } else {
+ func(callback.arg === undefined ? null : callback.arg);
+ }
+ }
+ }
+
+ function withStackSave(f) {
+ var stack = stackSave();
+ var ret = f();
+ stackRestore(stack);
+ return ret;
+ }
+ function demangle(func) {
+ return func;
+ }
+
+ function demangleAll(text) {
+ var regex =
+ /\b_Z[\w\d_]+/g;
+ return text.replace(regex,
+ function(x) {
+ var y = demangle(x);
+ return x === y ? x : (y + ' [' + x + ']');
+ });
+ }
+
+
+ /**
+ * @param {number} ptr
+ * @param {string} type
+ */
+ function getValue(ptr, type = 'i8') {
+ if (type.endsWith('*')) type = 'i32';
+ switch (type) {
+ case 'i1': return HEAP8[((ptr)>>0)];
+ case 'i8': return HEAP8[((ptr)>>0)];
+ case 'i16': return HEAP16[((ptr)>>1)];
+ case 'i32': return HEAP32[((ptr)>>2)];
+ case 'i64': return HEAP32[((ptr)>>2)];
+ case 'float': return HEAPF32[((ptr)>>2)];
+ case 'double': return Number(HEAPF64[((ptr)>>3)]);
+ default: abort('invalid type for getValue: ' + type);
+ }
+ return null;
+ }
+
+ var wasmTableMirror = [];
+ function getWasmTableEntry(funcPtr) {
+ var func = wasmTableMirror[funcPtr];
+ if (!func) {
+ if (funcPtr >= wasmTableMirror.length) wasmTableMirror.length = funcPtr + 1;
+ wasmTableMirror[funcPtr] = func = wasmTable.get(funcPtr);
+ }
+ return func;
+ }
+
+ function handleException(e) {
+ // Certain exception types we do not treat as errors since they are used for
+ // internal control flow.
+ // 1. ExitStatus, which is thrown by exit()
+ // 2. "unwind", which is thrown by emscripten_unwind_to_js_event_loop() and others
+ // that wish to return to JS event loop.
+ if (e instanceof ExitStatus || e == 'unwind') {
+ return EXITSTATUS;
+ }
+ quit_(1, e);
+ }
+
+ function jsStackTrace() {
+ var error = new Error();
+ if (!error.stack) {
+ // IE10+ special cases: It does have callstack info, but it is only
+ // populated if an Error object is thrown, so try that as a special-case.
+ try {
+ throw new Error();
+ } catch(e) {
+ error = e;
+ }
+ if (!error.stack) {
+ return '(no stack trace available)';
+ }
+ }
+ return error.stack.toString();
+ }
+
+
+ /**
+ * @param {number} ptr
+ * @param {number} value
+ * @param {string} type
+ */
+ function setValue(ptr, value, type = 'i8') {
+ if (type.endsWith('*')) type = 'i32';
+ switch (type) {
+ case 'i1': HEAP8[((ptr)>>0)] = value; break;
+ case 'i8': HEAP8[((ptr)>>0)] = value; break;
+ case 'i16': HEAP16[((ptr)>>1)] = value; break;
+ case 'i32': HEAP32[((ptr)>>2)] = value; break;
+ case 'i64': (tempI64 = [value>>>0,(tempDouble=value,(+(Math.abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? ((Math.min((+(Math.floor((tempDouble)/4294967296.0))), 4294967295.0))|0)>>>0 : (~~((+(Math.ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)],HEAP32[((ptr)>>2)] = tempI64[0],HEAP32[(((ptr)+(4))>>2)] = tempI64[1]); break;
+ case 'float': HEAPF32[((ptr)>>2)] = value; break;
+ case 'double': HEAPF64[((ptr)>>3)] = value; break;
+ default: abort('invalid type for setValue: ' + type);
+ }
+ }
+
+ function setWasmTableEntry(idx, func) {
+ wasmTable.set(idx, func);
+ // With ABORT_ON_WASM_EXCEPTIONS wasmTable.get is overriden to return wrapped
+ // functions so we need to call it here to retrieve the potential wrapper correctly
+ // instead of just storing 'func' directly into wasmTableMirror
+ wasmTableMirror[idx] = wasmTable.get(idx);
+ }
+
+ function stackTrace() {
+ var js = jsStackTrace();
+ if (Module['extraStackTrace']) js += '\n' + Module['extraStackTrace']();
+ return demangleAll(js);
+ }
+
+ var EXAMPLE = {internal_func:function () {
+ }};
+ function _InterceptGLObject() {
+ globalThis.AvaloniaGL = GL
+ }
+
+ /** @type {function(...*):?} */
+ function __ZNKSt3__220__vector_base_commonILb1EE20__throw_length_errorEv(
+ ) {
+ err('missing function: _ZNKSt3__220__vector_base_commonILb1EE20__throw_length_errorEv'); abort(-1);
+ }
+
+ function ___assert_fail(condition, filename, line, func) {
+ abort('Assertion failed: ' + UTF8ToString(condition) + ', at: ' + [filename ? UTF8ToString(filename) : 'unknown filename', line, func ? UTF8ToString(func) : 'unknown function']);
+ }
+
+ function ___cxa_allocate_exception(size) {
+ // Thrown object is prepended by exception metadata block
+ return _malloc(size + 24) + 24;
+ }
+
+ var exceptionCaught = [];
+
+ function exception_addRef(info) {
+ info.add_ref();
+ }
+
+ var uncaughtExceptionCount = 0;
+ function ___cxa_begin_catch(ptr) {
+ var info = new ExceptionInfo(ptr);
+ if (!info.get_caught()) {
+ info.set_caught(true);
+ uncaughtExceptionCount--;
+ }
+ info.set_rethrown(false);
+ exceptionCaught.push(info);
+ exception_addRef(info);
+ return info.get_exception_ptr();
+ }
+
+ var exceptionLast = 0;
+
+ /** @constructor */
+ function ExceptionInfo(excPtr) {
+ this.excPtr = excPtr;
+ this.ptr = excPtr - 24;
+
+ this.set_type = function(type) {
+ HEAPU32[(((this.ptr)+(4))>>2)] = type;
+ };
+
+ this.get_type = function() {
+ return HEAPU32[(((this.ptr)+(4))>>2)];
+ };
+
+ this.set_destructor = function(destructor) {
+ HEAPU32[(((this.ptr)+(8))>>2)] = destructor;
+ };
+
+ this.get_destructor = function() {
+ return HEAPU32[(((this.ptr)+(8))>>2)];
+ };
+
+ this.set_refcount = function(refcount) {
+ HEAP32[((this.ptr)>>2)] = refcount;
+ };
+
+ this.set_caught = function (caught) {
+ caught = caught ? 1 : 0;
+ HEAP8[(((this.ptr)+(12))>>0)] = caught;
+ };
+
+ this.get_caught = function () {
+ return HEAP8[(((this.ptr)+(12))>>0)] != 0;
+ };
+
+ this.set_rethrown = function (rethrown) {
+ rethrown = rethrown ? 1 : 0;
+ HEAP8[(((this.ptr)+(13))>>0)] = rethrown;
+ };
+
+ this.get_rethrown = function () {
+ return HEAP8[(((this.ptr)+(13))>>0)] != 0;
+ };
+
+ // Initialize native structure fields. Should be called once after allocated.
+ this.init = function(type, destructor) {
+ this.set_adjusted_ptr(0);
+ this.set_type(type);
+ this.set_destructor(destructor);
+ this.set_refcount(0);
+ this.set_caught(false);
+ this.set_rethrown(false);
+ }
+
+ this.add_ref = function() {
+ var value = HEAP32[((this.ptr)>>2)];
+ HEAP32[((this.ptr)>>2)] = value + 1;
+ };
+
+ // Returns true if last reference released.
+ this.release_ref = function() {
+ var prev = HEAP32[((this.ptr)>>2)];
+ HEAP32[((this.ptr)>>2)] = prev - 1;
+ return prev === 1;
+ };
+
+ this.set_adjusted_ptr = function(adjustedPtr) {
+ HEAPU32[(((this.ptr)+(16))>>2)] = adjustedPtr;
+ };
+
+ this.get_adjusted_ptr = function() {
+ return HEAPU32[(((this.ptr)+(16))>>2)];
+ };
+
+ // Get pointer which is expected to be received by catch clause in C++ code. It may be adjusted
+ // when the pointer is casted to some of the exception object base classes (e.g. when virtual
+ // inheritance is used). When a pointer is thrown this method should return the thrown pointer
+ // itself.
+ this.get_exception_ptr = function() {
+ // Work around a fastcomp bug, this code is still included for some reason in a build without
+ // exceptions support.
+ var isPointer = ___cxa_is_pointer_type(this.get_type());
+ if (isPointer) {
+ return HEAPU32[((this.excPtr)>>2)];
+ }
+ var adjusted = this.get_adjusted_ptr();
+ if (adjusted !== 0) return adjusted;
+ return this.excPtr;
+ };
+ }
+ function ___cxa_free_exception(ptr) {
+ return _free(new ExceptionInfo(ptr).ptr);
+ }
+ function exception_decRef(info) {
+ // A rethrown exception can reach refcount 0; it must not be discarded
+ // Its next handler will clear the rethrown flag and addRef it, prior to
+ // final decRef and destruction here
+ if (info.release_ref() && !info.get_rethrown()) {
+ var destructor = info.get_destructor();
+ if (destructor) {
+ // In Wasm, destructors return 'this' as in ARM
+ getWasmTableEntry(destructor)(info.excPtr);
+ }
+ ___cxa_free_exception(info.excPtr);
+ }
+ }
+ function ___cxa_end_catch() {
+ // Clear state flag.
+ _setThrew(0);
+ // Call destructor if one is registered then clear it.
+ var info = exceptionCaught.pop();
+
+ exception_decRef(info);
+ exceptionLast = 0; // XXX in decRef?
+ }
+
+ function ___resumeException(ptr) {
+ if (!exceptionLast) { exceptionLast = ptr; }
+ throw ptr;
+ }
+ function ___cxa_find_matching_catch_2() {
+ var thrown = exceptionLast;
+ if (!thrown) {
+ // just pass through the null ptr
+ setTempRet0(0);
+ return 0;
+ }
+ var info = new ExceptionInfo(thrown);
+ info.set_adjusted_ptr(thrown);
+ var thrownType = info.get_type();
+ if (!thrownType) {
+ // just pass through the thrown ptr
+ setTempRet0(0);
+ return thrown;
+ }
+ var typeArray = Array.prototype.slice.call(arguments);
+
+ // can_catch receives a **, add indirection
+ // The different catch blocks are denoted by different types.
+ // Due to inheritance, those types may not precisely match the
+ // type of the thrown object. Find one which matches, and
+ // return the type of the catch block which should be called.
+ for (var i = 0; i < typeArray.length; i++) {
+ var caughtType = typeArray[i];
+ if (caughtType === 0 || caughtType === thrownType) {
+ // Catch all clause matched or exactly the same type is caught
+ break;
+ }
+ var adjusted_ptr_addr = info.ptr + 16;
+ if (___cxa_can_catch(caughtType, thrownType, adjusted_ptr_addr)) {
+ setTempRet0(caughtType);
+ return thrown;
+ }
+ }
+ setTempRet0(thrownType);
+ return thrown;
+ }
+
+ function ___cxa_find_matching_catch_3() {
+ var thrown = exceptionLast;
+ if (!thrown) {
+ // just pass through the null ptr
+ setTempRet0(0);
+ return 0;
+ }
+ var info = new ExceptionInfo(thrown);
+ info.set_adjusted_ptr(thrown);
+ var thrownType = info.get_type();
+ if (!thrownType) {
+ // just pass through the thrown ptr
+ setTempRet0(0);
+ return thrown;
+ }
+ var typeArray = Array.prototype.slice.call(arguments);
+
+ // can_catch receives a **, add indirection
+ // The different catch blocks are denoted by different types.
+ // Due to inheritance, those types may not precisely match the
+ // type of the thrown object. Find one which matches, and
+ // return the type of the catch block which should be called.
+ for (var i = 0; i < typeArray.length; i++) {
+ var caughtType = typeArray[i];
+ if (caughtType === 0 || caughtType === thrownType) {
+ // Catch all clause matched or exactly the same type is caught
+ break;
+ }
+ var adjusted_ptr_addr = info.ptr + 16;
+ if (___cxa_can_catch(caughtType, thrownType, adjusted_ptr_addr)) {
+ setTempRet0(caughtType);
+ return thrown;
+ }
+ }
+ setTempRet0(thrownType);
+ return thrown;
+ }
+
+
+ function ___cxa_rethrow() {
+ var info = exceptionCaught.pop();
+ if (!info) {
+ abort('no exception to throw');
+ }
+ var ptr = info.excPtr;
+ if (!info.get_rethrown()) {
+ // Only pop if the corresponding push was through rethrow_primary_exception
+ exceptionCaught.push(info);
+ info.set_rethrown(true);
+ info.set_caught(false);
+ uncaughtExceptionCount++;
+ }
+ exceptionLast = ptr;
+ throw ptr;
+ }
+
+ function ___cxa_throw(ptr, type, destructor) {
+ var info = new ExceptionInfo(ptr);
+ // Initialize ExceptionInfo content after it was allocated in __cxa_allocate_exception.
+ info.init(type, destructor);
+ exceptionLast = ptr;
+ uncaughtExceptionCount++;
+ throw ptr;
+ }
+
+ function ___cxa_uncaught_exceptions() {
+ return uncaughtExceptionCount;
+ }
+
+
+ var PATH = {isAbs:(path) => path.charAt(0) === '/',splitPath:(filename) => {
+ var splitPathRe = /^(\/?|)([\s\S]*?)((?:\.{1,2}|[^\/]+?|)(\.[^.\/]*|))(?:[\/]*)$/;
+ return splitPathRe.exec(filename).slice(1);
+ },normalizeArray:(parts, allowAboveRoot) => {
+ // if the path tries to go above the root, `up` ends up > 0
+ var up = 0;
+ for (var i = parts.length - 1; i >= 0; i--) {
+ var last = parts[i];
+ if (last === '.') {
+ parts.splice(i, 1);
+ } else if (last === '..') {
+ parts.splice(i, 1);
+ up++;
+ } else if (up) {
+ parts.splice(i, 1);
+ up--;
+ }
+ }
+ // if the path is allowed to go above the root, restore leading ..s
+ if (allowAboveRoot) {
+ for (; up; up--) {
+ parts.unshift('..');
+ }
+ }
+ return parts;
+ },normalize:(path) => {
+ var isAbsolute = PATH.isAbs(path),
+ trailingSlash = path.substr(-1) === '/';
+ // Normalize the path
+ path = PATH.normalizeArray(path.split('/').filter((p) => !!p), !isAbsolute).join('/');
+ if (!path && !isAbsolute) {
+ path = '.';
+ }
+ if (path && trailingSlash) {
+ path += '/';
+ }
+ return (isAbsolute ? '/' : '') + path;
+ },dirname:(path) => {
+ var result = PATH.splitPath(path),
+ root = result[0],
+ dir = result[1];
+ if (!root && !dir) {
+ // No dirname whatsoever
+ return '.';
+ }
+ if (dir) {
+ // It has a dirname, strip trailing slash
+ dir = dir.substr(0, dir.length - 1);
+ }
+ return root + dir;
+ },basename:(path) => {
+ // EMSCRIPTEN return '/'' for '/', not an empty string
+ if (path === '/') return '/';
+ path = PATH.normalize(path);
+ path = path.replace(/\/$/, "");
+ var lastSlash = path.lastIndexOf('/');
+ if (lastSlash === -1) return path;
+ return path.substr(lastSlash+1);
+ },join:function() {
+ var paths = Array.prototype.slice.call(arguments, 0);
+ return PATH.normalize(paths.join('/'));
+ },join2:(l, r) => {
+ return PATH.normalize(l + '/' + r);
+ }};
+
+ function getRandomDevice() {
+ if (typeof crypto == 'object' && typeof crypto['getRandomValues'] == 'function') {
+ // for modern web browsers
+ var randomBuffer = new Uint8Array(1);
+ return function() { crypto.getRandomValues(randomBuffer); return randomBuffer[0]; };
+ } else
+ if (ENVIRONMENT_IS_NODE) {
+ // for nodejs with or without crypto support included
+ try {
+ var crypto_module = require('crypto');
+ // nodejs has crypto support
+ return function() { return crypto_module['randomBytes'](1)[0]; };
+ } catch (e) {
+ // nodejs doesn't have crypto support
+ }
+ }
+ // we couldn't find a proper implementation, as Math.random() is not suitable for /dev/random, see emscripten-core/emscripten/pull/7096
+ return function() { abort("randomDevice"); };
+ }
+
+ var PATH_FS = {resolve:function() {
+ var resolvedPath = '',
+ resolvedAbsolute = false;
+ for (var i = arguments.length - 1; i >= -1 && !resolvedAbsolute; i--) {
+ var path = (i >= 0) ? arguments[i] : FS.cwd();
+ // Skip empty and invalid entries
+ if (typeof path != 'string') {
+ throw new TypeError('Arguments to path.resolve must be strings');
+ } else if (!path) {
+ return ''; // an invalid portion invalidates the whole thing
+ }
+ resolvedPath = path + '/' + resolvedPath;
+ resolvedAbsolute = PATH.isAbs(path);
+ }
+ // At this point the path should be resolved to a full absolute path, but
+ // handle relative paths to be safe (might happen when process.cwd() fails)
+ resolvedPath = PATH.normalizeArray(resolvedPath.split('/').filter((p) => !!p), !resolvedAbsolute).join('/');
+ return ((resolvedAbsolute ? '/' : '') + resolvedPath) || '.';
+ },relative:(from, to) => {
+ from = PATH_FS.resolve(from).substr(1);
+ to = PATH_FS.resolve(to).substr(1);
+ function trim(arr) {
+ var start = 0;
+ for (; start < arr.length; start++) {
+ if (arr[start] !== '') break;
+ }
+ var end = arr.length - 1;
+ for (; end >= 0; end--) {
+ if (arr[end] !== '') break;
+ }
+ if (start > end) return [];
+ return arr.slice(start, end - start + 1);
+ }
+ var fromParts = trim(from.split('/'));
+ var toParts = trim(to.split('/'));
+ var length = Math.min(fromParts.length, toParts.length);
+ var samePartsLength = length;
+ for (var i = 0; i < length; i++) {
+ if (fromParts[i] !== toParts[i]) {
+ samePartsLength = i;
+ break;
+ }
+ }
+ var outputParts = [];
+ for (var i = samePartsLength; i < fromParts.length; i++) {
+ outputParts.push('..');
+ }
+ outputParts = outputParts.concat(toParts.slice(samePartsLength));
+ return outputParts.join('/');
+ }};
+
+ var TTY = {ttys:[],init:function () {
+ // https://github.com/emscripten-core/emscripten/pull/1555
+ // if (ENVIRONMENT_IS_NODE) {
+ // // currently, FS.init does not distinguish if process.stdin is a file or TTY
+ // // device, it always assumes it's a TTY device. because of this, we're forcing
+ // // process.stdin to UTF8 encoding to at least make stdin reading compatible
+ // // with text files until FS.init can be refactored.
+ // process['stdin']['setEncoding']('utf8');
+ // }
+ },shutdown:function() {
+ // https://github.com/emscripten-core/emscripten/pull/1555
+ // if (ENVIRONMENT_IS_NODE) {
+ // // inolen: any idea as to why node -e 'process.stdin.read()' wouldn't exit immediately (with process.stdin being a tty)?
+ // // isaacs: because now it's reading from the stream, you've expressed interest in it, so that read() kicks off a _read() which creates a ReadReq operation
+ // // inolen: I thought read() in that case was a synchronous operation that just grabbed some amount of buffered data if it exists?
+ // // isaacs: it is. but it also triggers a _read() call, which calls readStart() on the handle
+ // // isaacs: do process.stdin.pause() and i'd think it'd probably close the pending call
+ // process['stdin']['pause']();
+ // }
+ },register:function(dev, ops) {
+ TTY.ttys[dev] = { input: [], output: [], ops: ops };
+ FS.registerDevice(dev, TTY.stream_ops);
+ },stream_ops:{open:function(stream) {
+ var tty = TTY.ttys[stream.node.rdev];
+ if (!tty) {
+ throw new FS.ErrnoError(43);
+ }
+ stream.tty = tty;
+ stream.seekable = false;
+ },close:function(stream) {
+ // flush any pending line data
+ stream.tty.ops.flush(stream.tty);
+ },flush:function(stream) {
+ stream.tty.ops.flush(stream.tty);
+ },read:function(stream, buffer, offset, length, pos /* ignored */) {
+ if (!stream.tty || !stream.tty.ops.get_char) {
+ throw new FS.ErrnoError(60);
+ }
+ var bytesRead = 0;
+ for (var i = 0; i < length; i++) {
+ var result;
+ try {
+ result = stream.tty.ops.get_char(stream.tty);
+ } catch (e) {
+ throw new FS.ErrnoError(29);
+ }
+ if (result === undefined && bytesRead === 0) {
+ throw new FS.ErrnoError(6);
+ }
+ if (result === null || result === undefined) break;
+ bytesRead++;
+ buffer[offset+i] = result;
+ }
+ if (bytesRead) {
+ stream.node.timestamp = Date.now();
+ }
+ return bytesRead;
+ },write:function(stream, buffer, offset, length, pos) {
+ if (!stream.tty || !stream.tty.ops.put_char) {
+ throw new FS.ErrnoError(60);
+ }
+ try {
+ for (var i = 0; i < length; i++) {
+ stream.tty.ops.put_char(stream.tty, buffer[offset+i]);
+ }
+ } catch (e) {
+ throw new FS.ErrnoError(29);
+ }
+ if (length) {
+ stream.node.timestamp = Date.now();
+ }
+ return i;
+ }},default_tty_ops:{get_char:function(tty) {
+ if (!tty.input.length) {
+ var result = null;
+ if (ENVIRONMENT_IS_NODE) {
+ // we will read data by chunks of BUFSIZE
+ var BUFSIZE = 256;
+ var buf = Buffer.alloc(BUFSIZE);
+ var bytesRead = 0;
+
+ try {
+ bytesRead = fs.readSync(process.stdin.fd, buf, 0, BUFSIZE, -1);
+ } catch(e) {
+ // Cross-platform differences: on Windows, reading EOF throws an exception, but on other OSes,
+ // reading EOF returns 0. Uniformize behavior by treating the EOF exception to return 0.
+ if (e.toString().includes('EOF')) bytesRead = 0;
+ else throw e;
+ }
+
+ if (bytesRead > 0) {
+ result = buf.slice(0, bytesRead).toString('utf-8');
+ } else {
+ result = null;
+ }
+ } else
+ if (typeof window != 'undefined' &&
+ typeof window.prompt == 'function') {
+ // Browser.
+ result = window.prompt('Input: '); // returns null on cancel
+ if (result !== null) {
+ result += '\n';
+ }
+ } else if (typeof readline == 'function') {
+ // Command line.
+ result = readline();
+ if (result !== null) {
+ result += '\n';
+ }
+ }
+ if (!result) {
+ return null;
+ }
+ tty.input = intArrayFromString(result, true);
+ }
+ return tty.input.shift();
+ },put_char:function(tty, val) {
+ if (val === null || val === 10) {
+ out(UTF8ArrayToString(tty.output, 0));
+ tty.output = [];
+ } else {
+ if (val != 0) tty.output.push(val); // val == 0 would cut text output off in the middle.
+ }
+ },flush:function(tty) {
+ if (tty.output && tty.output.length > 0) {
+ out(UTF8ArrayToString(tty.output, 0));
+ tty.output = [];
+ }
+ }},default_tty1_ops:{put_char:function(tty, val) {
+ if (val === null || val === 10) {
+ err(UTF8ArrayToString(tty.output, 0));
+ tty.output = [];
+ } else {
+ if (val != 0) tty.output.push(val);
+ }
+ },flush:function(tty) {
+ if (tty.output && tty.output.length > 0) {
+ err(UTF8ArrayToString(tty.output, 0));
+ tty.output = [];
+ }
+ }}};
+
+ function zeroMemory(address, size) {
+ HEAPU8.fill(0, address, address + size);
+ }
+
+ function alignMemory(size, alignment) {
+ return Math.ceil(size / alignment) * alignment;
+ }
+ function mmapAlloc(size) {
+ size = alignMemory(size, 65536);
+ var ptr = _emscripten_builtin_memalign(65536, size);
+ if (!ptr) return 0;
+ zeroMemory(ptr, size);
+ return ptr;
+ }
+ var MEMFS = {ops_table:null,mount:function(mount) {
+ return MEMFS.createNode(null, '/', 16384 | 511 /* 0777 */, 0);
+ },createNode:function(parent, name, mode, dev) {
+ if (FS.isBlkdev(mode) || FS.isFIFO(mode)) {
+ // no supported
+ throw new FS.ErrnoError(63);
+ }
+ if (!MEMFS.ops_table) {
+ MEMFS.ops_table = {
+ dir: {
+ node: {
+ getattr: MEMFS.node_ops.getattr,
+ setattr: MEMFS.node_ops.setattr,
+ lookup: MEMFS.node_ops.lookup,
+ mknod: MEMFS.node_ops.mknod,
+ rename: MEMFS.node_ops.rename,
+ unlink: MEMFS.node_ops.unlink,
+ rmdir: MEMFS.node_ops.rmdir,
+ readdir: MEMFS.node_ops.readdir,
+ symlink: MEMFS.node_ops.symlink
+ },
+ stream: {
+ llseek: MEMFS.stream_ops.llseek
+ }
+ },
+ file: {
+ node: {
+ getattr: MEMFS.node_ops.getattr,
+ setattr: MEMFS.node_ops.setattr
+ },
+ stream: {
+ llseek: MEMFS.stream_ops.llseek,
+ read: MEMFS.stream_ops.read,
+ write: MEMFS.stream_ops.write,
+ allocate: MEMFS.stream_ops.allocate,
+ mmap: MEMFS.stream_ops.mmap,
+ msync: MEMFS.stream_ops.msync
+ }
+ },
+ link: {
+ node: {
+ getattr: MEMFS.node_ops.getattr,
+ setattr: MEMFS.node_ops.setattr,
+ readlink: MEMFS.node_ops.readlink
+ },
+ stream: {}
+ },
+ chrdev: {
+ node: {
+ getattr: MEMFS.node_ops.getattr,
+ setattr: MEMFS.node_ops.setattr
+ },
+ stream: FS.chrdev_stream_ops
+ }
+ };
+ }
+ var node = FS.createNode(parent, name, mode, dev);
+ if (FS.isDir(node.mode)) {
+ node.node_ops = MEMFS.ops_table.dir.node;
+ node.stream_ops = MEMFS.ops_table.dir.stream;
+ node.contents = {};
+ } else if (FS.isFile(node.mode)) {
+ node.node_ops = MEMFS.ops_table.file.node;
+ node.stream_ops = MEMFS.ops_table.file.stream;
+ node.usedBytes = 0; // The actual number of bytes used in the typed array, as opposed to contents.length which gives the whole capacity.
+ // When the byte data of the file is populated, this will point to either a typed array, or a normal JS array. Typed arrays are preferred
+ // for performance, and used by default. However, typed arrays are not resizable like normal JS arrays are, so there is a small disk size
+ // penalty involved for appending file writes that continuously grow a file similar to std::vector capacity vs used -scheme.
+ node.contents = null;
+ } else if (FS.isLink(node.mode)) {
+ node.node_ops = MEMFS.ops_table.link.node;
+ node.stream_ops = MEMFS.ops_table.link.stream;
+ } else if (FS.isChrdev(node.mode)) {
+ node.node_ops = MEMFS.ops_table.chrdev.node;
+ node.stream_ops = MEMFS.ops_table.chrdev.stream;
+ }
+ node.timestamp = Date.now();
+ // add the new node to the parent
+ if (parent) {
+ parent.contents[name] = node;
+ parent.timestamp = node.timestamp;
+ }
+ return node;
+ },getFileDataAsTypedArray:function(node) {
+ if (!node.contents) return new Uint8Array(0);
+ if (node.contents.subarray) return node.contents.subarray(0, node.usedBytes); // Make sure to not return excess unused bytes.
+ return new Uint8Array(node.contents);
+ },expandFileStorage:function(node, newCapacity) {
+ var prevCapacity = node.contents ? node.contents.length : 0;
+ if (prevCapacity >= newCapacity) return; // No need to expand, the storage was already large enough.
+ // Don't expand strictly to the given requested limit if it's only a very small increase, but instead geometrically grow capacity.
+ // For small filesizes (<1MB), perform size*2 geometric increase, but for large sizes, do a much more conservative size*1.125 increase to
+ // avoid overshooting the allocation cap by a very large margin.
+ var CAPACITY_DOUBLING_MAX = 1024 * 1024;
+ newCapacity = Math.max(newCapacity, (prevCapacity * (prevCapacity < CAPACITY_DOUBLING_MAX ? 2.0 : 1.125)) >>> 0);
+ if (prevCapacity != 0) newCapacity = Math.max(newCapacity, 256); // At minimum allocate 256b for each file when expanding.
+ var oldContents = node.contents;
+ node.contents = new Uint8Array(newCapacity); // Allocate new storage.
+ if (node.usedBytes > 0) node.contents.set(oldContents.subarray(0, node.usedBytes), 0); // Copy old data over to the new storage.
+ },resizeFileStorage:function(node, newSize) {
+ if (node.usedBytes == newSize) return;
+ if (newSize == 0) {
+ node.contents = null; // Fully decommit when requesting a resize to zero.
+ node.usedBytes = 0;
+ } else {
+ var oldContents = node.contents;
+ node.contents = new Uint8Array(newSize); // Allocate new storage.
+ if (oldContents) {
+ node.contents.set(oldContents.subarray(0, Math.min(newSize, node.usedBytes))); // Copy old data over to the new storage.
+ }
+ node.usedBytes = newSize;
+ }
+ },node_ops:{getattr:function(node) {
+ var attr = {};
+ // device numbers reuse inode numbers.
+ attr.dev = FS.isChrdev(node.mode) ? node.id : 1;
+ attr.ino = node.id;
+ attr.mode = node.mode;
+ attr.nlink = 1;
+ attr.uid = 0;
+ attr.gid = 0;
+ attr.rdev = node.rdev;
+ if (FS.isDir(node.mode)) {
+ attr.size = 4096;
+ } else if (FS.isFile(node.mode)) {
+ attr.size = node.usedBytes;
+ } else if (FS.isLink(node.mode)) {
+ attr.size = node.link.length;
+ } else {
+ attr.size = 0;
+ }
+ attr.atime = new Date(node.timestamp);
+ attr.mtime = new Date(node.timestamp);
+ attr.ctime = new Date(node.timestamp);
+ // NOTE: In our implementation, st_blocks = Math.ceil(st_size/st_blksize),
+ // but this is not required by the standard.
+ attr.blksize = 4096;
+ attr.blocks = Math.ceil(attr.size / attr.blksize);
+ return attr;
+ },setattr:function(node, attr) {
+ if (attr.mode !== undefined) {
+ node.mode = attr.mode;
+ }
+ if (attr.timestamp !== undefined) {
+ node.timestamp = attr.timestamp;
+ }
+ if (attr.size !== undefined) {
+ MEMFS.resizeFileStorage(node, attr.size);
+ }
+ },lookup:function(parent, name) {
+ throw FS.genericErrors[44];
+ },mknod:function(parent, name, mode, dev) {
+ return MEMFS.createNode(parent, name, mode, dev);
+ },rename:function(old_node, new_dir, new_name) {
+ // if we're overwriting a directory at new_name, make sure it's empty.
+ if (FS.isDir(old_node.mode)) {
+ var new_node;
+ try {
+ new_node = FS.lookupNode(new_dir, new_name);
+ } catch (e) {
+ }
+ if (new_node) {
+ for (var i in new_node.contents) {
+ throw new FS.ErrnoError(55);
+ }
+ }
+ }
+ // do the internal rewiring
+ delete old_node.parent.contents[old_node.name];
+ old_node.parent.timestamp = Date.now()
+ old_node.name = new_name;
+ new_dir.contents[new_name] = old_node;
+ new_dir.timestamp = old_node.parent.timestamp;
+ old_node.parent = new_dir;
+ },unlink:function(parent, name) {
+ delete parent.contents[name];
+ parent.timestamp = Date.now();
+ },rmdir:function(parent, name) {
+ var node = FS.lookupNode(parent, name);
+ for (var i in node.contents) {
+ throw new FS.ErrnoError(55);
+ }
+ delete parent.contents[name];
+ parent.timestamp = Date.now();
+ },readdir:function(node) {
+ var entries = ['.', '..'];
+ for (var key in node.contents) {
+ if (!node.contents.hasOwnProperty(key)) {
+ continue;
+ }
+ entries.push(key);
+ }
+ return entries;
+ },symlink:function(parent, newname, oldpath) {
+ var node = MEMFS.createNode(parent, newname, 511 /* 0777 */ | 40960, 0);
+ node.link = oldpath;
+ return node;
+ },readlink:function(node) {
+ if (!FS.isLink(node.mode)) {
+ throw new FS.ErrnoError(28);
+ }
+ return node.link;
+ }},stream_ops:{read:function(stream, buffer, offset, length, position) {
+ var contents = stream.node.contents;
+ if (position >= stream.node.usedBytes) return 0;
+ var size = Math.min(stream.node.usedBytes - position, length);
+ if (size > 8 && contents.subarray) { // non-trivial, and typed array
+ buffer.set(contents.subarray(position, position + size), offset);
+ } else {
+ for (var i = 0; i < size; i++) buffer[offset + i] = contents[position + i];
+ }
+ return size;
+ },write:function(stream, buffer, offset, length, position, canOwn) {
+ // If the buffer is located in main memory (HEAP), and if
+ // memory can grow, we can't hold on to references of the
+ // memory buffer, as they may get invalidated. That means we
+ // need to do copy its contents.
+ if (buffer.buffer === HEAP8.buffer) {
+ canOwn = false;
+ }
+
+ if (!length) return 0;
+ var node = stream.node;
+ node.timestamp = Date.now();
+
+ if (buffer.subarray && (!node.contents || node.contents.subarray)) { // This write is from a typed array to a typed array?
+ if (canOwn) {
+ node.contents = buffer.subarray(offset, offset + length);
+ node.usedBytes = length;
+ return length;
+ } else if (node.usedBytes === 0 && position === 0) { // If this is a simple first write to an empty file, do a fast set since we don't need to care about old data.
+ node.contents = buffer.slice(offset, offset + length);
+ node.usedBytes = length;
+ return length;
+ } else if (position + length <= node.usedBytes) { // Writing to an already allocated and used subrange of the file?
+ node.contents.set(buffer.subarray(offset, offset + length), position);
+ return length;
+ }
+ }
+
+ // Appending to an existing file and we need to reallocate, or source data did not come as a typed array.
+ MEMFS.expandFileStorage(node, position+length);
+ if (node.contents.subarray && buffer.subarray) {
+ // Use typed array write which is available.
+ node.contents.set(buffer.subarray(offset, offset + length), position);
+ } else {
+ for (var i = 0; i < length; i++) {
+ node.contents[position + i] = buffer[offset + i]; // Or fall back to manual write if not.
+ }
+ }
+ node.usedBytes = Math.max(node.usedBytes, position + length);
+ return length;
+ },llseek:function(stream, offset, whence) {
+ var position = offset;
+ if (whence === 1) {
+ position += stream.position;
+ } else if (whence === 2) {
+ if (FS.isFile(stream.node.mode)) {
+ position += stream.node.usedBytes;
+ }
+ }
+ if (position < 0) {
+ throw new FS.ErrnoError(28);
+ }
+ return position;
+ },allocate:function(stream, offset, length) {
+ MEMFS.expandFileStorage(stream.node, offset + length);
+ stream.node.usedBytes = Math.max(stream.node.usedBytes, offset + length);
+ },mmap:function(stream, length, position, prot, flags) {
+ if (!FS.isFile(stream.node.mode)) {
+ throw new FS.ErrnoError(43);
+ }
+ var ptr;
+ var allocated;
+ var contents = stream.node.contents;
+ // Only make a new copy when MAP_PRIVATE is specified.
+ if (!(flags & 2) && contents.buffer === buffer) {
+ // We can't emulate MAP_SHARED when the file is not backed by the buffer
+ // we're mapping to (e.g. the HEAP buffer).
+ allocated = false;
+ ptr = contents.byteOffset;
+ } else {
+ // Try to avoid unnecessary slices.
+ if (position > 0 || position + length < contents.length) {
+ if (contents.subarray) {
+ contents = contents.subarray(position, position + length);
+ } else {
+ contents = Array.prototype.slice.call(contents, position, position + length);
+ }
+ }
+ allocated = true;
+ ptr = mmapAlloc(length);
+ if (!ptr) {
+ throw new FS.ErrnoError(48);
+ }
+ HEAP8.set(contents, ptr);
+ }
+ return { ptr: ptr, allocated: allocated };
+ },msync:function(stream, buffer, offset, length, mmapFlags) {
+ if (!FS.isFile(stream.node.mode)) {
+ throw new FS.ErrnoError(43);
+ }
+ if (mmapFlags & 2) {
+ // MAP_PRIVATE calls need not to be synced back to underlying fs
+ return 0;
+ }
+
+ var bytesWritten = MEMFS.stream_ops.write(stream, buffer, 0, length, offset, false);
+ // should we check if bytesWritten and length are the same?
+ return 0;
+ }}};
+
+ /** @param {boolean=} noRunDep */
+ function asyncLoad(url, onload, onerror, noRunDep) {
+ var dep = !noRunDep ? getUniqueRunDependency('al ' + url) : '';
+ readAsync(url, function(arrayBuffer) {
+ assert(arrayBuffer, 'Loading data file "' + url + '" failed (no arrayBuffer).');
+ onload(new Uint8Array(arrayBuffer));
+ if (dep) removeRunDependency(dep);
+ }, function(event) {
+ if (onerror) {
+ onerror();
+ } else {
+ throw 'Loading data file "' + url + '" failed.';
+ }
+ });
+ if (dep) addRunDependency(dep);
+ }
+ var FS = {root:null,mounts:[],devices:{},streams:[],nextInode:1,nameTable:null,currentPath:"/",initialized:false,ignorePermissions:true,ErrnoError:null,genericErrors:{},filesystems:null,syncFSRequests:0,lookupPath:(path, opts = {}) => {
+ path = PATH_FS.resolve(FS.cwd(), path);
+
+ if (!path) return { path: '', node: null };
+
+ var defaults = {
+ follow_mount: true,
+ recurse_count: 0
+ };
+ opts = Object.assign(defaults, opts)
+
+ if (opts.recurse_count > 8) { // max recursive lookup of 8
+ throw new FS.ErrnoError(32);
+ }
+
+ // split the path
+ var parts = PATH.normalizeArray(path.split('/').filter((p) => !!p), false);
+
+ // start at the root
+ var current = FS.root;
+ var current_path = '/';
+
+ for (var i = 0; i < parts.length; i++) {
+ var islast = (i === parts.length-1);
+ if (islast && opts.parent) {
+ // stop resolving
+ break;
+ }
+
+ current = FS.lookupNode(current, parts[i]);
+ current_path = PATH.join2(current_path, parts[i]);
+
+ // jump to the mount's root node if this is a mountpoint
+ if (FS.isMountpoint(current)) {
+ if (!islast || (islast && opts.follow_mount)) {
+ current = current.mounted.root;
+ }
+ }
+
+ // by default, lookupPath will not follow a symlink if it is the final path component.
+ // setting opts.follow = true will override this behavior.
+ if (!islast || opts.follow) {
+ var count = 0;
+ while (FS.isLink(current.mode)) {
+ var link = FS.readlink(current_path);
+ current_path = PATH_FS.resolve(PATH.dirname(current_path), link);
+
+ var lookup = FS.lookupPath(current_path, { recurse_count: opts.recurse_count + 1 });
+ current = lookup.node;
+
+ if (count++ > 40) { // limit max consecutive symlinks to 40 (SYMLOOP_MAX).
+ throw new FS.ErrnoError(32);
+ }
+ }
+ }
+ }
+
+ return { path: current_path, node: current };
+ },getPath:(node) => {
+ var path;
+ while (true) {
+ if (FS.isRoot(node)) {
+ var mount = node.mount.mountpoint;
+ if (!path) return mount;
+ return mount[mount.length-1] !== '/' ? mount + '/' + path : mount + path;
+ }
+ path = path ? node.name + '/' + path : node.name;
+ node = node.parent;
+ }
+ },hashName:(parentid, name) => {
+ var hash = 0;
+
+ for (var i = 0; i < name.length; i++) {
+ hash = ((hash << 5) - hash + name.charCodeAt(i)) | 0;
+ }
+ return ((parentid + hash) >>> 0) % FS.nameTable.length;
+ },hashAddNode:(node) => {
+ var hash = FS.hashName(node.parent.id, node.name);
+ node.name_next = FS.nameTable[hash];
+ FS.nameTable[hash] = node;
+ },hashRemoveNode:(node) => {
+ var hash = FS.hashName(node.parent.id, node.name);
+ if (FS.nameTable[hash] === node) {
+ FS.nameTable[hash] = node.name_next;
+ } else {
+ var current = FS.nameTable[hash];
+ while (current) {
+ if (current.name_next === node) {
+ current.name_next = node.name_next;
+ break;
+ }
+ current = current.name_next;
+ }
+ }
+ },lookupNode:(parent, name) => {
+ var errCode = FS.mayLookup(parent);
+ if (errCode) {
+ throw new FS.ErrnoError(errCode, parent);
+ }
+ var hash = FS.hashName(parent.id, name);
+ for (var node = FS.nameTable[hash]; node; node = node.name_next) {
+ var nodeName = node.name;
+ if (node.parent.id === parent.id && nodeName === name) {
+ return node;
+ }
+ }
+ // if we failed to find it in the cache, call into the VFS
+ return FS.lookup(parent, name);
+ },createNode:(parent, name, mode, rdev) => {
+ var node = new FS.FSNode(parent, name, mode, rdev);
+
+ FS.hashAddNode(node);
+
+ return node;
+ },destroyNode:(node) => {
+ FS.hashRemoveNode(node);
+ },isRoot:(node) => {
+ return node === node.parent;
+ },isMountpoint:(node) => {
+ return !!node.mounted;
+ },isFile:(mode) => {
+ return (mode & 61440) === 32768;
+ },isDir:(mode) => {
+ return (mode & 61440) === 16384;
+ },isLink:(mode) => {
+ return (mode & 61440) === 40960;
+ },isChrdev:(mode) => {
+ return (mode & 61440) === 8192;
+ },isBlkdev:(mode) => {
+ return (mode & 61440) === 24576;
+ },isFIFO:(mode) => {
+ return (mode & 61440) === 4096;
+ },isSocket:(mode) => {
+ return (mode & 49152) === 49152;
+ },flagModes:{"r":0,"r+":2,"w":577,"w+":578,"a":1089,"a+":1090},modeStringToFlags:(str) => {
+ var flags = FS.flagModes[str];
+ if (typeof flags == 'undefined') {
+ throw new Error('Unknown file open mode: ' + str);
+ }
+ return flags;
+ },flagsToPermissionString:(flag) => {
+ var perms = ['r', 'w', 'rw'][flag & 3];
+ if ((flag & 512)) {
+ perms += 'w';
+ }
+ return perms;
+ },nodePermissions:(node, perms) => {
+ if (FS.ignorePermissions) {
+ return 0;
+ }
+ // return 0 if any user, group or owner bits are set.
+ if (perms.includes('r') && !(node.mode & 292)) {
+ return 2;
+ } else if (perms.includes('w') && !(node.mode & 146)) {
+ return 2;
+ } else if (perms.includes('x') && !(node.mode & 73)) {
+ return 2;
+ }
+ return 0;
+ },mayLookup:(dir) => {
+ var errCode = FS.nodePermissions(dir, 'x');
+ if (errCode) return errCode;
+ if (!dir.node_ops.lookup) return 2;
+ return 0;
+ },mayCreate:(dir, name) => {
+ try {
+ var node = FS.lookupNode(dir, name);
+ return 20;
+ } catch (e) {
+ }
+ return FS.nodePermissions(dir, 'wx');
+ },mayDelete:(dir, name, isdir) => {
+ var node;
+ try {
+ node = FS.lookupNode(dir, name);
+ } catch (e) {
+ return e.errno;
+ }
+ var errCode = FS.nodePermissions(dir, 'wx');
+ if (errCode) {
+ return errCode;
+ }
+ if (isdir) {
+ if (!FS.isDir(node.mode)) {
+ return 54;
+ }
+ if (FS.isRoot(node) || FS.getPath(node) === FS.cwd()) {
+ return 10;
+ }
+ } else {
+ if (FS.isDir(node.mode)) {
+ return 31;
+ }
+ }
+ return 0;
+ },mayOpen:(node, flags) => {
+ if (!node) {
+ return 44;
+ }
+ if (FS.isLink(node.mode)) {
+ return 32;
+ } else if (FS.isDir(node.mode)) {
+ if (FS.flagsToPermissionString(flags) !== 'r' || // opening for write
+ (flags & 512)) { // TODO: check for O_SEARCH? (== search for dir only)
+ return 31;
+ }
+ }
+ return FS.nodePermissions(node, FS.flagsToPermissionString(flags));
+ },MAX_OPEN_FDS:4096,nextfd:(fd_start = 0, fd_end = FS.MAX_OPEN_FDS) => {
+ for (var fd = fd_start; fd <= fd_end; fd++) {
+ if (!FS.streams[fd]) {
+ return fd;
+ }
+ }
+ throw new FS.ErrnoError(33);
+ },getStream:(fd) => FS.streams[fd],createStream:(stream, fd_start, fd_end) => {
+ if (!FS.FSStream) {
+ FS.FSStream = /** @constructor */ function() {
+ this.shared = { };
+ };
+ FS.FSStream.prototype = {
+ object: {
+ get: function() { return this.node; },
+ set: function(val) { this.node = val; }
+ },
+ isRead: {
+ get: function() { return (this.flags & 2097155) !== 1; }
+ },
+ isWrite: {
+ get: function() { return (this.flags & 2097155) !== 0; }
+ },
+ isAppend: {
+ get: function() { return (this.flags & 1024); }
+ },
+ flags: {
+ get: function() { return this.shared.flags; },
+ set: function(val) { this.shared.flags = val; },
+ },
+ position : {
+ get function() { return this.shared.position; },
+ set: function(val) { this.shared.position = val; },
+ },
+ };
+ }
+ // clone it, so we can return an instance of FSStream
+ stream = Object.assign(new FS.FSStream(), stream);
+ var fd = FS.nextfd(fd_start, fd_end);
+ stream.fd = fd;
+ FS.streams[fd] = stream;
+ return stream;
+ },closeStream:(fd) => {
+ FS.streams[fd] = null;
+ },chrdev_stream_ops:{open:(stream) => {
+ var device = FS.getDevice(stream.node.rdev);
+ // override node's stream ops with the device's
+ stream.stream_ops = device.stream_ops;
+ // forward the open call
+ if (stream.stream_ops.open) {
+ stream.stream_ops.open(stream);
+ }
+ },llseek:() => {
+ throw new FS.ErrnoError(70);
+ }},major:(dev) => ((dev) >> 8),minor:(dev) => ((dev) & 0xff),makedev:(ma, mi) => ((ma) << 8 | (mi)),registerDevice:(dev, ops) => {
+ FS.devices[dev] = { stream_ops: ops };
+ },getDevice:(dev) => FS.devices[dev],getMounts:(mount) => {
+ var mounts = [];
+ var check = [mount];
+
+ while (check.length) {
+ var m = check.pop();
+
+ mounts.push(m);
+
+ check.push.apply(check, m.mounts);
+ }
+
+ return mounts;
+ },syncfs:(populate, callback) => {
+ if (typeof populate == 'function') {
+ callback = populate;
+ populate = false;
+ }
+
+ FS.syncFSRequests++;
+
+ if (FS.syncFSRequests > 1) {
+ err('warning: ' + FS.syncFSRequests + ' FS.syncfs operations in flight at once, probably just doing extra work');
+ }
+
+ var mounts = FS.getMounts(FS.root.mount);
+ var completed = 0;
+
+ function doCallback(errCode) {
+ FS.syncFSRequests--;
+ return callback(errCode);
+ }
+
+ function done(errCode) {
+ if (errCode) {
+ if (!done.errored) {
+ done.errored = true;
+ return doCallback(errCode);
+ }
+ return;
+ }
+ if (++completed >= mounts.length) {
+ doCallback(null);
+ }
+ };
+
+ // sync all mounts
+ mounts.forEach((mount) => {
+ if (!mount.type.syncfs) {
+ return done(null);
+ }
+ mount.type.syncfs(mount, populate, done);
+ });
+ },mount:(type, opts, mountpoint) => {
+ var root = mountpoint === '/';
+ var pseudo = !mountpoint;
+ var node;
+
+ if (root && FS.root) {
+ throw new FS.ErrnoError(10);
+ } else if (!root && !pseudo) {
+ var lookup = FS.lookupPath(mountpoint, { follow_mount: false });
+
+ mountpoint = lookup.path; // use the absolute path
+ node = lookup.node;
+
+ if (FS.isMountpoint(node)) {
+ throw new FS.ErrnoError(10);
+ }
+
+ if (!FS.isDir(node.mode)) {
+ throw new FS.ErrnoError(54);
+ }
+ }
+
+ var mount = {
+ type: type,
+ opts: opts,
+ mountpoint: mountpoint,
+ mounts: []
+ };
+
+ // create a root node for the fs
+ var mountRoot = type.mount(mount);
+ mountRoot.mount = mount;
+ mount.root = mountRoot;
+
+ if (root) {
+ FS.root = mountRoot;
+ } else if (node) {
+ // set as a mountpoint
+ node.mounted = mount;
+
+ // add the new mount to the current mount's children
+ if (node.mount) {
+ node.mount.mounts.push(mount);
+ }
+ }
+
+ return mountRoot;
+ },unmount:(mountpoint) => {
+ var lookup = FS.lookupPath(mountpoint, { follow_mount: false });
+
+ if (!FS.isMountpoint(lookup.node)) {
+ throw new FS.ErrnoError(28);
+ }
+
+ // destroy the nodes for this mount, and all its child mounts
+ var node = lookup.node;
+ var mount = node.mounted;
+ var mounts = FS.getMounts(mount);
+
+ Object.keys(FS.nameTable).forEach((hash) => {
+ var current = FS.nameTable[hash];
+
+ while (current) {
+ var next = current.name_next;
+
+ if (mounts.includes(current.mount)) {
+ FS.destroyNode(current);
+ }
+
+ current = next;
+ }
+ });
+
+ // no longer a mountpoint
+ node.mounted = null;
+
+ // remove this mount from the child mounts
+ var idx = node.mount.mounts.indexOf(mount);
+ node.mount.mounts.splice(idx, 1);
+ },lookup:(parent, name) => {
+ return parent.node_ops.lookup(parent, name);
+ },mknod:(path, mode, dev) => {
+ var lookup = FS.lookupPath(path, { parent: true });
+ var parent = lookup.node;
+ var name = PATH.basename(path);
+ if (!name || name === '.' || name === '..') {
+ throw new FS.ErrnoError(28);
+ }
+ var errCode = FS.mayCreate(parent, name);
+ if (errCode) {
+ throw new FS.ErrnoError(errCode);
+ }
+ if (!parent.node_ops.mknod) {
+ throw new FS.ErrnoError(63);
+ }
+ return parent.node_ops.mknod(parent, name, mode, dev);
+ },create:(path, mode) => {
+ mode = mode !== undefined ? mode : 438 /* 0666 */;
+ mode &= 4095;
+ mode |= 32768;
+ return FS.mknod(path, mode, 0);
+ },mkdir:(path, mode) => {
+ mode = mode !== undefined ? mode : 511 /* 0777 */;
+ mode &= 511 | 512;
+ mode |= 16384;
+ return FS.mknod(path, mode, 0);
+ },mkdirTree:(path, mode) => {
+ var dirs = path.split('/');
+ var d = '';
+ for (var i = 0; i < dirs.length; ++i) {
+ if (!dirs[i]) continue;
+ d += '/' + dirs[i];
+ try {
+ FS.mkdir(d, mode);
+ } catch(e) {
+ if (e.errno != 20) throw e;
+ }
+ }
+ },mkdev:(path, mode, dev) => {
+ if (typeof dev == 'undefined') {
+ dev = mode;
+ mode = 438 /* 0666 */;
+ }
+ mode |= 8192;
+ return FS.mknod(path, mode, dev);
+ },symlink:(oldpath, newpath) => {
+ if (!PATH_FS.resolve(oldpath)) {
+ throw new FS.ErrnoError(44);
+ }
+ var lookup = FS.lookupPath(newpath, { parent: true });
+ var parent = lookup.node;
+ if (!parent) {
+ throw new FS.ErrnoError(44);
+ }
+ var newname = PATH.basename(newpath);
+ var errCode = FS.mayCreate(parent, newname);
+ if (errCode) {
+ throw new FS.ErrnoError(errCode);
+ }
+ if (!parent.node_ops.symlink) {
+ throw new FS.ErrnoError(63);
+ }
+ return parent.node_ops.symlink(parent, newname, oldpath);
+ },rename:(old_path, new_path) => {
+ var old_dirname = PATH.dirname(old_path);
+ var new_dirname = PATH.dirname(new_path);
+ var old_name = PATH.basename(old_path);
+ var new_name = PATH.basename(new_path);
+ // parents must exist
+ var lookup, old_dir, new_dir;
+
+ // let the errors from non existant directories percolate up
+ lookup = FS.lookupPath(old_path, { parent: true });
+ old_dir = lookup.node;
+ lookup = FS.lookupPath(new_path, { parent: true });
+ new_dir = lookup.node;
+
+ if (!old_dir || !new_dir) throw new FS.ErrnoError(44);
+ // need to be part of the same mount
+ if (old_dir.mount !== new_dir.mount) {
+ throw new FS.ErrnoError(75);
+ }
+ // source must exist
+ var old_node = FS.lookupNode(old_dir, old_name);
+ // old path should not be an ancestor of the new path
+ var relative = PATH_FS.relative(old_path, new_dirname);
+ if (relative.charAt(0) !== '.') {
+ throw new FS.ErrnoError(28);
+ }
+ // new path should not be an ancestor of the old path
+ relative = PATH_FS.relative(new_path, old_dirname);
+ if (relative.charAt(0) !== '.') {
+ throw new FS.ErrnoError(55);
+ }
+ // see if the new path already exists
+ var new_node;
+ try {
+ new_node = FS.lookupNode(new_dir, new_name);
+ } catch (e) {
+ // not fatal
+ }
+ // early out if nothing needs to change
+ if (old_node === new_node) {
+ return;
+ }
+ // we'll need to delete the old entry
+ var isdir = FS.isDir(old_node.mode);
+ var errCode = FS.mayDelete(old_dir, old_name, isdir);
+ if (errCode) {
+ throw new FS.ErrnoError(errCode);
+ }
+ // need delete permissions if we'll be overwriting.
+ // need create permissions if new doesn't already exist.
+ errCode = new_node ?
+ FS.mayDelete(new_dir, new_name, isdir) :
+ FS.mayCreate(new_dir, new_name);
+ if (errCode) {
+ throw new FS.ErrnoError(errCode);
+ }
+ if (!old_dir.node_ops.rename) {
+ throw new FS.ErrnoError(63);
+ }
+ if (FS.isMountpoint(old_node) || (new_node && FS.isMountpoint(new_node))) {
+ throw new FS.ErrnoError(10);
+ }
+ // if we are going to change the parent, check write permissions
+ if (new_dir !== old_dir) {
+ errCode = FS.nodePermissions(old_dir, 'w');
+ if (errCode) {
+ throw new FS.ErrnoError(errCode);
+ }
+ }
+ // remove the node from the lookup hash
+ FS.hashRemoveNode(old_node);
+ // do the underlying fs rename
+ try {
+ old_dir.node_ops.rename(old_node, new_dir, new_name);
+ } catch (e) {
+ throw e;
+ } finally {
+ // add the node back to the hash (in case node_ops.rename
+ // changed its name)
+ FS.hashAddNode(old_node);
+ }
+ },rmdir:(path) => {
+ var lookup = FS.lookupPath(path, { parent: true });
+ var parent = lookup.node;
+ var name = PATH.basename(path);
+ var node = FS.lookupNode(parent, name);
+ var errCode = FS.mayDelete(parent, name, true);
+ if (errCode) {
+ throw new FS.ErrnoError(errCode);
+ }
+ if (!parent.node_ops.rmdir) {
+ throw new FS.ErrnoError(63);
+ }
+ if (FS.isMountpoint(node)) {
+ throw new FS.ErrnoError(10);
+ }
+ parent.node_ops.rmdir(parent, name);
+ FS.destroyNode(node);
+ },readdir:(path) => {
+ var lookup = FS.lookupPath(path, { follow: true });
+ var node = lookup.node;
+ if (!node.node_ops.readdir) {
+ throw new FS.ErrnoError(54);
+ }
+ return node.node_ops.readdir(node);
+ },unlink:(path) => {
+ var lookup = FS.lookupPath(path, { parent: true });
+ var parent = lookup.node;
+ if (!parent) {
+ throw new FS.ErrnoError(44);
+ }
+ var name = PATH.basename(path);
+ var node = FS.lookupNode(parent, name);
+ var errCode = FS.mayDelete(parent, name, false);
+ if (errCode) {
+ // According to POSIX, we should map EISDIR to EPERM, but
+ // we instead do what Linux does (and we must, as we use
+ // the musl linux libc).
+ throw new FS.ErrnoError(errCode);
+ }
+ if (!parent.node_ops.unlink) {
+ throw new FS.ErrnoError(63);
+ }
+ if (FS.isMountpoint(node)) {
+ throw new FS.ErrnoError(10);
+ }
+ parent.node_ops.unlink(parent, name);
+ FS.destroyNode(node);
+ },readlink:(path) => {
+ var lookup = FS.lookupPath(path);
+ var link = lookup.node;
+ if (!link) {
+ throw new FS.ErrnoError(44);
+ }
+ if (!link.node_ops.readlink) {
+ throw new FS.ErrnoError(28);
+ }
+ return PATH_FS.resolve(FS.getPath(link.parent), link.node_ops.readlink(link));
+ },stat:(path, dontFollow) => {
+ var lookup = FS.lookupPath(path, { follow: !dontFollow });
+ var node = lookup.node;
+ if (!node) {
+ throw new FS.ErrnoError(44);
+ }
+ if (!node.node_ops.getattr) {
+ throw new FS.ErrnoError(63);
+ }
+ return node.node_ops.getattr(node);
+ },lstat:(path) => {
+ return FS.stat(path, true);
+ },chmod:(path, mode, dontFollow) => {
+ var node;
+ if (typeof path == 'string') {
+ var lookup = FS.lookupPath(path, { follow: !dontFollow });
+ node = lookup.node;
+ } else {
+ node = path;
+ }
+ if (!node.node_ops.setattr) {
+ throw new FS.ErrnoError(63);
+ }
+ node.node_ops.setattr(node, {
+ mode: (mode & 4095) | (node.mode & ~4095),
+ timestamp: Date.now()
+ });
+ },lchmod:(path, mode) => {
+ FS.chmod(path, mode, true);
+ },fchmod:(fd, mode) => {
+ var stream = FS.getStream(fd);
+ if (!stream) {
+ throw new FS.ErrnoError(8);
+ }
+ FS.chmod(stream.node, mode);
+ },chown:(path, uid, gid, dontFollow) => {
+ var node;
+ if (typeof path == 'string') {
+ var lookup = FS.lookupPath(path, { follow: !dontFollow });
+ node = lookup.node;
+ } else {
+ node = path;
+ }
+ if (!node.node_ops.setattr) {
+ throw new FS.ErrnoError(63);
+ }
+ node.node_ops.setattr(node, {
+ timestamp: Date.now()
+ // we ignore the uid / gid for now
+ });
+ },lchown:(path, uid, gid) => {
+ FS.chown(path, uid, gid, true);
+ },fchown:(fd, uid, gid) => {
+ var stream = FS.getStream(fd);
+ if (!stream) {
+ throw new FS.ErrnoError(8);
+ }
+ FS.chown(stream.node, uid, gid);
+ },truncate:(path, len) => {
+ if (len < 0) {
+ throw new FS.ErrnoError(28);
+ }
+ var node;
+ if (typeof path == 'string') {
+ var lookup = FS.lookupPath(path, { follow: true });
+ node = lookup.node;
+ } else {
+ node = path;
+ }
+ if (!node.node_ops.setattr) {
+ throw new FS.ErrnoError(63);
+ }
+ if (FS.isDir(node.mode)) {
+ throw new FS.ErrnoError(31);
+ }
+ if (!FS.isFile(node.mode)) {
+ throw new FS.ErrnoError(28);
+ }
+ var errCode = FS.nodePermissions(node, 'w');
+ if (errCode) {
+ throw new FS.ErrnoError(errCode);
+ }
+ node.node_ops.setattr(node, {
+ size: len,
+ timestamp: Date.now()
+ });
+ },ftruncate:(fd, len) => {
+ var stream = FS.getStream(fd);
+ if (!stream) {
+ throw new FS.ErrnoError(8);
+ }
+ if ((stream.flags & 2097155) === 0) {
+ throw new FS.ErrnoError(28);
+ }
+ FS.truncate(stream.node, len);
+ },utime:(path, atime, mtime) => {
+ var lookup = FS.lookupPath(path, { follow: true });
+ var node = lookup.node;
+ node.node_ops.setattr(node, {
+ timestamp: Math.max(atime, mtime)
+ });
+ },open:(path, flags, mode) => {
+ if (path === "") {
+ throw new FS.ErrnoError(44);
+ }
+ flags = typeof flags == 'string' ? FS.modeStringToFlags(flags) : flags;
+ mode = typeof mode == 'undefined' ? 438 /* 0666 */ : mode;
+ if ((flags & 64)) {
+ mode = (mode & 4095) | 32768;
+ } else {
+ mode = 0;
+ }
+ var node;
+ if (typeof path == 'object') {
+ node = path;
+ } else {
+ path = PATH.normalize(path);
+ try {
+ var lookup = FS.lookupPath(path, {
+ follow: !(flags & 131072)
+ });
+ node = lookup.node;
+ } catch (e) {
+ // ignore
+ }
+ }
+ // perhaps we need to create the node
+ var created = false;
+ if ((flags & 64)) {
+ if (node) {
+ // if O_CREAT and O_EXCL are set, error out if the node already exists
+ if ((flags & 128)) {
+ throw new FS.ErrnoError(20);
+ }
+ } else {
+ // node doesn't exist, try to create it
+ node = FS.mknod(path, mode, 0);
+ created = true;
+ }
+ }
+ if (!node) {
+ throw new FS.ErrnoError(44);
+ }
+ // can't truncate a device
+ if (FS.isChrdev(node.mode)) {
+ flags &= ~512;
+ }
+ // if asked only for a directory, then this must be one
+ if ((flags & 65536) && !FS.isDir(node.mode)) {
+ throw new FS.ErrnoError(54);
+ }
+ // check permissions, if this is not a file we just created now (it is ok to
+ // create and write to a file with read-only permissions; it is read-only
+ // for later use)
+ if (!created) {
+ var errCode = FS.mayOpen(node, flags);
+ if (errCode) {
+ throw new FS.ErrnoError(errCode);
+ }
+ }
+ // do truncation if necessary
+ if ((flags & 512) && !created) {
+ FS.truncate(node, 0);
+ }
+ // we've already handled these, don't pass down to the underlying vfs
+ flags &= ~(128 | 512 | 131072);
+
+ // register the stream with the filesystem
+ var stream = FS.createStream({
+ node: node,
+ path: FS.getPath(node), // we want the absolute path to the node
+ flags: flags,
+ seekable: true,
+ position: 0,
+ stream_ops: node.stream_ops,
+ // used by the file family libc calls (fopen, fwrite, ferror, etc.)
+ ungotten: [],
+ error: false
+ });
+ // call the new stream's open function
+ if (stream.stream_ops.open) {
+ stream.stream_ops.open(stream);
+ }
+ if (Module['logReadFiles'] && !(flags & 1)) {
+ if (!FS.readFiles) FS.readFiles = {};
+ if (!(path in FS.readFiles)) {
+ FS.readFiles[path] = 1;
+ }
+ }
+ return stream;
+ },close:(stream) => {
+ if (FS.isClosed(stream)) {
+ throw new FS.ErrnoError(8);
+ }
+ if (stream.getdents) stream.getdents = null; // free readdir state
+ try {
+ if (stream.stream_ops.close) {
+ stream.stream_ops.close(stream);
+ }
+ } catch (e) {
+ throw e;
+ } finally {
+ FS.closeStream(stream.fd);
+ }
+ stream.fd = null;
+ },isClosed:(stream) => {
+ return stream.fd === null;
+ },llseek:(stream, offset, whence) => {
+ if (FS.isClosed(stream)) {
+ throw new FS.ErrnoError(8);
+ }
+ if (!stream.seekable || !stream.stream_ops.llseek) {
+ throw new FS.ErrnoError(70);
+ }
+ if (whence != 0 && whence != 1 && whence != 2) {
+ throw new FS.ErrnoError(28);
+ }
+ stream.position = stream.stream_ops.llseek(stream, offset, whence);
+ stream.ungotten = [];
+ return stream.position;
+ },read:(stream, buffer, offset, length, position) => {
+ if (length < 0 || position < 0) {
+ throw new FS.ErrnoError(28);
+ }
+ if (FS.isClosed(stream)) {
+ throw new FS.ErrnoError(8);
+ }
+ if ((stream.flags & 2097155) === 1) {
+ throw new FS.ErrnoError(8);
+ }
+ if (FS.isDir(stream.node.mode)) {
+ throw new FS.ErrnoError(31);
+ }
+ if (!stream.stream_ops.read) {
+ throw new FS.ErrnoError(28);
+ }
+ var seeking = typeof position != 'undefined';
+ if (!seeking) {
+ position = stream.position;
+ } else if (!stream.seekable) {
+ throw new FS.ErrnoError(70);
+ }
+ var bytesRead = stream.stream_ops.read(stream, buffer, offset, length, position);
+ if (!seeking) stream.position += bytesRead;
+ return bytesRead;
+ },write:(stream, buffer, offset, length, position, canOwn) => {
+ if (length < 0 || position < 0) {
+ throw new FS.ErrnoError(28);
+ }
+ if (FS.isClosed(stream)) {
+ throw new FS.ErrnoError(8);
+ }
+ if ((stream.flags & 2097155) === 0) {
+ throw new FS.ErrnoError(8);
+ }
+ if (FS.isDir(stream.node.mode)) {
+ throw new FS.ErrnoError(31);
+ }
+ if (!stream.stream_ops.write) {
+ throw new FS.ErrnoError(28);
+ }
+ if (stream.seekable && stream.flags & 1024) {
+ // seek to the end before writing in append mode
+ FS.llseek(stream, 0, 2);
+ }
+ var seeking = typeof position != 'undefined';
+ if (!seeking) {
+ position = stream.position;
+ } else if (!stream.seekable) {
+ throw new FS.ErrnoError(70);
+ }
+ var bytesWritten = stream.stream_ops.write(stream, buffer, offset, length, position, canOwn);
+ if (!seeking) stream.position += bytesWritten;
+ return bytesWritten;
+ },allocate:(stream, offset, length) => {
+ if (FS.isClosed(stream)) {
+ throw new FS.ErrnoError(8);
+ }
+ if (offset < 0 || length <= 0) {
+ throw new FS.ErrnoError(28);
+ }
+ if ((stream.flags & 2097155) === 0) {
+ throw new FS.ErrnoError(8);
+ }
+ if (!FS.isFile(stream.node.mode) && !FS.isDir(stream.node.mode)) {
+ throw new FS.ErrnoError(43);
+ }
+ if (!stream.stream_ops.allocate) {
+ throw new FS.ErrnoError(138);
+ }
+ stream.stream_ops.allocate(stream, offset, length);
+ },mmap:(stream, length, position, prot, flags) => {
+ // User requests writing to file (prot & PROT_WRITE != 0).
+ // Checking if we have permissions to write to the file unless
+ // MAP_PRIVATE flag is set. According to POSIX spec it is possible
+ // to write to file opened in read-only mode with MAP_PRIVATE flag,
+ // as all modifications will be visible only in the memory of
+ // the current process.
+ if ((prot & 2) !== 0
+ && (flags & 2) === 0
+ && (stream.flags & 2097155) !== 2) {
+ throw new FS.ErrnoError(2);
+ }
+ if ((stream.flags & 2097155) === 1) {
+ throw new FS.ErrnoError(2);
+ }
+ if (!stream.stream_ops.mmap) {
+ throw new FS.ErrnoError(43);
+ }
+ return stream.stream_ops.mmap(stream, length, position, prot, flags);
+ },msync:(stream, buffer, offset, length, mmapFlags) => {
+ if (!stream || !stream.stream_ops.msync) {
+ return 0;
+ }
+ return stream.stream_ops.msync(stream, buffer, offset, length, mmapFlags);
+ },munmap:(stream) => 0,ioctl:(stream, cmd, arg) => {
+ if (!stream.stream_ops.ioctl) {
+ throw new FS.ErrnoError(59);
+ }
+ return stream.stream_ops.ioctl(stream, cmd, arg);
+ },readFile:(path, opts = {}) => {
+ opts.flags = opts.flags || 0;
+ opts.encoding = opts.encoding || 'binary';
+ if (opts.encoding !== 'utf8' && opts.encoding !== 'binary') {
+ throw new Error('Invalid encoding type "' + opts.encoding + '"');
+ }
+ var ret;
+ var stream = FS.open(path, opts.flags);
+ var stat = FS.stat(path);
+ var length = stat.size;
+ var buf = new Uint8Array(length);
+ FS.read(stream, buf, 0, length, 0);
+ if (opts.encoding === 'utf8') {
+ ret = UTF8ArrayToString(buf, 0);
+ } else if (opts.encoding === 'binary') {
+ ret = buf;
+ }
+ FS.close(stream);
+ return ret;
+ },writeFile:(path, data, opts = {}) => {
+ opts.flags = opts.flags || 577;
+ var stream = FS.open(path, opts.flags, opts.mode);
+ if (typeof data == 'string') {
+ var buf = new Uint8Array(lengthBytesUTF8(data)+1);
+ var actualNumBytes = stringToUTF8Array(data, buf, 0, buf.length);
+ FS.write(stream, buf, 0, actualNumBytes, undefined, opts.canOwn);
+ } else if (ArrayBuffer.isView(data)) {
+ FS.write(stream, data, 0, data.byteLength, undefined, opts.canOwn);
+ } else {
+ throw new Error('Unsupported data type');
+ }
+ FS.close(stream);
+ },cwd:() => FS.currentPath,chdir:(path) => {
+ var lookup = FS.lookupPath(path, { follow: true });
+ if (lookup.node === null) {
+ throw new FS.ErrnoError(44);
+ }
+ if (!FS.isDir(lookup.node.mode)) {
+ throw new FS.ErrnoError(54);
+ }
+ var errCode = FS.nodePermissions(lookup.node, 'x');
+ if (errCode) {
+ throw new FS.ErrnoError(errCode);
+ }
+ FS.currentPath = lookup.path;
+ },createDefaultDirectories:() => {
+ FS.mkdir('/tmp');
+ FS.mkdir('/home');
+ FS.mkdir('/home/web_user');
+ },createDefaultDevices:() => {
+ // create /dev
+ FS.mkdir('/dev');
+ // setup /dev/null
+ FS.registerDevice(FS.makedev(1, 3), {
+ read: () => 0,
+ write: (stream, buffer, offset, length, pos) => length,
+ });
+ FS.mkdev('/dev/null', FS.makedev(1, 3));
+ // setup /dev/tty and /dev/tty1
+ // stderr needs to print output using err() rather than out()
+ // so we register a second tty just for it.
+ TTY.register(FS.makedev(5, 0), TTY.default_tty_ops);
+ TTY.register(FS.makedev(6, 0), TTY.default_tty1_ops);
+ FS.mkdev('/dev/tty', FS.makedev(5, 0));
+ FS.mkdev('/dev/tty1', FS.makedev(6, 0));
+ // setup /dev/[u]random
+ var random_device = getRandomDevice();
+ FS.createDevice('/dev', 'random', random_device);
+ FS.createDevice('/dev', 'urandom', random_device);
+ // we're not going to emulate the actual shm device,
+ // just create the tmp dirs that reside in it commonly
+ FS.mkdir('/dev/shm');
+ FS.mkdir('/dev/shm/tmp');
+ },createSpecialDirectories:() => {
+ // create /proc/self/fd which allows /proc/self/fd/6 => readlink gives the
+ // name of the stream for fd 6 (see test_unistd_ttyname)
+ FS.mkdir('/proc');
+ var proc_self = FS.mkdir('/proc/self');
+ FS.mkdir('/proc/self/fd');
+ FS.mount({
+ mount: () => {
+ var node = FS.createNode(proc_self, 'fd', 16384 | 511 /* 0777 */, 73);
+ node.node_ops = {
+ lookup: (parent, name) => {
+ var fd = +name;
+ var stream = FS.getStream(fd);
+ if (!stream) throw new FS.ErrnoError(8);
+ var ret = {
+ parent: null,
+ mount: { mountpoint: 'fake' },
+ node_ops: { readlink: () => stream.path },
+ };
+ ret.parent = ret; // make it look like a simple root node
+ return ret;
+ }
+ };
+ return node;
+ }
+ }, {}, '/proc/self/fd');
+ },createStandardStreams:() => {
+ // TODO deprecate the old functionality of a single
+ // input / output callback and that utilizes FS.createDevice
+ // and instead require a unique set of stream ops
+
+ // by default, we symlink the standard streams to the
+ // default tty devices. however, if the standard streams
+ // have been overwritten we create a unique device for
+ // them instead.
+ if (Module['stdin']) {
+ FS.createDevice('/dev', 'stdin', Module['stdin']);
+ } else {
+ FS.symlink('/dev/tty', '/dev/stdin');
+ }
+ if (Module['stdout']) {
+ FS.createDevice('/dev', 'stdout', null, Module['stdout']);
+ } else {
+ FS.symlink('/dev/tty', '/dev/stdout');
+ }
+ if (Module['stderr']) {
+ FS.createDevice('/dev', 'stderr', null, Module['stderr']);
+ } else {
+ FS.symlink('/dev/tty1', '/dev/stderr');
+ }
+
+ // open default streams for the stdin, stdout and stderr devices
+ var stdin = FS.open('/dev/stdin', 0);
+ var stdout = FS.open('/dev/stdout', 1);
+ var stderr = FS.open('/dev/stderr', 1);
+ },ensureErrnoError:() => {
+ if (FS.ErrnoError) return;
+ FS.ErrnoError = /** @this{Object} */ function ErrnoError(errno, node) {
+ this.node = node;
+ this.setErrno = /** @this{Object} */ function(errno) {
+ this.errno = errno;
+ };
+ this.setErrno(errno);
+ this.message = 'FS error';
+
+ };
+ FS.ErrnoError.prototype = new Error();
+ FS.ErrnoError.prototype.constructor = FS.ErrnoError;
+ // Some errors may happen quite a bit, to avoid overhead we reuse them (and suffer a lack of stack info)
+ [44].forEach((code) => {
+ FS.genericErrors[code] = new FS.ErrnoError(code);
+ FS.genericErrors[code].stack = '';
+ });
+ },staticInit:() => {
+ FS.ensureErrnoError();
+
+ FS.nameTable = new Array(4096);
+
+ FS.mount(MEMFS, {}, '/');
+
+ FS.createDefaultDirectories();
+ FS.createDefaultDevices();
+ FS.createSpecialDirectories();
+
+ FS.filesystems = {
+ 'MEMFS': MEMFS,
+ };
+ },init:(input, output, error) => {
+ FS.init.initialized = true;
+
+ FS.ensureErrnoError();
+
+ // Allow Module.stdin etc. to provide defaults, if none explicitly passed to us here
+ Module['stdin'] = input || Module['stdin'];
+ Module['stdout'] = output || Module['stdout'];
+ Module['stderr'] = error || Module['stderr'];
+
+ FS.createStandardStreams();
+ },quit:() => {
+ FS.init.initialized = false;
+ // force-flush all streams, so we get musl std streams printed out
+ // close all of our streams
+ for (var i = 0; i < FS.streams.length; i++) {
+ var stream = FS.streams[i];
+ if (!stream) {
+ continue;
+ }
+ FS.close(stream);
+ }
+ },getMode:(canRead, canWrite) => {
+ var mode = 0;
+ if (canRead) mode |= 292 | 73;
+ if (canWrite) mode |= 146;
+ return mode;
+ },findObject:(path, dontResolveLastLink) => {
+ var ret = FS.analyzePath(path, dontResolveLastLink);
+ if (ret.exists) {
+ return ret.object;
+ } else {
+ return null;
+ }
+ },analyzePath:(path, dontResolveLastLink) => {
+ // operate from within the context of the symlink's target
+ try {
+ var lookup = FS.lookupPath(path, { follow: !dontResolveLastLink });
+ path = lookup.path;
+ } catch (e) {
+ }
+ var ret = {
+ isRoot: false, exists: false, error: 0, name: null, path: null, object: null,
+ parentExists: false, parentPath: null, parentObject: null
+ };
+ try {
+ var lookup = FS.lookupPath(path, { parent: true });
+ ret.parentExists = true;
+ ret.parentPath = lookup.path;
+ ret.parentObject = lookup.node;
+ ret.name = PATH.basename(path);
+ lookup = FS.lookupPath(path, { follow: !dontResolveLastLink });
+ ret.exists = true;
+ ret.path = lookup.path;
+ ret.object = lookup.node;
+ ret.name = lookup.node.name;
+ ret.isRoot = lookup.path === '/';
+ } catch (e) {
+ ret.error = e.errno;
+ };
+ return ret;
+ },createPath:(parent, path, canRead, canWrite) => {
+ parent = typeof parent == 'string' ? parent : FS.getPath(parent);
+ var parts = path.split('/').reverse();
+ while (parts.length) {
+ var part = parts.pop();
+ if (!part) continue;
+ var current = PATH.join2(parent, part);
+ try {
+ FS.mkdir(current);
+ } catch (e) {
+ // ignore EEXIST
+ }
+ parent = current;
+ }
+ return current;
+ },createFile:(parent, name, properties, canRead, canWrite) => {
+ var path = PATH.join2(typeof parent == 'string' ? parent : FS.getPath(parent), name);
+ var mode = FS.getMode(canRead, canWrite);
+ return FS.create(path, mode);
+ },createDataFile:(parent, name, data, canRead, canWrite, canOwn) => {
+ var path = name;
+ if (parent) {
+ parent = typeof parent == 'string' ? parent : FS.getPath(parent);
+ path = name ? PATH.join2(parent, name) : parent;
+ }
+ var mode = FS.getMode(canRead, canWrite);
+ var node = FS.create(path, mode);
+ if (data) {
+ if (typeof data == 'string') {
+ var arr = new Array(data.length);
+ for (var i = 0, len = data.length; i < len; ++i) arr[i] = data.charCodeAt(i);
+ data = arr;
+ }
+ // make sure we can write to the file
+ FS.chmod(node, mode | 146);
+ var stream = FS.open(node, 577);
+ FS.write(stream, data, 0, data.length, 0, canOwn);
+ FS.close(stream);
+ FS.chmod(node, mode);
+ }
+ return node;
+ },createDevice:(parent, name, input, output) => {
+ var path = PATH.join2(typeof parent == 'string' ? parent : FS.getPath(parent), name);
+ var mode = FS.getMode(!!input, !!output);
+ if (!FS.createDevice.major) FS.createDevice.major = 64;
+ var dev = FS.makedev(FS.createDevice.major++, 0);
+ // Create a fake device that a set of stream ops to emulate
+ // the old behavior.
+ FS.registerDevice(dev, {
+ open: (stream) => {
+ stream.seekable = false;
+ },
+ close: (stream) => {
+ // flush any pending line data
+ if (output && output.buffer && output.buffer.length) {
+ output(10);
+ }
+ },
+ read: (stream, buffer, offset, length, pos /* ignored */) => {
+ var bytesRead = 0;
+ for (var i = 0; i < length; i++) {
+ var result;
+ try {
+ result = input();
+ } catch (e) {
+ throw new FS.ErrnoError(29);
+ }
+ if (result === undefined && bytesRead === 0) {
+ throw new FS.ErrnoError(6);
+ }
+ if (result === null || result === undefined) break;
+ bytesRead++;
+ buffer[offset+i] = result;
+ }
+ if (bytesRead) {
+ stream.node.timestamp = Date.now();
+ }
+ return bytesRead;
+ },
+ write: (stream, buffer, offset, length, pos) => {
+ for (var i = 0; i < length; i++) {
+ try {
+ output(buffer[offset+i]);
+ } catch (e) {
+ throw new FS.ErrnoError(29);
+ }
+ }
+ if (length) {
+ stream.node.timestamp = Date.now();
+ }
+ return i;
+ }
+ });
+ return FS.mkdev(path, mode, dev);
+ },forceLoadFile:(obj) => {
+ if (obj.isDevice || obj.isFolder || obj.link || obj.contents) return true;
+ if (typeof XMLHttpRequest != 'undefined') {
+ throw new Error("Lazy loading should have been performed (contents set) in createLazyFile, but it was not. Lazy loading only works in web workers. Use --embed-file or --preload-file in emcc on the main thread.");
+ } else if (read_) {
+ // Command-line.
+ try {
+ // WARNING: Can't read binary files in V8's d8 or tracemonkey's js, as
+ // read() will try to parse UTF8.
+ obj.contents = intArrayFromString(read_(obj.url), true);
+ obj.usedBytes = obj.contents.length;
+ } catch (e) {
+ throw new FS.ErrnoError(29);
+ }
+ } else {
+ throw new Error('Cannot load without read() or XMLHttpRequest.');
+ }
+ },createLazyFile:(parent, name, url, canRead, canWrite) => {
+ // Lazy chunked Uint8Array (implements get and length from Uint8Array). Actual getting is abstracted away for eventual reuse.
+ /** @constructor */
+ function LazyUint8Array() {
+ this.lengthKnown = false;
+ this.chunks = []; // Loaded chunks. Index is the chunk number
+ }
+ LazyUint8Array.prototype.get = /** @this{Object} */ function LazyUint8Array_get(idx) {
+ if (idx > this.length-1 || idx < 0) {
+ return undefined;
+ }
+ var chunkOffset = idx % this.chunkSize;
+ var chunkNum = (idx / this.chunkSize)|0;
+ return this.getter(chunkNum)[chunkOffset];
+ };
+ LazyUint8Array.prototype.setDataGetter = function LazyUint8Array_setDataGetter(getter) {
+ this.getter = getter;
+ };
+ LazyUint8Array.prototype.cacheLength = function LazyUint8Array_cacheLength() {
+ // Find length
+ var xhr = new XMLHttpRequest();
+ xhr.open('HEAD', url, false);
+ xhr.send(null);
+ if (!(xhr.status >= 200 && xhr.status < 300 || xhr.status === 304)) throw new Error("Couldn't load " + url + ". Status: " + xhr.status);
+ var datalength = Number(xhr.getResponseHeader("Content-length"));
+ var header;
+ var hasByteServing = (header = xhr.getResponseHeader("Accept-Ranges")) && header === "bytes";
+ var usesGzip = (header = xhr.getResponseHeader("Content-Encoding")) && header === "gzip";
+
+ var chunkSize = 1024*1024; // Chunk size in bytes
+
+ if (!hasByteServing) chunkSize = datalength;
+
+ // Function to get a range from the remote URL.
+ var doXHR = (from, to) => {
+ if (from > to) throw new Error("invalid range (" + from + ", " + to + ") or no bytes requested!");
+ if (to > datalength-1) throw new Error("only " + datalength + " bytes available! programmer error!");
+
+ // TODO: Use mozResponseArrayBuffer, responseStream, etc. if available.
+ var xhr = new XMLHttpRequest();
+ xhr.open('GET', url, false);
+ if (datalength !== chunkSize) xhr.setRequestHeader("Range", "bytes=" + from + "-" + to);
+
+ // Some hints to the browser that we want binary data.
+ xhr.responseType = 'arraybuffer';
+ if (xhr.overrideMimeType) {
+ xhr.overrideMimeType('text/plain; charset=x-user-defined');
+ }
+
+ xhr.send(null);
+ if (!(xhr.status >= 200 && xhr.status < 300 || xhr.status === 304)) throw new Error("Couldn't load " + url + ". Status: " + xhr.status);
+ if (xhr.response !== undefined) {
+ return new Uint8Array(/** @type{Array} */(xhr.response || []));
+ } else {
+ return intArrayFromString(xhr.responseText || '', true);
+ }
+ };
+ var lazyArray = this;
+ lazyArray.setDataGetter((chunkNum) => {
+ var start = chunkNum * chunkSize;
+ var end = (chunkNum+1) * chunkSize - 1; // including this byte
+ end = Math.min(end, datalength-1); // if datalength-1 is selected, this is the last block
+ if (typeof lazyArray.chunks[chunkNum] == 'undefined') {
+ lazyArray.chunks[chunkNum] = doXHR(start, end);
+ }
+ if (typeof lazyArray.chunks[chunkNum] == 'undefined') throw new Error('doXHR failed!');
+ return lazyArray.chunks[chunkNum];
+ });
+
+ if (usesGzip || !datalength) {
+ // if the server uses gzip or doesn't supply the length, we have to download the whole file to get the (uncompressed) length
+ chunkSize = datalength = 1; // this will force getter(0)/doXHR do download the whole file
+ datalength = this.getter(0).length;
+ chunkSize = datalength;
+ out("LazyFiles on gzip forces download of the whole file when length is accessed");
+ }
+
+ this._length = datalength;
+ this._chunkSize = chunkSize;
+ this.lengthKnown = true;
+ };
+ if (typeof XMLHttpRequest != 'undefined') {
+ if (!ENVIRONMENT_IS_WORKER) throw 'Cannot do synchronous binary XHRs outside webworkers in modern browsers. Use --embed-file or --preload-file in emcc';
+ var lazyArray = new LazyUint8Array();
+ Object.defineProperties(lazyArray, {
+ length: {
+ get: /** @this{Object} */ function() {
+ if (!this.lengthKnown) {
+ this.cacheLength();
+ }
+ return this._length;
+ }
+ },
+ chunkSize: {
+ get: /** @this{Object} */ function() {
+ if (!this.lengthKnown) {
+ this.cacheLength();
+ }
+ return this._chunkSize;
+ }
+ }
+ });
+
+ var properties = { isDevice: false, contents: lazyArray };
+ } else {
+ var properties = { isDevice: false, url: url };
+ }
+
+ var node = FS.createFile(parent, name, properties, canRead, canWrite);
+ // This is a total hack, but I want to get this lazy file code out of the
+ // core of MEMFS. If we want to keep this lazy file concept I feel it should
+ // be its own thin LAZYFS proxying calls to MEMFS.
+ if (properties.contents) {
+ node.contents = properties.contents;
+ } else if (properties.url) {
+ node.contents = null;
+ node.url = properties.url;
+ }
+ // Add a function that defers querying the file size until it is asked the first time.
+ Object.defineProperties(node, {
+ usedBytes: {
+ get: /** @this {FSNode} */ function() { return this.contents.length; }
+ }
+ });
+ // override each stream op with one that tries to force load the lazy file first
+ var stream_ops = {};
+ var keys = Object.keys(node.stream_ops);
+ keys.forEach((key) => {
+ var fn = node.stream_ops[key];
+ stream_ops[key] = function forceLoadLazyFile() {
+ FS.forceLoadFile(node);
+ return fn.apply(null, arguments);
+ };
+ });
+ // use a custom read function
+ stream_ops.read = (stream, buffer, offset, length, position) => {
+ FS.forceLoadFile(node);
+ var contents = stream.node.contents;
+ if (position >= contents.length)
+ return 0;
+ var size = Math.min(contents.length - position, length);
+ if (contents.slice) { // normal array
+ for (var i = 0; i < size; i++) {
+ buffer[offset + i] = contents[position + i];
+ }
+ } else {
+ for (var i = 0; i < size; i++) { // LazyUint8Array from sync binary XHR
+ buffer[offset + i] = contents.get(position + i);
+ }
+ }
+ return size;
+ };
+ node.stream_ops = stream_ops;
+ return node;
+ },createPreloadedFile:(parent, name, url, canRead, canWrite, onload, onerror, dontCreateFile, canOwn, preFinish) => {
+ // TODO we should allow people to just pass in a complete filename instead
+ // of parent and name being that we just join them anyways
+ var fullname = name ? PATH_FS.resolve(PATH.join2(parent, name)) : parent;
+ var dep = getUniqueRunDependency('cp ' + fullname); // might have several active requests for the same fullname
+ function processData(byteArray) {
+ function finish(byteArray) {
+ if (preFinish) preFinish();
+ if (!dontCreateFile) {
+ FS.createDataFile(parent, name, byteArray, canRead, canWrite, canOwn);
+ }
+ if (onload) onload();
+ removeRunDependency(dep);
+ }
+ if (Browser.handledByPreloadPlugin(byteArray, fullname, finish, () => {
+ if (onerror) onerror();
+ removeRunDependency(dep);
+ })) {
+ return;
+ }
+ finish(byteArray);
+ }
+ addRunDependency(dep);
+ if (typeof url == 'string') {
+ asyncLoad(url, (byteArray) => processData(byteArray), onerror);
+ } else {
+ processData(url);
+ }
+ },indexedDB:() => {
+ return window.indexedDB || window.mozIndexedDB || window.webkitIndexedDB || window.msIndexedDB;
+ },DB_NAME:() => {
+ return 'EM_FS_' + window.location.pathname;
+ },DB_VERSION:20,DB_STORE_NAME:"FILE_DATA",saveFilesToDB:(paths, onload, onerror) => {
+ onload = onload || (() => {});
+ onerror = onerror || (() => {});
+ var indexedDB = FS.indexedDB();
+ try {
+ var openRequest = indexedDB.open(FS.DB_NAME(), FS.DB_VERSION);
+ } catch (e) {
+ return onerror(e);
+ }
+ openRequest.onupgradeneeded = () => {
+ out('creating db');
+ var db = openRequest.result;
+ db.createObjectStore(FS.DB_STORE_NAME);
+ };
+ openRequest.onsuccess = () => {
+ var db = openRequest.result;
+ var transaction = db.transaction([FS.DB_STORE_NAME], 'readwrite');
+ var files = transaction.objectStore(FS.DB_STORE_NAME);
+ var ok = 0, fail = 0, total = paths.length;
+ function finish() {
+ if (fail == 0) onload(); else onerror();
+ }
+ paths.forEach((path) => {
+ var putRequest = files.put(FS.analyzePath(path).object.contents, path);
+ putRequest.onsuccess = () => { ok++; if (ok + fail == total) finish() };
+ putRequest.onerror = () => { fail++; if (ok + fail == total) finish() };
+ });
+ transaction.onerror = onerror;
+ };
+ openRequest.onerror = onerror;
+ },loadFilesFromDB:(paths, onload, onerror) => {
+ onload = onload || (() => {});
+ onerror = onerror || (() => {});
+ var indexedDB = FS.indexedDB();
+ try {
+ var openRequest = indexedDB.open(FS.DB_NAME(), FS.DB_VERSION);
+ } catch (e) {
+ return onerror(e);
+ }
+ openRequest.onupgradeneeded = onerror; // no database to load from
+ openRequest.onsuccess = () => {
+ var db = openRequest.result;
+ try {
+ var transaction = db.transaction([FS.DB_STORE_NAME], 'readonly');
+ } catch(e) {
+ onerror(e);
+ return;
+ }
+ var files = transaction.objectStore(FS.DB_STORE_NAME);
+ var ok = 0, fail = 0, total = paths.length;
+ function finish() {
+ if (fail == 0) onload(); else onerror();
+ }
+ paths.forEach((path) => {
+ var getRequest = files.get(path);
+ getRequest.onsuccess = () => {
+ if (FS.analyzePath(path).exists) {
+ FS.unlink(path);
+ }
+ FS.createDataFile(PATH.dirname(path), PATH.basename(path), getRequest.result, true, true, true);
+ ok++;
+ if (ok + fail == total) finish();
+ };
+ getRequest.onerror = () => { fail++; if (ok + fail == total) finish() };
+ });
+ transaction.onerror = onerror;
+ };
+ openRequest.onerror = onerror;
+ }};
+ var SYSCALLS = {DEFAULT_POLLMASK:5,calculateAt:function(dirfd, path, allowEmpty) {
+ if (PATH.isAbs(path)) {
+ return path;
+ }
+ // relative path
+ var dir;
+ if (dirfd === -100) {
+ dir = FS.cwd();
+ } else {
+ var dirstream = FS.getStream(dirfd);
+ if (!dirstream) throw new FS.ErrnoError(8);
+ dir = dirstream.path;
+ }
+ if (path.length == 0) {
+ if (!allowEmpty) {
+ throw new FS.ErrnoError(44);;
+ }
+ return dir;
+ }
+ return PATH.join2(dir, path);
+ },doStat:function(func, path, buf) {
+ try {
+ var stat = func(path);
+ } catch (e) {
+ if (e && e.node && PATH.normalize(path) !== PATH.normalize(FS.getPath(e.node))) {
+ // an error occurred while trying to look up the path; we should just report ENOTDIR
+ return -54;
+ }
+ throw e;
+ }
+ HEAP32[((buf)>>2)] = stat.dev;
+ HEAP32[(((buf)+(4))>>2)] = 0;
+ HEAP32[(((buf)+(8))>>2)] = stat.ino;
+ HEAP32[(((buf)+(12))>>2)] = stat.mode;
+ HEAP32[(((buf)+(16))>>2)] = stat.nlink;
+ HEAP32[(((buf)+(20))>>2)] = stat.uid;
+ HEAP32[(((buf)+(24))>>2)] = stat.gid;
+ HEAP32[(((buf)+(28))>>2)] = stat.rdev;
+ HEAP32[(((buf)+(32))>>2)] = 0;
+ (tempI64 = [stat.size>>>0,(tempDouble=stat.size,(+(Math.abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? ((Math.min((+(Math.floor((tempDouble)/4294967296.0))), 4294967295.0))|0)>>>0 : (~~((+(Math.ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)],HEAP32[(((buf)+(40))>>2)] = tempI64[0],HEAP32[(((buf)+(44))>>2)] = tempI64[1]);
+ HEAP32[(((buf)+(48))>>2)] = 4096;
+ HEAP32[(((buf)+(52))>>2)] = stat.blocks;
+ HEAP32[(((buf)+(56))>>2)] = (stat.atime.getTime() / 1000)|0;
+ HEAP32[(((buf)+(60))>>2)] = 0;
+ HEAP32[(((buf)+(64))>>2)] = (stat.mtime.getTime() / 1000)|0;
+ HEAP32[(((buf)+(68))>>2)] = 0;
+ HEAP32[(((buf)+(72))>>2)] = (stat.ctime.getTime() / 1000)|0;
+ HEAP32[(((buf)+(76))>>2)] = 0;
+ (tempI64 = [stat.ino>>>0,(tempDouble=stat.ino,(+(Math.abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? ((Math.min((+(Math.floor((tempDouble)/4294967296.0))), 4294967295.0))|0)>>>0 : (~~((+(Math.ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)],HEAP32[(((buf)+(80))>>2)] = tempI64[0],HEAP32[(((buf)+(84))>>2)] = tempI64[1]);
+ return 0;
+ },doMsync:function(addr, stream, len, flags, offset) {
+ var buffer = HEAPU8.slice(addr, addr + len);
+ FS.msync(stream, buffer, offset, len, flags);
+ },varargs:undefined,get:function() {
+ SYSCALLS.varargs += 4;
+ var ret = HEAP32[(((SYSCALLS.varargs)-(4))>>2)];
+ return ret;
+ },getStr:function(ptr) {
+ var ret = UTF8ToString(ptr);
+ return ret;
+ },getStreamFromFD:function(fd) {
+ var stream = FS.getStream(fd);
+ if (!stream) throw new FS.ErrnoError(8);
+ return stream;
+ }};
+ function ___syscall_chdir(path) {
+ try {
+
+ path = SYSCALLS.getStr(path);
+ FS.chdir(path);
+ return 0;
+ } catch (e) {
+ if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e;
+ return -e.errno;
+ }
+ }
+
+ function ___syscall_chmod(path, mode) {
+ try {
+
+ path = SYSCALLS.getStr(path);
+ FS.chmod(path, mode);
+ return 0;
+ } catch (e) {
+ if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e;
+ return -e.errno;
+ }
+ }
+
+ function ___syscall_faccessat(dirfd, path, amode, flags) {
+ try {
+
+ path = SYSCALLS.getStr(path);
+ path = SYSCALLS.calculateAt(dirfd, path);
+ if (amode & ~7) {
+ // need a valid mode
+ return -28;
+ }
+ var lookup = FS.lookupPath(path, { follow: true });
+ var node = lookup.node;
+ if (!node) {
+ return -44;
+ }
+ var perms = '';
+ if (amode & 4) perms += 'r';
+ if (amode & 2) perms += 'w';
+ if (amode & 1) perms += 'x';
+ if (perms /* otherwise, they've just passed F_OK */ && FS.nodePermissions(node, perms)) {
+ return -2;
+ }
+ return 0;
+ } catch (e) {
+ if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e;
+ return -e.errno;
+ }
+ }
+
+ function ___syscall_fadvise64(fd, offset, len, advice) {
+ return 0; // your advice is important to us (but we can't use it)
+ }
+
+ function ___syscall_fchmod(fd, mode) {
+ try {
+
+ FS.fchmod(fd, mode);
+ return 0;
+ } catch (e) {
+ if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e;
+ return -e.errno;
+ }
+ }
+
+ function setErrNo(value) {
+ HEAP32[((___errno_location())>>2)] = value;
+ return value;
+ }
+ function ___syscall_fcntl64(fd, cmd, varargs) {
+ SYSCALLS.varargs = varargs;
+ try {
+
+ var stream = SYSCALLS.getStreamFromFD(fd);
+ switch (cmd) {
+ case 0: {
+ var arg = SYSCALLS.get();
+ if (arg < 0) {
+ return -28;
+ }
+ var newStream;
+ newStream = FS.createStream(stream, arg);
+ return newStream.fd;
+ }
+ case 1:
+ case 2:
+ return 0; // FD_CLOEXEC makes no sense for a single process.
+ case 3:
+ return stream.flags;
+ case 4: {
+ var arg = SYSCALLS.get();
+ stream.flags |= arg;
+ return 0;
+ }
+ case 5:
+ /* case 5: Currently in musl F_GETLK64 has same value as F_GETLK, so omitted to avoid duplicate case blocks. If that changes, uncomment this */ {
+
+ var arg = SYSCALLS.get();
+ var offset = 0;
+ // We're always unlocked.
+ HEAP16[(((arg)+(offset))>>1)] = 2;
+ return 0;
+ }
+ case 6:
+ case 7:
+ /* case 6: Currently in musl F_SETLK64 has same value as F_SETLK, so omitted to avoid duplicate case blocks. If that changes, uncomment this */
+ /* case 7: Currently in musl F_SETLKW64 has same value as F_SETLKW, so omitted to avoid duplicate case blocks. If that changes, uncomment this */
+
+
+ return 0; // Pretend that the locking is successful.
+ case 16:
+ case 8:
+ return -28; // These are for sockets. We don't have them fully implemented yet.
+ case 9:
+ // musl trusts getown return values, due to a bug where they must be, as they overlap with errors. just return -1 here, so fcntl() returns that, and we set errno ourselves.
+ setErrNo(28);
+ return -1;
+ default: {
+ return -28;
+ }
+ }
+ } catch (e) {
+ if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e;
+ return -e.errno;
+ }
+ }
+
+ function ___syscall_fstat64(fd, buf) {
+ try {
+
+ var stream = SYSCALLS.getStreamFromFD(fd);
+ return SYSCALLS.doStat(FS.stat, stream.path, buf);
+ } catch (e) {
+ if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e;
+ return -e.errno;
+ }
+ }
+
+ function ___syscall_statfs64(path, size, buf) {
+ try {
+
+ path = SYSCALLS.getStr(path);
+ // NOTE: None of the constants here are true. We're just returning safe and
+ // sane values.
+ HEAP32[(((buf)+(4))>>2)] = 4096;
+ HEAP32[(((buf)+(40))>>2)] = 4096;
+ HEAP32[(((buf)+(8))>>2)] = 1000000;
+ HEAP32[(((buf)+(12))>>2)] = 500000;
+ HEAP32[(((buf)+(16))>>2)] = 500000;
+ HEAP32[(((buf)+(20))>>2)] = FS.nextInode;
+ HEAP32[(((buf)+(24))>>2)] = 1000000;
+ HEAP32[(((buf)+(28))>>2)] = 42;
+ HEAP32[(((buf)+(44))>>2)] = 2; // ST_NOSUID
+ HEAP32[(((buf)+(36))>>2)] = 255;
+ return 0;
+ } catch (e) {
+ if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e;
+ return -e.errno;
+ }
+ }
+ function ___syscall_fstatfs64(fd, size, buf) {
+ try {
+
+ var stream = SYSCALLS.getStreamFromFD(fd);
+ return ___syscall_statfs64(0, size, buf);
+ } catch (e) {
+ if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e;
+ return -e.errno;
+ }
+ }
+
+ function convertI32PairToI53Checked(lo, hi) {
+ return ((hi + 0x200000) >>> 0 < 0x400001 - !!lo) ? (lo >>> 0) + hi * 4294967296 : NaN;
+ }
+ function ___syscall_ftruncate64(fd, length_low, length_high) {
+ try {
+
+ var length = convertI32PairToI53Checked(length_low, length_high); if (isNaN(length)) return -61;
+ FS.ftruncate(fd, length);
+ return 0;
+ } catch (e) {
+ if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e;
+ return -e.errno;
+ }
+ }
+
+ function ___syscall_getcwd(buf, size) {
+ try {
+
+ if (size === 0) return -28;
+ var cwd = FS.cwd();
+ var cwdLengthInBytes = lengthBytesUTF8(cwd) + 1;
+ if (size < cwdLengthInBytes) return -68;
+ stringToUTF8(cwd, buf, size);
+ return cwdLengthInBytes;
+ } catch (e) {
+ if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e;
+ return -e.errno;
+ }
+ }
+
+ function ___syscall_getdents64(fd, dirp, count) {
+ try {
+
+ var stream = SYSCALLS.getStreamFromFD(fd)
+ if (!stream.getdents) {
+ stream.getdents = FS.readdir(stream.path);
+ }
+
+ var struct_size = 280;
+ var pos = 0;
+ var off = FS.llseek(stream, 0, 1);
+
+ var idx = Math.floor(off / struct_size);
+
+ while (idx < stream.getdents.length && pos + struct_size <= count) {
+ var id;
+ var type;
+ var name = stream.getdents[idx];
+ if (name === '.') {
+ id = stream.node.id;
+ type = 4; // DT_DIR
+ }
+ else if (name === '..') {
+ var lookup = FS.lookupPath(stream.path, { parent: true });
+ id = lookup.node.id;
+ type = 4; // DT_DIR
+ }
+ else {
+ var child = FS.lookupNode(stream.node, name);
+ id = child.id;
+ type = FS.isChrdev(child.mode) ? 2 : // DT_CHR, character device.
+ FS.isDir(child.mode) ? 4 : // DT_DIR, directory.
+ FS.isLink(child.mode) ? 10 : // DT_LNK, symbolic link.
+ 8; // DT_REG, regular file.
+ }
+ (tempI64 = [id>>>0,(tempDouble=id,(+(Math.abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? ((Math.min((+(Math.floor((tempDouble)/4294967296.0))), 4294967295.0))|0)>>>0 : (~~((+(Math.ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)],HEAP32[((dirp + pos)>>2)] = tempI64[0],HEAP32[(((dirp + pos)+(4))>>2)] = tempI64[1]);
+ (tempI64 = [(idx + 1) * struct_size>>>0,(tempDouble=(idx + 1) * struct_size,(+(Math.abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? ((Math.min((+(Math.floor((tempDouble)/4294967296.0))), 4294967295.0))|0)>>>0 : (~~((+(Math.ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)],HEAP32[(((dirp + pos)+(8))>>2)] = tempI64[0],HEAP32[(((dirp + pos)+(12))>>2)] = tempI64[1]);
+ HEAP16[(((dirp + pos)+(16))>>1)] = 280;
+ HEAP8[(((dirp + pos)+(18))>>0)] = type;
+ stringToUTF8(name, dirp + pos + 19, 256);
+ pos += struct_size;
+ idx += 1;
+ }
+ FS.llseek(stream, idx * struct_size, 0);
+ return pos;
+ } catch (e) {
+ if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e;
+ return -e.errno;
+ }
+ }
+
+ function ___syscall_ioctl(fd, op, varargs) {
+ SYSCALLS.varargs = varargs;
+ try {
+
+ var stream = SYSCALLS.getStreamFromFD(fd);
+ switch (op) {
+ case 21509:
+ case 21505: {
+ if (!stream.tty) return -59;
+ return 0;
+ }
+ case 21510:
+ case 21511:
+ case 21512:
+ case 21506:
+ case 21507:
+ case 21508: {
+ if (!stream.tty) return -59;
+ return 0; // no-op, not actually adjusting terminal settings
+ }
+ case 21519: {
+ if (!stream.tty) return -59;
+ var argp = SYSCALLS.get();
+ HEAP32[((argp)>>2)] = 0;
+ return 0;
+ }
+ case 21520: {
+ if (!stream.tty) return -59;
+ return -28; // not supported
+ }
+ case 21531: {
+ var argp = SYSCALLS.get();
+ return FS.ioctl(stream, op, argp);
+ }
+ case 21523: {
+ // TODO: in theory we should write to the winsize struct that gets
+ // passed in, but for now musl doesn't read anything on it
+ if (!stream.tty) return -59;
+ return 0;
+ }
+ case 21524: {
+ // TODO: technically, this ioctl call should change the window size.
+ // but, since emscripten doesn't have any concept of a terminal window
+ // yet, we'll just silently throw it away as we do TIOCGWINSZ
+ if (!stream.tty) return -59;
+ return 0;
+ }
+ default: abort('bad ioctl syscall ' + op);
+ }
+ } catch (e) {
+ if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e;
+ return -e.errno;
+ }
+ }
+
+ function ___syscall_lstat64(path, buf) {
+ try {
+
+ path = SYSCALLS.getStr(path);
+ return SYSCALLS.doStat(FS.lstat, path, buf);
+ } catch (e) {
+ if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e;
+ return -e.errno;
+ }
+ }
+
+ function ___syscall_mkdirat(dirfd, path, mode) {
+ try {
+
+ path = SYSCALLS.getStr(path);
+ path = SYSCALLS.calculateAt(dirfd, path);
+ // remove a trailing slash, if one - /a/b/ has basename of '', but
+ // we want to create b in the context of this function
+ path = PATH.normalize(path);
+ if (path[path.length-1] === '/') path = path.substr(0, path.length-1);
+ FS.mkdir(path, mode, 0);
+ return 0;
+ } catch (e) {
+ if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e;
+ return -e.errno;
+ }
+ }
+
+ function ___syscall_newfstatat(dirfd, path, buf, flags) {
+ try {
+
+ path = SYSCALLS.getStr(path);
+ var nofollow = flags & 256;
+ var allowEmpty = flags & 4096;
+ flags = flags & (~4352);
+ path = SYSCALLS.calculateAt(dirfd, path, allowEmpty);
+ return SYSCALLS.doStat(nofollow ? FS.lstat : FS.stat, path, buf);
+ } catch (e) {
+ if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e;
+ return -e.errno;
+ }
+ }
+
+ function ___syscall_openat(dirfd, path, flags, varargs) {
+ SYSCALLS.varargs = varargs;
+ try {
+
+ path = SYSCALLS.getStr(path);
+ path = SYSCALLS.calculateAt(dirfd, path);
+ var mode = varargs ? SYSCALLS.get() : 0;
+ return FS.open(path, flags, mode).fd;
+ } catch (e) {
+ if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e;
+ return -e.errno;
+ }
+ }
+
+ function ___syscall_readlinkat(dirfd, path, buf, bufsize) {
+ try {
+
+ path = SYSCALLS.getStr(path);
+ path = SYSCALLS.calculateAt(dirfd, path);
+ if (bufsize <= 0) return -28;
+ var ret = FS.readlink(path);
+
+ var len = Math.min(bufsize, lengthBytesUTF8(ret));
+ var endChar = HEAP8[buf+len];
+ stringToUTF8(ret, buf, bufsize+1);
+ // readlink is one of the rare functions that write out a C string, but does never append a null to the output buffer(!)
+ // stringToUTF8() always appends a null byte, so restore the character under the null byte after the write.
+ HEAP8[buf+len] = endChar;
+ return len;
+ } catch (e) {
+ if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e;
+ return -e.errno;
+ }
+ }
+
+ var SOCKFS = {mount:function(mount) {
+ // If Module['websocket'] has already been defined (e.g. for configuring
+ // the subprotocol/url) use that, if not initialise it to a new object.
+ Module['websocket'] = (Module['websocket'] &&
+ ('object' === typeof Module['websocket'])) ? Module['websocket'] : {};
+
+ // Add the Event registration mechanism to the exported websocket configuration
+ // object so we can register network callbacks from native JavaScript too.
+ // For more documentation see system/include/emscripten/emscripten.h
+ Module['websocket']._callbacks = {};
+ Module['websocket']['on'] = /** @this{Object} */ function(event, callback) {
+ if ('function' === typeof callback) {
+ this._callbacks[event] = callback;
+ }
+ return this;
+ };
+
+ Module['websocket'].emit = /** @this{Object} */ function(event, param) {
+ if ('function' === typeof this._callbacks[event]) {
+ this._callbacks[event].call(this, param);
+ }
+ };
+
+ // If debug is enabled register simple default logging callbacks for each Event.
+
+ return FS.createNode(null, '/', 16384 | 511 /* 0777 */, 0);
+ },createSocket:function(family, type, protocol) {
+ type &= ~526336; // Some applications may pass it; it makes no sense for a single process.
+ var streaming = type == 1;
+ if (streaming && protocol && protocol != 6) {
+ throw new FS.ErrnoError(66); // if SOCK_STREAM, must be tcp or 0.
+ }
+
+ // create our internal socket structure
+ var sock = {
+ family: family,
+ type: type,
+ protocol: protocol,
+ server: null,
+ error: null, // Used in getsockopt for SOL_SOCKET/SO_ERROR test
+ peers: {},
+ pending: [],
+ recv_queue: [],
+ sock_ops: SOCKFS.websocket_sock_ops
+ };
+
+ // create the filesystem node to store the socket structure
+ var name = SOCKFS.nextname();
+ var node = FS.createNode(SOCKFS.root, name, 49152, 0);
+ node.sock = sock;
+
+ // and the wrapping stream that enables library functions such
+ // as read and write to indirectly interact with the socket
+ var stream = FS.createStream({
+ path: name,
+ node: node,
+ flags: 2,
+ seekable: false,
+ stream_ops: SOCKFS.stream_ops
+ });
+
+ // map the new stream to the socket structure (sockets have a 1:1
+ // relationship with a stream)
+ sock.stream = stream;
+
+ return sock;
+ },getSocket:function(fd) {
+ var stream = FS.getStream(fd);
+ if (!stream || !FS.isSocket(stream.node.mode)) {
+ return null;
+ }
+ return stream.node.sock;
+ },stream_ops:{poll:function(stream) {
+ var sock = stream.node.sock;
+ return sock.sock_ops.poll(sock);
+ },ioctl:function(stream, request, varargs) {
+ var sock = stream.node.sock;
+ return sock.sock_ops.ioctl(sock, request, varargs);
+ },read:function(stream, buffer, offset, length, position /* ignored */) {
+ var sock = stream.node.sock;
+ var msg = sock.sock_ops.recvmsg(sock, length);
+ if (!msg) {
+ // socket is closed
+ return 0;
+ }
+ buffer.set(msg.buffer, offset);
+ return msg.buffer.length;
+ },write:function(stream, buffer, offset, length, position /* ignored */) {
+ var sock = stream.node.sock;
+ return sock.sock_ops.sendmsg(sock, buffer, offset, length);
+ },close:function(stream) {
+ var sock = stream.node.sock;
+ sock.sock_ops.close(sock);
+ }},nextname:function() {
+ if (!SOCKFS.nextname.current) {
+ SOCKFS.nextname.current = 0;
+ }
+ return 'socket[' + (SOCKFS.nextname.current++) + ']';
+ },websocket_sock_ops:{createPeer:function(sock, addr, port) {
+ var ws;
+
+ if (typeof addr == 'object') {
+ ws = addr;
+ addr = null;
+ port = null;
+ }
+
+ if (ws) {
+ // for sockets that've already connected (e.g. we're the server)
+ // we can inspect the _socket property for the address
+ if (ws._socket) {
+ addr = ws._socket.remoteAddress;
+ port = ws._socket.remotePort;
+ }
+ // if we're just now initializing a connection to the remote,
+ // inspect the url property
+ else {
+ var result = /ws[s]?:\/\/([^:]+):(\d+)/.exec(ws.url);
+ if (!result) {
+ throw new Error('WebSocket URL must be in the format ws(s)://address:port');
+ }
+ addr = result[1];
+ port = parseInt(result[2], 10);
+ }
+ } else {
+ // create the actual websocket object and connect
+ try {
+ // runtimeConfig gets set to true if WebSocket runtime configuration is available.
+ var runtimeConfig = (Module['websocket'] && ('object' === typeof Module['websocket']));
+
+ // The default value is 'ws://' the replace is needed because the compiler replaces '//' comments with '#'
+ // comments without checking context, so we'd end up with ws:#, the replace swaps the '#' for '//' again.
+ var url = 'ws:#'.replace('#', '//');
+
+ if (runtimeConfig) {
+ if ('string' === typeof Module['websocket']['url']) {
+ url = Module['websocket']['url']; // Fetch runtime WebSocket URL config.
+ }
+ }
+
+ if (url === 'ws://' || url === 'wss://') { // Is the supplied URL config just a prefix, if so complete it.
+ var parts = addr.split('/');
+ url = url + parts[0] + ":" + port + "/" + parts.slice(1).join('/');
+ }
+
+ // Make the WebSocket subprotocol (Sec-WebSocket-Protocol) default to binary if no configuration is set.
+ var subProtocols = 'binary'; // The default value is 'binary'
+
+ if (runtimeConfig) {
+ if ('string' === typeof Module['websocket']['subprotocol']) {
+ subProtocols = Module['websocket']['subprotocol']; // Fetch runtime WebSocket subprotocol config.
+ }
+ }
+
+ // The default WebSocket options
+ var opts = undefined;
+
+ if (subProtocols !== 'null') {
+ // The regex trims the string (removes spaces at the beginning and end, then splits the string by
+ // , into an Array. Whitespace removal is important for Websockify and ws.
+ subProtocols = subProtocols.replace(/^ +| +$/g,"").split(/ *, */);
+
+ opts = subProtocols;
+ }
+
+ // some webservers (azure) does not support subprotocol header
+ if (runtimeConfig && null === Module['websocket']['subprotocol']) {
+ subProtocols = 'null';
+ opts = undefined;
+ }
+
+ // If node we use the ws library.
+ var WebSocketConstructor;
+ if (ENVIRONMENT_IS_NODE) {
+ WebSocketConstructor = /** @type{(typeof WebSocket)} */(require('ws'));
+ } else
+ {
+ WebSocketConstructor = WebSocket;
+ }
+ ws = new WebSocketConstructor(url, opts);
+ ws.binaryType = 'arraybuffer';
+ } catch (e) {
+ throw new FS.ErrnoError(23);
+ }
+ }
+
+ var peer = {
+ addr: addr,
+ port: port,
+ socket: ws,
+ dgram_send_queue: []
+ };
+
+ SOCKFS.websocket_sock_ops.addPeer(sock, peer);
+ SOCKFS.websocket_sock_ops.handlePeerEvents(sock, peer);
+
+ // if this is a bound dgram socket, send the port number first to allow
+ // us to override the ephemeral port reported to us by remotePort on the
+ // remote end.
+ if (sock.type === 2 && typeof sock.sport != 'undefined') {
+ peer.dgram_send_queue.push(new Uint8Array([
+ 255, 255, 255, 255,
+ 'p'.charCodeAt(0), 'o'.charCodeAt(0), 'r'.charCodeAt(0), 't'.charCodeAt(0),
+ ((sock.sport & 0xff00) >> 8) , (sock.sport & 0xff)
+ ]));
+ }
+
+ return peer;
+ },getPeer:function(sock, addr, port) {
+ return sock.peers[addr + ':' + port];
+ },addPeer:function(sock, peer) {
+ sock.peers[peer.addr + ':' + peer.port] = peer;
+ },removePeer:function(sock, peer) {
+ delete sock.peers[peer.addr + ':' + peer.port];
+ },handlePeerEvents:function(sock, peer) {
+ var first = true;
+
+ var handleOpen = function () {
+
+ Module['websocket'].emit('open', sock.stream.fd);
+
+ try {
+ var queued = peer.dgram_send_queue.shift();
+ while (queued) {
+ peer.socket.send(queued);
+ queued = peer.dgram_send_queue.shift();
+ }
+ } catch (e) {
+ // not much we can do here in the way of proper error handling as we've already
+ // lied and said this data was sent. shut it down.
+ peer.socket.close();
+ }
+ };
+
+ function handleMessage(data) {
+ if (typeof data == 'string') {
+ var encoder = new TextEncoder(); // should be utf-8
+ data = encoder.encode(data); // make a typed array from the string
+ } else {
+ assert(data.byteLength !== undefined); // must receive an ArrayBuffer
+ if (data.byteLength == 0) {
+ // An empty ArrayBuffer will emit a pseudo disconnect event
+ // as recv/recvmsg will return zero which indicates that a socket
+ // has performed a shutdown although the connection has not been disconnected yet.
+ return;
+ } else {
+ data = new Uint8Array(data); // make a typed array view on the array buffer
+ }
+ }
+
+ // if this is the port message, override the peer's port with it
+ var wasfirst = first;
+ first = false;
+ if (wasfirst &&
+ data.length === 10 &&
+ data[0] === 255 && data[1] === 255 && data[2] === 255 && data[3] === 255 &&
+ data[4] === 'p'.charCodeAt(0) && data[5] === 'o'.charCodeAt(0) && data[6] === 'r'.charCodeAt(0) && data[7] === 't'.charCodeAt(0)) {
+ // update the peer's port and it's key in the peer map
+ var newport = ((data[8] << 8) | data[9]);
+ SOCKFS.websocket_sock_ops.removePeer(sock, peer);
+ peer.port = newport;
+ SOCKFS.websocket_sock_ops.addPeer(sock, peer);
+ return;
+ }
+
+ sock.recv_queue.push({ addr: peer.addr, port: peer.port, data: data });
+ Module['websocket'].emit('message', sock.stream.fd);
+ };
+
+ if (ENVIRONMENT_IS_NODE) {
+ peer.socket.on('open', handleOpen);
+ peer.socket.on('message', function(data, isBinary) {
+ if (!isBinary) {
+ return;
+ }
+ handleMessage((new Uint8Array(data)).buffer); // copy from node Buffer -> ArrayBuffer
+ });
+ peer.socket.on('close', function() {
+ Module['websocket'].emit('close', sock.stream.fd);
+ });
+ peer.socket.on('error', function(error) {
+ // Although the ws library may pass errors that may be more descriptive than
+ // ECONNREFUSED they are not necessarily the expected error code e.g.
+ // ENOTFOUND on getaddrinfo seems to be node.js specific, so using ECONNREFUSED
+ // is still probably the most useful thing to do.
+ sock.error = 14; // Used in getsockopt for SOL_SOCKET/SO_ERROR test.
+ Module['websocket'].emit('error', [sock.stream.fd, sock.error, 'ECONNREFUSED: Connection refused']);
+ // don't throw
+ });
+ } else {
+ peer.socket.onopen = handleOpen;
+ peer.socket.onclose = function() {
+ Module['websocket'].emit('close', sock.stream.fd);
+ };
+ peer.socket.onmessage = function peer_socket_onmessage(event) {
+ handleMessage(event.data);
+ };
+ peer.socket.onerror = function(error) {
+ // The WebSocket spec only allows a 'simple event' to be thrown on error,
+ // so we only really know as much as ECONNREFUSED.
+ sock.error = 14; // Used in getsockopt for SOL_SOCKET/SO_ERROR test.
+ Module['websocket'].emit('error', [sock.stream.fd, sock.error, 'ECONNREFUSED: Connection refused']);
+ };
+ }
+ },poll:function(sock) {
+ if (sock.type === 1 && sock.server) {
+ // listen sockets should only say they're available for reading
+ // if there are pending clients.
+ return sock.pending.length ? (64 | 1) : 0;
+ }
+
+ var mask = 0;
+ var dest = sock.type === 1 ? // we only care about the socket state for connection-based sockets
+ SOCKFS.websocket_sock_ops.getPeer(sock, sock.daddr, sock.dport) :
+ null;
+
+ if (sock.recv_queue.length ||
+ !dest || // connection-less sockets are always ready to read
+ (dest && dest.socket.readyState === dest.socket.CLOSING) ||
+ (dest && dest.socket.readyState === dest.socket.CLOSED)) { // let recv return 0 once closed
+ mask |= (64 | 1);
+ }
+
+ if (!dest || // connection-less sockets are always ready to write
+ (dest && dest.socket.readyState === dest.socket.OPEN)) {
+ mask |= 4;
+ }
+
+ if ((dest && dest.socket.readyState === dest.socket.CLOSING) ||
+ (dest && dest.socket.readyState === dest.socket.CLOSED)) {
+ mask |= 16;
+ }
+
+ return mask;
+ },ioctl:function(sock, request, arg) {
+ switch (request) {
+ case 21531:
+ var bytes = 0;
+ if (sock.recv_queue.length) {
+ bytes = sock.recv_queue[0].data.length;
+ }
+ HEAP32[((arg)>>2)] = bytes;
+ return 0;
+ default:
+ return 28;
+ }
+ },close:function(sock) {
+ // if we've spawned a listen server, close it
+ if (sock.server) {
+ try {
+ sock.server.close();
+ } catch (e) {
+ }
+ sock.server = null;
+ }
+ // close any peer connections
+ var peers = Object.keys(sock.peers);
+ for (var i = 0; i < peers.length; i++) {
+ var peer = sock.peers[peers[i]];
+ try {
+ peer.socket.close();
+ } catch (e) {
+ }
+ SOCKFS.websocket_sock_ops.removePeer(sock, peer);
+ }
+ return 0;
+ },bind:function(sock, addr, port) {
+ if (typeof sock.saddr != 'undefined' || typeof sock.sport != 'undefined') {
+ throw new FS.ErrnoError(28); // already bound
+ }
+ sock.saddr = addr;
+ sock.sport = port;
+ // in order to emulate dgram sockets, we need to launch a listen server when
+ // binding on a connection-less socket
+ // note: this is only required on the server side
+ if (sock.type === 2) {
+ // close the existing server if it exists
+ if (sock.server) {
+ sock.server.close();
+ sock.server = null;
+ }
+ // swallow error operation not supported error that occurs when binding in the
+ // browser where this isn't supported
+ try {
+ sock.sock_ops.listen(sock, 0);
+ } catch (e) {
+ if (!(e instanceof FS.ErrnoError)) throw e;
+ if (e.errno !== 138) throw e;
+ }
+ }
+ },connect:function(sock, addr, port) {
+ if (sock.server) {
+ throw new FS.ErrnoError(138);
+ }
+
+ // TODO autobind
+ // if (!sock.addr && sock.type == 2) {
+ // }
+
+ // early out if we're already connected / in the middle of connecting
+ if (typeof sock.daddr != 'undefined' && typeof sock.dport != 'undefined') {
+ var dest = SOCKFS.websocket_sock_ops.getPeer(sock, sock.daddr, sock.dport);
+ if (dest) {
+ if (dest.socket.readyState === dest.socket.CONNECTING) {
+ throw new FS.ErrnoError(7);
+ } else {
+ throw new FS.ErrnoError(30);
+ }
+ }
+ }
+
+ // add the socket to our peer list and set our
+ // destination address / port to match
+ var peer = SOCKFS.websocket_sock_ops.createPeer(sock, addr, port);
+ sock.daddr = peer.addr;
+ sock.dport = peer.port;
+
+ // always "fail" in non-blocking mode
+ throw new FS.ErrnoError(26);
+ },listen:function(sock, backlog) {
+ if (!ENVIRONMENT_IS_NODE) {
+ throw new FS.ErrnoError(138);
+ }
+ if (sock.server) {
+ throw new FS.ErrnoError(28); // already listening
+ }
+ var WebSocketServer = require('ws').Server;
+ var host = sock.saddr;
+ sock.server = new WebSocketServer({
+ host: host,
+ port: sock.sport
+ // TODO support backlog
+ });
+ Module['websocket'].emit('listen', sock.stream.fd); // Send Event with listen fd.
+
+ sock.server.on('connection', function(ws) {
+ if (sock.type === 1) {
+ var newsock = SOCKFS.createSocket(sock.family, sock.type, sock.protocol);
+
+ // create a peer on the new socket
+ var peer = SOCKFS.websocket_sock_ops.createPeer(newsock, ws);
+ newsock.daddr = peer.addr;
+ newsock.dport = peer.port;
+
+ // push to queue for accept to pick up
+ sock.pending.push(newsock);
+ Module['websocket'].emit('connection', newsock.stream.fd);
+ } else {
+ // create a peer on the listen socket so calling sendto
+ // with the listen socket and an address will resolve
+ // to the correct client
+ SOCKFS.websocket_sock_ops.createPeer(sock, ws);
+ Module['websocket'].emit('connection', sock.stream.fd);
+ }
+ });
+ sock.server.on('close', function() {
+ Module['websocket'].emit('close', sock.stream.fd);
+ sock.server = null;
+ });
+ sock.server.on('error', function(error) {
+ // Although the ws library may pass errors that may be more descriptive than
+ // ECONNREFUSED they are not necessarily the expected error code e.g.
+ // ENOTFOUND on getaddrinfo seems to be node.js specific, so using EHOSTUNREACH
+ // is still probably the most useful thing to do. This error shouldn't
+ // occur in a well written app as errors should get trapped in the compiled
+ // app's own getaddrinfo call.
+ sock.error = 23; // Used in getsockopt for SOL_SOCKET/SO_ERROR test.
+ Module['websocket'].emit('error', [sock.stream.fd, sock.error, 'EHOSTUNREACH: Host is unreachable']);
+ // don't throw
+ });
+ },accept:function(listensock) {
+ if (!listensock.server || !listensock.pending.length) {
+ throw new FS.ErrnoError(28);
+ }
+ var newsock = listensock.pending.shift();
+ newsock.stream.flags = listensock.stream.flags;
+ return newsock;
+ },getname:function(sock, peer) {
+ var addr, port;
+ if (peer) {
+ if (sock.daddr === undefined || sock.dport === undefined) {
+ throw new FS.ErrnoError(53);
+ }
+ addr = sock.daddr;
+ port = sock.dport;
+ } else {
+ // TODO saddr and sport will be set for bind()'d UDP sockets, but what
+ // should we be returning for TCP sockets that've been connect()'d?
+ addr = sock.saddr || 0;
+ port = sock.sport || 0;
+ }
+ return { addr: addr, port: port };
+ },sendmsg:function(sock, buffer, offset, length, addr, port) {
+ if (sock.type === 2) {
+ // connection-less sockets will honor the message address,
+ // and otherwise fall back to the bound destination address
+ if (addr === undefined || port === undefined) {
+ addr = sock.daddr;
+ port = sock.dport;
+ }
+ // if there was no address to fall back to, error out
+ if (addr === undefined || port === undefined) {
+ throw new FS.ErrnoError(17);
+ }
+ } else {
+ // connection-based sockets will only use the bound
+ addr = sock.daddr;
+ port = sock.dport;
+ }
+
+ // find the peer for the destination address
+ var dest = SOCKFS.websocket_sock_ops.getPeer(sock, addr, port);
+
+ // early out if not connected with a connection-based socket
+ if (sock.type === 1) {
+ if (!dest || dest.socket.readyState === dest.socket.CLOSING || dest.socket.readyState === dest.socket.CLOSED) {
+ throw new FS.ErrnoError(53);
+ } else if (dest.socket.readyState === dest.socket.CONNECTING) {
+ throw new FS.ErrnoError(6);
+ }
+ }
+
+ // create a copy of the incoming data to send, as the WebSocket API
+ // doesn't work entirely with an ArrayBufferView, it'll just send
+ // the entire underlying buffer
+ if (ArrayBuffer.isView(buffer)) {
+ offset += buffer.byteOffset;
+ buffer = buffer.buffer;
+ }
+
+ var data;
+ data = buffer.slice(offset, offset + length);
+
+ // if we're emulating a connection-less dgram socket and don't have
+ // a cached connection, queue the buffer to send upon connect and
+ // lie, saying the data was sent now.
+ if (sock.type === 2) {
+ if (!dest || dest.socket.readyState !== dest.socket.OPEN) {
+ // if we're not connected, open a new connection
+ if (!dest || dest.socket.readyState === dest.socket.CLOSING || dest.socket.readyState === dest.socket.CLOSED) {
+ dest = SOCKFS.websocket_sock_ops.createPeer(sock, addr, port);
+ }
+ dest.dgram_send_queue.push(data);
+ return length;
+ }
+ }
+
+ try {
+ // send the actual data
+ dest.socket.send(data);
+ return length;
+ } catch (e) {
+ throw new FS.ErrnoError(28);
+ }
+ },recvmsg:function(sock, length) {
+ // http://pubs.opengroup.org/onlinepubs/7908799/xns/recvmsg.html
+ if (sock.type === 1 && sock.server) {
+ // tcp servers should not be recv()'ing on the listen socket
+ throw new FS.ErrnoError(53);
+ }
+
+ var queued = sock.recv_queue.shift();
+ if (!queued) {
+ if (sock.type === 1) {
+ var dest = SOCKFS.websocket_sock_ops.getPeer(sock, sock.daddr, sock.dport);
+
+ if (!dest) {
+ // if we have a destination address but are not connected, error out
+ throw new FS.ErrnoError(53);
+ }
+ else if (dest.socket.readyState === dest.socket.CLOSING || dest.socket.readyState === dest.socket.CLOSED) {
+ // return null if the socket has closed
+ return null;
+ }
+ else {
+ // else, our socket is in a valid state but truly has nothing available
+ throw new FS.ErrnoError(6);
+ }
+ } else {
+ throw new FS.ErrnoError(6);
+ }
+ }
+
+ // queued.data will be an ArrayBuffer if it's unadulterated, but if it's
+ // requeued TCP data it'll be an ArrayBufferView
+ var queuedLength = queued.data.byteLength || queued.data.length;
+ var queuedOffset = queued.data.byteOffset || 0;
+ var queuedBuffer = queued.data.buffer || queued.data;
+ var bytesRead = Math.min(length, queuedLength);
+ var res = {
+ buffer: new Uint8Array(queuedBuffer, queuedOffset, bytesRead),
+ addr: queued.addr,
+ port: queued.port
+ };
+
+ // push back any unread data for TCP connections
+ if (sock.type === 1 && bytesRead < queuedLength) {
+ var bytesRemaining = queuedLength - bytesRead;
+ queued.data = new Uint8Array(queuedBuffer, queuedOffset + bytesRead, bytesRemaining);
+ sock.recv_queue.unshift(queued);
+ }
+
+ return res;
+ }}};
+ function getSocketFromFD(fd) {
+ var socket = SOCKFS.getSocket(fd);
+ if (!socket) throw new FS.ErrnoError(8);
+ return socket;
+ }
+
+ var Sockets = {BUFFER_SIZE:10240,MAX_BUFFER_SIZE:10485760,nextFd:1,fds:{},nextport:1,maxport:65535,peer:null,connections:{},portmap:{},localAddr:4261412874,addrPool:[33554442,50331658,67108874,83886090,100663306,117440522,134217738,150994954,167772170,184549386,201326602,218103818,234881034]};
+
+ function inetPton4(str) {
+ var b = str.split('.');
+ for (var i = 0; i < 4; i++) {
+ var tmp = Number(b[i]);
+ if (isNaN(tmp)) return null;
+ b[i] = tmp;
+ }
+ return (b[0] | (b[1] << 8) | (b[2] << 16) | (b[3] << 24)) >>> 0;
+ }
+
+ /** @suppress {checkTypes} */
+ function jstoi_q(str) {
+ return parseInt(str);
+ }
+ function inetPton6(str) {
+ var words;
+ var w, offset, z, i;
+ /* http://home.deds.nl/~aeron/regex/ */
+ var valid6regx = /^((?=.*::)(?!.*::.+::)(::)?([\dA-F]{1,4}:(:|\b)|){5}|([\dA-F]{1,4}:){6})((([\dA-F]{1,4}((?!\3)::|:\b|$))|(?!\2\3)){2}|(((2[0-4]|1\d|[1-9])?\d|25[0-5])\.?\b){4})$/i
+ var parts = [];
+ if (!valid6regx.test(str)) {
+ return null;
+ }
+ if (str === "::") {
+ return [0, 0, 0, 0, 0, 0, 0, 0];
+ }
+ // Z placeholder to keep track of zeros when splitting the string on ":"
+ if (str.startsWith("::")) {
+ str = str.replace("::", "Z:"); // leading zeros case
+ } else {
+ str = str.replace("::", ":Z:");
+ }
+
+ if (str.indexOf(".") > 0) {
+ // parse IPv4 embedded stress
+ str = str.replace(new RegExp('[.]', 'g'), ":");
+ words = str.split(":");
+ words[words.length-4] = jstoi_q(words[words.length-4]) + jstoi_q(words[words.length-3])*256;
+ words[words.length-3] = jstoi_q(words[words.length-2]) + jstoi_q(words[words.length-1])*256;
+ words = words.slice(0, words.length-2);
+ } else {
+ words = str.split(":");
+ }
+
+ offset = 0; z = 0;
+ for (w=0; w < words.length; w++) {
+ if (typeof words[w] == 'string') {
+ if (words[w] === 'Z') {
+ // compressed zeros - write appropriate number of zero words
+ for (z = 0; z < (8 - words.length+1); z++) {
+ parts[w+z] = 0;
+ }
+ offset = z-1;
+ } else {
+ // parse hex to field to 16-bit value and write it in network byte-order
+ parts[w+offset] = _htons(parseInt(words[w],16));
+ }
+ } else {
+ // parsed IPv4 words
+ parts[w+offset] = words[w];
+ }
+ }
+ return [
+ (parts[1] << 16) | parts[0],
+ (parts[3] << 16) | parts[2],
+ (parts[5] << 16) | parts[4],
+ (parts[7] << 16) | parts[6]
+ ];
+ }
+ /** @param {number=} addrlen */
+ function writeSockaddr(sa, family, addr, port, addrlen) {
+ switch (family) {
+ case 2:
+ addr = inetPton4(addr);
+ zeroMemory(sa, 16);
+ if (addrlen) {
+ HEAP32[((addrlen)>>2)] = 16;
+ }
+ HEAP16[((sa)>>1)] = family;
+ HEAP32[(((sa)+(4))>>2)] = addr;
+ HEAP16[(((sa)+(2))>>1)] = _htons(port);
+ break;
+ case 10:
+ addr = inetPton6(addr);
+ zeroMemory(sa, 28);
+ if (addrlen) {
+ HEAP32[((addrlen)>>2)] = 28;
+ }
+ HEAP32[((sa)>>2)] = family;
+ HEAP32[(((sa)+(8))>>2)] = addr[0];
+ HEAP32[(((sa)+(12))>>2)] = addr[1];
+ HEAP32[(((sa)+(16))>>2)] = addr[2];
+ HEAP32[(((sa)+(20))>>2)] = addr[3];
+ HEAP16[(((sa)+(2))>>1)] = _htons(port);
+ break;
+ default:
+ return 5;
+ }
+ return 0;
+ }
+
+ var DNS = {address_map:{id:1,addrs:{},names:{}},lookup_name:function (name) {
+ // If the name is already a valid ipv4 / ipv6 address, don't generate a fake one.
+ var res = inetPton4(name);
+ if (res !== null) {
+ return name;
+ }
+ res = inetPton6(name);
+ if (res !== null) {
+ return name;
+ }
+
+ // See if this name is already mapped.
+ var addr;
+
+ if (DNS.address_map.addrs[name]) {
+ addr = DNS.address_map.addrs[name];
+ } else {
+ var id = DNS.address_map.id++;
+ assert(id < 65535, 'exceeded max address mappings of 65535');
+
+ addr = '172.29.' + (id & 0xff) + '.' + (id & 0xff00);
+
+ DNS.address_map.names[addr] = name;
+ DNS.address_map.addrs[name] = addr;
+ }
+
+ return addr;
+ },lookup_addr:function (addr) {
+ if (DNS.address_map.names[addr]) {
+ return DNS.address_map.names[addr];
+ }
+
+ return null;
+ }};
+ function ___syscall_recvfrom(fd, buf, len, flags, addr, addrlen) {
+ try {
+
+ var sock = getSocketFromFD(fd);
+ var msg = sock.sock_ops.recvmsg(sock, len);
+ if (!msg) return 0; // socket is closed
+ if (addr) {
+ var errno = writeSockaddr(addr, sock.family, DNS.lookup_name(msg.addr), msg.port, addrlen);
+ }
+ HEAPU8.set(msg.buffer, buf);
+ return msg.buffer.byteLength;
+ } catch (e) {
+ if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e;
+ return -e.errno;
+ }
+ }
+
+ function ___syscall_renameat(olddirfd, oldpath, newdirfd, newpath) {
+ try {
+
+ oldpath = SYSCALLS.getStr(oldpath);
+ newpath = SYSCALLS.getStr(newpath);
+ oldpath = SYSCALLS.calculateAt(olddirfd, oldpath);
+ newpath = SYSCALLS.calculateAt(newdirfd, newpath);
+ FS.rename(oldpath, newpath);
+ return 0;
+ } catch (e) {
+ if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e;
+ return -e.errno;
+ }
+ }
+
+ function ___syscall_rmdir(path) {
+ try {
+
+ path = SYSCALLS.getStr(path);
+ FS.rmdir(path);
+ return 0;
+ } catch (e) {
+ if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e;
+ return -e.errno;
+ }
+ }
+
+ function inetNtop4(addr) {
+ return (addr & 0xff) + '.' + ((addr >> 8) & 0xff) + '.' + ((addr >> 16) & 0xff) + '.' + ((addr >> 24) & 0xff)
+ }
+
+ function inetNtop6(ints) {
+ // ref: http://www.ietf.org/rfc/rfc2373.txt - section 2.5.4
+ // Format for IPv4 compatible and mapped 128-bit IPv6 Addresses
+ // 128-bits are split into eight 16-bit words
+ // stored in network byte order (big-endian)
+ // | 80 bits | 16 | 32 bits |
+ // +-----------------------------------------------------------------+
+ // | 10 bytes | 2 | 4 bytes |
+ // +--------------------------------------+--------------------------+
+ // + 5 words | 1 | 2 words |
+ // +--------------------------------------+--------------------------+
+ // |0000..............................0000|0000| IPv4 ADDRESS | (compatible)
+ // +--------------------------------------+----+---------------------+
+ // |0000..............................0000|FFFF| IPv4 ADDRESS | (mapped)
+ // +--------------------------------------+----+---------------------+
+ var str = "";
+ var word = 0;
+ var longest = 0;
+ var lastzero = 0;
+ var zstart = 0;
+ var len = 0;
+ var i = 0;
+ var parts = [
+ ints[0] & 0xffff,
+ (ints[0] >> 16),
+ ints[1] & 0xffff,
+ (ints[1] >> 16),
+ ints[2] & 0xffff,
+ (ints[2] >> 16),
+ ints[3] & 0xffff,
+ (ints[3] >> 16)
+ ];
+
+ // Handle IPv4-compatible, IPv4-mapped, loopback and any/unspecified addresses
+
+ var hasipv4 = true;
+ var v4part = "";
+ // check if the 10 high-order bytes are all zeros (first 5 words)
+ for (i = 0; i < 5; i++) {
+ if (parts[i] !== 0) { hasipv4 = false; break; }
+ }
+
+ if (hasipv4) {
+ // low-order 32-bits store an IPv4 address (bytes 13 to 16) (last 2 words)
+ v4part = inetNtop4(parts[6] | (parts[7] << 16));
+ // IPv4-mapped IPv6 address if 16-bit value (bytes 11 and 12) == 0xFFFF (6th word)
+ if (parts[5] === -1) {
+ str = "::ffff:";
+ str += v4part;
+ return str;
+ }
+ // IPv4-compatible IPv6 address if 16-bit value (bytes 11 and 12) == 0x0000 (6th word)
+ if (parts[5] === 0) {
+ str = "::";
+ //special case IPv6 addresses
+ if (v4part === "0.0.0.0") v4part = ""; // any/unspecified address
+ if (v4part === "0.0.0.1") v4part = "1";// loopback address
+ str += v4part;
+ return str;
+ }
+ }
+
+ // Handle all other IPv6 addresses
+
+ // first run to find the longest contiguous zero words
+ for (word = 0; word < 8; word++) {
+ if (parts[word] === 0) {
+ if (word - lastzero > 1) {
+ len = 0;
+ }
+ lastzero = word;
+ len++;
+ }
+ if (len > longest) {
+ longest = len;
+ zstart = word - longest + 1;
+ }
+ }
+
+ for (word = 0; word < 8; word++) {
+ if (longest > 1) {
+ // compress contiguous zeros - to produce "::"
+ if (parts[word] === 0 && word >= zstart && word < (zstart + longest) ) {
+ if (word === zstart) {
+ str += ":";
+ if (zstart === 0) str += ":"; //leading zeros case
+ }
+ continue;
+ }
+ }
+ // converts 16-bit words from big-endian to little-endian before converting to hex string
+ str += Number(_ntohs(parts[word] & 0xffff)).toString(16);
+ str += word < 7 ? ":" : "";
+ }
+ return str;
+ }
+ function readSockaddr(sa, salen) {
+ // family / port offsets are common to both sockaddr_in and sockaddr_in6
+ var family = HEAP16[((sa)>>1)];
+ var port = _ntohs(HEAPU16[(((sa)+(2))>>1)]);
+ var addr;
+
+ switch (family) {
+ case 2:
+ if (salen !== 16) {
+ return { errno: 28 };
+ }
+ addr = HEAP32[(((sa)+(4))>>2)];
+ addr = inetNtop4(addr);
+ break;
+ case 10:
+ if (salen !== 28) {
+ return { errno: 28 };
+ }
+ addr = [
+ HEAP32[(((sa)+(8))>>2)],
+ HEAP32[(((sa)+(12))>>2)],
+ HEAP32[(((sa)+(16))>>2)],
+ HEAP32[(((sa)+(20))>>2)]
+ ];
+ addr = inetNtop6(addr);
+ break;
+ default:
+ return { errno: 5 };
+ }
+
+ return { family: family, addr: addr, port: port };
+ }
+ /** @param {boolean=} allowNull */
+ function getSocketAddress(addrp, addrlen, allowNull) {
+ if (allowNull && addrp === 0) return null;
+ var info = readSockaddr(addrp, addrlen);
+ if (info.errno) throw new FS.ErrnoError(info.errno);
+ info.addr = DNS.lookup_addr(info.addr) || info.addr;
+ return info;
+ }
+ function ___syscall_sendto(fd, message, length, flags, addr, addr_len) {
+ try {
+
+ var sock = getSocketFromFD(fd);
+ var dest = getSocketAddress(addr, addr_len, true);
+ if (!dest) {
+ // send, no address provided
+ return FS.write(sock.stream, HEAP8,message, length);
+ } else {
+ // sendto an address
+ return sock.sock_ops.sendmsg(sock, HEAP8,message, length, dest.addr, dest.port);
+ }
+ } catch (e) {
+ if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e;
+ return -e.errno;
+ }
+ }
+
+ function ___syscall_stat64(path, buf) {
+ try {
+
+ path = SYSCALLS.getStr(path);
+ return SYSCALLS.doStat(FS.stat, path, buf);
+ } catch (e) {
+ if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e;
+ return -e.errno;
+ }
+ }
+
+ function ___syscall_unlinkat(dirfd, path, flags) {
+ try {
+
+ path = SYSCALLS.getStr(path);
+ path = SYSCALLS.calculateAt(dirfd, path);
+ if (flags === 0) {
+ FS.unlink(path);
+ } else if (flags === 512) {
+ FS.rmdir(path);
+ } else {
+ abort('Invalid flags passed to unlinkat');
+ }
+ return 0;
+ } catch (e) {
+ if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e;
+ return -e.errno;
+ }
+ }
+
+ function ___syscall_utimensat(dirfd, path, times, flags) {
+ try {
+
+ path = SYSCALLS.getStr(path);
+ path = SYSCALLS.calculateAt(dirfd, path, true);
+ if (!times) {
+ var atime = Date.now();
+ var mtime = atime;
+ } else {
+ var seconds = HEAP32[((times)>>2)];
+ var nanoseconds = HEAP32[(((times)+(4))>>2)];
+ atime = (seconds*1000) + (nanoseconds/(1000*1000));
+ times += 8;
+ seconds = HEAP32[((times)>>2)];
+ nanoseconds = HEAP32[(((times)+(4))>>2)];
+ mtime = (seconds*1000) + (nanoseconds/(1000*1000));
+ }
+ FS.utime(path, atime, mtime);
+ return 0;
+ } catch (e) {
+ if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e;
+ return -e.errno;
+ }
+ }
+
+ function __emscripten_date_now() {
+ return Date.now();
+ }
+
+ var nowIsMonotonic = true;;
+ function __emscripten_get_now_is_monotonic() {
+ return nowIsMonotonic;
+ }
+
+ function __emscripten_throw_longjmp() { throw Infinity; }
+
+ function __localtime_js(time, tmPtr) {
+ var date = new Date(HEAP32[((time)>>2)]*1000);
+ HEAP32[((tmPtr)>>2)] = date.getSeconds();
+ HEAP32[(((tmPtr)+(4))>>2)] = date.getMinutes();
+ HEAP32[(((tmPtr)+(8))>>2)] = date.getHours();
+ HEAP32[(((tmPtr)+(12))>>2)] = date.getDate();
+ HEAP32[(((tmPtr)+(16))>>2)] = date.getMonth();
+ HEAP32[(((tmPtr)+(20))>>2)] = date.getFullYear()-1900;
+ HEAP32[(((tmPtr)+(24))>>2)] = date.getDay();
+
+ var start = new Date(date.getFullYear(), 0, 1);
+ var yday = ((date.getTime() - start.getTime()) / (1000 * 60 * 60 * 24))|0;
+ HEAP32[(((tmPtr)+(28))>>2)] = yday;
+ HEAP32[(((tmPtr)+(36))>>2)] = -(date.getTimezoneOffset() * 60);
+
+ // Attention: DST is in December in South, and some regions don't have DST at all.
+ var summerOffset = new Date(date.getFullYear(), 6, 1).getTimezoneOffset();
+ var winterOffset = start.getTimezoneOffset();
+ var dst = (summerOffset != winterOffset && date.getTimezoneOffset() == Math.min(winterOffset, summerOffset))|0;
+ HEAP32[(((tmPtr)+(32))>>2)] = dst;
+ }
+
+ function __mmap_js(len, prot, flags, fd, off, allocated) {
+ try {
+
+ var stream = FS.getStream(fd);
+ if (!stream) return -8;
+ var res = FS.mmap(stream, len, off, prot, flags);
+ var ptr = res.ptr;
+ HEAP32[((allocated)>>2)] = res.allocated;
+ return ptr;
+ } catch (e) {
+ if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e;
+ return -e.errno;
+ }
+ }
+
+ function __msync_js(addr, len, flags, fd) {
+ try {
+
+ SYSCALLS.doMsync(addr, FS.getStream(fd), len, flags, 0);
+ return 0;
+ } catch (e) {
+ if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e;
+ return -e.errno;
+ }
+ }
+
+ function __munmap_js(addr, len, prot, flags, fd, offset) {
+ try {
+
+ var stream = FS.getStream(fd);
+ if (stream) {
+ if (prot & 2) {
+ SYSCALLS.doMsync(addr, stream, len, flags, offset);
+ }
+ FS.munmap(stream);
+ }
+ } catch (e) {
+ if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e;
+ return -e.errno;
+ }
+ }
+
+ function _tzset_impl(timezone, daylight, tzname) {
+ var currentYear = new Date().getFullYear();
+ var winter = new Date(currentYear, 0, 1);
+ var summer = new Date(currentYear, 6, 1);
+ var winterOffset = winter.getTimezoneOffset();
+ var summerOffset = summer.getTimezoneOffset();
+
+ // Local standard timezone offset. Local standard time is not adjusted for daylight savings.
+ // This code uses the fact that getTimezoneOffset returns a greater value during Standard Time versus Daylight Saving Time (DST).
+ // Thus it determines the expected output during Standard Time, and it compares whether the output of the given date the same (Standard) or less (DST).
+ var stdTimezoneOffset = Math.max(winterOffset, summerOffset);
+
+ // timezone is specified as seconds west of UTC ("The external variable
+ // `timezone` shall be set to the difference, in seconds, between
+ // Coordinated Universal Time (UTC) and local standard time."), the same
+ // as returned by stdTimezoneOffset.
+ // See http://pubs.opengroup.org/onlinepubs/009695399/functions/tzset.html
+ HEAP32[((timezone)>>2)] = stdTimezoneOffset * 60;
+
+ HEAP32[((daylight)>>2)] = Number(winterOffset != summerOffset);
+
+ function extractZone(date) {
+ var match = date.toTimeString().match(/\(([A-Za-z ]+)\)$/);
+ return match ? match[1] : "GMT";
+ };
+ var winterName = extractZone(winter);
+ var summerName = extractZone(summer);
+ var winterNamePtr = allocateUTF8(winterName);
+ var summerNamePtr = allocateUTF8(summerName);
+ if (summerOffset < winterOffset) {
+ // Northern hemisphere
+ HEAPU32[((tzname)>>2)] = winterNamePtr;
+ HEAPU32[(((tzname)+(4))>>2)] = summerNamePtr;
+ } else {
+ HEAPU32[((tzname)>>2)] = summerNamePtr;
+ HEAPU32[(((tzname)+(4))>>2)] = winterNamePtr;
+ }
+ }
+ function __tzset_js(timezone, daylight, tzname) {
+ // TODO: Use (malleable) environment variables instead of system settings.
+ if (__tzset_js.called) return;
+ __tzset_js.called = true;
+ _tzset_impl(timezone, daylight, tzname);
+ }
+
+ function _abort() {
+ abort('');
+ }
+
+ var DOTNETENTROPY = {batchedQuotaMax:65536,getBatchedRandomValues:function (buffer, bufferLength) {
+ // Chrome doesn't want SharedArrayBuffer to be passed to crypto APIs
+ const needTempBuf = typeof SharedArrayBuffer !== 'undefined' && Module.HEAPU8.buffer instanceof SharedArrayBuffer;
+ // if we need a temporary buffer, make one that is big enough and write into it from the beginning
+ // otherwise, use the wasm instance memory and write at the given 'buffer' pointer offset.
+ const buf = needTempBuf ? new ArrayBuffer(bufferLength) : Module.HEAPU8.buffer;
+ const offset = needTempBuf ? 0 : buffer;
+ // for modern web browsers
+ // map the work array to the memory buffer passed with the length
+ for (let i = 0; i < bufferLength; i += this.batchedQuotaMax) {
+ const view = new Uint8Array(buf, offset + i, Math.min(bufferLength - i, this.batchedQuotaMax));
+ crypto.getRandomValues(view)
+ }
+ if (needTempBuf) {
+ // copy data out of the temporary buffer into the wasm instance memory
+ const heapView = new Uint8Array(Module.HEAPU8.buffer, buffer, bufferLength);
+ heapView.set(new Uint8Array (buf));
+ }
+ }};
+ function _dotnet_browser_entropy(buffer, bufferLength) {
+ // check that we have crypto available
+ if (typeof crypto === 'object' && typeof crypto['getRandomValues'] === 'function') {
+ DOTNETENTROPY.getBatchedRandomValues(buffer, bufferLength)
+ return 0;
+ } else {
+ // we couldn't find a proper implementation, as Math.random() is not suitable
+ // instead of aborting here we will return and let managed code handle the message
+ return -1;
+ }
+ }
+
+ function getHeapMax() {
+ // Stay one Wasm page short of 4GB: while e.g. Chrome is able to allocate
+ // full 4GB Wasm memories, the size will wrap back to 0 bytes in Wasm side
+ // for any code that deals with heap sizes, which would require special
+ // casing all heap size related code to treat 0 specially.
+ return 2147483648;
+ }
+ function _emscripten_get_heap_max() {
+ return getHeapMax();
+ }
+
+ var _emscripten_get_now;if (ENVIRONMENT_IS_NODE) {
+ _emscripten_get_now = () => {
+ var t = process['hrtime']();
+ return t[0] * 1e3 + t[1] / 1e6;
+ };
+ } else if (typeof dateNow != 'undefined') {
+ _emscripten_get_now = dateNow;
+ } else _emscripten_get_now = () => performance.now();
+ ;
+
+ function _emscripten_get_now_res() { // return resolution of get_now, in nanoseconds
+ if (ENVIRONMENT_IS_NODE) {
+ return 1; // nanoseconds
+ } else
+ if (typeof dateNow != 'undefined') {
+ return 1000; // microseconds (1/1000 of a millisecond)
+ } else
+ // Modern environment where performance.now() is supported:
+ return 1000; // microseconds (1/1000 of a millisecond)
+ }
+
+ function __webgl_enable_ANGLE_instanced_arrays(ctx) {
+ // Extension available in WebGL 1 from Firefox 26 and Google Chrome 30 onwards. Core feature in WebGL 2.
+ var ext = ctx.getExtension('ANGLE_instanced_arrays');
+ if (ext) {
+ ctx['vertexAttribDivisor'] = function(index, divisor) { ext['vertexAttribDivisorANGLE'](index, divisor); };
+ ctx['drawArraysInstanced'] = function(mode, first, count, primcount) { ext['drawArraysInstancedANGLE'](mode, first, count, primcount); };
+ ctx['drawElementsInstanced'] = function(mode, count, type, indices, primcount) { ext['drawElementsInstancedANGLE'](mode, count, type, indices, primcount); };
+ return 1;
+ }
+ }
+
+ function __webgl_enable_OES_vertex_array_object(ctx) {
+ // Extension available in WebGL 1 from Firefox 25 and WebKit 536.28/desktop Safari 6.0.3 onwards. Core feature in WebGL 2.
+ var ext = ctx.getExtension('OES_vertex_array_object');
+ if (ext) {
+ ctx['createVertexArray'] = function() { return ext['createVertexArrayOES'](); };
+ ctx['deleteVertexArray'] = function(vao) { ext['deleteVertexArrayOES'](vao); };
+ ctx['bindVertexArray'] = function(vao) { ext['bindVertexArrayOES'](vao); };
+ ctx['isVertexArray'] = function(vao) { return ext['isVertexArrayOES'](vao); };
+ return 1;
+ }
+ }
+
+ function __webgl_enable_WEBGL_draw_buffers(ctx) {
+ // Extension available in WebGL 1 from Firefox 28 onwards. Core feature in WebGL 2.
+ var ext = ctx.getExtension('WEBGL_draw_buffers');
+ if (ext) {
+ ctx['drawBuffers'] = function(n, bufs) { ext['drawBuffersWEBGL'](n, bufs); };
+ return 1;
+ }
+ }
+
+ function __webgl_enable_WEBGL_multi_draw(ctx) {
+ // Closure is expected to be allowed to minify the '.multiDrawWebgl' property, so not accessing it quoted.
+ return !!(ctx.multiDrawWebgl = ctx.getExtension('WEBGL_multi_draw'));
+ }
+ var GL = {counter:1,buffers:[],programs:[],framebuffers:[],renderbuffers:[],textures:[],shaders:[],vaos:[],contexts:[],offscreenCanvases:{},queries:[],stringCache:{},unpackAlignment:4,recordError:function recordError(errorCode) {
+ if (!GL.lastError) {
+ GL.lastError = errorCode;
+ }
+ },getNewId:function(table) {
+ var ret = GL.counter++;
+ for (var i = table.length; i < ret; i++) {
+ table[i] = null;
+ }
+ return ret;
+ },getSource:function(shader, count, string, length) {
+ var source = '';
+ for (var i = 0; i < count; ++i) {
+ var len = length ? HEAP32[(((length)+(i*4))>>2)] : -1;
+ source += UTF8ToString(HEAP32[(((string)+(i*4))>>2)], len < 0 ? undefined : len);
+ }
+ return source;
+ },createContext:function(/** @type {HTMLCanvasElement} */ canvas, webGLContextAttributes) {
+
+ // BUG: Workaround Safari WebGL issue: After successfully acquiring WebGL context on a canvas,
+ // calling .getContext() will always return that context independent of which 'webgl' or 'webgl2'
+ // context version was passed. See https://bugs.webkit.org/show_bug.cgi?id=222758 and
+ // https://github.com/emscripten-core/emscripten/issues/13295.
+ // TODO: Once the bug is fixed and shipped in Safari, adjust the Safari version field in above check.
+ if (!canvas.getContextSafariWebGL2Fixed) {
+ canvas.getContextSafariWebGL2Fixed = canvas.getContext;
+ /** @type {function(this:HTMLCanvasElement, string, (Object|null)=): (Object|null)} */
+ function fixedGetContext(ver, attrs) {
+ var gl = canvas.getContextSafariWebGL2Fixed(ver, attrs);
+ return ((ver == 'webgl') == (gl instanceof WebGLRenderingContext)) ? gl : null;
+ }
+ canvas.getContext = fixedGetContext;
+ }
+
+ var ctx =
+ (canvas.getContext("webgl", webGLContextAttributes)
+ // https://caniuse.com/#feat=webgl
+ );
+
+ if (!ctx) return 0;
+
+ var handle = GL.registerContext(ctx, webGLContextAttributes);
+
+ return handle;
+ },registerContext:function(ctx, webGLContextAttributes) {
+ // without pthreads a context is just an integer ID
+ var handle = GL.getNewId(GL.contexts);
+
+ var context = {
+ handle: handle,
+ attributes: webGLContextAttributes,
+ version: webGLContextAttributes.majorVersion,
+ GLctx: ctx
+ };
+
+ // Store the created context object so that we can access the context given a canvas without having to pass the parameters again.
+ if (ctx.canvas) ctx.canvas.GLctxObject = context;
+ GL.contexts[handle] = context;
+ if (typeof webGLContextAttributes.enableExtensionsByDefault == 'undefined' || webGLContextAttributes.enableExtensionsByDefault) {
+ GL.initExtensions(context);
+ }
+
+ return handle;
+ },makeContextCurrent:function(contextHandle) {
+
+ GL.currentContext = GL.contexts[contextHandle]; // Active Emscripten GL layer context object.
+ Module.ctx = GLctx = GL.currentContext && GL.currentContext.GLctx; // Active WebGL context object.
+ return !(contextHandle && !GLctx);
+ },getContext:function(contextHandle) {
+ return GL.contexts[contextHandle];
+ },deleteContext:function(contextHandle) {
+ if (GL.currentContext === GL.contexts[contextHandle]) GL.currentContext = null;
+ if (typeof JSEvents == 'object') JSEvents.removeAllHandlersOnTarget(GL.contexts[contextHandle].GLctx.canvas); // Release all JS event handlers on the DOM element that the GL context is associated with since the context is now deleted.
+ if (GL.contexts[contextHandle] && GL.contexts[contextHandle].GLctx.canvas) GL.contexts[contextHandle].GLctx.canvas.GLctxObject = undefined; // Make sure the canvas object no longer refers to the context object so there are no GC surprises.
+ GL.contexts[contextHandle] = null;
+ },initExtensions:function(context) {
+ // If this function is called without a specific context object, init the extensions of the currently active context.
+ if (!context) context = GL.currentContext;
+
+ if (context.initExtensionsDone) return;
+ context.initExtensionsDone = true;
+
+ var GLctx = context.GLctx;
+
+ // Detect the presence of a few extensions manually, this GL interop layer itself will need to know if they exist.
+
+ // Extensions that are only available in WebGL 1 (the calls will be no-ops if called on a WebGL 2 context active)
+ __webgl_enable_ANGLE_instanced_arrays(GLctx);
+ __webgl_enable_OES_vertex_array_object(GLctx);
+ __webgl_enable_WEBGL_draw_buffers(GLctx);
+
+ {
+ GLctx.disjointTimerQueryExt = GLctx.getExtension("EXT_disjoint_timer_query");
+ }
+
+ __webgl_enable_WEBGL_multi_draw(GLctx);
+
+ // .getSupportedExtensions() can return null if context is lost, so coerce to empty array.
+ var exts = GLctx.getSupportedExtensions() || [];
+ exts.forEach(function(ext) {
+ // WEBGL_lose_context, WEBGL_debug_renderer_info and WEBGL_debug_shaders are not enabled by default.
+ if (!ext.includes('lose_context') && !ext.includes('debug')) {
+ // Call .getExtension() to enable that extension permanently.
+ GLctx.getExtension(ext);
+ }
+ });
+ }};
+ function _emscripten_glActiveTexture(x0) { GLctx['activeTexture'](x0) }
+
+ function _emscripten_glAttachShader(program, shader) {
+ GLctx.attachShader(GL.programs[program], GL.shaders[shader]);
+ }
+
+ function _emscripten_glBeginQueryEXT(target, id) {
+ GLctx.disjointTimerQueryExt['beginQueryEXT'](target, GL.queries[id]);
+ }
+
+ function _emscripten_glBindAttribLocation(program, index, name) {
+ GLctx.bindAttribLocation(GL.programs[program], index, UTF8ToString(name));
+ }
+
+ function _emscripten_glBindBuffer(target, buffer) {
+
+ GLctx.bindBuffer(target, GL.buffers[buffer]);
+ }
+
+ function _emscripten_glBindFramebuffer(target, framebuffer) {
+
+ GLctx.bindFramebuffer(target, GL.framebuffers[framebuffer]);
+
+ }
+
+ function _emscripten_glBindRenderbuffer(target, renderbuffer) {
+ GLctx.bindRenderbuffer(target, GL.renderbuffers[renderbuffer]);
+ }
+
+ function _emscripten_glBindTexture(target, texture) {
+ GLctx.bindTexture(target, GL.textures[texture]);
+ }
+
+ function _emscripten_glBindVertexArrayOES(vao) {
+ GLctx['bindVertexArray'](GL.vaos[vao]);
+ }
+
+ function _emscripten_glBlendColor(x0, x1, x2, x3) { GLctx['blendColor'](x0, x1, x2, x3) }
+
+ function _emscripten_glBlendEquation(x0) { GLctx['blendEquation'](x0) }
+
+ function _emscripten_glBlendEquationSeparate(x0, x1) { GLctx['blendEquationSeparate'](x0, x1) }
+
+ function _emscripten_glBlendFunc(x0, x1) { GLctx['blendFunc'](x0, x1) }
+
+ function _emscripten_glBlendFuncSeparate(x0, x1, x2, x3) { GLctx['blendFuncSeparate'](x0, x1, x2, x3) }
+
+ function _emscripten_glBufferData(target, size, data, usage) {
+
+ // N.b. here first form specifies a heap subarray, second form an integer size, so the ?: code here is polymorphic. It is advised to avoid
+ // randomly mixing both uses in calling code, to avoid any potential JS engine JIT issues.
+ GLctx.bufferData(target, data ? HEAPU8.subarray(data, data+size) : size, usage);
+ }
+
+ function _emscripten_glBufferSubData(target, offset, size, data) {
+ GLctx.bufferSubData(target, offset, HEAPU8.subarray(data, data+size));
+ }
+
+ function _emscripten_glCheckFramebufferStatus(x0) { return GLctx['checkFramebufferStatus'](x0) }
+
+ function _emscripten_glClear(x0) { GLctx['clear'](x0) }
+
+ function _emscripten_glClearColor(x0, x1, x2, x3) { GLctx['clearColor'](x0, x1, x2, x3) }
+
+ function _emscripten_glClearDepthf(x0) { GLctx['clearDepth'](x0) }
+
+ function _emscripten_glClearStencil(x0) { GLctx['clearStencil'](x0) }
+
+ function _emscripten_glColorMask(red, green, blue, alpha) {
+ GLctx.colorMask(!!red, !!green, !!blue, !!alpha);
+ }
+
+ function _emscripten_glCompileShader(shader) {
+ GLctx.compileShader(GL.shaders[shader]);
+ }
+
+ function _emscripten_glCompressedTexImage2D(target, level, internalFormat, width, height, border, imageSize, data) {
+ GLctx['compressedTexImage2D'](target, level, internalFormat, width, height, border, data ? HEAPU8.subarray((data), (data+imageSize)) : null);
+ }
+
+ function _emscripten_glCompressedTexSubImage2D(target, level, xoffset, yoffset, width, height, format, imageSize, data) {
+ GLctx['compressedTexSubImage2D'](target, level, xoffset, yoffset, width, height, format, data ? HEAPU8.subarray((data), (data+imageSize)) : null);
+ }
+
+ function _emscripten_glCopyTexImage2D(x0, x1, x2, x3, x4, x5, x6, x7) { GLctx['copyTexImage2D'](x0, x1, x2, x3, x4, x5, x6, x7) }
+
+ function _emscripten_glCopyTexSubImage2D(x0, x1, x2, x3, x4, x5, x6, x7) { GLctx['copyTexSubImage2D'](x0, x1, x2, x3, x4, x5, x6, x7) }
+
+ function _emscripten_glCreateProgram() {
+ var id = GL.getNewId(GL.programs);
+ var program = GLctx.createProgram();
+ // Store additional information needed for each shader program:
+ program.name = id;
+ // Lazy cache results of glGetProgramiv(GL_ACTIVE_UNIFORM_MAX_LENGTH/GL_ACTIVE_ATTRIBUTE_MAX_LENGTH/GL_ACTIVE_UNIFORM_BLOCK_MAX_NAME_LENGTH)
+ program.maxUniformLength = program.maxAttributeLength = program.maxUniformBlockNameLength = 0;
+ program.uniformIdCounter = 1;
+ GL.programs[id] = program;
+ return id;
+ }
+
+ function _emscripten_glCreateShader(shaderType) {
+ var id = GL.getNewId(GL.shaders);
+ GL.shaders[id] = GLctx.createShader(shaderType);
+
+ return id;
+ }
+
+ function _emscripten_glCullFace(x0) { GLctx['cullFace'](x0) }
+
+ function _emscripten_glDeleteBuffers(n, buffers) {
+ for (var i = 0; i < n; i++) {
+ var id = HEAP32[(((buffers)+(i*4))>>2)];
+ var buffer = GL.buffers[id];
+
+ // From spec: "glDeleteBuffers silently ignores 0's and names that do not
+ // correspond to existing buffer objects."
+ if (!buffer) continue;
+
+ GLctx.deleteBuffer(buffer);
+ buffer.name = 0;
+ GL.buffers[id] = null;
+
+ }
+ }
+
+ function _emscripten_glDeleteFramebuffers(n, framebuffers) {
+ for (var i = 0; i < n; ++i) {
+ var id = HEAP32[(((framebuffers)+(i*4))>>2)];
+ var framebuffer = GL.framebuffers[id];
+ if (!framebuffer) continue; // GL spec: "glDeleteFramebuffers silently ignores 0s and names that do not correspond to existing framebuffer objects".
+ GLctx.deleteFramebuffer(framebuffer);
+ framebuffer.name = 0;
+ GL.framebuffers[id] = null;
+ }
+ }
+
+ function _emscripten_glDeleteProgram(id) {
+ if (!id) return;
+ var program = GL.programs[id];
+ if (!program) { // glDeleteProgram actually signals an error when deleting a nonexisting object, unlike some other GL delete functions.
+ GL.recordError(0x501 /* GL_INVALID_VALUE */);
+ return;
+ }
+ GLctx.deleteProgram(program);
+ program.name = 0;
+ GL.programs[id] = null;
+ }
+
+ function _emscripten_glDeleteQueriesEXT(n, ids) {
+ for (var i = 0; i < n; i++) {
+ var id = HEAP32[(((ids)+(i*4))>>2)];
+ var query = GL.queries[id];
+ if (!query) continue; // GL spec: "unused names in ids are ignored, as is the name zero."
+ GLctx.disjointTimerQueryExt['deleteQueryEXT'](query);
+ GL.queries[id] = null;
+ }
+ }
+
+ function _emscripten_glDeleteRenderbuffers(n, renderbuffers) {
+ for (var i = 0; i < n; i++) {
+ var id = HEAP32[(((renderbuffers)+(i*4))>>2)];
+ var renderbuffer = GL.renderbuffers[id];
+ if (!renderbuffer) continue; // GL spec: "glDeleteRenderbuffers silently ignores 0s and names that do not correspond to existing renderbuffer objects".
+ GLctx.deleteRenderbuffer(renderbuffer);
+ renderbuffer.name = 0;
+ GL.renderbuffers[id] = null;
+ }
+ }
+
+ function _emscripten_glDeleteShader(id) {
+ if (!id) return;
+ var shader = GL.shaders[id];
+ if (!shader) { // glDeleteShader actually signals an error when deleting a nonexisting object, unlike some other GL delete functions.
+ GL.recordError(0x501 /* GL_INVALID_VALUE */);
+ return;
+ }
+ GLctx.deleteShader(shader);
+ GL.shaders[id] = null;
+ }
+
+ function _emscripten_glDeleteTextures(n, textures) {
+ for (var i = 0; i < n; i++) {
+ var id = HEAP32[(((textures)+(i*4))>>2)];
+ var texture = GL.textures[id];
+ if (!texture) continue; // GL spec: "glDeleteTextures silently ignores 0s and names that do not correspond to existing textures".
+ GLctx.deleteTexture(texture);
+ texture.name = 0;
+ GL.textures[id] = null;
+ }
+ }
+
+ function _emscripten_glDeleteVertexArraysOES(n, vaos) {
+ for (var i = 0; i < n; i++) {
+ var id = HEAP32[(((vaos)+(i*4))>>2)];
+ GLctx['deleteVertexArray'](GL.vaos[id]);
+ GL.vaos[id] = null;
+ }
+ }
+
+ function _emscripten_glDepthFunc(x0) { GLctx['depthFunc'](x0) }
+
+ function _emscripten_glDepthMask(flag) {
+ GLctx.depthMask(!!flag);
+ }
+
+ function _emscripten_glDepthRangef(x0, x1) { GLctx['depthRange'](x0, x1) }
+
+ function _emscripten_glDetachShader(program, shader) {
+ GLctx.detachShader(GL.programs[program], GL.shaders[shader]);
+ }
+
+ function _emscripten_glDisable(x0) { GLctx['disable'](x0) }
+
+ function _emscripten_glDisableVertexAttribArray(index) {
+ GLctx.disableVertexAttribArray(index);
+ }
+
+ function _emscripten_glDrawArrays(mode, first, count) {
+
+ GLctx.drawArrays(mode, first, count);
+
+ }
+
+ function _emscripten_glDrawArraysInstancedANGLE(mode, first, count, primcount) {
+ GLctx['drawArraysInstanced'](mode, first, count, primcount);
+ }
+
+ var tempFixedLengthArray = [];
+ function _emscripten_glDrawBuffersWEBGL(n, bufs) {
+
+ var bufArray = tempFixedLengthArray[n];
+ for (var i = 0; i < n; i++) {
+ bufArray[i] = HEAP32[(((bufs)+(i*4))>>2)];
+ }
+
+ GLctx['drawBuffers'](bufArray);
+ }
+
+ function _emscripten_glDrawElements(mode, count, type, indices) {
+
+ GLctx.drawElements(mode, count, type, indices);
+
+ }
+
+ function _emscripten_glDrawElementsInstancedANGLE(mode, count, type, indices, primcount) {
+ GLctx['drawElementsInstanced'](mode, count, type, indices, primcount);
+ }
+
+ function _emscripten_glEnable(x0) { GLctx['enable'](x0) }
+
+ function _emscripten_glEnableVertexAttribArray(index) {
+ GLctx.enableVertexAttribArray(index);
+ }
+
+ function _emscripten_glEndQueryEXT(target) {
+ GLctx.disjointTimerQueryExt['endQueryEXT'](target);
+ }
+
+ function _emscripten_glFinish() { GLctx['finish']() }
+
+ function _emscripten_glFlush() { GLctx['flush']() }
+
+ function _emscripten_glFramebufferRenderbuffer(target, attachment, renderbuffertarget, renderbuffer) {
+ GLctx.framebufferRenderbuffer(target, attachment, renderbuffertarget,
+ GL.renderbuffers[renderbuffer]);
+ }
+
+ function _emscripten_glFramebufferTexture2D(target, attachment, textarget, texture, level) {
+ GLctx.framebufferTexture2D(target, attachment, textarget,
+ GL.textures[texture], level);
+ }
+
+ function _emscripten_glFrontFace(x0) { GLctx['frontFace'](x0) }
+
+ function __glGenObject(n, buffers, createFunction, objectTable
+ ) {
+ for (var i = 0; i < n; i++) {
+ var buffer = GLctx[createFunction]();
+ var id = buffer && GL.getNewId(objectTable);
+ if (buffer) {
+ buffer.name = id;
+ objectTable[id] = buffer;
+ } else {
+ GL.recordError(0x502 /* GL_INVALID_OPERATION */);
+ }
+ HEAP32[(((buffers)+(i*4))>>2)] = id;
+ }
+ }
+ function _emscripten_glGenBuffers(n, buffers) {
+ __glGenObject(n, buffers, 'createBuffer', GL.buffers
+ );
+ }
+
+ function _emscripten_glGenFramebuffers(n, ids) {
+ __glGenObject(n, ids, 'createFramebuffer', GL.framebuffers
+ );
+ }
+
+ function _emscripten_glGenQueriesEXT(n, ids) {
+ for (var i = 0; i < n; i++) {
+ var query = GLctx.disjointTimerQueryExt['createQueryEXT']();
+ if (!query) {
+ GL.recordError(0x502 /* GL_INVALID_OPERATION */);
+ while (i < n) HEAP32[(((ids)+(i++*4))>>2)] = 0;
+ return;
+ }
+ var id = GL.getNewId(GL.queries);
+ query.name = id;
+ GL.queries[id] = query;
+ HEAP32[(((ids)+(i*4))>>2)] = id;
+ }
+ }
+
+ function _emscripten_glGenRenderbuffers(n, renderbuffers) {
+ __glGenObject(n, renderbuffers, 'createRenderbuffer', GL.renderbuffers
+ );
+ }
+
+ function _emscripten_glGenTextures(n, textures) {
+ __glGenObject(n, textures, 'createTexture', GL.textures
+ );
+ }
+
+ function _emscripten_glGenVertexArraysOES(n, arrays) {
+ __glGenObject(n, arrays, 'createVertexArray', GL.vaos
+ );
+ }
+
+ function _emscripten_glGenerateMipmap(x0) { GLctx['generateMipmap'](x0) }
+
+ function __glGetActiveAttribOrUniform(funcName, program, index, bufSize, length, size, type, name) {
+ program = GL.programs[program];
+ var info = GLctx[funcName](program, index);
+ if (info) { // If an error occurs, nothing will be written to length, size and type and name.
+ var numBytesWrittenExclNull = name && stringToUTF8(info.name, name, bufSize);
+ if (length) HEAP32[((length)>>2)] = numBytesWrittenExclNull;
+ if (size) HEAP32[((size)>>2)] = info.size;
+ if (type) HEAP32[((type)>>2)] = info.type;
+ }
+ }
+ function _emscripten_glGetActiveAttrib(program, index, bufSize, length, size, type, name) {
+ __glGetActiveAttribOrUniform('getActiveAttrib', program, index, bufSize, length, size, type, name);
+ }
+
+ function _emscripten_glGetActiveUniform(program, index, bufSize, length, size, type, name) {
+ __glGetActiveAttribOrUniform('getActiveUniform', program, index, bufSize, length, size, type, name);
+ }
+
+ function _emscripten_glGetAttachedShaders(program, maxCount, count, shaders) {
+ var result = GLctx.getAttachedShaders(GL.programs[program]);
+ var len = result.length;
+ if (len > maxCount) {
+ len = maxCount;
+ }
+ HEAP32[((count)>>2)] = len;
+ for (var i = 0; i < len; ++i) {
+ var id = GL.shaders.indexOf(result[i]);
+ HEAP32[(((shaders)+(i*4))>>2)] = id;
+ }
+ }
+
+ function _emscripten_glGetAttribLocation(program, name) {
+ return GLctx.getAttribLocation(GL.programs[program], UTF8ToString(name));
+ }
+
+ function writeI53ToI64(ptr, num) {
+ HEAPU32[ptr>>2] = num;
+ HEAPU32[ptr+4>>2] = (num - HEAPU32[ptr>>2])/4294967296;
+ }
+ function emscriptenWebGLGet(name_, p, type) {
+ // Guard against user passing a null pointer.
+ // Note that GLES2 spec does not say anything about how passing a null pointer should be treated.
+ // Testing on desktop core GL 3, the application crashes on glGetIntegerv to a null pointer, but
+ // better to report an error instead of doing anything random.
+ if (!p) {
+ GL.recordError(0x501 /* GL_INVALID_VALUE */);
+ return;
+ }
+ var ret = undefined;
+ switch (name_) { // Handle a few trivial GLES values
+ case 0x8DFA: // GL_SHADER_COMPILER
+ ret = 1;
+ break;
+ case 0x8DF8: // GL_SHADER_BINARY_FORMATS
+ if (type != 0 && type != 1) {
+ GL.recordError(0x500); // GL_INVALID_ENUM
+ }
+ return; // Do not write anything to the out pointer, since no binary formats are supported.
+ case 0x8DF9: // GL_NUM_SHADER_BINARY_FORMATS
+ ret = 0;
+ break;
+ case 0x86A2: // GL_NUM_COMPRESSED_TEXTURE_FORMATS
+ // WebGL doesn't have GL_NUM_COMPRESSED_TEXTURE_FORMATS (it's obsolete since GL_COMPRESSED_TEXTURE_FORMATS returns a JS array that can be queried for length),
+ // so implement it ourselves to allow C++ GLES2 code get the length.
+ var formats = GLctx.getParameter(0x86A3 /*GL_COMPRESSED_TEXTURE_FORMATS*/);
+ ret = formats ? formats.length : 0;
+ break;
+
+ }
+
+ if (ret === undefined) {
+ var result = GLctx.getParameter(name_);
+ switch (typeof result) {
+ case "number":
+ ret = result;
+ break;
+ case "boolean":
+ ret = result ? 1 : 0;
+ break;
+ case "string":
+ GL.recordError(0x500); // GL_INVALID_ENUM
+ return;
+ case "object":
+ if (result === null) {
+ // null is a valid result for some (e.g., which buffer is bound - perhaps nothing is bound), but otherwise
+ // can mean an invalid name_, which we need to report as an error
+ switch (name_) {
+ case 0x8894: // ARRAY_BUFFER_BINDING
+ case 0x8B8D: // CURRENT_PROGRAM
+ case 0x8895: // ELEMENT_ARRAY_BUFFER_BINDING
+ case 0x8CA6: // FRAMEBUFFER_BINDING or DRAW_FRAMEBUFFER_BINDING
+ case 0x8CA7: // RENDERBUFFER_BINDING
+ case 0x8069: // TEXTURE_BINDING_2D
+ case 0x85B5: // WebGL 2 GL_VERTEX_ARRAY_BINDING, or WebGL 1 extension OES_vertex_array_object GL_VERTEX_ARRAY_BINDING_OES
+ case 0x8514: { // TEXTURE_BINDING_CUBE_MAP
+ ret = 0;
+ break;
+ }
+ default: {
+ GL.recordError(0x500); // GL_INVALID_ENUM
+ return;
+ }
+ }
+ } else if (result instanceof Float32Array ||
+ result instanceof Uint32Array ||
+ result instanceof Int32Array ||
+ result instanceof Array) {
+ for (var i = 0; i < result.length; ++i) {
+ switch (type) {
+ case 0: HEAP32[(((p)+(i*4))>>2)] = result[i]; break;
+ case 2: HEAPF32[(((p)+(i*4))>>2)] = result[i]; break;
+ case 4: HEAP8[(((p)+(i))>>0)] = result[i] ? 1 : 0; break;
+ }
+ }
+ return;
+ } else {
+ try {
+ ret = result.name | 0;
+ } catch(e) {
+ GL.recordError(0x500); // GL_INVALID_ENUM
+ err('GL_INVALID_ENUM in glGet' + type + 'v: Unknown object returned from WebGL getParameter(' + name_ + ')! (error: ' + e + ')');
+ return;
+ }
+ }
+ break;
+ default:
+ GL.recordError(0x500); // GL_INVALID_ENUM
+ err('GL_INVALID_ENUM in glGet' + type + 'v: Native code calling glGet' + type + 'v(' + name_ + ') and it returns ' + result + ' of type ' + typeof(result) + '!');
+ return;
+ }
+ }
+
+ switch (type) {
+ case 1: writeI53ToI64(p, ret); break;
+ case 0: HEAP32[((p)>>2)] = ret; break;
+ case 2: HEAPF32[((p)>>2)] = ret; break;
+ case 4: HEAP8[((p)>>0)] = ret ? 1 : 0; break;
+ }
+ }
+ function _emscripten_glGetBooleanv(name_, p) {
+ emscriptenWebGLGet(name_, p, 4);
+ }
+
+ function _emscripten_glGetBufferParameteriv(target, value, data) {
+ if (!data) {
+ // GLES2 specification does not specify how to behave if data is a null pointer. Since calling this function does not make sense
+ // if data == null, issue a GL error to notify user about it.
+ GL.recordError(0x501 /* GL_INVALID_VALUE */);
+ return;
+ }
+ HEAP32[((data)>>2)] = GLctx.getBufferParameter(target, value);
+ }
+
+ function _emscripten_glGetError() {
+ var error = GLctx.getError() || GL.lastError;
+ GL.lastError = 0/*GL_NO_ERROR*/;
+ return error;
+ }
+
+ function _emscripten_glGetFloatv(name_, p) {
+ emscriptenWebGLGet(name_, p, 2);
+ }
+
+ function _emscripten_glGetFramebufferAttachmentParameteriv(target, attachment, pname, params) {
+ var result = GLctx.getFramebufferAttachmentParameter(target, attachment, pname);
+ if (result instanceof WebGLRenderbuffer ||
+ result instanceof WebGLTexture) {
+ result = result.name | 0;
+ }
+ HEAP32[((params)>>2)] = result;
+ }
+
+ function _emscripten_glGetIntegerv(name_, p) {
+ emscriptenWebGLGet(name_, p, 0);
+ }
+
+ function _emscripten_glGetProgramInfoLog(program, maxLength, length, infoLog) {
+ var log = GLctx.getProgramInfoLog(GL.programs[program]);
+ if (log === null) log = '(unknown error)';
+ var numBytesWrittenExclNull = (maxLength > 0 && infoLog) ? stringToUTF8(log, infoLog, maxLength) : 0;
+ if (length) HEAP32[((length)>>2)] = numBytesWrittenExclNull;
+ }
+
+ function _emscripten_glGetProgramiv(program, pname, p) {
+ if (!p) {
+ // GLES2 specification does not specify how to behave if p is a null pointer. Since calling this function does not make sense
+ // if p == null, issue a GL error to notify user about it.
+ GL.recordError(0x501 /* GL_INVALID_VALUE */);
+ return;
+ }
+
+ if (program >= GL.counter) {
+ GL.recordError(0x501 /* GL_INVALID_VALUE */);
+ return;
+ }
+
+ program = GL.programs[program];
+
+ if (pname == 0x8B84) { // GL_INFO_LOG_LENGTH
+ var log = GLctx.getProgramInfoLog(program);
+ if (log === null) log = '(unknown error)';
+ HEAP32[((p)>>2)] = log.length + 1;
+ } else if (pname == 0x8B87 /* GL_ACTIVE_UNIFORM_MAX_LENGTH */) {
+ if (!program.maxUniformLength) {
+ for (var i = 0; i < GLctx.getProgramParameter(program, 0x8B86/*GL_ACTIVE_UNIFORMS*/); ++i) {
+ program.maxUniformLength = Math.max(program.maxUniformLength, GLctx.getActiveUniform(program, i).name.length+1);
+ }
+ }
+ HEAP32[((p)>>2)] = program.maxUniformLength;
+ } else if (pname == 0x8B8A /* GL_ACTIVE_ATTRIBUTE_MAX_LENGTH */) {
+ if (!program.maxAttributeLength) {
+ for (var i = 0; i < GLctx.getProgramParameter(program, 0x8B89/*GL_ACTIVE_ATTRIBUTES*/); ++i) {
+ program.maxAttributeLength = Math.max(program.maxAttributeLength, GLctx.getActiveAttrib(program, i).name.length+1);
+ }
+ }
+ HEAP32[((p)>>2)] = program.maxAttributeLength;
+ } else if (pname == 0x8A35 /* GL_ACTIVE_UNIFORM_BLOCK_MAX_NAME_LENGTH */) {
+ if (!program.maxUniformBlockNameLength) {
+ for (var i = 0; i < GLctx.getProgramParameter(program, 0x8A36/*GL_ACTIVE_UNIFORM_BLOCKS*/); ++i) {
+ program.maxUniformBlockNameLength = Math.max(program.maxUniformBlockNameLength, GLctx.getActiveUniformBlockName(program, i).length+1);
+ }
+ }
+ HEAP32[((p)>>2)] = program.maxUniformBlockNameLength;
+ } else {
+ HEAP32[((p)>>2)] = GLctx.getProgramParameter(program, pname);
+ }
+ }
+
+ function _emscripten_glGetQueryObjecti64vEXT(id, pname, params) {
+ if (!params) {
+ // GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense
+ // if p == null, issue a GL error to notify user about it.
+ GL.recordError(0x501 /* GL_INVALID_VALUE */);
+ return;
+ }
+ var query = GL.queries[id];
+ var param;
+ {
+ param = GLctx.disjointTimerQueryExt['getQueryObjectEXT'](query, pname);
+ }
+ var ret;
+ if (typeof param == 'boolean') {
+ ret = param ? 1 : 0;
+ } else {
+ ret = param;
+ }
+ writeI53ToI64(params, ret);
+ }
+
+ function _emscripten_glGetQueryObjectivEXT(id, pname, params) {
+ if (!params) {
+ // GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense
+ // if p == null, issue a GL error to notify user about it.
+ GL.recordError(0x501 /* GL_INVALID_VALUE */);
+ return;
+ }
+ var query = GL.queries[id];
+ var param = GLctx.disjointTimerQueryExt['getQueryObjectEXT'](query, pname);
+ var ret;
+ if (typeof param == 'boolean') {
+ ret = param ? 1 : 0;
+ } else {
+ ret = param;
+ }
+ HEAP32[((params)>>2)] = ret;
+ }
+
+ function _emscripten_glGetQueryObjectui64vEXT(id, pname, params) {
+ if (!params) {
+ // GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense
+ // if p == null, issue a GL error to notify user about it.
+ GL.recordError(0x501 /* GL_INVALID_VALUE */);
+ return;
+ }
+ var query = GL.queries[id];
+ var param;
+ {
+ param = GLctx.disjointTimerQueryExt['getQueryObjectEXT'](query, pname);
+ }
+ var ret;
+ if (typeof param == 'boolean') {
+ ret = param ? 1 : 0;
+ } else {
+ ret = param;
+ }
+ writeI53ToI64(params, ret);
+ }
+
+ function _emscripten_glGetQueryObjectuivEXT(id, pname, params) {
+ if (!params) {
+ // GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense
+ // if p == null, issue a GL error to notify user about it.
+ GL.recordError(0x501 /* GL_INVALID_VALUE */);
+ return;
+ }
+ var query = GL.queries[id];
+ var param = GLctx.disjointTimerQueryExt['getQueryObjectEXT'](query, pname);
+ var ret;
+ if (typeof param == 'boolean') {
+ ret = param ? 1 : 0;
+ } else {
+ ret = param;
+ }
+ HEAP32[((params)>>2)] = ret;
+ }
+
+ function _emscripten_glGetQueryivEXT(target, pname, params) {
+ if (!params) {
+ // GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense
+ // if p == null, issue a GL error to notify user about it.
+ GL.recordError(0x501 /* GL_INVALID_VALUE */);
+ return;
+ }
+ HEAP32[((params)>>2)] = GLctx.disjointTimerQueryExt['getQueryEXT'](target, pname);
+ }
+
+ function _emscripten_glGetRenderbufferParameteriv(target, pname, params) {
+ if (!params) {
+ // GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense
+ // if params == null, issue a GL error to notify user about it.
+ GL.recordError(0x501 /* GL_INVALID_VALUE */);
+ return;
+ }
+ HEAP32[((params)>>2)] = GLctx.getRenderbufferParameter(target, pname);
+ }
+
+ function _emscripten_glGetShaderInfoLog(shader, maxLength, length, infoLog) {
+ var log = GLctx.getShaderInfoLog(GL.shaders[shader]);
+ if (log === null) log = '(unknown error)';
+ var numBytesWrittenExclNull = (maxLength > 0 && infoLog) ? stringToUTF8(log, infoLog, maxLength) : 0;
+ if (length) HEAP32[((length)>>2)] = numBytesWrittenExclNull;
+ }
+
+ function _emscripten_glGetShaderPrecisionFormat(shaderType, precisionType, range, precision) {
+ var result = GLctx.getShaderPrecisionFormat(shaderType, precisionType);
+ HEAP32[((range)>>2)] = result.rangeMin;
+ HEAP32[(((range)+(4))>>2)] = result.rangeMax;
+ HEAP32[((precision)>>2)] = result.precision;
+ }
+
+ function _emscripten_glGetShaderSource(shader, bufSize, length, source) {
+ var result = GLctx.getShaderSource(GL.shaders[shader]);
+ if (!result) return; // If an error occurs, nothing will be written to length or source.
+ var numBytesWrittenExclNull = (bufSize > 0 && source) ? stringToUTF8(result, source, bufSize) : 0;
+ if (length) HEAP32[((length)>>2)] = numBytesWrittenExclNull;
+ }
+
+ function _emscripten_glGetShaderiv(shader, pname, p) {
+ if (!p) {
+ // GLES2 specification does not specify how to behave if p is a null pointer. Since calling this function does not make sense
+ // if p == null, issue a GL error to notify user about it.
+ GL.recordError(0x501 /* GL_INVALID_VALUE */);
+ return;
+ }
+ if (pname == 0x8B84) { // GL_INFO_LOG_LENGTH
+ var log = GLctx.getShaderInfoLog(GL.shaders[shader]);
+ if (log === null) log = '(unknown error)';
+ // The GLES2 specification says that if the shader has an empty info log,
+ // a value of 0 is returned. Otherwise the log has a null char appended.
+ // (An empty string is falsey, so we can just check that instead of
+ // looking at log.length.)
+ var logLength = log ? log.length + 1 : 0;
+ HEAP32[((p)>>2)] = logLength;
+ } else if (pname == 0x8B88) { // GL_SHADER_SOURCE_LENGTH
+ var source = GLctx.getShaderSource(GL.shaders[shader]);
+ // source may be a null, or the empty string, both of which are falsey
+ // values that we report a 0 length for.
+ var sourceLength = source ? source.length + 1 : 0;
+ HEAP32[((p)>>2)] = sourceLength;
+ } else {
+ HEAP32[((p)>>2)] = GLctx.getShaderParameter(GL.shaders[shader], pname);
+ }
+ }
+
+ function stringToNewUTF8(jsString) {
+ var length = lengthBytesUTF8(jsString)+1;
+ var cString = _malloc(length);
+ stringToUTF8(jsString, cString, length);
+ return cString;
+ }
+ function _emscripten_glGetString(name_) {
+ var ret = GL.stringCache[name_];
+ if (!ret) {
+ switch (name_) {
+ case 0x1F03 /* GL_EXTENSIONS */:
+ var exts = GLctx.getSupportedExtensions() || []; // .getSupportedExtensions() can return null if context is lost, so coerce to empty array.
+ exts = exts.concat(exts.map(function(e) { return "GL_" + e; }));
+ ret = stringToNewUTF8(exts.join(' '));
+ break;
+ case 0x1F00 /* GL_VENDOR */:
+ case 0x1F01 /* GL_RENDERER */:
+ case 0x9245 /* UNMASKED_VENDOR_WEBGL */:
+ case 0x9246 /* UNMASKED_RENDERER_WEBGL */:
+ var s = GLctx.getParameter(name_);
+ if (!s) {
+ GL.recordError(0x500/*GL_INVALID_ENUM*/);
+ }
+ ret = s && stringToNewUTF8(s);
+ break;
+
+ case 0x1F02 /* GL_VERSION */:
+ var glVersion = GLctx.getParameter(0x1F02 /*GL_VERSION*/);
+ // return GLES version string corresponding to the version of the WebGL context
+ {
+ glVersion = 'OpenGL ES 2.0 (' + glVersion + ')';
+ }
+ ret = stringToNewUTF8(glVersion);
+ break;
+ case 0x8B8C /* GL_SHADING_LANGUAGE_VERSION */:
+ var glslVersion = GLctx.getParameter(0x8B8C /*GL_SHADING_LANGUAGE_VERSION*/);
+ // extract the version number 'N.M' from the string 'WebGL GLSL ES N.M ...'
+ var ver_re = /^WebGL GLSL ES ([0-9]\.[0-9][0-9]?)(?:$| .*)/;
+ var ver_num = glslVersion.match(ver_re);
+ if (ver_num !== null) {
+ if (ver_num[1].length == 3) ver_num[1] = ver_num[1] + '0'; // ensure minor version has 2 digits
+ glslVersion = 'OpenGL ES GLSL ES ' + ver_num[1] + ' (' + glslVersion + ')';
+ }
+ ret = stringToNewUTF8(glslVersion);
+ break;
+ default:
+ GL.recordError(0x500/*GL_INVALID_ENUM*/);
+ // fall through
+ }
+ GL.stringCache[name_] = ret;
+ }
+ return ret;
+ }
+
+ function _emscripten_glGetTexParameterfv(target, pname, params) {
+ if (!params) {
+ // GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense
+ // if p == null, issue a GL error to notify user about it.
+ GL.recordError(0x501 /* GL_INVALID_VALUE */);
+ return;
+ }
+ HEAPF32[((params)>>2)] = GLctx.getTexParameter(target, pname);
+ }
+
+ function _emscripten_glGetTexParameteriv(target, pname, params) {
+ if (!params) {
+ // GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense
+ // if p == null, issue a GL error to notify user about it.
+ GL.recordError(0x501 /* GL_INVALID_VALUE */);
+ return;
+ }
+ HEAP32[((params)>>2)] = GLctx.getTexParameter(target, pname);
+ }
+
+ /** @noinline */
+ function webglGetLeftBracePos(name) {
+ return name.slice(-1) == ']' && name.lastIndexOf('[');
+ }
+ function webglPrepareUniformLocationsBeforeFirstUse(program) {
+ var uniformLocsById = program.uniformLocsById, // Maps GLuint -> WebGLUniformLocation
+ uniformSizeAndIdsByName = program.uniformSizeAndIdsByName, // Maps name -> [uniform array length, GLuint]
+ i, j;
+
+ // On the first time invocation of glGetUniformLocation on this shader program:
+ // initialize cache data structures and discover which uniforms are arrays.
+ if (!uniformLocsById) {
+ // maps GLint integer locations to WebGLUniformLocations
+ program.uniformLocsById = uniformLocsById = {};
+ // maps integer locations back to uniform name strings, so that we can lazily fetch uniform array locations
+ program.uniformArrayNamesById = {};
+
+ for (i = 0; i < GLctx.getProgramParameter(program, 0x8B86/*GL_ACTIVE_UNIFORMS*/); ++i) {
+ var u = GLctx.getActiveUniform(program, i);
+ var nm = u.name;
+ var sz = u.size;
+ var lb = webglGetLeftBracePos(nm);
+ var arrayName = lb > 0 ? nm.slice(0, lb) : nm;
+
+ // Assign a new location.
+ var id = program.uniformIdCounter;
+ program.uniformIdCounter += sz;
+ // Eagerly get the location of the uniformArray[0] base element.
+ // The remaining indices >0 will be left for lazy evaluation to
+ // improve performance. Those may never be needed to fetch, if the
+ // application fills arrays always in full starting from the first
+ // element of the array.
+ uniformSizeAndIdsByName[arrayName] = [sz, id];
+
+ // Store placeholder integers in place that highlight that these
+ // >0 index locations are array indices pending population.
+ for(j = 0; j < sz; ++j) {
+ uniformLocsById[id] = j;
+ program.uniformArrayNamesById[id++] = arrayName;
+ }
+ }
+ }
+ }
+ function _emscripten_glGetUniformLocation(program, name) {
+
+ name = UTF8ToString(name);
+
+ if (program = GL.programs[program]) {
+ webglPrepareUniformLocationsBeforeFirstUse(program);
+ var uniformLocsById = program.uniformLocsById; // Maps GLuint -> WebGLUniformLocation
+ var arrayIndex = 0;
+ var uniformBaseName = name;
+
+ // Invariant: when populating integer IDs for uniform locations, we must maintain the precondition that
+ // arrays reside in contiguous addresses, i.e. for a 'vec4 colors[10];', colors[4] must be at location colors[0]+4.
+ // However, user might call glGetUniformLocation(program, "colors") for an array, so we cannot discover based on the user
+ // input arguments whether the uniform we are dealing with is an array. The only way to discover which uniforms are arrays
+ // is to enumerate over all the active uniforms in the program.
+ var leftBrace = webglGetLeftBracePos(name);
+
+ // If user passed an array accessor "[index]", parse the array index off the accessor.
+ if (leftBrace > 0) {
+ arrayIndex = jstoi_q(name.slice(leftBrace + 1)) >>> 0; // "index]", coerce parseInt(']') with >>>0 to treat "foo[]" as "foo[0]" and foo[-1] as unsigned out-of-bounds.
+ uniformBaseName = name.slice(0, leftBrace);
+ }
+
+ // Have we cached the location of this uniform before?
+ var sizeAndId = program.uniformSizeAndIdsByName[uniformBaseName]; // A pair [array length, GLint of the uniform location]
+
+ // If an uniform with this name exists, and if its index is within the array limits (if it's even an array),
+ // query the WebGLlocation, or return an existing cached location.
+ if (sizeAndId && arrayIndex < sizeAndId[0]) {
+ arrayIndex += sizeAndId[1]; // Add the base location of the uniform to the array index offset.
+ if ((uniformLocsById[arrayIndex] = uniformLocsById[arrayIndex] || GLctx.getUniformLocation(program, name))) {
+ return arrayIndex;
+ }
+ }
+ }
+ else {
+ // N.b. we are currently unable to distinguish between GL program IDs that never existed vs GL program IDs that have been deleted,
+ // so report GL_INVALID_VALUE in both cases.
+ GL.recordError(0x501 /* GL_INVALID_VALUE */);
+ }
+ return -1;
+ }
+
+ function webglGetUniformLocation(location) {
+ var p = GLctx.currentProgram;
+
+ if (p) {
+ var webglLoc = p.uniformLocsById[location];
+ // p.uniformLocsById[location] stores either an integer, or a WebGLUniformLocation.
+
+ // If an integer, we have not yet bound the location, so do it now. The integer value specifies the array index
+ // we should bind to.
+ if (typeof webglLoc == 'number') {
+ p.uniformLocsById[location] = webglLoc = GLctx.getUniformLocation(p, p.uniformArrayNamesById[location] + (webglLoc > 0 ? '[' + webglLoc + ']' : ''));
+ }
+ // Else an already cached WebGLUniformLocation, return it.
+ return webglLoc;
+ } else {
+ GL.recordError(0x502/*GL_INVALID_OPERATION*/);
+ }
+ }
+ /** @suppress{checkTypes} */
+ function emscriptenWebGLGetUniform(program, location, params, type) {
+ if (!params) {
+ // GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense
+ // if params == null, issue a GL error to notify user about it.
+ GL.recordError(0x501 /* GL_INVALID_VALUE */);
+ return;
+ }
+ program = GL.programs[program];
+ webglPrepareUniformLocationsBeforeFirstUse(program);
+ var data = GLctx.getUniform(program, webglGetUniformLocation(location));
+ if (typeof data == 'number' || typeof data == 'boolean') {
+ switch (type) {
+ case 0: HEAP32[((params)>>2)] = data; break;
+ case 2: HEAPF32[((params)>>2)] = data; break;
+ }
+ } else {
+ for (var i = 0; i < data.length; i++) {
+ switch (type) {
+ case 0: HEAP32[(((params)+(i*4))>>2)] = data[i]; break;
+ case 2: HEAPF32[(((params)+(i*4))>>2)] = data[i]; break;
+ }
+ }
+ }
+ }
+ function _emscripten_glGetUniformfv(program, location, params) {
+ emscriptenWebGLGetUniform(program, location, params, 2);
+ }
+
+ function _emscripten_glGetUniformiv(program, location, params) {
+ emscriptenWebGLGetUniform(program, location, params, 0);
+ }
+
+ function _emscripten_glGetVertexAttribPointerv(index, pname, pointer) {
+ if (!pointer) {
+ // GLES2 specification does not specify how to behave if pointer is a null pointer. Since calling this function does not make sense
+ // if pointer == null, issue a GL error to notify user about it.
+ GL.recordError(0x501 /* GL_INVALID_VALUE */);
+ return;
+ }
+ HEAP32[((pointer)>>2)] = GLctx.getVertexAttribOffset(index, pname);
+ }
+
+ /** @suppress{checkTypes} */
+ function emscriptenWebGLGetVertexAttrib(index, pname, params, type) {
+ if (!params) {
+ // GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense
+ // if params == null, issue a GL error to notify user about it.
+ GL.recordError(0x501 /* GL_INVALID_VALUE */);
+ return;
+ }
+ var data = GLctx.getVertexAttrib(index, pname);
+ if (pname == 0x889F/*VERTEX_ATTRIB_ARRAY_BUFFER_BINDING*/) {
+ HEAP32[((params)>>2)] = data && data["name"];
+ } else if (typeof data == 'number' || typeof data == 'boolean') {
+ switch (type) {
+ case 0: HEAP32[((params)>>2)] = data; break;
+ case 2: HEAPF32[((params)>>2)] = data; break;
+ case 5: HEAP32[((params)>>2)] = Math.fround(data); break;
+ }
+ } else {
+ for (var i = 0; i < data.length; i++) {
+ switch (type) {
+ case 0: HEAP32[(((params)+(i*4))>>2)] = data[i]; break;
+ case 2: HEAPF32[(((params)+(i*4))>>2)] = data[i]; break;
+ case 5: HEAP32[(((params)+(i*4))>>2)] = Math.fround(data[i]); break;
+ }
+ }
+ }
+ }
+ function _emscripten_glGetVertexAttribfv(index, pname, params) {
+ // N.B. This function may only be called if the vertex attribute was specified using the function glVertexAttrib*f(),
+ // otherwise the results are undefined. (GLES3 spec 6.1.12)
+ emscriptenWebGLGetVertexAttrib(index, pname, params, 2);
+ }
+
+ function _emscripten_glGetVertexAttribiv(index, pname, params) {
+ // N.B. This function may only be called if the vertex attribute was specified using the function glVertexAttrib*f(),
+ // otherwise the results are undefined. (GLES3 spec 6.1.12)
+ emscriptenWebGLGetVertexAttrib(index, pname, params, 5);
+ }
+
+ function _emscripten_glHint(x0, x1) { GLctx['hint'](x0, x1) }
+
+ function _emscripten_glIsBuffer(buffer) {
+ var b = GL.buffers[buffer];
+ if (!b) return 0;
+ return GLctx.isBuffer(b);
+ }
+
+ function _emscripten_glIsEnabled(x0) { return GLctx['isEnabled'](x0) }
+
+ function _emscripten_glIsFramebuffer(framebuffer) {
+ var fb = GL.framebuffers[framebuffer];
+ if (!fb) return 0;
+ return GLctx.isFramebuffer(fb);
+ }
+
+ function _emscripten_glIsProgram(program) {
+ program = GL.programs[program];
+ if (!program) return 0;
+ return GLctx.isProgram(program);
+ }
+
+ function _emscripten_glIsQueryEXT(id) {
+ var query = GL.queries[id];
+ if (!query) return 0;
+ return GLctx.disjointTimerQueryExt['isQueryEXT'](query);
+ }
+
+ function _emscripten_glIsRenderbuffer(renderbuffer) {
+ var rb = GL.renderbuffers[renderbuffer];
+ if (!rb) return 0;
+ return GLctx.isRenderbuffer(rb);
+ }
+
+ function _emscripten_glIsShader(shader) {
+ var s = GL.shaders[shader];
+ if (!s) return 0;
+ return GLctx.isShader(s);
+ }
+
+ function _emscripten_glIsTexture(id) {
+ var texture = GL.textures[id];
+ if (!texture) return 0;
+ return GLctx.isTexture(texture);
+ }
+
+ function _emscripten_glIsVertexArrayOES(array) {
+
+ var vao = GL.vaos[array];
+ if (!vao) return 0;
+ return GLctx['isVertexArray'](vao);
+ }
+
+ function _emscripten_glLineWidth(x0) { GLctx['lineWidth'](x0) }
+
+ function _emscripten_glLinkProgram(program) {
+ program = GL.programs[program];
+ GLctx.linkProgram(program);
+ // Invalidate earlier computed uniform->ID mappings, those have now become stale
+ program.uniformLocsById = 0; // Mark as null-like so that glGetUniformLocation() knows to populate this again.
+ program.uniformSizeAndIdsByName = {};
+
+ }
+
+ function _emscripten_glPixelStorei(pname, param) {
+ if (pname == 0xCF5 /* GL_UNPACK_ALIGNMENT */) {
+ GL.unpackAlignment = param;
+ }
+ GLctx.pixelStorei(pname, param);
+ }
+
+ function _emscripten_glPolygonOffset(x0, x1) { GLctx['polygonOffset'](x0, x1) }
+
+ function _emscripten_glQueryCounterEXT(id, target) {
+ GLctx.disjointTimerQueryExt['queryCounterEXT'](GL.queries[id], target);
+ }
+
+ function computeUnpackAlignedImageSize(width, height, sizePerPixel, alignment) {
+ function roundedToNextMultipleOf(x, y) {
+ return (x + y - 1) & -y;
+ }
+ var plainRowSize = width * sizePerPixel;
+ var alignedRowSize = roundedToNextMultipleOf(plainRowSize, alignment);
+ return height * alignedRowSize;
+ }
+
+ function __colorChannelsInGlTextureFormat(format) {
+ // Micro-optimizations for size: map format to size by subtracting smallest enum value (0x1902) from all values first.
+ // Also omit the most common size value (1) from the list, which is assumed by formats not on the list.
+ var colorChannels = {
+ // 0x1902 /* GL_DEPTH_COMPONENT */ - 0x1902: 1,
+ // 0x1906 /* GL_ALPHA */ - 0x1902: 1,
+ 5: 3,
+ 6: 4,
+ // 0x1909 /* GL_LUMINANCE */ - 0x1902: 1,
+ 8: 2,
+ 29502: 3,
+ 29504: 4,
+ };
+ return colorChannels[format - 0x1902]||1;
+ }
+
+ function heapObjectForWebGLType(type) {
+ // Micro-optimization for size: Subtract lowest GL enum number (0x1400/* GL_BYTE */) from type to compare
+ // smaller values for the heap, for shorter generated code size.
+ // Also the type HEAPU16 is not tested for explicitly, but any unrecognized type will return out HEAPU16.
+ // (since most types are HEAPU16)
+ type -= 0x1400;
+
+ if (type == 1) return HEAPU8;
+
+ if (type == 4) return HEAP32;
+
+ if (type == 6) return HEAPF32;
+
+ if (type == 5
+ || type == 28922
+ )
+ return HEAPU32;
+
+ return HEAPU16;
+ }
+
+ function heapAccessShiftForWebGLHeap(heap) {
+ return 31 - Math.clz32(heap.BYTES_PER_ELEMENT);
+ }
+ function emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, internalFormat) {
+ var heap = heapObjectForWebGLType(type);
+ var shift = heapAccessShiftForWebGLHeap(heap);
+ var byteSize = 1<> shift, pixels + bytes >> shift);
+ }
+ function _emscripten_glReadPixels(x, y, width, height, format, type, pixels) {
+ var pixelData = emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, format);
+ if (!pixelData) {
+ GL.recordError(0x500/*GL_INVALID_ENUM*/);
+ return;
+ }
+ GLctx.readPixels(x, y, width, height, format, type, pixelData);
+ }
+
+ function _emscripten_glReleaseShaderCompiler() {
+ // NOP (as allowed by GLES 2.0 spec)
+ }
+
+ function _emscripten_glRenderbufferStorage(x0, x1, x2, x3) { GLctx['renderbufferStorage'](x0, x1, x2, x3) }
+
+ function _emscripten_glSampleCoverage(value, invert) {
+ GLctx.sampleCoverage(value, !!invert);
+ }
+
+ function _emscripten_glScissor(x0, x1, x2, x3) { GLctx['scissor'](x0, x1, x2, x3) }
+
+ function _emscripten_glShaderBinary() {
+ GL.recordError(0x500/*GL_INVALID_ENUM*/);
+ }
+
+ function _emscripten_glShaderSource(shader, count, string, length) {
+ var source = GL.getSource(shader, count, string, length);
+
+ GLctx.shaderSource(GL.shaders[shader], source);
+ }
+
+ function _emscripten_glStencilFunc(x0, x1, x2) { GLctx['stencilFunc'](x0, x1, x2) }
+
+ function _emscripten_glStencilFuncSeparate(x0, x1, x2, x3) { GLctx['stencilFuncSeparate'](x0, x1, x2, x3) }
+
+ function _emscripten_glStencilMask(x0) { GLctx['stencilMask'](x0) }
+
+ function _emscripten_glStencilMaskSeparate(x0, x1) { GLctx['stencilMaskSeparate'](x0, x1) }
+
+ function _emscripten_glStencilOp(x0, x1, x2) { GLctx['stencilOp'](x0, x1, x2) }
+
+ function _emscripten_glStencilOpSeparate(x0, x1, x2, x3) { GLctx['stencilOpSeparate'](x0, x1, x2, x3) }
+
+ function _emscripten_glTexImage2D(target, level, internalFormat, width, height, border, format, type, pixels) {
+ GLctx.texImage2D(target, level, internalFormat, width, height, border, format, type, pixels ? emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, internalFormat) : null);
+ }
+
+ function _emscripten_glTexParameterf(x0, x1, x2) { GLctx['texParameterf'](x0, x1, x2) }
+
+ function _emscripten_glTexParameterfv(target, pname, params) {
+ var param = HEAPF32[((params)>>2)];
+ GLctx.texParameterf(target, pname, param);
+ }
+
+ function _emscripten_glTexParameteri(x0, x1, x2) { GLctx['texParameteri'](x0, x1, x2) }
+
+ function _emscripten_glTexParameteriv(target, pname, params) {
+ var param = HEAP32[((params)>>2)];
+ GLctx.texParameteri(target, pname, param);
+ }
+
+ function _emscripten_glTexSubImage2D(target, level, xoffset, yoffset, width, height, format, type, pixels) {
+ var pixelData = null;
+ if (pixels) pixelData = emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, 0);
+ GLctx.texSubImage2D(target, level, xoffset, yoffset, width, height, format, type, pixelData);
+ }
+
+ function _emscripten_glUniform1f(location, v0) {
+ GLctx.uniform1f(webglGetUniformLocation(location), v0);
+ }
+
+ var miniTempWebGLFloatBuffers = [];
+ function _emscripten_glUniform1fv(location, count, value) {
+
+ if (count <= 288) {
+ // avoid allocation when uploading few enough uniforms
+ var view = miniTempWebGLFloatBuffers[count-1];
+ for (var i = 0; i < count; ++i) {
+ view[i] = HEAPF32[(((value)+(4*i))>>2)];
+ }
+ } else
+ {
+ var view = HEAPF32.subarray((value)>>2, (value+count*4)>>2);
+ }
+ GLctx.uniform1fv(webglGetUniformLocation(location), view);
+ }
+
+ function _emscripten_glUniform1i(location, v0) {
+ GLctx.uniform1i(webglGetUniformLocation(location), v0);
+ }
+
+ var __miniTempWebGLIntBuffers = [];
+ function _emscripten_glUniform1iv(location, count, value) {
+
+ if (count <= 288) {
+ // avoid allocation when uploading few enough uniforms
+ var view = __miniTempWebGLIntBuffers[count-1];
+ for (var i = 0; i < count; ++i) {
+ view[i] = HEAP32[(((value)+(4*i))>>2)];
+ }
+ } else
+ {
+ var view = HEAP32.subarray((value)>>2, (value+count*4)>>2);
+ }
+ GLctx.uniform1iv(webglGetUniformLocation(location), view);
+ }
+
+ function _emscripten_glUniform2f(location, v0, v1) {
+ GLctx.uniform2f(webglGetUniformLocation(location), v0, v1);
+ }
+
+ function _emscripten_glUniform2fv(location, count, value) {
+
+ if (count <= 144) {
+ // avoid allocation when uploading few enough uniforms
+ var view = miniTempWebGLFloatBuffers[2*count-1];
+ for (var i = 0; i < 2*count; i += 2) {
+ view[i] = HEAPF32[(((value)+(4*i))>>2)];
+ view[i+1] = HEAPF32[(((value)+(4*i+4))>>2)];
+ }
+ } else
+ {
+ var view = HEAPF32.subarray((value)>>2, (value+count*8)>>2);
+ }
+ GLctx.uniform2fv(webglGetUniformLocation(location), view);
+ }
+
+ function _emscripten_glUniform2i(location, v0, v1) {
+ GLctx.uniform2i(webglGetUniformLocation(location), v0, v1);
+ }
+
+ function _emscripten_glUniform2iv(location, count, value) {
+
+ if (count <= 144) {
+ // avoid allocation when uploading few enough uniforms
+ var view = __miniTempWebGLIntBuffers[2*count-1];
+ for (var i = 0; i < 2*count; i += 2) {
+ view[i] = HEAP32[(((value)+(4*i))>>2)];
+ view[i+1] = HEAP32[(((value)+(4*i+4))>>2)];
+ }
+ } else
+ {
+ var view = HEAP32.subarray((value)>>2, (value+count*8)>>2);
+ }
+ GLctx.uniform2iv(webglGetUniformLocation(location), view);
+ }
+
+ function _emscripten_glUniform3f(location, v0, v1, v2) {
+ GLctx.uniform3f(webglGetUniformLocation(location), v0, v1, v2);
+ }
+
+ function _emscripten_glUniform3fv(location, count, value) {
+
+ if (count <= 96) {
+ // avoid allocation when uploading few enough uniforms
+ var view = miniTempWebGLFloatBuffers[3*count-1];
+ for (var i = 0; i < 3*count; i += 3) {
+ view[i] = HEAPF32[(((value)+(4*i))>>2)];
+ view[i+1] = HEAPF32[(((value)+(4*i+4))>>2)];
+ view[i+2] = HEAPF32[(((value)+(4*i+8))>>2)];
+ }
+ } else
+ {
+ var view = HEAPF32.subarray((value)>>2, (value+count*12)>>2);
+ }
+ GLctx.uniform3fv(webglGetUniformLocation(location), view);
+ }
+
+ function _emscripten_glUniform3i(location, v0, v1, v2) {
+ GLctx.uniform3i(webglGetUniformLocation(location), v0, v1, v2);
+ }
+
+ function _emscripten_glUniform3iv(location, count, value) {
+
+ if (count <= 96) {
+ // avoid allocation when uploading few enough uniforms
+ var view = __miniTempWebGLIntBuffers[3*count-1];
+ for (var i = 0; i < 3*count; i += 3) {
+ view[i] = HEAP32[(((value)+(4*i))>>2)];
+ view[i+1] = HEAP32[(((value)+(4*i+4))>>2)];
+ view[i+2] = HEAP32[(((value)+(4*i+8))>>2)];
+ }
+ } else
+ {
+ var view = HEAP32.subarray((value)>>2, (value+count*12)>>2);
+ }
+ GLctx.uniform3iv(webglGetUniformLocation(location), view);
+ }
+
+ function _emscripten_glUniform4f(location, v0, v1, v2, v3) {
+ GLctx.uniform4f(webglGetUniformLocation(location), v0, v1, v2, v3);
+ }
+
+ function _emscripten_glUniform4fv(location, count, value) {
+
+ if (count <= 72) {
+ // avoid allocation when uploading few enough uniforms
+ var view = miniTempWebGLFloatBuffers[4*count-1];
+ // hoist the heap out of the loop for size and for pthreads+growth.
+ var heap = HEAPF32;
+ value >>= 2;
+ for (var i = 0; i < 4 * count; i += 4) {
+ var dst = value + i;
+ view[i] = heap[dst];
+ view[i + 1] = heap[dst + 1];
+ view[i + 2] = heap[dst + 2];
+ view[i + 3] = heap[dst + 3];
+ }
+ } else
+ {
+ var view = HEAPF32.subarray((value)>>2, (value+count*16)>>2);
+ }
+ GLctx.uniform4fv(webglGetUniformLocation(location), view);
+ }
+
+ function _emscripten_glUniform4i(location, v0, v1, v2, v3) {
+ GLctx.uniform4i(webglGetUniformLocation(location), v0, v1, v2, v3);
+ }
+
+ function _emscripten_glUniform4iv(location, count, value) {
+
+ if (count <= 72) {
+ // avoid allocation when uploading few enough uniforms
+ var view = __miniTempWebGLIntBuffers[4*count-1];
+ for (var i = 0; i < 4*count; i += 4) {
+ view[i] = HEAP32[(((value)+(4*i))>>2)];
+ view[i+1] = HEAP32[(((value)+(4*i+4))>>2)];
+ view[i+2] = HEAP32[(((value)+(4*i+8))>>2)];
+ view[i+3] = HEAP32[(((value)+(4*i+12))>>2)];
+ }
+ } else
+ {
+ var view = HEAP32.subarray((value)>>2, (value+count*16)>>2);
+ }
+ GLctx.uniform4iv(webglGetUniformLocation(location), view);
+ }
+
+ function _emscripten_glUniformMatrix2fv(location, count, transpose, value) {
+
+ if (count <= 72) {
+ // avoid allocation when uploading few enough uniforms
+ var view = miniTempWebGLFloatBuffers[4*count-1];
+ for (var i = 0; i < 4*count; i += 4) {
+ view[i] = HEAPF32[(((value)+(4*i))>>2)];
+ view[i+1] = HEAPF32[(((value)+(4*i+4))>>2)];
+ view[i+2] = HEAPF32[(((value)+(4*i+8))>>2)];
+ view[i+3] = HEAPF32[(((value)+(4*i+12))>>2)];
+ }
+ } else
+ {
+ var view = HEAPF32.subarray((value)>>2, (value+count*16)>>2);
+ }
+ GLctx.uniformMatrix2fv(webglGetUniformLocation(location), !!transpose, view);
+ }
+
+ function _emscripten_glUniformMatrix3fv(location, count, transpose, value) {
+
+ if (count <= 32) {
+ // avoid allocation when uploading few enough uniforms
+ var view = miniTempWebGLFloatBuffers[9*count-1];
+ for (var i = 0; i < 9*count; i += 9) {
+ view[i] = HEAPF32[(((value)+(4*i))>>2)];
+ view[i+1] = HEAPF32[(((value)+(4*i+4))>>2)];
+ view[i+2] = HEAPF32[(((value)+(4*i+8))>>2)];
+ view[i+3] = HEAPF32[(((value)+(4*i+12))>>2)];
+ view[i+4] = HEAPF32[(((value)+(4*i+16))>>2)];
+ view[i+5] = HEAPF32[(((value)+(4*i+20))>>2)];
+ view[i+6] = HEAPF32[(((value)+(4*i+24))>>2)];
+ view[i+7] = HEAPF32[(((value)+(4*i+28))>>2)];
+ view[i+8] = HEAPF32[(((value)+(4*i+32))>>2)];
+ }
+ } else
+ {
+ var view = HEAPF32.subarray((value)>>2, (value+count*36)>>2);
+ }
+ GLctx.uniformMatrix3fv(webglGetUniformLocation(location), !!transpose, view);
+ }
+
+ function _emscripten_glUniformMatrix4fv(location, count, transpose, value) {
+
+ if (count <= 18) {
+ // avoid allocation when uploading few enough uniforms
+ var view = miniTempWebGLFloatBuffers[16*count-1];
+ // hoist the heap out of the loop for size and for pthreads+growth.
+ var heap = HEAPF32;
+ value >>= 2;
+ for (var i = 0; i < 16 * count; i += 16) {
+ var dst = value + i;
+ view[i] = heap[dst];
+ view[i + 1] = heap[dst + 1];
+ view[i + 2] = heap[dst + 2];
+ view[i + 3] = heap[dst + 3];
+ view[i + 4] = heap[dst + 4];
+ view[i + 5] = heap[dst + 5];
+ view[i + 6] = heap[dst + 6];
+ view[i + 7] = heap[dst + 7];
+ view[i + 8] = heap[dst + 8];
+ view[i + 9] = heap[dst + 9];
+ view[i + 10] = heap[dst + 10];
+ view[i + 11] = heap[dst + 11];
+ view[i + 12] = heap[dst + 12];
+ view[i + 13] = heap[dst + 13];
+ view[i + 14] = heap[dst + 14];
+ view[i + 15] = heap[dst + 15];
+ }
+ } else
+ {
+ var view = HEAPF32.subarray((value)>>2, (value+count*64)>>2);
+ }
+ GLctx.uniformMatrix4fv(webglGetUniformLocation(location), !!transpose, view);
+ }
+
+ function _emscripten_glUseProgram(program) {
+ program = GL.programs[program];
+ GLctx.useProgram(program);
+ // Record the currently active program so that we can access the uniform
+ // mapping table of that program.
+ GLctx.currentProgram = program;
+ }
+
+ function _emscripten_glValidateProgram(program) {
+ GLctx.validateProgram(GL.programs[program]);
+ }
+
+ function _emscripten_glVertexAttrib1f(x0, x1) { GLctx['vertexAttrib1f'](x0, x1) }
+
+ function _emscripten_glVertexAttrib1fv(index, v) {
+
+ GLctx.vertexAttrib1f(index, HEAPF32[v>>2]);
+ }
+
+ function _emscripten_glVertexAttrib2f(x0, x1, x2) { GLctx['vertexAttrib2f'](x0, x1, x2) }
+
+ function _emscripten_glVertexAttrib2fv(index, v) {
+
+ GLctx.vertexAttrib2f(index, HEAPF32[v>>2], HEAPF32[v+4>>2]);
+ }
+
+ function _emscripten_glVertexAttrib3f(x0, x1, x2, x3) { GLctx['vertexAttrib3f'](x0, x1, x2, x3) }
+
+ function _emscripten_glVertexAttrib3fv(index, v) {
+
+ GLctx.vertexAttrib3f(index, HEAPF32[v>>2], HEAPF32[v+4>>2], HEAPF32[v+8>>2]);
+ }
+
+ function _emscripten_glVertexAttrib4f(x0, x1, x2, x3, x4) { GLctx['vertexAttrib4f'](x0, x1, x2, x3, x4) }
+
+ function _emscripten_glVertexAttrib4fv(index, v) {
+
+ GLctx.vertexAttrib4f(index, HEAPF32[v>>2], HEAPF32[v+4>>2], HEAPF32[v+8>>2], HEAPF32[v+12>>2]);
+ }
+
+ function _emscripten_glVertexAttribDivisorANGLE(index, divisor) {
+ GLctx['vertexAttribDivisor'](index, divisor);
+ }
+
+ function _emscripten_glVertexAttribPointer(index, size, type, normalized, stride, ptr) {
+ GLctx.vertexAttribPointer(index, size, type, !!normalized, stride, ptr);
+ }
+
+ function _emscripten_glViewport(x0, x1, x2, x3) { GLctx['viewport'](x0, x1, x2, x3) }
+
+ function _emscripten_memcpy_big(dest, src, num) {
+ HEAPU8.copyWithin(dest, src, src + num);
+ }
+
+ function emscripten_realloc_buffer(size) {
+ try {
+ // round size grow request up to wasm page size (fixed 64KB per spec)
+ wasmMemory.grow((size - buffer.byteLength + 65535) >>> 16); // .grow() takes a delta compared to the previous size
+ updateGlobalBufferAndViews(wasmMemory.buffer);
+ return 1 /*success*/;
+ } catch(e) {
+ }
+ // implicit 0 return to save code size (caller will cast "undefined" into 0
+ // anyhow)
+ }
+ function _emscripten_resize_heap(requestedSize) {
+ var oldSize = HEAPU8.length;
+ requestedSize = requestedSize >>> 0;
+ // With multithreaded builds, races can happen (another thread might increase the size
+ // in between), so return a failure, and let the caller retry.
+
+ // Memory resize rules:
+ // 1. Always increase heap size to at least the requested size, rounded up
+ // to next page multiple.
+ // 2a. If MEMORY_GROWTH_LINEAR_STEP == -1, excessively resize the heap
+ // geometrically: increase the heap size according to
+ // MEMORY_GROWTH_GEOMETRIC_STEP factor (default +20%), At most
+ // overreserve by MEMORY_GROWTH_GEOMETRIC_CAP bytes (default 96MB).
+ // 2b. If MEMORY_GROWTH_LINEAR_STEP != -1, excessively resize the heap
+ // linearly: increase the heap size by at least
+ // MEMORY_GROWTH_LINEAR_STEP bytes.
+ // 3. Max size for the heap is capped at 2048MB-WASM_PAGE_SIZE, or by
+ // MAXIMUM_MEMORY, or by ASAN limit, depending on which is smallest
+ // 4. If we were unable to allocate as much memory, it may be due to
+ // over-eager decision to excessively reserve due to (3) above.
+ // Hence if an allocation fails, cut down on the amount of excess
+ // growth, in an attempt to succeed to perform a smaller allocation.
+
+ // A limit is set for how much we can grow. We should not exceed that
+ // (the wasm binary specifies it, so if we tried, we'd fail anyhow).
+ var maxHeapSize = getHeapMax();
+ if (requestedSize > maxHeapSize) {
+ return false;
+ }
+
+ let alignUp = (x, multiple) => x + (multiple - x % multiple) % multiple;
+
+ // Loop through potential heap size increases. If we attempt a too eager
+ // reservation that fails, cut down on the attempted size and reserve a
+ // smaller bump instead. (max 3 times, chosen somewhat arbitrarily)
+ for (var cutDown = 1; cutDown <= 4; cutDown *= 2) {
+ var overGrownHeapSize = oldSize * (1 + 0.2 / cutDown); // ensure geometric growth
+ // but limit overreserving (default to capping at +96MB overgrowth at most)
+ overGrownHeapSize = Math.min(overGrownHeapSize, requestedSize + 100663296 );
+
+ var newSize = Math.min(maxHeapSize, alignUp(Math.max(requestedSize, overGrownHeapSize), 65536));
+
+ var replacement = emscripten_realloc_buffer(newSize);
+ if (replacement) {
+
+ return true;
+ }
+ }
+ return false;
+ }
+
+ var ENV = {};
+
+ function getExecutableName() {
+ return thisProgram || './this.program';
+ }
+ function getEnvStrings() {
+ if (!getEnvStrings.strings) {
+ // Default values.
+ // Browser language detection #8751
+ var lang = ((typeof navigator == 'object' && navigator.languages && navigator.languages[0]) || 'C').replace('-', '_') + '.UTF-8';
+ var env = {
+ 'USER': 'web_user',
+ 'LOGNAME': 'web_user',
+ 'PATH': '/',
+ 'PWD': '/',
+ 'HOME': '/home/web_user',
+ 'LANG': lang,
+ '_': getExecutableName()
+ };
+ // Apply the user-provided values, if any.
+ for (var x in ENV) {
+ // x is a key in ENV; if ENV[x] is undefined, that means it was
+ // explicitly set to be so. We allow user code to do that to
+ // force variables with default values to remain unset.
+ if (ENV[x] === undefined) delete env[x];
+ else env[x] = ENV[x];
+ }
+ var strings = [];
+ for (var x in env) {
+ strings.push(x + '=' + env[x]);
+ }
+ getEnvStrings.strings = strings;
+ }
+ return getEnvStrings.strings;
+ }
+ function _environ_get(__environ, environ_buf) {
+ var bufSize = 0;
+ getEnvStrings().forEach(function(string, i) {
+ var ptr = environ_buf + bufSize;
+ HEAPU32[(((__environ)+(i*4))>>2)] = ptr;
+ writeAsciiToMemory(string, ptr);
+ bufSize += string.length + 1;
+ });
+ return 0;
+ }
+
+ function _environ_sizes_get(penviron_count, penviron_buf_size) {
+ var strings = getEnvStrings();
+ HEAPU32[((penviron_count)>>2)] = strings.length;
+ var bufSize = 0;
+ strings.forEach(function(string) {
+ bufSize += string.length + 1;
+ });
+ HEAPU32[((penviron_buf_size)>>2)] = bufSize;
+ return 0;
+ }
+
+ function _exit(status) {
+ // void _exit(int status);
+ // http://pubs.opengroup.org/onlinepubs/000095399/functions/exit.html
+ exit(status);
+ }
+
+ function _fd_close(fd) {
+ try {
+
+ var stream = SYSCALLS.getStreamFromFD(fd);
+ FS.close(stream);
+ return 0;
+ } catch (e) {
+ if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e;
+ return e.errno;
+ }
+ }
+
+ function _fd_fdstat_get(fd, pbuf) {
+ try {
+
+ var stream = SYSCALLS.getStreamFromFD(fd);
+ // All character devices are terminals (other things a Linux system would
+ // assume is a character device, like the mouse, we have special APIs for).
+ var type = stream.tty ? 2 :
+ FS.isDir(stream.mode) ? 3 :
+ FS.isLink(stream.mode) ? 7 :
+ 4;
+ HEAP8[((pbuf)>>0)] = type;
+ // TODO HEAP16[(((pbuf)+(2))>>1)] = ?;
+ // TODO (tempI64 = [?>>>0,(tempDouble=?,(+(Math.abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? ((Math.min((+(Math.floor((tempDouble)/4294967296.0))), 4294967295.0))|0)>>>0 : (~~((+(Math.ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)],HEAP32[(((pbuf)+(8))>>2)] = tempI64[0],HEAP32[(((pbuf)+(12))>>2)] = tempI64[1]);
+ // TODO (tempI64 = [?>>>0,(tempDouble=?,(+(Math.abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? ((Math.min((+(Math.floor((tempDouble)/4294967296.0))), 4294967295.0))|0)>>>0 : (~~((+(Math.ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)],HEAP32[(((pbuf)+(16))>>2)] = tempI64[0],HEAP32[(((pbuf)+(20))>>2)] = tempI64[1]);
+ return 0;
+ } catch (e) {
+ if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e;
+ return e.errno;
+ }
+ }
+
+ /** @param {number=} offset */
+ function doReadv(stream, iov, iovcnt, offset) {
+ var ret = 0;
+ for (var i = 0; i < iovcnt; i++) {
+ var ptr = HEAPU32[((iov)>>2)];
+ var len = HEAPU32[(((iov)+(4))>>2)];
+ iov += 8;
+ var curr = FS.read(stream, HEAP8,ptr, len, offset);
+ if (curr < 0) return -1;
+ ret += curr;
+ if (curr < len) break; // nothing more to read
+ }
+ return ret;
+ }
+ function _fd_pread(fd, iov, iovcnt, offset_low, offset_high, pnum) {
+ try {
+
+ var offset = convertI32PairToI53Checked(offset_low, offset_high); if (isNaN(offset)) return 61;
+ var stream = SYSCALLS.getStreamFromFD(fd)
+ var num = doReadv(stream, iov, iovcnt, offset);
+ HEAP32[((pnum)>>2)] = num;
+ return 0;
+ } catch (e) {
+ if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e;
+ return e.errno;
+ }
+ }
+
+ /** @param {number=} offset */
+ function doWritev(stream, iov, iovcnt, offset) {
+ var ret = 0;
+ for (var i = 0; i < iovcnt; i++) {
+ var ptr = HEAPU32[((iov)>>2)];
+ var len = HEAPU32[(((iov)+(4))>>2)];
+ iov += 8;
+ var curr = FS.write(stream, HEAP8,ptr, len, offset);
+ if (curr < 0) return -1;
+ ret += curr;
+ }
+ return ret;
+ }
+ function _fd_pwrite(fd, iov, iovcnt, offset_low, offset_high, pnum) {
+ try {
+
+ var offset = convertI32PairToI53Checked(offset_low, offset_high); if (isNaN(offset)) return 61;
+ var stream = SYSCALLS.getStreamFromFD(fd)
+ var num = doWritev(stream, iov, iovcnt, offset);
+ HEAP32[((pnum)>>2)] = num;
+ return 0;
+ } catch (e) {
+ if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e;
+ return e.errno;
+ }
+ }
+
+ function _fd_read(fd, iov, iovcnt, pnum) {
+ try {
+
+ var stream = SYSCALLS.getStreamFromFD(fd);
+ var num = doReadv(stream, iov, iovcnt);
+ HEAP32[((pnum)>>2)] = num;
+ return 0;
+ } catch (e) {
+ if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e;
+ return e.errno;
+ }
+ }
+
+ function _fd_seek(fd, offset_low, offset_high, whence, newOffset) {
+ try {
+
+ var offset = convertI32PairToI53Checked(offset_low, offset_high); if (isNaN(offset)) return 61;
+ var stream = SYSCALLS.getStreamFromFD(fd);
+ FS.llseek(stream, offset, whence);
+ (tempI64 = [stream.position>>>0,(tempDouble=stream.position,(+(Math.abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? ((Math.min((+(Math.floor((tempDouble)/4294967296.0))), 4294967295.0))|0)>>>0 : (~~((+(Math.ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)],HEAP32[((newOffset)>>2)] = tempI64[0],HEAP32[(((newOffset)+(4))>>2)] = tempI64[1]);
+ if (stream.getdents && offset === 0 && whence === 0) stream.getdents = null; // reset readdir state
+ return 0;
+ } catch (e) {
+ if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e;
+ return e.errno;
+ }
+ }
+
+ function _fd_sync(fd) {
+ try {
+
+ var stream = SYSCALLS.getStreamFromFD(fd);
+ if (stream.stream_ops && stream.stream_ops.fsync) {
+ return -stream.stream_ops.fsync(stream);
+ }
+ return 0; // we can't do anything synchronously; the in-memory FS is already synced to
+ } catch (e) {
+ if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e;
+ return e.errno;
+ }
+ }
+
+ function _fd_write(fd, iov, iovcnt, pnum) {
+ try {
+
+ var stream = SYSCALLS.getStreamFromFD(fd);
+ var num = doWritev(stream, iov, iovcnt);
+ HEAPU32[((pnum)>>2)] = num;
+ return 0;
+ } catch (e) {
+ if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e;
+ return e.errno;
+ }
+ }
+
+ function _getTempRet0() {
+ return getTempRet0();
+ }
+
+ function _llvm_eh_typeid_for(type) {
+ return type;
+ }
+
+ var DOTNET = {};
+ function _mono_set_timeout(
+ ) {
+ return __dotnet_runtime.__linker_exports.mono_set_timeout.apply(__dotnet_runtime, arguments)
+ }
+
+ function _mono_wasm_add_dbg_command_received(
+ ) {
+ return __dotnet_runtime.__linker_exports.mono_wasm_add_dbg_command_received.apply(__dotnet_runtime, arguments)
+ }
+
+ function _mono_wasm_asm_loaded(
+ ) {
+ return __dotnet_runtime.__linker_exports.mono_wasm_asm_loaded.apply(__dotnet_runtime, arguments)
+ }
+
+ function _mono_wasm_bind_cs_function(
+ ) {
+ return __dotnet_runtime.__linker_exports.mono_wasm_bind_cs_function.apply(__dotnet_runtime, arguments)
+ }
+
+ function _mono_wasm_bind_js_function(
+ ) {
+ return __dotnet_runtime.__linker_exports.mono_wasm_bind_js_function.apply(__dotnet_runtime, arguments)
+ }
+
+ function _mono_wasm_create_cs_owned_object_ref(
+ ) {
+ return __dotnet_runtime.__linker_exports.mono_wasm_create_cs_owned_object_ref.apply(__dotnet_runtime, arguments)
+ }
+
+ function _mono_wasm_debugger_log(
+ ) {
+ return __dotnet_runtime.__linker_exports.mono_wasm_debugger_log.apply(__dotnet_runtime, arguments)
+ }
+
+ function _mono_wasm_fire_debugger_agent_message(
+ ) {
+ return __dotnet_runtime.__linker_exports.mono_wasm_fire_debugger_agent_message.apply(__dotnet_runtime, arguments)
+ }
+
+ function _mono_wasm_get_by_index_ref(
+ ) {
+ return __dotnet_runtime.__linker_exports.mono_wasm_get_by_index_ref.apply(__dotnet_runtime, arguments)
+ }
+
+ function _mono_wasm_get_global_object_ref(
+ ) {
+ return __dotnet_runtime.__linker_exports.mono_wasm_get_global_object_ref.apply(__dotnet_runtime, arguments)
+ }
+
+ function _mono_wasm_get_object_property_ref(
+ ) {
+ return __dotnet_runtime.__linker_exports.mono_wasm_get_object_property_ref.apply(__dotnet_runtime, arguments)
+ }
+
+ function _mono_wasm_invoke_bound_function(
+ ) {
+ return __dotnet_runtime.__linker_exports.mono_wasm_invoke_bound_function.apply(__dotnet_runtime, arguments)
+ }
+
+ function _mono_wasm_invoke_js_blazor(
+ ) {
+ return __dotnet_runtime.__linker_exports.mono_wasm_invoke_js_blazor.apply(__dotnet_runtime, arguments)
+ }
+
+ function _mono_wasm_invoke_js_with_args_ref(
+ ) {
+ return __dotnet_runtime.__linker_exports.mono_wasm_invoke_js_with_args_ref.apply(__dotnet_runtime, arguments)
+ }
+
+ function _mono_wasm_marshal_promise(
+ ) {
+ return __dotnet_runtime.__linker_exports.mono_wasm_marshal_promise.apply(__dotnet_runtime, arguments)
+ }
+
+ function _mono_wasm_release_cs_owned_object(
+ ) {
+ return __dotnet_runtime.__linker_exports.mono_wasm_release_cs_owned_object.apply(__dotnet_runtime, arguments)
+ }
+
+ function _mono_wasm_set_by_index_ref(
+ ) {
+ return __dotnet_runtime.__linker_exports.mono_wasm_set_by_index_ref.apply(__dotnet_runtime, arguments)
+ }
+
+ function _mono_wasm_set_entrypoint_breakpoint(
+ ) {
+ return __dotnet_runtime.__linker_exports.mono_wasm_set_entrypoint_breakpoint.apply(__dotnet_runtime, arguments)
+ }
+
+ function _mono_wasm_set_object_property_ref(
+ ) {
+ return __dotnet_runtime.__linker_exports.mono_wasm_set_object_property_ref.apply(__dotnet_runtime, arguments)
+ }
+
+ function _mono_wasm_trace_logger(
+ ) {
+ return __dotnet_runtime.__linker_exports.mono_wasm_trace_logger.apply(__dotnet_runtime, arguments)
+ }
+
+ function _mono_wasm_typed_array_from_ref(
+ ) {
+ return __dotnet_runtime.__linker_exports.mono_wasm_typed_array_from_ref.apply(__dotnet_runtime, arguments)
+ }
+
+ function _mono_wasm_typed_array_to_array_ref(
+ ) {
+ return __dotnet_runtime.__linker_exports.mono_wasm_typed_array_to_array_ref.apply(__dotnet_runtime, arguments)
+ }
+
+ function _schedule_background_exec(
+ ) {
+ return __dotnet_runtime.__linker_exports.schedule_background_exec.apply(__dotnet_runtime, arguments)
+ }
+
+ function _setTempRet0(val) {
+ setTempRet0(val);
+ }
+
+ function __isLeapYear(year) {
+ return year%4 === 0 && (year%100 !== 0 || year%400 === 0);
+ }
+
+ function __arraySum(array, index) {
+ var sum = 0;
+ for (var i = 0; i <= index; sum += array[i++]) {
+ // no-op
+ }
+ return sum;
+ }
+
+ var __MONTH_DAYS_LEAP = [31,29,31,30,31,30,31,31,30,31,30,31];
+
+ var __MONTH_DAYS_REGULAR = [31,28,31,30,31,30,31,31,30,31,30,31];
+ function __addDays(date, days) {
+ var newDate = new Date(date.getTime());
+ while (days > 0) {
+ var leap = __isLeapYear(newDate.getFullYear());
+ var currentMonth = newDate.getMonth();
+ var daysInCurrentMonth = (leap ? __MONTH_DAYS_LEAP : __MONTH_DAYS_REGULAR)[currentMonth];
+
+ if (days > daysInCurrentMonth-newDate.getDate()) {
+ // we spill over to next month
+ days -= (daysInCurrentMonth-newDate.getDate()+1);
+ newDate.setDate(1);
+ if (currentMonth < 11) {
+ newDate.setMonth(currentMonth+1)
+ } else {
+ newDate.setMonth(0);
+ newDate.setFullYear(newDate.getFullYear()+1);
+ }
+ } else {
+ // we stay in current month
+ newDate.setDate(newDate.getDate()+days);
+ return newDate;
+ }
+ }
+
+ return newDate;
+ }
+ function _strftime(s, maxsize, format, tm) {
+ // size_t strftime(char *restrict s, size_t maxsize, const char *restrict format, const struct tm *restrict timeptr);
+ // http://pubs.opengroup.org/onlinepubs/009695399/functions/strftime.html
+
+ var tm_zone = HEAP32[(((tm)+(40))>>2)];
+
+ var date = {
+ tm_sec: HEAP32[((tm)>>2)],
+ tm_min: HEAP32[(((tm)+(4))>>2)],
+ tm_hour: HEAP32[(((tm)+(8))>>2)],
+ tm_mday: HEAP32[(((tm)+(12))>>2)],
+ tm_mon: HEAP32[(((tm)+(16))>>2)],
+ tm_year: HEAP32[(((tm)+(20))>>2)],
+ tm_wday: HEAP32[(((tm)+(24))>>2)],
+ tm_yday: HEAP32[(((tm)+(28))>>2)],
+ tm_isdst: HEAP32[(((tm)+(32))>>2)],
+ tm_gmtoff: HEAP32[(((tm)+(36))>>2)],
+ tm_zone: tm_zone ? UTF8ToString(tm_zone) : ''
+ };
+
+ var pattern = UTF8ToString(format);
+
+ // expand format
+ var EXPANSION_RULES_1 = {
+ '%c': '%a %b %d %H:%M:%S %Y', // Replaced by the locale's appropriate date and time representation - e.g., Mon Aug 3 14:02:01 2013
+ '%D': '%m/%d/%y', // Equivalent to %m / %d / %y
+ '%F': '%Y-%m-%d', // Equivalent to %Y - %m - %d
+ '%h': '%b', // Equivalent to %b
+ '%r': '%I:%M:%S %p', // Replaced by the time in a.m. and p.m. notation
+ '%R': '%H:%M', // Replaced by the time in 24-hour notation
+ '%T': '%H:%M:%S', // Replaced by the time
+ '%x': '%m/%d/%y', // Replaced by the locale's appropriate date representation
+ '%X': '%H:%M:%S', // Replaced by the locale's appropriate time representation
+ // Modified Conversion Specifiers
+ '%Ec': '%c', // Replaced by the locale's alternative appropriate date and time representation.
+ '%EC': '%C', // Replaced by the name of the base year (period) in the locale's alternative representation.
+ '%Ex': '%m/%d/%y', // Replaced by the locale's alternative date representation.
+ '%EX': '%H:%M:%S', // Replaced by the locale's alternative time representation.
+ '%Ey': '%y', // Replaced by the offset from %EC (year only) in the locale's alternative representation.
+ '%EY': '%Y', // Replaced by the full alternative year representation.
+ '%Od': '%d', // Replaced by the day of the month, using the locale's alternative numeric symbols, filled as needed with leading zeros if there is any alternative symbol for zero; otherwise, with leading characters.
+ '%Oe': '%e', // Replaced by the day of the month, using the locale's alternative numeric symbols, filled as needed with leading characters.
+ '%OH': '%H', // Replaced by the hour (24-hour clock) using the locale's alternative numeric symbols.
+ '%OI': '%I', // Replaced by the hour (12-hour clock) using the locale's alternative numeric symbols.
+ '%Om': '%m', // Replaced by the month using the locale's alternative numeric symbols.
+ '%OM': '%M', // Replaced by the minutes using the locale's alternative numeric symbols.
+ '%OS': '%S', // Replaced by the seconds using the locale's alternative numeric symbols.
+ '%Ou': '%u', // Replaced by the weekday as a number in the locale's alternative representation (Monday=1).
+ '%OU': '%U', // Replaced by the week number of the year (Sunday as the first day of the week, rules corresponding to %U ) using the locale's alternative numeric symbols.
+ '%OV': '%V', // Replaced by the week number of the year (Monday as the first day of the week, rules corresponding to %V ) using the locale's alternative numeric symbols.
+ '%Ow': '%w', // Replaced by the number of the weekday (Sunday=0) using the locale's alternative numeric symbols.
+ '%OW': '%W', // Replaced by the week number of the year (Monday as the first day of the week) using the locale's alternative numeric symbols.
+ '%Oy': '%y', // Replaced by the year (offset from %C ) using the locale's alternative numeric symbols.
+ };
+ for (var rule in EXPANSION_RULES_1) {
+ pattern = pattern.replace(new RegExp(rule, 'g'), EXPANSION_RULES_1[rule]);
+ }
+
+ var WEEKDAYS = ['Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday'];
+ var MONTHS = ['January', 'February', 'March', 'April', 'May', 'June', 'July', 'August', 'September', 'October', 'November', 'December'];
+
+ function leadingSomething(value, digits, character) {
+ var str = typeof value == 'number' ? value.toString() : (value || '');
+ while (str.length < digits) {
+ str = character[0]+str;
+ }
+ return str;
+ }
+
+ function leadingNulls(value, digits) {
+ return leadingSomething(value, digits, '0');
+ }
+
+ function compareByDay(date1, date2) {
+ function sgn(value) {
+ return value < 0 ? -1 : (value > 0 ? 1 : 0);
+ }
+
+ var compare;
+ if ((compare = sgn(date1.getFullYear()-date2.getFullYear())) === 0) {
+ if ((compare = sgn(date1.getMonth()-date2.getMonth())) === 0) {
+ compare = sgn(date1.getDate()-date2.getDate());
+ }
+ }
+ return compare;
+ }
+
+ function getFirstWeekStartDate(janFourth) {
+ switch (janFourth.getDay()) {
+ case 0: // Sunday
+ return new Date(janFourth.getFullYear()-1, 11, 29);
+ case 1: // Monday
+ return janFourth;
+ case 2: // Tuesday
+ return new Date(janFourth.getFullYear(), 0, 3);
+ case 3: // Wednesday
+ return new Date(janFourth.getFullYear(), 0, 2);
+ case 4: // Thursday
+ return new Date(janFourth.getFullYear(), 0, 1);
+ case 5: // Friday
+ return new Date(janFourth.getFullYear()-1, 11, 31);
+ case 6: // Saturday
+ return new Date(janFourth.getFullYear()-1, 11, 30);
+ }
+ }
+
+ function getWeekBasedYear(date) {
+ var thisDate = __addDays(new Date(date.tm_year+1900, 0, 1), date.tm_yday);
+
+ var janFourthThisYear = new Date(thisDate.getFullYear(), 0, 4);
+ var janFourthNextYear = new Date(thisDate.getFullYear()+1, 0, 4);
+
+ var firstWeekStartThisYear = getFirstWeekStartDate(janFourthThisYear);
+ var firstWeekStartNextYear = getFirstWeekStartDate(janFourthNextYear);
+
+ if (compareByDay(firstWeekStartThisYear, thisDate) <= 0) {
+ // this date is after the start of the first week of this year
+ if (compareByDay(firstWeekStartNextYear, thisDate) <= 0) {
+ return thisDate.getFullYear()+1;
+ } else {
+ return thisDate.getFullYear();
+ }
+ } else {
+ return thisDate.getFullYear()-1;
+ }
+ }
+
+ var EXPANSION_RULES_2 = {
+ '%a': function(date) {
+ return WEEKDAYS[date.tm_wday].substring(0,3);
+ },
+ '%A': function(date) {
+ return WEEKDAYS[date.tm_wday];
+ },
+ '%b': function(date) {
+ return MONTHS[date.tm_mon].substring(0,3);
+ },
+ '%B': function(date) {
+ return MONTHS[date.tm_mon];
+ },
+ '%C': function(date) {
+ var year = date.tm_year+1900;
+ return leadingNulls((year/100)|0,2);
+ },
+ '%d': function(date) {
+ return leadingNulls(date.tm_mday, 2);
+ },
+ '%e': function(date) {
+ return leadingSomething(date.tm_mday, 2, ' ');
+ },
+ '%g': function(date) {
+ // %g, %G, and %V give values according to the ISO 8601:2000 standard week-based year.
+ // In this system, weeks begin on a Monday and week 1 of the year is the week that includes
+ // January 4th, which is also the week that includes the first Thursday of the year, and
+ // is also the first week that contains at least four days in the year.
+ // If the first Monday of January is the 2nd, 3rd, or 4th, the preceding days are part of
+ // the last week of the preceding year; thus, for Saturday 2nd January 1999,
+ // %G is replaced by 1998 and %V is replaced by 53. If December 29th, 30th,
+ // or 31st is a Monday, it and any following days are part of week 1 of the following year.
+ // Thus, for Tuesday 30th December 1997, %G is replaced by 1998 and %V is replaced by 01.
+
+ return getWeekBasedYear(date).toString().substring(2);
+ },
+ '%G': function(date) {
+ return getWeekBasedYear(date);
+ },
+ '%H': function(date) {
+ return leadingNulls(date.tm_hour, 2);
+ },
+ '%I': function(date) {
+ var twelveHour = date.tm_hour;
+ if (twelveHour == 0) twelveHour = 12;
+ else if (twelveHour > 12) twelveHour -= 12;
+ return leadingNulls(twelveHour, 2);
+ },
+ '%j': function(date) {
+ // Day of the year (001-366)
+ return leadingNulls(date.tm_mday+__arraySum(__isLeapYear(date.tm_year+1900) ? __MONTH_DAYS_LEAP : __MONTH_DAYS_REGULAR, date.tm_mon-1), 3);
+ },
+ '%m': function(date) {
+ return leadingNulls(date.tm_mon+1, 2);
+ },
+ '%M': function(date) {
+ return leadingNulls(date.tm_min, 2);
+ },
+ '%n': function() {
+ return '\n';
+ },
+ '%p': function(date) {
+ if (date.tm_hour >= 0 && date.tm_hour < 12) {
+ return 'AM';
+ } else {
+ return 'PM';
+ }
+ },
+ '%S': function(date) {
+ return leadingNulls(date.tm_sec, 2);
+ },
+ '%t': function() {
+ return '\t';
+ },
+ '%u': function(date) {
+ return date.tm_wday || 7;
+ },
+ '%U': function(date) {
+ var days = date.tm_yday + 7 - date.tm_wday;
+ return leadingNulls(Math.floor(days / 7), 2);
+ },
+ '%V': function(date) {
+ // Replaced by the week number of the year (Monday as the first day of the week)
+ // as a decimal number [01,53]. If the week containing 1 January has four
+ // or more days in the new year, then it is considered week 1.
+ // Otherwise, it is the last week of the previous year, and the next week is week 1.
+ // Both January 4th and the first Thursday of January are always in week 1. [ tm_year, tm_wday, tm_yday]
+ var val = Math.floor((date.tm_yday + 7 - (date.tm_wday + 6) % 7 ) / 7);
+ // If 1 Jan is just 1-3 days past Monday, the previous week
+ // is also in this year.
+ if ((date.tm_wday + 371 - date.tm_yday - 2) % 7 <= 2) {
+ val++;
+ }
+ if (!val) {
+ val = 52;
+ // If 31 December of prev year a Thursday, or Friday of a
+ // leap year, then the prev year has 53 weeks.
+ var dec31 = (date.tm_wday + 7 - date.tm_yday - 1) % 7;
+ if (dec31 == 4 || (dec31 == 5 && __isLeapYear(date.tm_year%400-1))) {
+ val++;
+ }
+ } else if (val == 53) {
+ // If 1 January is not a Thursday, and not a Wednesday of a
+ // leap year, then this year has only 52 weeks.
+ var jan1 = (date.tm_wday + 371 - date.tm_yday) % 7;
+ if (jan1 != 4 && (jan1 != 3 || !__isLeapYear(date.tm_year)))
+ val = 1;
+ }
+ return leadingNulls(val, 2);
+ },
+ '%w': function(date) {
+ return date.tm_wday;
+ },
+ '%W': function(date) {
+ var days = date.tm_yday + 7 - ((date.tm_wday + 6) % 7);
+ return leadingNulls(Math.floor(days / 7), 2);
+ },
+ '%y': function(date) {
+ // Replaced by the last two digits of the year as a decimal number [00,99]. [ tm_year]
+ return (date.tm_year+1900).toString().substring(2);
+ },
+ '%Y': function(date) {
+ // Replaced by the year as a decimal number (for example, 1997). [ tm_year]
+ return date.tm_year+1900;
+ },
+ '%z': function(date) {
+ // Replaced by the offset from UTC in the ISO 8601:2000 standard format ( +hhmm or -hhmm ).
+ // For example, "-0430" means 4 hours 30 minutes behind UTC (west of Greenwich).
+ var off = date.tm_gmtoff;
+ var ahead = off >= 0;
+ off = Math.abs(off) / 60;
+ // convert from minutes into hhmm format (which means 60 minutes = 100 units)
+ off = (off / 60)*100 + (off % 60);
+ return (ahead ? '+' : '-') + String("0000" + off).slice(-4);
+ },
+ '%Z': function(date) {
+ return date.tm_zone;
+ },
+ '%%': function() {
+ return '%';
+ }
+ };
+
+ // Replace %% with a pair of NULLs (which cannot occur in a C string), then
+ // re-inject them after processing.
+ pattern = pattern.replace(/%%/g, '\0\0')
+ for (var rule in EXPANSION_RULES_2) {
+ if (pattern.includes(rule)) {
+ pattern = pattern.replace(new RegExp(rule, 'g'), EXPANSION_RULES_2[rule](date));
+ }
+ }
+ pattern = pattern.replace(/\0\0/g, '%')
+
+ var bytes = intArrayFromString(pattern, false);
+ if (bytes.length > maxsize) {
+ return 0;
+ }
+
+ writeArrayToMemory(bytes, s);
+ return bytes.length-1;
+ }
+
+ function _strftime_l(s, maxsize, format, tm) {
+ return _strftime(s, maxsize, format, tm); // no locale support yet
+ }
+
+
+ var FSNode = /** @constructor */ function(parent, name, mode, rdev) {
+ if (!parent) {
+ parent = this; // root node sets parent to itself
+ }
+ this.parent = parent;
+ this.mount = parent.mount;
+ this.mounted = null;
+ this.id = FS.nextInode++;
+ this.name = name;
+ this.mode = mode;
+ this.node_ops = {};
+ this.stream_ops = {};
+ this.rdev = rdev;
+ };
+ var readMode = 292/*292*/ | 73/*73*/;
+ var writeMode = 146/*146*/;
+ Object.defineProperties(FSNode.prototype, {
+ read: {
+ get: /** @this{FSNode} */function() {
+ return (this.mode & readMode) === readMode;
+ },
+ set: /** @this{FSNode} */function(val) {
+ val ? this.mode |= readMode : this.mode &= ~readMode;
+ }
+ },
+ write: {
+ get: /** @this{FSNode} */function() {
+ return (this.mode & writeMode) === writeMode;
+ },
+ set: /** @this{FSNode} */function(val) {
+ val ? this.mode |= writeMode : this.mode &= ~writeMode;
+ }
+ },
+ isFolder: {
+ get: /** @this{FSNode} */function() {
+ return FS.isDir(this.mode);
+ }
+ },
+ isDevice: {
+ get: /** @this{FSNode} */function() {
+ return FS.isChrdev(this.mode);
+ }
+ }
+ });
+ FS.FSNode = FSNode;
+ FS.staticInit();Module["FS_createPath"] = FS.createPath;Module["FS_createDataFile"] = FS.createDataFile;Module["FS_readFile"] = FS.readFile;Module["FS_createPath"] = FS.createPath;Module["FS_createDataFile"] = FS.createDataFile;Module["FS_createPreloadedFile"] = FS.createPreloadedFile;Module["FS_unlink"] = FS.unlink;Module["FS_createLazyFile"] = FS.createLazyFile;Module["FS_createDevice"] = FS.createDevice;;
+var GLctx;;
+for (var i = 0; i < 32; ++i) tempFixedLengthArray.push(new Array(i));;
+var miniTempWebGLFloatBuffersStorage = new Float32Array(288);
+ for (/**@suppress{duplicate}*/var i = 0; i < 288; ++i) {
+ miniTempWebGLFloatBuffers[i] = miniTempWebGLFloatBuffersStorage.subarray(0, i+1);
+ }
+ ;
+var __miniTempWebGLIntBuffersStorage = new Int32Array(288);
+ for (/**@suppress{duplicate}*/var i = 0; i < 288; ++i) {
+ __miniTempWebGLIntBuffers[i] = __miniTempWebGLIntBuffersStorage.subarray(0, i+1);
+ }
+ ;
+
+ let __dotnet_replacement_PThread = false ? {} : undefined;
+ if (false) {
+ __dotnet_replacement_PThread.loadWasmModuleToWorker = PThread.loadWasmModuleToWorker;
+ __dotnet_replacement_PThread.threadInitTLS = PThread.threadInitTLS;
+ __dotnet_replacement_PThread.allocateUnusedWorker = PThread.allocateUnusedWorker;
+ }
+ let __dotnet_replacements = {scriptUrl: import.meta.url, fetch: globalThis.fetch, require, updateGlobalBufferAndViews, pthreadReplacements: __dotnet_replacement_PThread};
+ if (ENVIRONMENT_IS_NODE) {
+ __dotnet_replacements.requirePromise = import(/* webpackIgnore: true */'module').then(mod => mod.createRequire(import.meta.url));
+ }
+ let __dotnet_exportedAPI = __dotnet_runtime.__initializeImportsAndExports(
+ { isGlobal:false, isNode:ENVIRONMENT_IS_NODE, isWorker:ENVIRONMENT_IS_WORKER, isShell:ENVIRONMENT_IS_SHELL, isWeb:ENVIRONMENT_IS_WEB, isPThread:false, quit_, ExitStatus, requirePromise:__dotnet_replacements.requirePromise },
+ { mono:MONO, binding:BINDING, internal:INTERNAL, module:Module, marshaled_imports: IMPORTS },
+ __dotnet_replacements, __callbackAPI);
+ updateGlobalBufferAndViews = __dotnet_replacements.updateGlobalBufferAndViews;
+ var fetch = __dotnet_replacements.fetch;
+ _scriptDir = __dirname = scriptDirectory = __dotnet_replacements.scriptDirectory;
+ if (ENVIRONMENT_IS_NODE) {
+ __dotnet_replacements.requirePromise.then(someRequire => {
+ require = someRequire;
+ });
+ }
+ var noExitRuntime = __dotnet_replacements.noExitRuntime;
+ if (false) {
+ PThread.loadWasmModuleToWorker = __dotnet_replacements.pthreadReplacements.loadWasmModuleToWorker;
+ PThread.threadInitTLS = __dotnet_replacements.pthreadReplacements.threadInitTLS;
+ PThread.allocateUnusedWorker = __dotnet_replacements.pthreadReplacements.allocateUnusedWorker;
+ }
+ ;
+var ASSERTIONS = false;
+
+
+
+/** @type {function(string, boolean=, number=)} */
+function intArrayFromString(stringy, dontAddNull, length) {
+ var len = length > 0 ? length : lengthBytesUTF8(stringy)+1;
+ var u8array = new Array(len);
+ var numBytesWritten = stringToUTF8Array(stringy, u8array, 0, u8array.length);
+ if (dontAddNull) u8array.length = numBytesWritten;
+ return u8array;
+}
+
+function intArrayToString(array) {
+ var ret = [];
+ for (var i = 0; i < array.length; i++) {
+ var chr = array[i];
+ if (chr > 0xFF) {
+ if (ASSERTIONS) {
+ assert(false, 'Character code ' + chr + ' (' + String.fromCharCode(chr) + ') at offset ' + i + ' not in 0x00-0xFF.');
+ }
+ chr &= 0xFF;
+ }
+ ret.push(String.fromCharCode(chr));
+ }
+ return ret.join('');
+}
+
+
+// Copied from https://github.com/strophe/strophejs/blob/e06d027/src/polyfills.js#L149
+
+// This code was written by Tyler Akins and has been placed in the
+// public domain. It would be nice if you left this header intact.
+// Base64 code from Tyler Akins -- http://rumkin.com
+
+/**
+ * Decodes a base64 string.
+ * @param {string} input The string to decode.
+ */
+var decodeBase64 = typeof atob == 'function' ? atob : function (input) {
+ var keyStr = 'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/=';
+
+ var output = '';
+ var chr1, chr2, chr3;
+ var enc1, enc2, enc3, enc4;
+ var i = 0;
+ // remove all characters that are not A-Z, a-z, 0-9, +, /, or =
+ input = input.replace(/[^A-Za-z0-9\+\/\=]/g, '');
+ do {
+ enc1 = keyStr.indexOf(input.charAt(i++));
+ enc2 = keyStr.indexOf(input.charAt(i++));
+ enc3 = keyStr.indexOf(input.charAt(i++));
+ enc4 = keyStr.indexOf(input.charAt(i++));
+
+ chr1 = (enc1 << 2) | (enc2 >> 4);
+ chr2 = ((enc2 & 15) << 4) | (enc3 >> 2);
+ chr3 = ((enc3 & 3) << 6) | enc4;
+
+ output = output + String.fromCharCode(chr1);
+
+ if (enc3 !== 64) {
+ output = output + String.fromCharCode(chr2);
+ }
+ if (enc4 !== 64) {
+ output = output + String.fromCharCode(chr3);
+ }
+ } while (i < input.length);
+ return output;
+};
+
+// Converts a string of base64 into a byte array.
+// Throws error on invalid input.
+function intArrayFromBase64(s) {
+ if (typeof ENVIRONMENT_IS_NODE == 'boolean' && ENVIRONMENT_IS_NODE) {
+ var buf = Buffer.from(s, 'base64');
+ return new Uint8Array(buf['buffer'], buf['byteOffset'], buf['byteLength']);
+ }
+
+ try {
+ var decoded = decodeBase64(s);
+ var bytes = new Uint8Array(decoded.length);
+ for (var i = 0 ; i < decoded.length ; ++i) {
+ bytes[i] = decoded.charCodeAt(i);
+ }
+ return bytes;
+ } catch (_) {
+ throw new Error('Converting base64 string to bytes failed.');
+ }
+}
+
+// If filename is a base64 data URI, parses and returns data (Buffer on node,
+// Uint8Array otherwise). If filename is not a base64 data URI, returns undefined.
+function tryParseAsDataURI(filename) {
+ if (!isDataURI(filename)) {
+ return;
+ }
+
+ return intArrayFromBase64(filename.slice(dataURIPrefix.length));
+}
+
+
+var asmLibraryArg = {
+ "InterceptGLObject": _InterceptGLObject,
+ "_ZNKSt3__220__vector_base_commonILb1EE20__throw_length_errorEv": __ZNKSt3__220__vector_base_commonILb1EE20__throw_length_errorEv,
+ "__assert_fail": ___assert_fail,
+ "__cxa_allocate_exception": ___cxa_allocate_exception,
+ "__cxa_begin_catch": ___cxa_begin_catch,
+ "__cxa_end_catch": ___cxa_end_catch,
+ "__cxa_find_matching_catch_2": ___cxa_find_matching_catch_2,
+ "__cxa_find_matching_catch_3": ___cxa_find_matching_catch_3,
+ "__cxa_free_exception": ___cxa_free_exception,
+ "__cxa_rethrow": ___cxa_rethrow,
+ "__cxa_throw": ___cxa_throw,
+ "__cxa_uncaught_exceptions": ___cxa_uncaught_exceptions,
+ "__resumeException": ___resumeException,
+ "__syscall_chdir": ___syscall_chdir,
+ "__syscall_chmod": ___syscall_chmod,
+ "__syscall_faccessat": ___syscall_faccessat,
+ "__syscall_fadvise64": ___syscall_fadvise64,
+ "__syscall_fchmod": ___syscall_fchmod,
+ "__syscall_fcntl64": ___syscall_fcntl64,
+ "__syscall_fstat64": ___syscall_fstat64,
+ "__syscall_fstatfs64": ___syscall_fstatfs64,
+ "__syscall_ftruncate64": ___syscall_ftruncate64,
+ "__syscall_getcwd": ___syscall_getcwd,
+ "__syscall_getdents64": ___syscall_getdents64,
+ "__syscall_ioctl": ___syscall_ioctl,
+ "__syscall_lstat64": ___syscall_lstat64,
+ "__syscall_mkdirat": ___syscall_mkdirat,
+ "__syscall_newfstatat": ___syscall_newfstatat,
+ "__syscall_openat": ___syscall_openat,
+ "__syscall_readlinkat": ___syscall_readlinkat,
+ "__syscall_recvfrom": ___syscall_recvfrom,
+ "__syscall_renameat": ___syscall_renameat,
+ "__syscall_rmdir": ___syscall_rmdir,
+ "__syscall_sendto": ___syscall_sendto,
+ "__syscall_stat64": ___syscall_stat64,
+ "__syscall_unlinkat": ___syscall_unlinkat,
+ "__syscall_utimensat": ___syscall_utimensat,
+ "_emscripten_date_now": __emscripten_date_now,
+ "_emscripten_get_now_is_monotonic": __emscripten_get_now_is_monotonic,
+ "_emscripten_throw_longjmp": __emscripten_throw_longjmp,
+ "_localtime_js": __localtime_js,
+ "_mmap_js": __mmap_js,
+ "_msync_js": __msync_js,
+ "_munmap_js": __munmap_js,
+ "_tzset_js": __tzset_js,
+ "abort": _abort,
+ "dotnet_browser_entropy": _dotnet_browser_entropy,
+ "emscripten_get_heap_max": _emscripten_get_heap_max,
+ "emscripten_get_now": _emscripten_get_now,
+ "emscripten_get_now_res": _emscripten_get_now_res,
+ "emscripten_glActiveTexture": _emscripten_glActiveTexture,
+ "emscripten_glAttachShader": _emscripten_glAttachShader,
+ "emscripten_glBeginQueryEXT": _emscripten_glBeginQueryEXT,
+ "emscripten_glBindAttribLocation": _emscripten_glBindAttribLocation,
+ "emscripten_glBindBuffer": _emscripten_glBindBuffer,
+ "emscripten_glBindFramebuffer": _emscripten_glBindFramebuffer,
+ "emscripten_glBindRenderbuffer": _emscripten_glBindRenderbuffer,
+ "emscripten_glBindTexture": _emscripten_glBindTexture,
+ "emscripten_glBindVertexArrayOES": _emscripten_glBindVertexArrayOES,
+ "emscripten_glBlendColor": _emscripten_glBlendColor,
+ "emscripten_glBlendEquation": _emscripten_glBlendEquation,
+ "emscripten_glBlendEquationSeparate": _emscripten_glBlendEquationSeparate,
+ "emscripten_glBlendFunc": _emscripten_glBlendFunc,
+ "emscripten_glBlendFuncSeparate": _emscripten_glBlendFuncSeparate,
+ "emscripten_glBufferData": _emscripten_glBufferData,
+ "emscripten_glBufferSubData": _emscripten_glBufferSubData,
+ "emscripten_glCheckFramebufferStatus": _emscripten_glCheckFramebufferStatus,
+ "emscripten_glClear": _emscripten_glClear,
+ "emscripten_glClearColor": _emscripten_glClearColor,
+ "emscripten_glClearDepthf": _emscripten_glClearDepthf,
+ "emscripten_glClearStencil": _emscripten_glClearStencil,
+ "emscripten_glColorMask": _emscripten_glColorMask,
+ "emscripten_glCompileShader": _emscripten_glCompileShader,
+ "emscripten_glCompressedTexImage2D": _emscripten_glCompressedTexImage2D,
+ "emscripten_glCompressedTexSubImage2D": _emscripten_glCompressedTexSubImage2D,
+ "emscripten_glCopyTexImage2D": _emscripten_glCopyTexImage2D,
+ "emscripten_glCopyTexSubImage2D": _emscripten_glCopyTexSubImage2D,
+ "emscripten_glCreateProgram": _emscripten_glCreateProgram,
+ "emscripten_glCreateShader": _emscripten_glCreateShader,
+ "emscripten_glCullFace": _emscripten_glCullFace,
+ "emscripten_glDeleteBuffers": _emscripten_glDeleteBuffers,
+ "emscripten_glDeleteFramebuffers": _emscripten_glDeleteFramebuffers,
+ "emscripten_glDeleteProgram": _emscripten_glDeleteProgram,
+ "emscripten_glDeleteQueriesEXT": _emscripten_glDeleteQueriesEXT,
+ "emscripten_glDeleteRenderbuffers": _emscripten_glDeleteRenderbuffers,
+ "emscripten_glDeleteShader": _emscripten_glDeleteShader,
+ "emscripten_glDeleteTextures": _emscripten_glDeleteTextures,
+ "emscripten_glDeleteVertexArraysOES": _emscripten_glDeleteVertexArraysOES,
+ "emscripten_glDepthFunc": _emscripten_glDepthFunc,
+ "emscripten_glDepthMask": _emscripten_glDepthMask,
+ "emscripten_glDepthRangef": _emscripten_glDepthRangef,
+ "emscripten_glDetachShader": _emscripten_glDetachShader,
+ "emscripten_glDisable": _emscripten_glDisable,
+ "emscripten_glDisableVertexAttribArray": _emscripten_glDisableVertexAttribArray,
+ "emscripten_glDrawArrays": _emscripten_glDrawArrays,
+ "emscripten_glDrawArraysInstancedANGLE": _emscripten_glDrawArraysInstancedANGLE,
+ "emscripten_glDrawBuffersWEBGL": _emscripten_glDrawBuffersWEBGL,
+ "emscripten_glDrawElements": _emscripten_glDrawElements,
+ "emscripten_glDrawElementsInstancedANGLE": _emscripten_glDrawElementsInstancedANGLE,
+ "emscripten_glEnable": _emscripten_glEnable,
+ "emscripten_glEnableVertexAttribArray": _emscripten_glEnableVertexAttribArray,
+ "emscripten_glEndQueryEXT": _emscripten_glEndQueryEXT,
+ "emscripten_glFinish": _emscripten_glFinish,
+ "emscripten_glFlush": _emscripten_glFlush,
+ "emscripten_glFramebufferRenderbuffer": _emscripten_glFramebufferRenderbuffer,
+ "emscripten_glFramebufferTexture2D": _emscripten_glFramebufferTexture2D,
+ "emscripten_glFrontFace": _emscripten_glFrontFace,
+ "emscripten_glGenBuffers": _emscripten_glGenBuffers,
+ "emscripten_glGenFramebuffers": _emscripten_glGenFramebuffers,
+ "emscripten_glGenQueriesEXT": _emscripten_glGenQueriesEXT,
+ "emscripten_glGenRenderbuffers": _emscripten_glGenRenderbuffers,
+ "emscripten_glGenTextures": _emscripten_glGenTextures,
+ "emscripten_glGenVertexArraysOES": _emscripten_glGenVertexArraysOES,
+ "emscripten_glGenerateMipmap": _emscripten_glGenerateMipmap,
+ "emscripten_glGetActiveAttrib": _emscripten_glGetActiveAttrib,
+ "emscripten_glGetActiveUniform": _emscripten_glGetActiveUniform,
+ "emscripten_glGetAttachedShaders": _emscripten_glGetAttachedShaders,
+ "emscripten_glGetAttribLocation": _emscripten_glGetAttribLocation,
+ "emscripten_glGetBooleanv": _emscripten_glGetBooleanv,
+ "emscripten_glGetBufferParameteriv": _emscripten_glGetBufferParameteriv,
+ "emscripten_glGetError": _emscripten_glGetError,
+ "emscripten_glGetFloatv": _emscripten_glGetFloatv,
+ "emscripten_glGetFramebufferAttachmentParameteriv": _emscripten_glGetFramebufferAttachmentParameteriv,
+ "emscripten_glGetIntegerv": _emscripten_glGetIntegerv,
+ "emscripten_glGetProgramInfoLog": _emscripten_glGetProgramInfoLog,
+ "emscripten_glGetProgramiv": _emscripten_glGetProgramiv,
+ "emscripten_glGetQueryObjecti64vEXT": _emscripten_glGetQueryObjecti64vEXT,
+ "emscripten_glGetQueryObjectivEXT": _emscripten_glGetQueryObjectivEXT,
+ "emscripten_glGetQueryObjectui64vEXT": _emscripten_glGetQueryObjectui64vEXT,
+ "emscripten_glGetQueryObjectuivEXT": _emscripten_glGetQueryObjectuivEXT,
+ "emscripten_glGetQueryivEXT": _emscripten_glGetQueryivEXT,
+ "emscripten_glGetRenderbufferParameteriv": _emscripten_glGetRenderbufferParameteriv,
+ "emscripten_glGetShaderInfoLog": _emscripten_glGetShaderInfoLog,
+ "emscripten_glGetShaderPrecisionFormat": _emscripten_glGetShaderPrecisionFormat,
+ "emscripten_glGetShaderSource": _emscripten_glGetShaderSource,
+ "emscripten_glGetShaderiv": _emscripten_glGetShaderiv,
+ "emscripten_glGetString": _emscripten_glGetString,
+ "emscripten_glGetTexParameterfv": _emscripten_glGetTexParameterfv,
+ "emscripten_glGetTexParameteriv": _emscripten_glGetTexParameteriv,
+ "emscripten_glGetUniformLocation": _emscripten_glGetUniformLocation,
+ "emscripten_glGetUniformfv": _emscripten_glGetUniformfv,
+ "emscripten_glGetUniformiv": _emscripten_glGetUniformiv,
+ "emscripten_glGetVertexAttribPointerv": _emscripten_glGetVertexAttribPointerv,
+ "emscripten_glGetVertexAttribfv": _emscripten_glGetVertexAttribfv,
+ "emscripten_glGetVertexAttribiv": _emscripten_glGetVertexAttribiv,
+ "emscripten_glHint": _emscripten_glHint,
+ "emscripten_glIsBuffer": _emscripten_glIsBuffer,
+ "emscripten_glIsEnabled": _emscripten_glIsEnabled,
+ "emscripten_glIsFramebuffer": _emscripten_glIsFramebuffer,
+ "emscripten_glIsProgram": _emscripten_glIsProgram,
+ "emscripten_glIsQueryEXT": _emscripten_glIsQueryEXT,
+ "emscripten_glIsRenderbuffer": _emscripten_glIsRenderbuffer,
+ "emscripten_glIsShader": _emscripten_glIsShader,
+ "emscripten_glIsTexture": _emscripten_glIsTexture,
+ "emscripten_glIsVertexArrayOES": _emscripten_glIsVertexArrayOES,
+ "emscripten_glLineWidth": _emscripten_glLineWidth,
+ "emscripten_glLinkProgram": _emscripten_glLinkProgram,
+ "emscripten_glPixelStorei": _emscripten_glPixelStorei,
+ "emscripten_glPolygonOffset": _emscripten_glPolygonOffset,
+ "emscripten_glQueryCounterEXT": _emscripten_glQueryCounterEXT,
+ "emscripten_glReadPixels": _emscripten_glReadPixels,
+ "emscripten_glReleaseShaderCompiler": _emscripten_glReleaseShaderCompiler,
+ "emscripten_glRenderbufferStorage": _emscripten_glRenderbufferStorage,
+ "emscripten_glSampleCoverage": _emscripten_glSampleCoverage,
+ "emscripten_glScissor": _emscripten_glScissor,
+ "emscripten_glShaderBinary": _emscripten_glShaderBinary,
+ "emscripten_glShaderSource": _emscripten_glShaderSource,
+ "emscripten_glStencilFunc": _emscripten_glStencilFunc,
+ "emscripten_glStencilFuncSeparate": _emscripten_glStencilFuncSeparate,
+ "emscripten_glStencilMask": _emscripten_glStencilMask,
+ "emscripten_glStencilMaskSeparate": _emscripten_glStencilMaskSeparate,
+ "emscripten_glStencilOp": _emscripten_glStencilOp,
+ "emscripten_glStencilOpSeparate": _emscripten_glStencilOpSeparate,
+ "emscripten_glTexImage2D": _emscripten_glTexImage2D,
+ "emscripten_glTexParameterf": _emscripten_glTexParameterf,
+ "emscripten_glTexParameterfv": _emscripten_glTexParameterfv,
+ "emscripten_glTexParameteri": _emscripten_glTexParameteri,
+ "emscripten_glTexParameteriv": _emscripten_glTexParameteriv,
+ "emscripten_glTexSubImage2D": _emscripten_glTexSubImage2D,
+ "emscripten_glUniform1f": _emscripten_glUniform1f,
+ "emscripten_glUniform1fv": _emscripten_glUniform1fv,
+ "emscripten_glUniform1i": _emscripten_glUniform1i,
+ "emscripten_glUniform1iv": _emscripten_glUniform1iv,
+ "emscripten_glUniform2f": _emscripten_glUniform2f,
+ "emscripten_glUniform2fv": _emscripten_glUniform2fv,
+ "emscripten_glUniform2i": _emscripten_glUniform2i,
+ "emscripten_glUniform2iv": _emscripten_glUniform2iv,
+ "emscripten_glUniform3f": _emscripten_glUniform3f,
+ "emscripten_glUniform3fv": _emscripten_glUniform3fv,
+ "emscripten_glUniform3i": _emscripten_glUniform3i,
+ "emscripten_glUniform3iv": _emscripten_glUniform3iv,
+ "emscripten_glUniform4f": _emscripten_glUniform4f,
+ "emscripten_glUniform4fv": _emscripten_glUniform4fv,
+ "emscripten_glUniform4i": _emscripten_glUniform4i,
+ "emscripten_glUniform4iv": _emscripten_glUniform4iv,
+ "emscripten_glUniformMatrix2fv": _emscripten_glUniformMatrix2fv,
+ "emscripten_glUniformMatrix3fv": _emscripten_glUniformMatrix3fv,
+ "emscripten_glUniformMatrix4fv": _emscripten_glUniformMatrix4fv,
+ "emscripten_glUseProgram": _emscripten_glUseProgram,
+ "emscripten_glValidateProgram": _emscripten_glValidateProgram,
+ "emscripten_glVertexAttrib1f": _emscripten_glVertexAttrib1f,
+ "emscripten_glVertexAttrib1fv": _emscripten_glVertexAttrib1fv,
+ "emscripten_glVertexAttrib2f": _emscripten_glVertexAttrib2f,
+ "emscripten_glVertexAttrib2fv": _emscripten_glVertexAttrib2fv,
+ "emscripten_glVertexAttrib3f": _emscripten_glVertexAttrib3f,
+ "emscripten_glVertexAttrib3fv": _emscripten_glVertexAttrib3fv,
+ "emscripten_glVertexAttrib4f": _emscripten_glVertexAttrib4f,
+ "emscripten_glVertexAttrib4fv": _emscripten_glVertexAttrib4fv,
+ "emscripten_glVertexAttribDivisorANGLE": _emscripten_glVertexAttribDivisorANGLE,
+ "emscripten_glVertexAttribPointer": _emscripten_glVertexAttribPointer,
+ "emscripten_glViewport": _emscripten_glViewport,
+ "emscripten_memcpy_big": _emscripten_memcpy_big,
+ "emscripten_resize_heap": _emscripten_resize_heap,
+ "environ_get": _environ_get,
+ "environ_sizes_get": _environ_sizes_get,
+ "exit": _exit,
+ "fd_close": _fd_close,
+ "fd_fdstat_get": _fd_fdstat_get,
+ "fd_pread": _fd_pread,
+ "fd_pwrite": _fd_pwrite,
+ "fd_read": _fd_read,
+ "fd_seek": _fd_seek,
+ "fd_sync": _fd_sync,
+ "fd_write": _fd_write,
+ "getTempRet0": _getTempRet0,
+ "invoke_diii": invoke_diii,
+ "invoke_fiii": invoke_fiii,
+ "invoke_i": invoke_i,
+ "invoke_ii": invoke_ii,
+ "invoke_iii": invoke_iii,
+ "invoke_iiii": invoke_iiii,
+ "invoke_iiiii": invoke_iiiii,
+ "invoke_iiiiid": invoke_iiiiid,
+ "invoke_iiiiii": invoke_iiiiii,
+ "invoke_iiiiiii": invoke_iiiiiii,
+ "invoke_iiiiiiii": invoke_iiiiiiii,
+ "invoke_iiiiiiiiii": invoke_iiiiiiiiii,
+ "invoke_iiiiiiiiiii": invoke_iiiiiiiiiii,
+ "invoke_iiiiiiiiiiii": invoke_iiiiiiiiiiii,
+ "invoke_iiiiiiiiiiiii": invoke_iiiiiiiiiiiii,
+ "invoke_iiiiij": invoke_iiiiij,
+ "invoke_j": invoke_j,
+ "invoke_jiiii": invoke_jiiii,
+ "invoke_v": invoke_v,
+ "invoke_vi": invoke_vi,
+ "invoke_vii": invoke_vii,
+ "invoke_viii": invoke_viii,
+ "invoke_viiii": invoke_viiii,
+ "invoke_viiiii": invoke_viiiii,
+ "invoke_viiiiii": invoke_viiiiii,
+ "invoke_viiiiiii": invoke_viiiiiii,
+ "invoke_viiiiiiiii": invoke_viiiiiiiii,
+ "invoke_viiiiiiiiii": invoke_viiiiiiiiii,
+ "invoke_viiiiiiiiiiiiiii": invoke_viiiiiiiiiiiiiii,
+ "llvm_eh_typeid_for": _llvm_eh_typeid_for,
+ "mono_set_timeout": _mono_set_timeout,
+ "mono_wasm_add_dbg_command_received": _mono_wasm_add_dbg_command_received,
+ "mono_wasm_asm_loaded": _mono_wasm_asm_loaded,
+ "mono_wasm_bind_cs_function": _mono_wasm_bind_cs_function,
+ "mono_wasm_bind_js_function": _mono_wasm_bind_js_function,
+ "mono_wasm_create_cs_owned_object_ref": _mono_wasm_create_cs_owned_object_ref,
+ "mono_wasm_debugger_log": _mono_wasm_debugger_log,
+ "mono_wasm_fire_debugger_agent_message": _mono_wasm_fire_debugger_agent_message,
+ "mono_wasm_get_by_index_ref": _mono_wasm_get_by_index_ref,
+ "mono_wasm_get_global_object_ref": _mono_wasm_get_global_object_ref,
+ "mono_wasm_get_object_property_ref": _mono_wasm_get_object_property_ref,
+ "mono_wasm_invoke_bound_function": _mono_wasm_invoke_bound_function,
+ "mono_wasm_invoke_js_blazor": _mono_wasm_invoke_js_blazor,
+ "mono_wasm_invoke_js_with_args_ref": _mono_wasm_invoke_js_with_args_ref,
+ "mono_wasm_marshal_promise": _mono_wasm_marshal_promise,
+ "mono_wasm_release_cs_owned_object": _mono_wasm_release_cs_owned_object,
+ "mono_wasm_set_by_index_ref": _mono_wasm_set_by_index_ref,
+ "mono_wasm_set_entrypoint_breakpoint": _mono_wasm_set_entrypoint_breakpoint,
+ "mono_wasm_set_object_property_ref": _mono_wasm_set_object_property_ref,
+ "mono_wasm_trace_logger": _mono_wasm_trace_logger,
+ "mono_wasm_typed_array_from_ref": _mono_wasm_typed_array_from_ref,
+ "mono_wasm_typed_array_to_array_ref": _mono_wasm_typed_array_to_array_ref,
+ "schedule_background_exec": _schedule_background_exec,
+ "setTempRet0": _setTempRet0,
+ "strftime": _strftime,
+ "strftime_l": _strftime_l
+};
+var asm = createWasm();
+/** @type {function(...*):?} */
+var ___wasm_call_ctors = Module["___wasm_call_ctors"] = function() {
+ return (___wasm_call_ctors = Module["___wasm_call_ctors"] = Module["asm"]["__wasm_call_ctors"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var _memset = Module["_memset"] = function() {
+ return (_memset = Module["_memset"] = Module["asm"]["memset"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var _malloc = Module["_malloc"] = function() {
+ return (_malloc = Module["_malloc"] = Module["asm"]["malloc"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var _free = Module["_free"] = function() {
+ return (_free = Module["_free"] = Module["asm"]["free"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var ___errno_location = Module["___errno_location"] = function() {
+ return (___errno_location = Module["___errno_location"] = Module["asm"]["__errno_location"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var _saveSetjmp = Module["_saveSetjmp"] = function() {
+ return (_saveSetjmp = Module["_saveSetjmp"] = Module["asm"]["saveSetjmp"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var _mono_wasm_register_root = Module["_mono_wasm_register_root"] = function() {
+ return (_mono_wasm_register_root = Module["_mono_wasm_register_root"] = Module["asm"]["mono_wasm_register_root"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var _mono_wasm_deregister_root = Module["_mono_wasm_deregister_root"] = function() {
+ return (_mono_wasm_deregister_root = Module["_mono_wasm_deregister_root"] = Module["asm"]["mono_wasm_deregister_root"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var _mono_wasm_add_assembly = Module["_mono_wasm_add_assembly"] = function() {
+ return (_mono_wasm_add_assembly = Module["_mono_wasm_add_assembly"] = Module["asm"]["mono_wasm_add_assembly"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var _mono_wasm_add_satellite_assembly = Module["_mono_wasm_add_satellite_assembly"] = function() {
+ return (_mono_wasm_add_satellite_assembly = Module["_mono_wasm_add_satellite_assembly"] = Module["asm"]["mono_wasm_add_satellite_assembly"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var _mono_wasm_setenv = Module["_mono_wasm_setenv"] = function() {
+ return (_mono_wasm_setenv = Module["_mono_wasm_setenv"] = Module["asm"]["mono_wasm_setenv"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var _mono_wasm_getenv = Module["_mono_wasm_getenv"] = function() {
+ return (_mono_wasm_getenv = Module["_mono_wasm_getenv"] = Module["asm"]["mono_wasm_getenv"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var _mono_wasm_register_bundled_satellite_assemblies = Module["_mono_wasm_register_bundled_satellite_assemblies"] = function() {
+ return (_mono_wasm_register_bundled_satellite_assemblies = Module["_mono_wasm_register_bundled_satellite_assemblies"] = Module["asm"]["mono_wasm_register_bundled_satellite_assemblies"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var _mono_wasm_load_runtime = Module["_mono_wasm_load_runtime"] = function() {
+ return (_mono_wasm_load_runtime = Module["_mono_wasm_load_runtime"] = Module["asm"]["mono_wasm_load_runtime"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var _mono_wasm_assembly_load = Module["_mono_wasm_assembly_load"] = function() {
+ return (_mono_wasm_assembly_load = Module["_mono_wasm_assembly_load"] = Module["asm"]["mono_wasm_assembly_load"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var _mono_wasm_get_corlib = Module["_mono_wasm_get_corlib"] = function() {
+ return (_mono_wasm_get_corlib = Module["_mono_wasm_get_corlib"] = Module["asm"]["mono_wasm_get_corlib"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var _mono_wasm_assembly_find_class = Module["_mono_wasm_assembly_find_class"] = function() {
+ return (_mono_wasm_assembly_find_class = Module["_mono_wasm_assembly_find_class"] = Module["asm"]["mono_wasm_assembly_find_class"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var _mono_wasm_runtime_run_module_cctor = Module["_mono_wasm_runtime_run_module_cctor"] = function() {
+ return (_mono_wasm_runtime_run_module_cctor = Module["_mono_wasm_runtime_run_module_cctor"] = Module["asm"]["mono_wasm_runtime_run_module_cctor"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var _mono_wasm_assembly_find_method = Module["_mono_wasm_assembly_find_method"] = function() {
+ return (_mono_wasm_assembly_find_method = Module["_mono_wasm_assembly_find_method"] = Module["asm"]["mono_wasm_assembly_find_method"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var _mono_wasm_get_delegate_invoke_ref = Module["_mono_wasm_get_delegate_invoke_ref"] = function() {
+ return (_mono_wasm_get_delegate_invoke_ref = Module["_mono_wasm_get_delegate_invoke_ref"] = Module["asm"]["mono_wasm_get_delegate_invoke_ref"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var _mono_wasm_box_primitive_ref = Module["_mono_wasm_box_primitive_ref"] = function() {
+ return (_mono_wasm_box_primitive_ref = Module["_mono_wasm_box_primitive_ref"] = Module["asm"]["mono_wasm_box_primitive_ref"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var _mono_wasm_invoke_method_ref = Module["_mono_wasm_invoke_method_ref"] = function() {
+ return (_mono_wasm_invoke_method_ref = Module["_mono_wasm_invoke_method_ref"] = Module["asm"]["mono_wasm_invoke_method_ref"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var _mono_wasm_invoke_method_bound = Module["_mono_wasm_invoke_method_bound"] = function() {
+ return (_mono_wasm_invoke_method_bound = Module["_mono_wasm_invoke_method_bound"] = Module["asm"]["mono_wasm_invoke_method_bound"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var _mono_wasm_assembly_get_entry_point = Module["_mono_wasm_assembly_get_entry_point"] = function() {
+ return (_mono_wasm_assembly_get_entry_point = Module["_mono_wasm_assembly_get_entry_point"] = Module["asm"]["mono_wasm_assembly_get_entry_point"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var _mono_wasm_string_get_utf8 = Module["_mono_wasm_string_get_utf8"] = function() {
+ return (_mono_wasm_string_get_utf8 = Module["_mono_wasm_string_get_utf8"] = Module["asm"]["mono_wasm_string_get_utf8"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var _mono_wasm_string_from_js = Module["_mono_wasm_string_from_js"] = function() {
+ return (_mono_wasm_string_from_js = Module["_mono_wasm_string_from_js"] = Module["asm"]["mono_wasm_string_from_js"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var _mono_wasm_string_from_utf16_ref = Module["_mono_wasm_string_from_utf16_ref"] = function() {
+ return (_mono_wasm_string_from_utf16_ref = Module["_mono_wasm_string_from_utf16_ref"] = Module["asm"]["mono_wasm_string_from_utf16_ref"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var _mono_wasm_get_obj_class = Module["_mono_wasm_get_obj_class"] = function() {
+ return (_mono_wasm_get_obj_class = Module["_mono_wasm_get_obj_class"] = Module["asm"]["mono_wasm_get_obj_class"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var _mono_wasm_get_obj_type = Module["_mono_wasm_get_obj_type"] = function() {
+ return (_mono_wasm_get_obj_type = Module["_mono_wasm_get_obj_type"] = Module["asm"]["mono_wasm_get_obj_type"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var _mono_wasm_try_unbox_primitive_and_get_type_ref = Module["_mono_wasm_try_unbox_primitive_and_get_type_ref"] = function() {
+ return (_mono_wasm_try_unbox_primitive_and_get_type_ref = Module["_mono_wasm_try_unbox_primitive_and_get_type_ref"] = Module["asm"]["mono_wasm_try_unbox_primitive_and_get_type_ref"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var _mono_wasm_array_length = Module["_mono_wasm_array_length"] = function() {
+ return (_mono_wasm_array_length = Module["_mono_wasm_array_length"] = Module["asm"]["mono_wasm_array_length"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var _mono_wasm_array_get = Module["_mono_wasm_array_get"] = function() {
+ return (_mono_wasm_array_get = Module["_mono_wasm_array_get"] = Module["asm"]["mono_wasm_array_get"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var _mono_wasm_array_get_ref = Module["_mono_wasm_array_get_ref"] = function() {
+ return (_mono_wasm_array_get_ref = Module["_mono_wasm_array_get_ref"] = Module["asm"]["mono_wasm_array_get_ref"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var _mono_wasm_obj_array_new_ref = Module["_mono_wasm_obj_array_new_ref"] = function() {
+ return (_mono_wasm_obj_array_new_ref = Module["_mono_wasm_obj_array_new_ref"] = Module["asm"]["mono_wasm_obj_array_new_ref"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var _mono_wasm_obj_array_new = Module["_mono_wasm_obj_array_new"] = function() {
+ return (_mono_wasm_obj_array_new = Module["_mono_wasm_obj_array_new"] = Module["asm"]["mono_wasm_obj_array_new"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var _mono_wasm_obj_array_set = Module["_mono_wasm_obj_array_set"] = function() {
+ return (_mono_wasm_obj_array_set = Module["_mono_wasm_obj_array_set"] = Module["asm"]["mono_wasm_obj_array_set"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var _mono_wasm_obj_array_set_ref = Module["_mono_wasm_obj_array_set_ref"] = function() {
+ return (_mono_wasm_obj_array_set_ref = Module["_mono_wasm_obj_array_set_ref"] = Module["asm"]["mono_wasm_obj_array_set_ref"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var _mono_wasm_string_array_new_ref = Module["_mono_wasm_string_array_new_ref"] = function() {
+ return (_mono_wasm_string_array_new_ref = Module["_mono_wasm_string_array_new_ref"] = Module["asm"]["mono_wasm_string_array_new_ref"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var _mono_wasm_exec_regression = Module["_mono_wasm_exec_regression"] = function() {
+ return (_mono_wasm_exec_regression = Module["_mono_wasm_exec_regression"] = Module["asm"]["mono_wasm_exec_regression"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var _mono_wasm_exit = Module["_mono_wasm_exit"] = function() {
+ return (_mono_wasm_exit = Module["_mono_wasm_exit"] = Module["asm"]["mono_wasm_exit"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var _mono_wasm_set_main_args = Module["_mono_wasm_set_main_args"] = function() {
+ return (_mono_wasm_set_main_args = Module["_mono_wasm_set_main_args"] = Module["asm"]["mono_wasm_set_main_args"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var _mono_wasm_strdup = Module["_mono_wasm_strdup"] = function() {
+ return (_mono_wasm_strdup = Module["_mono_wasm_strdup"] = Module["asm"]["mono_wasm_strdup"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var _mono_wasm_parse_runtime_options = Module["_mono_wasm_parse_runtime_options"] = function() {
+ return (_mono_wasm_parse_runtime_options = Module["_mono_wasm_parse_runtime_options"] = Module["asm"]["mono_wasm_parse_runtime_options"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var _mono_wasm_enable_on_demand_gc = Module["_mono_wasm_enable_on_demand_gc"] = function() {
+ return (_mono_wasm_enable_on_demand_gc = Module["_mono_wasm_enable_on_demand_gc"] = Module["asm"]["mono_wasm_enable_on_demand_gc"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var _mono_wasm_intern_string_ref = Module["_mono_wasm_intern_string_ref"] = function() {
+ return (_mono_wasm_intern_string_ref = Module["_mono_wasm_intern_string_ref"] = Module["asm"]["mono_wasm_intern_string_ref"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var _mono_wasm_string_get_data_ref = Module["_mono_wasm_string_get_data_ref"] = function() {
+ return (_mono_wasm_string_get_data_ref = Module["_mono_wasm_string_get_data_ref"] = Module["asm"]["mono_wasm_string_get_data_ref"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var _mono_wasm_string_get_data = Module["_mono_wasm_string_get_data"] = function() {
+ return (_mono_wasm_string_get_data = Module["_mono_wasm_string_get_data"] = Module["asm"]["mono_wasm_string_get_data"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var _mono_wasm_class_get_type = Module["_mono_wasm_class_get_type"] = function() {
+ return (_mono_wasm_class_get_type = Module["_mono_wasm_class_get_type"] = Module["asm"]["mono_wasm_class_get_type"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var _mono_wasm_type_get_class = Module["_mono_wasm_type_get_class"] = function() {
+ return (_mono_wasm_type_get_class = Module["_mono_wasm_type_get_class"] = Module["asm"]["mono_wasm_type_get_class"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var _mono_wasm_get_type_name = Module["_mono_wasm_get_type_name"] = function() {
+ return (_mono_wasm_get_type_name = Module["_mono_wasm_get_type_name"] = Module["asm"]["mono_wasm_get_type_name"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var _mono_wasm_get_type_aqn = Module["_mono_wasm_get_type_aqn"] = function() {
+ return (_mono_wasm_get_type_aqn = Module["_mono_wasm_get_type_aqn"] = Module["asm"]["mono_wasm_get_type_aqn"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var _mono_wasm_write_managed_pointer_unsafe = Module["_mono_wasm_write_managed_pointer_unsafe"] = function() {
+ return (_mono_wasm_write_managed_pointer_unsafe = Module["_mono_wasm_write_managed_pointer_unsafe"] = Module["asm"]["mono_wasm_write_managed_pointer_unsafe"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var _mono_wasm_copy_managed_pointer = Module["_mono_wasm_copy_managed_pointer"] = function() {
+ return (_mono_wasm_copy_managed_pointer = Module["_mono_wasm_copy_managed_pointer"] = Module["asm"]["mono_wasm_copy_managed_pointer"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var _mono_wasm_i52_to_f64 = Module["_mono_wasm_i52_to_f64"] = function() {
+ return (_mono_wasm_i52_to_f64 = Module["_mono_wasm_i52_to_f64"] = Module["asm"]["mono_wasm_i52_to_f64"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var _mono_wasm_u52_to_f64 = Module["_mono_wasm_u52_to_f64"] = function() {
+ return (_mono_wasm_u52_to_f64 = Module["_mono_wasm_u52_to_f64"] = Module["asm"]["mono_wasm_u52_to_f64"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var _mono_wasm_f64_to_u52 = Module["_mono_wasm_f64_to_u52"] = function() {
+ return (_mono_wasm_f64_to_u52 = Module["_mono_wasm_f64_to_u52"] = Module["asm"]["mono_wasm_f64_to_u52"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var _mono_wasm_f64_to_i52 = Module["_mono_wasm_f64_to_i52"] = function() {
+ return (_mono_wasm_f64_to_i52 = Module["_mono_wasm_f64_to_i52"] = Module["asm"]["mono_wasm_f64_to_i52"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var _mono_wasm_typed_array_new_ref = Module["_mono_wasm_typed_array_new_ref"] = function() {
+ return (_mono_wasm_typed_array_new_ref = Module["_mono_wasm_typed_array_new_ref"] = Module["asm"]["mono_wasm_typed_array_new_ref"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var _mono_wasm_unbox_enum = Module["_mono_wasm_unbox_enum"] = function() {
+ return (_mono_wasm_unbox_enum = Module["_mono_wasm_unbox_enum"] = Module["asm"]["mono_wasm_unbox_enum"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var _mono_wasm_set_is_debugger_attached = Module["_mono_wasm_set_is_debugger_attached"] = function() {
+ return (_mono_wasm_set_is_debugger_attached = Module["_mono_wasm_set_is_debugger_attached"] = Module["asm"]["mono_wasm_set_is_debugger_attached"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var _mono_wasm_change_debugger_log_level = Module["_mono_wasm_change_debugger_log_level"] = function() {
+ return (_mono_wasm_change_debugger_log_level = Module["_mono_wasm_change_debugger_log_level"] = Module["asm"]["mono_wasm_change_debugger_log_level"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var _mono_wasm_send_dbg_command_with_parms = Module["_mono_wasm_send_dbg_command_with_parms"] = function() {
+ return (_mono_wasm_send_dbg_command_with_parms = Module["_mono_wasm_send_dbg_command_with_parms"] = Module["asm"]["mono_wasm_send_dbg_command_with_parms"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var _mono_wasm_send_dbg_command = Module["_mono_wasm_send_dbg_command"] = function() {
+ return (_mono_wasm_send_dbg_command = Module["_mono_wasm_send_dbg_command"] = Module["asm"]["mono_wasm_send_dbg_command"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var _mono_wasm_event_pipe_enable = Module["_mono_wasm_event_pipe_enable"] = function() {
+ return (_mono_wasm_event_pipe_enable = Module["_mono_wasm_event_pipe_enable"] = Module["asm"]["mono_wasm_event_pipe_enable"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var _mono_wasm_event_pipe_session_start_streaming = Module["_mono_wasm_event_pipe_session_start_streaming"] = function() {
+ return (_mono_wasm_event_pipe_session_start_streaming = Module["_mono_wasm_event_pipe_session_start_streaming"] = Module["asm"]["mono_wasm_event_pipe_session_start_streaming"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var _mono_wasm_event_pipe_session_disable = Module["_mono_wasm_event_pipe_session_disable"] = function() {
+ return (_mono_wasm_event_pipe_session_disable = Module["_mono_wasm_event_pipe_session_disable"] = Module["asm"]["mono_wasm_event_pipe_session_disable"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var _mono_background_exec = Module["_mono_background_exec"] = function() {
+ return (_mono_background_exec = Module["_mono_background_exec"] = Module["asm"]["mono_background_exec"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var _mono_wasm_get_icudt_name = Module["_mono_wasm_get_icudt_name"] = function() {
+ return (_mono_wasm_get_icudt_name = Module["_mono_wasm_get_icudt_name"] = Module["asm"]["mono_wasm_get_icudt_name"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var _mono_wasm_load_icu_data = Module["_mono_wasm_load_icu_data"] = function() {
+ return (_mono_wasm_load_icu_data = Module["_mono_wasm_load_icu_data"] = Module["asm"]["mono_wasm_load_icu_data"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var _mono_print_method_from_ip = Module["_mono_print_method_from_ip"] = function() {
+ return (_mono_print_method_from_ip = Module["_mono_print_method_from_ip"] = Module["asm"]["mono_print_method_from_ip"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var _mono_set_timeout_exec = Module["_mono_set_timeout_exec"] = function() {
+ return (_mono_set_timeout_exec = Module["_mono_set_timeout_exec"] = Module["asm"]["mono_set_timeout_exec"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var ___dl_seterr = Module["___dl_seterr"] = function() {
+ return (___dl_seterr = Module["___dl_seterr"] = Module["asm"]["__dl_seterr"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var _htonl = Module["_htonl"] = function() {
+ return (_htonl = Module["_htonl"] = Module["asm"]["htonl"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var _htons = Module["_htons"] = function() {
+ return (_htons = Module["_htons"] = Module["asm"]["htons"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var _emscripten_builtin_memalign = Module["_emscripten_builtin_memalign"] = function() {
+ return (_emscripten_builtin_memalign = Module["_emscripten_builtin_memalign"] = Module["asm"]["emscripten_builtin_memalign"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var _ntohs = Module["_ntohs"] = function() {
+ return (_ntohs = Module["_ntohs"] = Module["asm"]["ntohs"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var _memalign = Module["_memalign"] = function() {
+ return (_memalign = Module["_memalign"] = Module["asm"]["memalign"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var _setThrew = Module["_setThrew"] = function() {
+ return (_setThrew = Module["_setThrew"] = Module["asm"]["setThrew"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var stackSave = Module["stackSave"] = function() {
+ return (stackSave = Module["stackSave"] = Module["asm"]["stackSave"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var stackRestore = Module["stackRestore"] = function() {
+ return (stackRestore = Module["stackRestore"] = Module["asm"]["stackRestore"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var stackAlloc = Module["stackAlloc"] = function() {
+ return (stackAlloc = Module["stackAlloc"] = Module["asm"]["stackAlloc"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var ___cxa_can_catch = Module["___cxa_can_catch"] = function() {
+ return (___cxa_can_catch = Module["___cxa_can_catch"] = Module["asm"]["__cxa_can_catch"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var ___cxa_is_pointer_type = Module["___cxa_is_pointer_type"] = function() {
+ return (___cxa_is_pointer_type = Module["___cxa_is_pointer_type"] = Module["asm"]["__cxa_is_pointer_type"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var dynCall_viji = Module["dynCall_viji"] = function() {
+ return (dynCall_viji = Module["dynCall_viji"] = Module["asm"]["dynCall_viji"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var dynCall_vijiii = Module["dynCall_vijiii"] = function() {
+ return (dynCall_vijiii = Module["dynCall_vijiii"] = Module["asm"]["dynCall_vijiii"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var dynCall_jiiiijiiiii = Module["dynCall_jiiiijiiiii"] = function() {
+ return (dynCall_jiiiijiiiii = Module["dynCall_jiiiijiiiii"] = Module["asm"]["dynCall_jiiiijiiiii"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var dynCall_viiij = Module["dynCall_viiij"] = function() {
+ return (dynCall_viiij = Module["dynCall_viiij"] = Module["asm"]["dynCall_viiij"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var dynCall_jiiiiii = Module["dynCall_jiiiiii"] = function() {
+ return (dynCall_jiiiiii = Module["dynCall_jiiiiii"] = Module["asm"]["dynCall_jiiiiii"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var dynCall_ji = Module["dynCall_ji"] = function() {
+ return (dynCall_ji = Module["dynCall_ji"] = Module["asm"]["dynCall_ji"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var dynCall_iijj = Module["dynCall_iijj"] = function() {
+ return (dynCall_iijj = Module["dynCall_iijj"] = Module["asm"]["dynCall_iijj"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var dynCall_viiiiij = Module["dynCall_viiiiij"] = function() {
+ return (dynCall_viiiiij = Module["dynCall_viiiiij"] = Module["asm"]["dynCall_viiiiij"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var dynCall_iiiij = Module["dynCall_iiiij"] = function() {
+ return (dynCall_iiiij = Module["dynCall_iiiij"] = Module["asm"]["dynCall_iiiij"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var dynCall_jii = Module["dynCall_jii"] = function() {
+ return (dynCall_jii = Module["dynCall_jii"] = Module["asm"]["dynCall_jii"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var dynCall_iij = Module["dynCall_iij"] = function() {
+ return (dynCall_iij = Module["dynCall_iij"] = Module["asm"]["dynCall_iij"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var dynCall_vij = Module["dynCall_vij"] = function() {
+ return (dynCall_vij = Module["dynCall_vij"] = Module["asm"]["dynCall_vij"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var dynCall_jiiiii = Module["dynCall_jiiiii"] = function() {
+ return (dynCall_jiiiii = Module["dynCall_jiiiii"] = Module["asm"]["dynCall_jiiiii"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var dynCall_jiiiiiiiii = Module["dynCall_jiiiiiiiii"] = function() {
+ return (dynCall_jiiiiiiiii = Module["dynCall_jiiiiiiiii"] = Module["asm"]["dynCall_jiiiiiiiii"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var dynCall_vj = Module["dynCall_vj"] = function() {
+ return (dynCall_vj = Module["dynCall_vj"] = Module["asm"]["dynCall_vj"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var dynCall_iji = Module["dynCall_iji"] = function() {
+ return (dynCall_iji = Module["dynCall_iji"] = Module["asm"]["dynCall_iji"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var dynCall_ij = Module["dynCall_ij"] = function() {
+ return (dynCall_ij = Module["dynCall_ij"] = Module["asm"]["dynCall_ij"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var dynCall_jj = Module["dynCall_jj"] = function() {
+ return (dynCall_jj = Module["dynCall_jj"] = Module["asm"]["dynCall_jj"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var dynCall_iiijiiiii = Module["dynCall_iiijiiiii"] = function() {
+ return (dynCall_iiijiiiii = Module["dynCall_iiijiiiii"] = Module["asm"]["dynCall_iiijiiiii"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var dynCall_j = Module["dynCall_j"] = function() {
+ return (dynCall_j = Module["dynCall_j"] = Module["asm"]["dynCall_j"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var dynCall_iiji = Module["dynCall_iiji"] = function() {
+ return (dynCall_iiji = Module["dynCall_iiji"] = Module["asm"]["dynCall_iiji"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var dynCall_iijjiii = Module["dynCall_iijjiii"] = function() {
+ return (dynCall_iijjiii = Module["dynCall_iijjiii"] = Module["asm"]["dynCall_iijjiii"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var dynCall_vijjjii = Module["dynCall_vijjjii"] = function() {
+ return (dynCall_vijjjii = Module["dynCall_vijjjii"] = Module["asm"]["dynCall_vijjjii"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var dynCall_iijii = Module["dynCall_iijii"] = function() {
+ return (dynCall_iijii = Module["dynCall_iijii"] = Module["asm"]["dynCall_iijii"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var dynCall_iijiii = Module["dynCall_iijiii"] = function() {
+ return (dynCall_iijiii = Module["dynCall_iijiii"] = Module["asm"]["dynCall_iijiii"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var dynCall_vijiiii = Module["dynCall_vijiiii"] = function() {
+ return (dynCall_vijiiii = Module["dynCall_vijiiii"] = Module["asm"]["dynCall_vijiiii"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var dynCall_jij = Module["dynCall_jij"] = function() {
+ return (dynCall_jij = Module["dynCall_jij"] = Module["asm"]["dynCall_jij"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var dynCall_iijiiii = Module["dynCall_iijiiii"] = function() {
+ return (dynCall_iijiiii = Module["dynCall_iijiiii"] = Module["asm"]["dynCall_iijiiii"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var dynCall_jd = Module["dynCall_jd"] = function() {
+ return (dynCall_jd = Module["dynCall_jd"] = Module["asm"]["dynCall_jd"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var dynCall_jf = Module["dynCall_jf"] = function() {
+ return (dynCall_jf = Module["dynCall_jf"] = Module["asm"]["dynCall_jf"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var dynCall_jiji = Module["dynCall_jiji"] = function() {
+ return (dynCall_jiji = Module["dynCall_jiji"] = Module["asm"]["dynCall_jiji"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var dynCall_iiiiij = Module["dynCall_iiiiij"] = function() {
+ return (dynCall_iiiiij = Module["dynCall_iiiiij"] = Module["asm"]["dynCall_iiiiij"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var dynCall_viijii = Module["dynCall_viijii"] = function() {
+ return (dynCall_viijii = Module["dynCall_viijii"] = Module["asm"]["dynCall_viijii"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var dynCall_jiiii = Module["dynCall_jiiii"] = function() {
+ return (dynCall_jiiii = Module["dynCall_jiiii"] = Module["asm"]["dynCall_jiiii"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var dynCall_iiiiijj = Module["dynCall_iiiiijj"] = function() {
+ return (dynCall_iiiiijj = Module["dynCall_iiiiijj"] = Module["asm"]["dynCall_iiiiijj"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var dynCall_iiiiiijj = Module["dynCall_iiiiiijj"] = function() {
+ return (dynCall_iiiiiijj = Module["dynCall_iiiiiijj"] = Module["asm"]["dynCall_iiiiiijj"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var dynCall_iiij = Module["dynCall_iiij"] = function() {
+ return (dynCall_iiij = Module["dynCall_iiij"] = Module["asm"]["dynCall_iiij"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var dynCall_iijiiij = Module["dynCall_iijiiij"] = function() {
+ return (dynCall_iijiiij = Module["dynCall_iijiiij"] = Module["asm"]["dynCall_iijiiij"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var dynCall_iijji = Module["dynCall_iijji"] = function() {
+ return (dynCall_iijji = Module["dynCall_iijji"] = Module["asm"]["dynCall_iijji"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var dynCall_jiiij = Module["dynCall_jiiij"] = function() {
+ return (dynCall_jiiij = Module["dynCall_jiiij"] = Module["asm"]["dynCall_jiiij"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var dynCall_viij = Module["dynCall_viij"] = function() {
+ return (dynCall_viij = Module["dynCall_viij"] = Module["asm"]["dynCall_viij"]).apply(null, arguments);
+};
+
+/** @type {function(...*):?} */
+var dynCall_jijj = Module["dynCall_jijj"] = function() {
+ return (dynCall_jijj = Module["dynCall_jijj"] = Module["asm"]["dynCall_jijj"]).apply(null, arguments);
+};
+
+
+function invoke_vii(index,a1,a2) {
+ var sp = stackSave();
+ try {
+ getWasmTableEntry(index)(a1,a2);
+ } catch(e) {
+ stackRestore(sp);
+ if (e !== e+0) throw e;
+ _setThrew(1, 0);
+ }
+}
+
+function invoke_ii(index,a1) {
+ var sp = stackSave();
+ try {
+ return getWasmTableEntry(index)(a1);
+ } catch(e) {
+ stackRestore(sp);
+ if (e !== e+0) throw e;
+ _setThrew(1, 0);
+ }
+}
+
+function invoke_viiii(index,a1,a2,a3,a4) {
+ var sp = stackSave();
+ try {
+ getWasmTableEntry(index)(a1,a2,a3,a4);
+ } catch(e) {
+ stackRestore(sp);
+ if (e !== e+0) throw e;
+ _setThrew(1, 0);
+ }
+}
+
+function invoke_iii(index,a1,a2) {
+ var sp = stackSave();
+ try {
+ return getWasmTableEntry(index)(a1,a2);
+ } catch(e) {
+ stackRestore(sp);
+ if (e !== e+0) throw e;
+ _setThrew(1, 0);
+ }
+}
+
+function invoke_vi(index,a1) {
+ var sp = stackSave();
+ try {
+ getWasmTableEntry(index)(a1);
+ } catch(e) {
+ stackRestore(sp);
+ if (e !== e+0) throw e;
+ _setThrew(1, 0);
+ }
+}
+
+function invoke_iiii(index,a1,a2,a3) {
+ var sp = stackSave();
+ try {
+ return getWasmTableEntry(index)(a1,a2,a3);
+ } catch(e) {
+ stackRestore(sp);
+ if (e !== e+0) throw e;
+ _setThrew(1, 0);
+ }
+}
+
+function invoke_viiiii(index,a1,a2,a3,a4,a5) {
+ var sp = stackSave();
+ try {
+ getWasmTableEntry(index)(a1,a2,a3,a4,a5);
+ } catch(e) {
+ stackRestore(sp);
+ if (e !== e+0) throw e;
+ _setThrew(1, 0);
+ }
+}
+
+function invoke_iiiii(index,a1,a2,a3,a4) {
+ var sp = stackSave();
+ try {
+ return getWasmTableEntry(index)(a1,a2,a3,a4);
+ } catch(e) {
+ stackRestore(sp);
+ if (e !== e+0) throw e;
+ _setThrew(1, 0);
+ }
+}
+
+function invoke_viii(index,a1,a2,a3) {
+ var sp = stackSave();
+ try {
+ getWasmTableEntry(index)(a1,a2,a3);
+ } catch(e) {
+ stackRestore(sp);
+ if (e !== e+0) throw e;
+ _setThrew(1, 0);
+ }
+}
+
+function invoke_iiiiii(index,a1,a2,a3,a4,a5) {
+ var sp = stackSave();
+ try {
+ return getWasmTableEntry(index)(a1,a2,a3,a4,a5);
+ } catch(e) {
+ stackRestore(sp);
+ if (e !== e+0) throw e;
+ _setThrew(1, 0);
+ }
+}
+
+function invoke_iiiiiii(index,a1,a2,a3,a4,a5,a6) {
+ var sp = stackSave();
+ try {
+ return getWasmTableEntry(index)(a1,a2,a3,a4,a5,a6);
+ } catch(e) {
+ stackRestore(sp);
+ if (e !== e+0) throw e;
+ _setThrew(1, 0);
+ }
+}
+
+function invoke_iiiiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9) {
+ var sp = stackSave();
+ try {
+ return getWasmTableEntry(index)(a1,a2,a3,a4,a5,a6,a7,a8,a9);
+ } catch(e) {
+ stackRestore(sp);
+ if (e !== e+0) throw e;
+ _setThrew(1, 0);
+ }
+}
+
+function invoke_v(index) {
+ var sp = stackSave();
+ try {
+ getWasmTableEntry(index)();
+ } catch(e) {
+ stackRestore(sp);
+ if (e !== e+0) throw e;
+ _setThrew(1, 0);
+ }
+}
+
+function invoke_viiiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9) {
+ var sp = stackSave();
+ try {
+ getWasmTableEntry(index)(a1,a2,a3,a4,a5,a6,a7,a8,a9);
+ } catch(e) {
+ stackRestore(sp);
+ if (e !== e+0) throw e;
+ _setThrew(1, 0);
+ }
+}
+
+function invoke_viiiiii(index,a1,a2,a3,a4,a5,a6) {
+ var sp = stackSave();
+ try {
+ getWasmTableEntry(index)(a1,a2,a3,a4,a5,a6);
+ } catch(e) {
+ stackRestore(sp);
+ if (e !== e+0) throw e;
+ _setThrew(1, 0);
+ }
+}
+
+function invoke_iiiiid(index,a1,a2,a3,a4,a5) {
+ var sp = stackSave();
+ try {
+ return getWasmTableEntry(index)(a1,a2,a3,a4,a5);
+ } catch(e) {
+ stackRestore(sp);
+ if (e !== e+0) throw e;
+ _setThrew(1, 0);
+ }
+}
+
+function invoke_iiiiiiii(index,a1,a2,a3,a4,a5,a6,a7) {
+ var sp = stackSave();
+ try {
+ return getWasmTableEntry(index)(a1,a2,a3,a4,a5,a6,a7);
+ } catch(e) {
+ stackRestore(sp);
+ if (e !== e+0) throw e;
+ _setThrew(1, 0);
+ }
+}
+
+function invoke_iiiiiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9,a10) {
+ var sp = stackSave();
+ try {
+ return getWasmTableEntry(index)(a1,a2,a3,a4,a5,a6,a7,a8,a9,a10);
+ } catch(e) {
+ stackRestore(sp);
+ if (e !== e+0) throw e;
+ _setThrew(1, 0);
+ }
+}
+
+function invoke_iiiiiiiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9,a10,a11,a12) {
+ var sp = stackSave();
+ try {
+ return getWasmTableEntry(index)(a1,a2,a3,a4,a5,a6,a7,a8,a9,a10,a11,a12);
+ } catch(e) {
+ stackRestore(sp);
+ if (e !== e+0) throw e;
+ _setThrew(1, 0);
+ }
+}
+
+function invoke_fiii(index,a1,a2,a3) {
+ var sp = stackSave();
+ try {
+ return getWasmTableEntry(index)(a1,a2,a3);
+ } catch(e) {
+ stackRestore(sp);
+ if (e !== e+0) throw e;
+ _setThrew(1, 0);
+ }
+}
+
+function invoke_diii(index,a1,a2,a3) {
+ var sp = stackSave();
+ try {
+ return getWasmTableEntry(index)(a1,a2,a3);
+ } catch(e) {
+ stackRestore(sp);
+ if (e !== e+0) throw e;
+ _setThrew(1, 0);
+ }
+}
+
+function invoke_i(index) {
+ var sp = stackSave();
+ try {
+ return getWasmTableEntry(index)();
+ } catch(e) {
+ stackRestore(sp);
+ if (e !== e+0) throw e;
+ _setThrew(1, 0);
+ }
+}
+
+function invoke_viiiiiii(index,a1,a2,a3,a4,a5,a6,a7) {
+ var sp = stackSave();
+ try {
+ getWasmTableEntry(index)(a1,a2,a3,a4,a5,a6,a7);
+ } catch(e) {
+ stackRestore(sp);
+ if (e !== e+0) throw e;
+ _setThrew(1, 0);
+ }
+}
+
+function invoke_iiiiiiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9,a10,a11) {
+ var sp = stackSave();
+ try {
+ return getWasmTableEntry(index)(a1,a2,a3,a4,a5,a6,a7,a8,a9,a10,a11);
+ } catch(e) {
+ stackRestore(sp);
+ if (e !== e+0) throw e;
+ _setThrew(1, 0);
+ }
+}
+
+function invoke_viiiiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9,a10) {
+ var sp = stackSave();
+ try {
+ getWasmTableEntry(index)(a1,a2,a3,a4,a5,a6,a7,a8,a9,a10);
+ } catch(e) {
+ stackRestore(sp);
+ if (e !== e+0) throw e;
+ _setThrew(1, 0);
+ }
+}
+
+function invoke_viiiiiiiiiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9,a10,a11,a12,a13,a14,a15) {
+ var sp = stackSave();
+ try {
+ getWasmTableEntry(index)(a1,a2,a3,a4,a5,a6,a7,a8,a9,a10,a11,a12,a13,a14,a15);
+ } catch(e) {
+ stackRestore(sp);
+ if (e !== e+0) throw e;
+ _setThrew(1, 0);
+ }
+}
+
+function invoke_j(index) {
+ var sp = stackSave();
+ try {
+ return dynCall_j(index);
+ } catch(e) {
+ stackRestore(sp);
+ if (e !== e+0) throw e;
+ _setThrew(1, 0);
+ }
+}
+
+function invoke_iiiiij(index,a1,a2,a3,a4,a5,a6) {
+ var sp = stackSave();
+ try {
+ return dynCall_iiiiij(index,a1,a2,a3,a4,a5,a6);
+ } catch(e) {
+ stackRestore(sp);
+ if (e !== e+0) throw e;
+ _setThrew(1, 0);
+ }
+}
+
+function invoke_jiiii(index,a1,a2,a3,a4) {
+ var sp = stackSave();
+ try {
+ return dynCall_jiiii(index,a1,a2,a3,a4);
+ } catch(e) {
+ stackRestore(sp);
+ if (e !== e+0) throw e;
+ _setThrew(1, 0);
+ }
+}
+
+
+
+
+// === Auto-generated postamble setup entry stuff ===
+
+Module["ccall"] = ccall;
+Module["cwrap"] = cwrap;
+Module["UTF8ArrayToString"] = UTF8ArrayToString;
+Module["UTF8ToString"] = UTF8ToString;
+Module["addRunDependency"] = addRunDependency;
+Module["removeRunDependency"] = removeRunDependency;
+Module["FS_createPath"] = FS.createPath;
+Module["FS_createDataFile"] = FS.createDataFile;
+Module["FS_createPreloadedFile"] = FS.createPreloadedFile;
+Module["FS_createLazyFile"] = FS.createLazyFile;
+Module["FS_createDevice"] = FS.createDevice;
+Module["FS_unlink"] = FS.unlink;
+Module["print"] = out;
+Module["setValue"] = setValue;
+Module["getValue"] = getValue;
+Module["FS"] = FS;
+
+var calledRun;
+
+/**
+ * @constructor
+ * @this {ExitStatus}
+ */
+function ExitStatus(status) {
+ this.name = "ExitStatus";
+ this.message = "Program terminated with exit(" + status + ")";
+ this.status = status;
+}
+
+var calledMain = false;
+
+dependenciesFulfilled = function runCaller() {
+ // If run has never been called, and we should call run (INVOKE_RUN is true, and Module.noInitialRun is not false)
+ if (!calledRun) run();
+ if (!calledRun) dependenciesFulfilled = runCaller; // try this again later, after new deps are fulfilled
+};
+
+/** @type {function(Array=)} */
+function run(args) {
+ args = args || arguments_;
+
+ if (runDependencies > 0) {
+ return;
+ }
+
+ preRun();
+
+ // a preRun added a dependency, run will be called later
+ if (runDependencies > 0) {
+ return;
+ }
+
+ function doRun() {
+ // run may have just been called through dependencies being fulfilled just in this very frame,
+ // or while the async setStatus time below was happening
+ if (calledRun) return;
+ calledRun = true;
+ Module['calledRun'] = true;
+
+ if (ABORT) return;
+
+ initRuntime();
+
+ readyPromiseResolve(Module);
+ if (Module['onRuntimeInitialized']) Module['onRuntimeInitialized']();
+
+ postRun();
+ }
+
+ if (Module['setStatus']) {
+ Module['setStatus']('Running...');
+ setTimeout(function() {
+ setTimeout(function() {
+ Module['setStatus']('');
+ }, 1);
+ doRun();
+ }, 1);
+ } else
+ {
+ doRun();
+ }
+}
+Module['run'] = run;
+
+/** @param {boolean|number=} implicit */
+function exit(status, implicit) {
+ EXITSTATUS = status;
+
+ procExit(status);
+}
+
+function procExit(code) {
+ EXITSTATUS = code;
+ if (!keepRuntimeAlive()) {
+ if (Module['onExit']) Module['onExit'](code);
+ ABORT = true;
+ }
+ quit_(code, new ExitStatus(code));
+}
+
+if (Module['preInit']) {
+ if (typeof Module['preInit'] == 'function') Module['preInit'] = [Module['preInit']];
+ while (Module['preInit'].length > 0) {
+ Module['preInit'].pop()();
+ }
+}
+
+run();
+
+
+
+
+
+createDotnetRuntime.ready = createDotnetRuntime.ready.then(() => { return __dotnet_exportedAPI; });
+
+ return createDotnetRuntime.ready
+}
+);
+})();
+export default createDotnetRuntime;
+const MONO = {}, BINDING = {}, INTERNAL = {}, IMPORTS = {};
+
+// TODO duplicated from emscripten, so we can use them in the __setEmscriptenEntrypoint
+var ENVIRONMENT_IS_WEB = typeof window == 'object';
+var ENVIRONMENT_IS_WORKER = typeof importScripts == 'function';
+var ENVIRONMENT_IS_NODE = typeof process == 'object' && typeof process.versions == 'object' && typeof process.versions.node == 'string';
+var ENVIRONMENT_IS_SHELL = !ENVIRONMENT_IS_WEB && !ENVIRONMENT_IS_NODE && !ENVIRONMENT_IS_WORKER;
+
+__dotnet_runtime.__setEmscriptenEntrypoint(createDotnetRuntime, { isNode: ENVIRONMENT_IS_NODE, isShell: ENVIRONMENT_IS_SHELL, isWeb: ENVIRONMENT_IS_WEB, isWorker: ENVIRONMENT_IS_WORKER });
+const dotnet = __dotnet_runtime.moduleExports.dotnet;
+const exit = __dotnet_runtime.moduleExports.exit;
+export { dotnet, exit, INTERNAL };
diff --git a/dotnet.js.br b/dotnet.js.br
new file mode 100644
index 0000000..91e981e
Binary files /dev/null and b/dotnet.js.br differ
diff --git a/dotnet.js.gz b/dotnet.js.gz
new file mode 100644
index 0000000..e7a992e
Binary files /dev/null and b/dotnet.js.gz differ
diff --git a/dotnet.js.symbols b/dotnet.js.symbols
new file mode 100644
index 0000000..a23edd5
--- /dev/null
+++ b/dotnet.js.symbols
@@ -0,0 +1,32501 @@
+0:abort
+1:std::__2::__vector_base_common::__throw_length_error\28\29\20const
+2:getTempRet0
+3:invoke_vii
+4:setTempRet0
+5:invoke_ii
+6:invoke_viiii
+7:invoke_iii
+8:invoke_vi
+9:invoke_iiii
+10:invoke_viiiii
+11:invoke_iiiii
+12:invoke_viii
+13:exit
+14:invoke_iiiiii
+15:invoke_iiiiiii
+16:invoke_iiiiiiiiii
+17:invoke_v
+18:invoke_viiiiiiiii
+19:invoke_viiiiii
+20:InterceptGLObject
+21:__assert_fail
+22:mono_wasm_invoke_js_blazor
+23:mono_wasm_set_entrypoint_breakpoint
+24:mono_wasm_trace_logger
+25:mono_wasm_invoke_js_with_args_ref
+26:mono_wasm_get_object_property_ref
+27:mono_wasm_get_by_index_ref
+28:mono_wasm_set_object_property_ref
+29:mono_wasm_set_by_index_ref
+30:mono_wasm_get_global_object_ref
+31:mono_wasm_create_cs_owned_object_ref
+32:mono_wasm_release_cs_owned_object
+33:mono_wasm_typed_array_to_array_ref
+34:mono_wasm_typed_array_from_ref
+35:mono_wasm_bind_js_function
+36:mono_wasm_invoke_bound_function
+37:mono_wasm_bind_cs_function
+38:mono_wasm_marshal_promise
+39:__cxa_allocate_exception
+40:__cxa_throw
+41:__cxa_find_matching_catch_3
+42:llvm_eh_typeid_for
+43:__cxa_begin_catch
+44:__cxa_end_catch
+45:__resumeException
+46:mono_wasm_debugger_log
+47:mono_wasm_asm_loaded
+48:mono_wasm_add_dbg_command_received
+49:mono_wasm_fire_debugger_agent_message
+50:strftime
+51:schedule_background_exec
+52:mono_set_timeout
+53:dotnet_browser_entropy
+54:emscripten_glGenQueriesEXT
+55:emscripten_glDeleteQueriesEXT
+56:emscripten_glIsQueryEXT
+57:emscripten_glBeginQueryEXT
+58:emscripten_glEndQueryEXT
+59:emscripten_glQueryCounterEXT
+60:emscripten_glGetQueryivEXT
+61:emscripten_glGetQueryObjectivEXT
+62:emscripten_glGetQueryObjectuivEXT
+63:emscripten_glGetQueryObjecti64vEXT
+64:emscripten_glGetQueryObjectui64vEXT
+65:emscripten_glBindVertexArrayOES
+66:emscripten_glDeleteVertexArraysOES
+67:emscripten_glGenVertexArraysOES
+68:emscripten_glIsVertexArrayOES
+69:emscripten_glDrawBuffersWEBGL
+70:emscripten_glDrawArraysInstancedANGLE
+71:emscripten_glDrawElementsInstancedANGLE
+72:emscripten_glVertexAttribDivisorANGLE
+73:emscripten_glActiveTexture
+74:emscripten_glAttachShader
+75:emscripten_glBindAttribLocation
+76:emscripten_glBindBuffer
+77:emscripten_glBindFramebuffer
+78:emscripten_glBindRenderbuffer
+79:emscripten_glBindTexture
+80:emscripten_glBlendColor
+81:emscripten_glBlendEquation
+82:emscripten_glBlendEquationSeparate
+83:emscripten_glBlendFunc
+84:emscripten_glBlendFuncSeparate
+85:emscripten_glBufferData
+86:emscripten_glBufferSubData
+87:emscripten_glCheckFramebufferStatus
+88:emscripten_glClear
+89:emscripten_glClearColor
+90:emscripten_glClearDepthf
+91:emscripten_glClearStencil
+92:emscripten_glColorMask
+93:emscripten_glCompileShader
+94:emscripten_glCompressedTexImage2D
+95:emscripten_glCompressedTexSubImage2D
+96:emscripten_glCopyTexImage2D
+97:emscripten_glCopyTexSubImage2D
+98:emscripten_glCreateProgram
+99:emscripten_glCreateShader
+100:emscripten_glCullFace
+101:emscripten_glDeleteBuffers
+102:emscripten_glDeleteFramebuffers
+103:emscripten_glDeleteProgram
+104:emscripten_glDeleteRenderbuffers
+105:emscripten_glDeleteShader
+106:emscripten_glDeleteTextures
+107:emscripten_glDepthFunc
+108:emscripten_glDepthMask
+109:emscripten_glDepthRangef
+110:emscripten_glDetachShader
+111:emscripten_glDisable
+112:emscripten_glDisableVertexAttribArray
+113:emscripten_glDrawArrays
+114:emscripten_glDrawElements
+115:emscripten_glEnable
+116:emscripten_glEnableVertexAttribArray
+117:emscripten_glFinish
+118:emscripten_glFlush
+119:emscripten_glFramebufferRenderbuffer
+120:emscripten_glFramebufferTexture2D
+121:emscripten_glFrontFace
+122:emscripten_glGenBuffers
+123:emscripten_glGenerateMipmap
+124:emscripten_glGenFramebuffers
+125:emscripten_glGenRenderbuffers
+126:emscripten_glGenTextures
+127:emscripten_glGetActiveAttrib
+128:emscripten_glGetActiveUniform
+129:emscripten_glGetAttachedShaders
+130:emscripten_glGetAttribLocation
+131:emscripten_glGetBooleanv
+132:emscripten_glGetBufferParameteriv
+133:emscripten_glGetError
+134:emscripten_glGetFloatv
+135:emscripten_glGetFramebufferAttachmentParameteriv
+136:emscripten_glGetIntegerv
+137:emscripten_glGetProgramiv
+138:emscripten_glGetProgramInfoLog
+139:emscripten_glGetRenderbufferParameteriv
+140:emscripten_glGetShaderiv
+141:emscripten_glGetShaderInfoLog
+142:emscripten_glGetShaderPrecisionFormat
+143:emscripten_glGetShaderSource
+144:emscripten_glGetString
+145:emscripten_glGetTexParameterfv
+146:emscripten_glGetTexParameteriv
+147:emscripten_glGetUniformfv
+148:emscripten_glGetUniformiv
+149:emscripten_glGetUniformLocation
+150:emscripten_glGetVertexAttribfv
+151:emscripten_glGetVertexAttribiv
+152:emscripten_glGetVertexAttribPointerv
+153:emscripten_glHint
+154:emscripten_glIsBuffer
+155:emscripten_glIsEnabled
+156:emscripten_glIsFramebuffer
+157:emscripten_glIsProgram
+158:emscripten_glIsRenderbuffer
+159:emscripten_glIsShader
+160:emscripten_glIsTexture
+161:emscripten_glLineWidth
+162:emscripten_glLinkProgram
+163:emscripten_glPixelStorei
+164:emscripten_glPolygonOffset
+165:emscripten_glReadPixels
+166:emscripten_glReleaseShaderCompiler
+167:emscripten_glRenderbufferStorage
+168:emscripten_glSampleCoverage
+169:emscripten_glScissor
+170:emscripten_glShaderBinary
+171:emscripten_glShaderSource
+172:emscripten_glStencilFunc
+173:emscripten_glStencilFuncSeparate
+174:emscripten_glStencilMask
+175:emscripten_glStencilMaskSeparate
+176:emscripten_glStencilOp
+177:emscripten_glStencilOpSeparate
+178:emscripten_glTexImage2D
+179:emscripten_glTexParameterf
+180:emscripten_glTexParameterfv
+181:emscripten_glTexParameteri
+182:emscripten_glTexParameteriv
+183:emscripten_glTexSubImage2D
+184:emscripten_glUniform1f
+185:emscripten_glUniform1fv
+186:emscripten_glUniform1i
+187:emscripten_glUniform1iv
+188:emscripten_glUniform2f
+189:emscripten_glUniform2fv
+190:emscripten_glUniform2i
+191:emscripten_glUniform2iv
+192:emscripten_glUniform3f
+193:emscripten_glUniform3fv
+194:emscripten_glUniform3i
+195:emscripten_glUniform3iv
+196:emscripten_glUniform4f
+197:emscripten_glUniform4fv
+198:emscripten_glUniform4i
+199:emscripten_glUniform4iv
+200:emscripten_glUniformMatrix2fv
+201:emscripten_glUniformMatrix3fv
+202:emscripten_glUniformMatrix4fv
+203:emscripten_glUseProgram
+204:emscripten_glValidateProgram
+205:emscripten_glVertexAttrib1f
+206:emscripten_glVertexAttrib1fv
+207:emscripten_glVertexAttrib2f
+208:emscripten_glVertexAttrib2fv
+209:emscripten_glVertexAttrib3f
+210:emscripten_glVertexAttrib3fv
+211:emscripten_glVertexAttrib4f
+212:emscripten_glVertexAttrib4fv
+213:emscripten_glVertexAttribPointer
+214:emscripten_glViewport
+215:__wasi_environ_sizes_get
+216:__wasi_environ_get
+217:__syscall_faccessat
+218:__syscall_chdir
+219:__syscall_chmod
+220:__wasi_fd_close
+221:emscripten_memcpy_big
+222:_tzset_js
+223:_localtime_js
+224:_emscripten_date_now
+225:_emscripten_get_now_is_monotonic
+226:emscripten_get_now
+227:emscripten_get_now_res
+228:__syscall_fchmod
+229:__syscall_fcntl64
+230:__syscall_openat
+231:__syscall_ioctl
+232:__wasi_fd_write
+233:__wasi_fd_read
+234:__syscall_fstat64
+235:__syscall_stat64
+236:__syscall_newfstatat
+237:__syscall_lstat64
+238:__wasi_fd_sync
+239:__syscall_getcwd
+240:__syscall_mkdirat
+241:_munmap_js
+242:_msync_js
+243:_mmap_js
+244:__syscall_getdents64
+245:__syscall_readlinkat
+246:__syscall_unlinkat
+247:__syscall_rmdir
+248:__syscall_renameat
+249:__syscall_fstatfs64
+250:emscripten_get_heap_max
+251:__syscall_utimensat
+252:__wasi_fd_fdstat_get
+253:emscripten_resize_heap
+254:_emscripten_throw_longjmp
+255:__cxa_find_matching_catch_2
+256:__cxa_free_exception
+257:__cxa_rethrow
+258:__cxa_uncaught_exceptions
+259:invoke_iiiiid
+260:invoke_iiiiiiii
+261:invoke_iiiiiiiiiii
+262:invoke_iiiiiiiiiiiii
+263:invoke_fiii
+264:invoke_diii
+265:invoke_i
+266:invoke_viiiiiii
+267:strftime_l
+268:invoke_iiiiiiiiiiii
+269:invoke_viiiiiiiiii
+270:invoke_viiiiiiiiiiiiiii
+271:__syscall_recvfrom
+272:__syscall_sendto
+273:legalimport$__syscall_ftruncate64
+274:legalimport$__wasi_fd_seek
+275:legalimport$__syscall_fadvise64
+276:legalimport$__wasi_fd_pread
+277:legalimport$__wasi_fd_pwrite
+278:legalimport$invoke_j
+279:legalimport$invoke_iiiiij
+280:legalimport$invoke_jiiii
+281:__wasm_call_ctors
+282:hb_parse_double\28char\20const**\2c\20char\20const*\2c\20double*\2c\20bool\29
+283:_hb_options_init\28\29
+284:hb_tag_from_string
+285:hb_language_from_string
+286:lang_find_or_insert\28char\20const*\29
+287:hb_language_to_string
+288:hb_language_get_default
+289:hb_script_get_horizontal_direction
+290:hb_feature_to_string
+291:hb_ot_face_t::init0\28hb_face_t*\29
+292:hb_ot_face_t::fini\28\29
+293:OT::cff1::accelerator_templ_t>::fini\28\29
+294:OT::cff2::accelerator_templ_t>::fini\28\29
+295:hb_ucd_get_unicode_funcs
+296:hb_lazy_loader_t::get_unconst\28\29\20const
+297:hb_ucd_combining_class\28hb_unicode_funcs_t*\2c\20unsigned\20int\2c\20void*\29
+298:hb_ucd_general_category\28hb_unicode_funcs_t*\2c\20unsigned\20int\2c\20void*\29
+299:hb_ucd_mirroring\28hb_unicode_funcs_t*\2c\20unsigned\20int\2c\20void*\29
+300:hb_ucd_script\28hb_unicode_funcs_t*\2c\20unsigned\20int\2c\20void*\29
+301:hb_ucd_compose\28hb_unicode_funcs_t*\2c\20unsigned\20int\2c\20unsigned\20int\2c\20unsigned\20int*\2c\20void*\29
+302:hb_ucd_decompose\28hb_unicode_funcs_t*\2c\20unsigned\20int\2c\20unsigned\20int*\2c\20unsigned\20int*\2c\20void*\29
+303:hb_unicode_funcs_get_default
+304:hb_unicode_funcs_create
+305:hb_unicode_funcs_get_empty
+306:hb_unicode_funcs_make_immutable
+307:hb_unicode_funcs_reference
+308:hb_unicode_combining_class_nil\28hb_unicode_funcs_t*\2c\20unsigned\20int\2c\20void*\29
+309:hb_unicode_eastasian_width_nil\28hb_unicode_funcs_t*\2c\20unsigned\20int\2c\20void*\29
+310:hb_unicode_general_category_nil\28hb_unicode_funcs_t*\2c\20unsigned\20int\2c\20void*\29
+311:hb_unicode_mirroring_nil\28hb_unicode_funcs_t*\2c\20unsigned\20int\2c\20void*\29
+312:hb_unicode_script_nil\28hb_unicode_funcs_t*\2c\20unsigned\20int\2c\20void*\29
+313:hb_unicode_compose_nil\28hb_unicode_funcs_t*\2c\20unsigned\20int\2c\20unsigned\20int\2c\20unsigned\20int*\2c\20void*\29
+314:hb_unicode_decompose_nil\28hb_unicode_funcs_t*\2c\20unsigned\20int\2c\20unsigned\20int*\2c\20unsigned\20int*\2c\20void*\29
+315:hb_unicode_decompose_compatibility_nil\28hb_unicode_funcs_t*\2c\20unsigned\20int\2c\20unsigned\20int*\2c\20void*\29
+316:hb_unicode_funcs_destroy
+317:hb_unicode_funcs_set_combining_class_func
+318:hb_unicode_funcs_set_general_category_func
+319:hb_unicode_funcs_set_mirroring_func
+320:hb_unicode_funcs_set_script_func
+321:hb_unicode_funcs_set_compose_func
+322:hb_unicode_funcs_set_decompose_func
+323:_hb_unicode_is_emoji_Extended_Pictographic\28unsigned\20int\29
+324:hb_segment_properties_equal
+325:hb_buffer_t::enlarge\28unsigned\20int\29
+326:hb_buffer_t::make_room_for\28unsigned\20int\2c\20unsigned\20int\29
+327:hb_buffer_t::remove_output\28\29
+328:hb_buffer_t::clear_output\28\29
+329:hb_buffer_t::clear_positions\28\29
+330:hb_buffer_t::swap_buffers\28\29
+331:hb_buffer_t::move_to\28unsigned\20int\29
+332:hb_buffer_t::set_masks\28unsigned\20int\2c\20unsigned\20int\2c\20unsigned\20int\2c\20unsigned\20int\29
+333:hb_buffer_t::reverse_range\28unsigned\20int\2c\20unsigned\20int\29
+334:hb_buffer_t::reverse\28\29
+335:hb_buffer_t::merge_clusters_impl\28unsigned\20int\2c\20unsigned\20int\29
+336:hb_buffer_t::merge_out_clusters\28unsigned\20int\2c\20unsigned\20int\29
+337:hb_buffer_t::delete_glyph\28\29
+338:hb_buffer_t::unsafe_to_break_impl\28unsigned\20int\2c\20unsigned\20int\29
+339:hb_buffer_t::unsafe_to_break_from_outbuffer\28unsigned\20int\2c\20unsigned\20int\29
+340:hb_buffer_create
+341:hb_buffer_destroy
+342:hb_buffer_get_content_type
+343:hb_buffer_set_direction
+344:hb_buffer_get_direction
+345:hb_buffer_set_language
+346:hb_buffer_get_length
+347:hb_buffer_get_glyph_infos
+348:hb_buffer_get_glyph_positions
+349:hb_buffer_reverse
+350:hb_buffer_guess_segment_properties
+351:hb_buffer_add_utf16
+352:hb_buffer_t::sort\28unsigned\20int\2c\20unsigned\20int\2c\20int\20\28*\29\28hb_glyph_info_t\20const*\2c\20hb_glyph_info_t\20const*\29\29
+353:hb_buffer_t::message_impl\28hb_font_t*\2c\20char\20const*\2c\20void*\29
+354:AAT::hb_aat_apply_context_t::hb_aat_apply_context_t\28hb_ot_shape_plan_t\20const*\2c\20hb_font_t*\2c\20hb_buffer_t*\2c\20hb_blob_t*\29
+355:OT::GDEF::accelerator_t::init\28hb_face_t*\29
+356:AAT::hb_aat_apply_context_t::~hb_aat_apply_context_t\28\29
+357:hb_aat_layout_find_feature_mapping\28unsigned\20int\29
+358:hb_aat_layout_compile_map\28hb_aat_map_builder_t\20const*\2c\20hb_aat_map_t*\29
+359:hb_lazy_loader_t\2c\20hb_face_t\2c\2025u\2c\20hb_blob_t>::get\28\29\20const
+360:AAT::mortmorx::compile_flags\28hb_aat_map_builder_t\20const*\2c\20hb_aat_map_t*\29\20const
+361:hb_lazy_loader_t\2c\20hb_face_t\2c\2026u\2c\20hb_blob_t>::get\28\29\20const
+362:AAT::mortmorx::compile_flags\28hb_aat_map_builder_t\20const*\2c\20hb_aat_map_t*\29\20const
+363:AAT::Chain::compile_flags\28hb_aat_map_builder_t\20const*\29\20const
+364:AAT::Chain::compile_flags\28hb_aat_map_builder_t\20const*\29\20const
+365:hb_aat_layout_has_substitution
+366:hb_aat_layout_substitute\28hb_ot_shape_plan_t\20const*\2c\20hb_font_t*\2c\20hb_buffer_t*\29
+367:hb_table_lazy_loader_t::get_blob\28\29\20const
+368:AAT::Chain::apply\28AAT::hb_aat_apply_context_t*\2c\20unsigned\20int\29\20const
+369:hb_table_lazy_loader_t::get_blob\28\29\20const
+370:AAT::Chain::apply\28AAT::hb_aat_apply_context_t*\2c\20unsigned\20int\29\20const
+371:hb_blob_t*\20hb_sanitize_context_t::sanitize_blob\28hb_blob_t*\29
+372:hb_blob_t*\20hb_sanitize_context_t::sanitize_blob\28hb_blob_t*\29
+373:hb_aat_layout_zero_width_deleted_glyphs\28hb_buffer_t*\29
+374:hb_aat_layout_remove_deleted_glyphs\28hb_buffer_t*\29
+375:is_deleted_glyph\28hb_glyph_info_t\20const*\29
+376:hb_aat_layout_has_positioning
+377:hb_lazy_loader_t\2c\20hb_face_t\2c\2027u\2c\20hb_blob_t>::get\28\29\20const
+378:hb_aat_layout_position\28hb_ot_shape_plan_t\20const*\2c\20hb_font_t*\2c\20hb_buffer_t*\29
+379:hb_table_lazy_loader_t::get_blob\28\29\20const
+380:hb_lazy_loader_t\2c\20hb_face_t\2c\2028u\2c\20hb_blob_t>::get\28\29\20const
+381:AAT::KerxTable::apply\28AAT::hb_aat_apply_context_t*\29\20const
+382:hb_blob_t*\20hb_sanitize_context_t::sanitize_blob\28hb_blob_t*\29
+383:hb_blob_t*\20hb_sanitize_context_t::sanitize_blob\28hb_blob_t*\29
+384:AAT::hb_aat_apply_context_t::return_t\20AAT::KerxSubTable::dispatch\28AAT::hb_aat_apply_context_t*\29\20const
+385:hb_aat_layout_has_tracking
+386:hb_lazy_loader_t\2c\20hb_face_t\2c\2029u\2c\20hb_blob_t>::get\28\29\20const
+387:hb_aat_layout_track\28hb_ot_shape_plan_t\20const*\2c\20hb_font_t*\2c\20hb_buffer_t*\29
+388:AAT::trak::apply\28AAT::hb_aat_apply_context_t*\29\20const
+389:AAT::TrackData::get_tracking\28void\20const*\2c\20float\29\20const
+390:hb_lazy_loader_t\2c\20hb_face_t\2c\2031u\2c\20hb_blob_t>::get\28\29\20const
+391:AAT::TrackData::interpolate_at\28unsigned\20int\2c\20float\2c\20AAT::TrackTableEntry\20const&\2c\20void\20const*\29\20const
+392:AAT::mortmorx::sanitize\28hb_sanitize_context_t*\29\20const
+393:AAT::Chain::sanitize\28hb_sanitize_context_t*\2c\20unsigned\20int\29\20const
+394:AAT::ChainSubtable::sanitize\28hb_sanitize_context_t*\29\20const
+395:hb_sanitize_context_t::return_t\20AAT::ChainSubtable::dispatch\28hb_sanitize_context_t*\29\20const
+396:AAT::StateTable::sanitize\28hb_sanitize_context_t*\2c\20unsigned\20int*\29\20const
+397:AAT::ContextualSubtable::sanitize\28hb_sanitize_context_t*\29\20const
+398:AAT::LigatureSubtable::sanitize\28hb_sanitize_context_t*\29\20const
+399:AAT::Lookup::sanitize\28hb_sanitize_context_t*\29\20const
+400:AAT::StateTable::EntryData>::sanitize\28hb_sanitize_context_t*\2c\20unsigned\20int*\29\20const
+401:AAT::Lookup>::sanitize\28hb_sanitize_context_t*\29\20const
+402:bool\20OT::VarSizedBinSearchArrayOf>>::sanitize>\20const*>\28hb_sanitize_context_t*\2c\20AAT::LookupFormat4>\20const*&&\29\20const
+403:AAT::StateTable::EntryData>::sanitize\28hb_sanitize_context_t*\2c\20unsigned\20int*\29\20const
+404:bool\20OT::UnsizedArrayOf\2c\20OT::IntType\2c\20false>>::sanitize\2c\20OT::IntType\2c\20false>\20const*>\28hb_sanitize_context_t*\2c\20unsigned\20int\2c\20OT::UnsizedListOfOffset16To\2c\20OT::IntType\2c\20false>\20const*&&\29\20const
+405:bool\20OT::VarSizedBinSearchArrayOf>::sanitize\20const*>\28hb_sanitize_context_t*\2c\20AAT::LookupFormat4\20const*&&\29\20const
+406:AAT::StateTable::EntryData>::sanitize\28hb_sanitize_context_t*\2c\20unsigned\20int*\29\20const
+407:AAT::mortmorx::sanitize\28hb_sanitize_context_t*\29\20const
+408:AAT::Chain::sanitize\28hb_sanitize_context_t*\2c\20unsigned\20int\29\20const
+409:hb_sanitize_context_t::return_t\20AAT::ChainSubtable::dispatch\28hb_sanitize_context_t*\29\20const
+410:AAT::StateTable::EntryData>::sanitize\28hb_sanitize_context_t*\2c\20unsigned\20int*\29\20const
+411:bool\20OT::OffsetTo\2c\20OT::IntType\2c\20false>\2c\20OT::IntType\2c\20false>::sanitize\28hb_sanitize_context_t*\2c\20void\20const*\2c\20int&&\29\20const
+412:AAT::StateTable::EntryData>::sanitize\28hb_sanitize_context_t*\2c\20unsigned\20int*\29\20const
+413:AAT::hb_aat_apply_context_t::return_t\20AAT::ChainSubtable::dispatch\28AAT::hb_aat_apply_context_t*\29\20const
+414:void\20AAT::StateTableDriver::drive::driver_context_t>\28AAT::RearrangementSubtable::driver_context_t*\29
+415:void\20AAT::StateTableDriver::EntryData>::drive::driver_context_t>\28AAT::ContextualSubtable::driver_context_t*\29
+416:AAT::LigatureSubtable::apply\28AAT::hb_aat_apply_context_t*\29\20const
+417:AAT::NoncontextualSubtable::apply\28AAT::hb_aat_apply_context_t*\29\20const
+418:void\20AAT::StateTableDriver::EntryData>::drive::driver_context_t>\28AAT::InsertionSubtable::driver_context_t*\29
+419:AAT::Lookup>::get_value\28unsigned\20int\2c\20unsigned\20int\29\20const
+420:AAT::RearrangementSubtable::driver_context_t::transition\28AAT::StateTableDriver*\2c\20AAT::Entry\20const&\29
+421:AAT::ContextualSubtable::driver_context_t::transition\28AAT::StateTableDriver::EntryData>*\2c\20AAT::Entry::EntryData>\20const&\29
+422:AAT::Lookup::get_value\28unsigned\20int\2c\20unsigned\20int\29\20const
+423:void\20AAT::StateTableDriver::EntryData>::drive::driver_context_t>\28AAT::LigatureSubtable::driver_context_t*\29
+424:AAT::LigatureSubtable::driver_context_t::transition\28AAT::StateTableDriver::EntryData>*\2c\20AAT::Entry::EntryData>\20const&\29
+425:AAT::InsertionSubtable::driver_context_t::transition\28AAT::StateTableDriver::EntryData>*\2c\20AAT::Entry::EntryData>\20const&\29
+426:AAT::hb_aat_apply_context_t::return_t\20AAT::ChainSubtable::dispatch\28AAT::hb_aat_apply_context_t*\29\20const
+427:void\20AAT::StateTableDriver::drive::driver_context_t>\28AAT::RearrangementSubtable::driver_context_t*\29
+428:void\20AAT::StateTableDriver::EntryData>::drive::driver_context_t>\28AAT::ContextualSubtable::driver_context_t*\29
+429:void\20AAT::StateTableDriver::drive::driver_context_t>\28AAT::LigatureSubtable::driver_context_t*\29
+430:AAT::NoncontextualSubtable::apply\28AAT::hb_aat_apply_context_t*\29\20const
+431:void\20AAT::StateTableDriver::EntryData>::drive::driver_context_t>\28AAT::InsertionSubtable::driver_context_t*\29
+432:AAT::RearrangementSubtable::driver_context_t::transition\28AAT::StateTableDriver*\2c\20AAT::Entry\20const&\29
+433:AAT::ContextualSubtable::driver_context_t::transition\28AAT::StateTableDriver::EntryData>*\2c\20AAT::Entry::EntryData>\20const&\29
+434:AAT::LigatureSubtable::driver_context_t::transition\28AAT::StateTableDriver*\2c\20AAT::Entry\20const&\29
+435:AAT::InsertionSubtable::driver_context_t::transition\28AAT::StateTableDriver::EntryData>*\2c\20AAT::Entry::EntryData>\20const&\29
+436:AAT::KerxTable::sanitize\28hb_sanitize_context_t*\29\20const
+437:hb_sanitize_context_t::return_t\20AAT::KerxSubTable::dispatch\28hb_sanitize_context_t*\29\20const
+438:AAT::StateTable::EntryData>::sanitize\28hb_sanitize_context_t*\2c\20unsigned\20int*\29\20const
+439:AAT::KerxSubTableFormat2::sanitize\28hb_sanitize_context_t*\29\20const
+440:AAT::StateTable::EntryData>::sanitize\28hb_sanitize_context_t*\2c\20unsigned\20int*\29\20const
+441:AAT::KerxSubTableFormat6::sanitize\28hb_sanitize_context_t*\29\20const
+442:AAT::Lookup>::sanitize\28hb_sanitize_context_t*\29\20const
+443:bool\20OT::VarSizedBinSearchArrayOf>>::sanitize>\20const*>\28hb_sanitize_context_t*\2c\20AAT::LookupFormat4>\20const*&&\29\20const
+444:AAT::ankr::sanitize\28hb_sanitize_context_t*\29\20const
+445:AAT::Lookup>\2c\20OT::IntType\2c\20false>>::sanitize\28hb_sanitize_context_t*\2c\20void\20const*\29\20const
+446:bool\20OT::UnsizedArrayOf>\2c\20OT::IntType\2c\20false>>::sanitize\28hb_sanitize_context_t*\2c\20unsigned\20int\2c\20void\20const*&\29\20const
+447:bool\20OT::VarSizedBinSearchArrayOf>\2c\20OT::IntType\2c\20false>>>::sanitize\28hb_sanitize_context_t*\2c\20void\20const*&\29\20const
+448:bool\20OT::VarSizedBinSearchArrayOf>\2c\20OT::IntType\2c\20false>>>::sanitize>\2c\20OT::IntType\2c\20false>>\20const*\2c\20void\20const*&>\28hb_sanitize_context_t*\2c\20AAT::LookupFormat4>\2c\20OT::IntType\2c\20false>>\20const*&&\2c\20void\20const*&\29\20const
+449:bool\20OT::VarSizedBinSearchArrayOf>\2c\20OT::IntType\2c\20false>>>::sanitize\28hb_sanitize_context_t*\2c\20void\20const*&\29\20const
+450:AAT::LookupSegmentSingle>\2c\20OT::IntType\2c\20false>>::sanitize\28hb_sanitize_context_t*\2c\20void\20const*\29\20const
+451:AAT::LookupSingle>\2c\20OT::IntType\2c\20false>>::sanitize\28hb_sanitize_context_t*\2c\20void\20const*\29\20const
+452:OT::hb_kern_machine_t::accelerator_t>::kern\28hb_font_t*\2c\20hb_buffer_t*\2c\20unsigned\20int\2c\20bool\29\20const
+453:void\20AAT::StateTableDriver::EntryData>::drive::driver_context_t>\28AAT::KerxSubTableFormat1::driver_context_t*\29
+454:OT::hb_kern_machine_t::accelerator_t>::kern\28hb_font_t*\2c\20hb_buffer_t*\2c\20unsigned\20int\2c\20bool\29\20const
+455:void\20AAT::StateTableDriver::EntryData>::drive::driver_context_t>\28AAT::KerxSubTableFormat4::driver_context_t*\29
+456:OT::hb_kern_machine_t::accelerator_t>::kern\28hb_font_t*\2c\20hb_buffer_t*\2c\20unsigned\20int\2c\20bool\29\20const
+457:AAT::KerxSubTableFormat0::get_kerning\28unsigned\20int\2c\20unsigned\20int\2c\20AAT::hb_aat_apply_context_t*\29\20const
+458:AAT::KerxSubTableFormat1::driver_context_t::transition\28AAT::StateTableDriver::EntryData>*\2c\20AAT::Entry::EntryData>\20const&\29
+459:AAT::KerxSubTableFormat2::get_kerning\28unsigned\20int\2c\20unsigned\20int\2c\20AAT::hb_aat_apply_context_t*\29\20const
+460:AAT::KerxSubTableFormat4::driver_context_t::transition\28AAT::StateTableDriver::EntryData>*\2c\20AAT::Entry::EntryData>\20const&\29
+461:hb_font_t::get_glyph_contour_point_for_origin\28unsigned\20int\2c\20unsigned\20int\2c\20hb_direction_t\2c\20int*\2c\20int*\29
+462:AAT::Lookup>\2c\20OT::IntType\2c\20false>>::get_value\28unsigned\20int\2c\20unsigned\20int\29\20const
+463:AAT::KerxSubTableFormat6::get_kerning\28unsigned\20int\2c\20unsigned\20int\2c\20AAT::hb_aat_apply_context_t*\29\20const
+464:AAT::Lookup>::get_value_or_null\28unsigned\20int\2c\20unsigned\20int\29\20const
+465:AAT::Lookup>::get_value\28unsigned\20int\2c\20unsigned\20int\29\20const
+466:hb_blob_t*\20hb_sanitize_context_t::sanitize_blob\28hb_blob_t*\29
+467:AAT::trak::sanitize\28hb_sanitize_context_t*\29\20const
+468:AAT::TrackData::sanitize\28hb_sanitize_context_t*\2c\20void\20const*\29\20const
+469:bool\20OT::UnsizedArrayOf::sanitize\20const&>\28hb_sanitize_context_t*\2c\20unsigned\20int\2c\20void\20const*&\2c\20OT::IntType\20const&\29\20const
+470:hb_blob_t*\20hb_sanitize_context_t::sanitize_blob\28hb_blob_t*\29
+471:bool\20OT::UnsizedArrayOf::sanitize\28hb_sanitize_context_t*\2c\20unsigned\20int\2c\20AAT::feat\20const*&&\29\20const
+472:hb_ot_layout_has_kerning\28hb_face_t*\29
+473:hb_lazy_loader_t\2c\20hb_face_t\2c\2020u\2c\20hb_blob_t>::get\28\29\20const
+474:hb_ot_layout_has_machine_kerning\28hb_face_t*\29
+475:OT::kern::has_state_machine\28\29\20const
+476:hb_ot_layout_has_cross_kerning\28hb_face_t*\29
+477:OT::kern::has_cross_stream\28\29\20const
+478:hb_ot_layout_kern\28hb_ot_shape_plan_t\20const*\2c\20hb_font_t*\2c\20hb_buffer_t*\29
+479:hb_table_lazy_loader_t::get_blob\28\29\20const
+480:hb_buffer_t::message\28hb_font_t*\2c\20char\20const*\2c\20...\29
+481:AAT::KerxTable::apply\28AAT::hb_aat_apply_context_t*\29\20const
+482:AAT::KerxTable::apply\28AAT::hb_aat_apply_context_t*\29\20const
+483:hb_blob_t*\20hb_sanitize_context_t::sanitize_blob\28hb_blob_t*\29
+484:OT::GDEF::is_blocklisted\28hb_blob_t*\2c\20hb_face_t*\29\20const
+485:hb_lazy_loader_t\2c\20hb_face_t\2c\2022u\2c\20OT::GSUB_accelerator_t>::get\28\29\20const
+486:hb_lazy_loader_t\2c\20hb_face_t\2c\2023u\2c\20OT::GPOS_accelerator_t>::get\28\29\20const
+487:hb_ot_layout_has_glyph_classes
+488:hb_lazy_loader_t\2c\20hb_face_t\2c\2021u\2c\20OT::GDEF_accelerator_t>::create\28hb_face_t*\29
+489:OT::Coverage::get_coverage\28unsigned\20int\29\20const
+490:hb_ot_layout_table_select_script
+491:hb_ot_layout_table_find_feature\28hb_face_t*\2c\20unsigned\20int\2c\20unsigned\20int\2c\20unsigned\20int*\29
+492:hb_ot_layout_script_select_language
+493:hb_ot_layout_language_get_required_feature
+494:hb_ot_layout_language_find_feature
+495:hb_ot_layout_feature_with_variations_get_lookups
+496:OT::GSUBGPOS::get_feature_variation\28unsigned\20int\2c\20unsigned\20int\29\20const
+497:hb_ot_layout_table_get_lookup_count
+498:hb_ot_layout_table_find_feature_variations
+499:OT::FeatureVariations::find_index\28int\20const*\2c\20unsigned\20int\2c\20unsigned\20int*\29\20const
+500:hb_ot_layout_has_substitution
+501:hb_ot_layout_lookup_would_substitute
+502:OT::SubstLookup::would_apply\28OT::hb_would_apply_context_t*\2c\20OT::hb_ot_layout_lookup_accelerator_t\20const*\29\20const
+503:OT::hb_would_apply_context_t::return_t\20OT::SubstLookupSubTable::dispatch\28OT::hb_would_apply_context_t*\2c\20unsigned\20int\29\20const
+504:hb_ot_layout_substitute_start\28hb_font_t*\2c\20hb_buffer_t*\29
+505:OT::GDEF::get_glyph_props\28unsigned\20int\29\20const
+506:hb_ot_layout_delete_glyphs_inplace\28hb_buffer_t*\2c\20bool\20\28*\29\28hb_glyph_info_t\20const*\29\29
+507:hb_ot_layout_has_positioning
+508:hb_ot_layout_position_start\28hb_font_t*\2c\20hb_buffer_t*\29
+509:hb_ot_layout_position_finish_advances\28hb_font_t*\2c\20hb_buffer_t*\29
+510:hb_ot_layout_position_finish_offsets\28hb_font_t*\2c\20hb_buffer_t*\29
+511:OT::propagate_attachment_offsets\28hb_glyph_position_t*\2c\20unsigned\20int\2c\20unsigned\20int\2c\20hb_direction_t\29
+512:hb_ot_map_t::substitute\28hb_ot_shape_plan_t\20const*\2c\20hb_font_t*\2c\20hb_buffer_t*\29\20const
+513:void\20hb_ot_map_t::apply\28GSUBProxy\20const&\2c\20hb_ot_shape_plan_t\20const*\2c\20hb_font_t*\2c\20hb_buffer_t*\29\20const
+514:OT::SubstLookup::apply_recurse_func\28OT::hb_ot_apply_context_t*\2c\20unsigned\20int\29
+515:OT::hb_ot_apply_context_t::hb_ot_apply_context_t\28unsigned\20int\2c\20hb_font_t*\2c\20hb_buffer_t*\29
+516:apply_forward\28OT::hb_ot_apply_context_t*\2c\20OT::hb_ot_layout_lookup_accelerator_t\20const&\29
+517:apply_backward\28OT::hb_ot_apply_context_t*\2c\20OT::hb_ot_layout_lookup_accelerator_t\20const&\29
+518:hb_ot_map_t::position\28hb_ot_shape_plan_t\20const*\2c\20hb_font_t*\2c\20hb_buffer_t*\29\20const
+519:void\20hb_ot_map_t::apply\28GPOSProxy\20const&\2c\20hb_ot_shape_plan_t\20const*\2c\20hb_font_t*\2c\20hb_buffer_t*\29\20const
+520:OT::PosLookup::apply_recurse_func\28OT::hb_ot_apply_context_t*\2c\20unsigned\20int\29
+521:hb_ot_layout_substitute_lookup\28OT::hb_ot_apply_context_t*\2c\20OT::SubstLookup\20const&\2c\20OT::hb_ot_layout_lookup_accelerator_t\20const&\29
+522:OT::Device::get_y_delta\28hb_font_t*\2c\20OT::VariationStore\20const&\29\20const
+523:OT::Device::get_x_delta\28hb_font_t*\2c\20OT::VariationStore\20const&\29\20const
+524:AAT::hb_aat_apply_context_t::return_t\20OT::KernSubTable::dispatch\28AAT::hb_aat_apply_context_t*\29\20const
+525:OT::hb_kern_machine_t::accelerator_t>::kern\28hb_font_t*\2c\20hb_buffer_t*\2c\20unsigned\20int\2c\20bool\29\20const
+526:OT::hb_kern_machine_t::accelerator_t>::kern\28hb_font_t*\2c\20hb_buffer_t*\2c\20unsigned\20int\2c\20bool\29\20const
+527:OT::hb_ot_apply_context_t::skipping_iterator_t::next\28\29
+528:AAT::KerxSubTableFormat2::get_kerning\28unsigned\20int\2c\20unsigned\20int\2c\20AAT::hb_aat_apply_context_t*\29\20const
+529:AAT::hb_aat_apply_context_t::return_t\20OT::KernSubTable::dispatch\28AAT::hb_aat_apply_context_t*\29\20const
+530:OT::hb_kern_machine_t::accelerator_t>::kern\28hb_font_t*\2c\20hb_buffer_t*\2c\20unsigned\20int\2c\20bool\29\20const
+531:void\20AAT::StateTableDriver::drive::driver_context_t>\28AAT::KerxSubTableFormat1::driver_context_t*\29
+532:OT::hb_kern_machine_t::accelerator_t>::kern\28hb_font_t*\2c\20hb_buffer_t*\2c\20unsigned\20int\2c\20bool\29\20const
+533:OT::hb_kern_machine_t>::kern\28hb_font_t*\2c\20hb_buffer_t*\2c\20unsigned\20int\2c\20bool\29\20const
+534:AAT::KerxSubTableFormat1::driver_context_t::transition\28AAT::StateTableDriver*\2c\20AAT::Entry\20const&\29
+535:AAT::KerxSubTableFormat2::get_kerning\28unsigned\20int\2c\20unsigned\20int\2c\20AAT::hb_aat_apply_context_t*\29\20const
+536:OT::ClassDef::get_class\28unsigned\20int\29\20const
+537:hb_font_t::get_glyph_h_origin_with_fallback\28unsigned\20int\2c\20int*\2c\20int*\29
+538:hb_font_t::get_glyph_v_origin_with_fallback\28unsigned\20int\2c\20int*\2c\20int*\29
+539:OT::VariationDevice::get_x_delta\28hb_font_t*\2c\20OT::VariationStore\20const&\29\20const
+540:OT::VariationDevice::get_y_delta\28hb_font_t*\2c\20OT::VariationStore\20const&\29\20const
+541:OT::VarData::get_delta\28unsigned\20int\2c\20int\20const*\2c\20unsigned\20int\2c\20OT::VarRegionList\20const&\29\20const
+542:OT::VarRegionList::evaluate\28unsigned\20int\2c\20int\20const*\2c\20unsigned\20int\29\20const
+543:OT::LigatureSet::would_apply\28OT::hb_would_apply_context_t*\29\20const
+544:OT::hb_would_apply_context_t::return_t\20OT::Context::dispatch\28OT::hb_would_apply_context_t*\29\20const
+545:OT::hb_would_apply_context_t::return_t\20OT::ChainContext::dispatch\28OT::hb_would_apply_context_t*\29\20const
+546:OT::hb_would_apply_context_t::return_t\20OT::Extension::dispatch\28OT::hb_would_apply_context_t*\29\20const
+547:OT::ContextFormat1::would_apply\28OT::hb_would_apply_context_t*\29\20const
+548:OT::ContextFormat2::would_apply\28OT::hb_would_apply_context_t*\29\20const
+549:OT::ChainRuleSet::would_apply\28OT::hb_would_apply_context_t*\2c\20OT::ChainContextApplyLookupContext&\29\20const
+550:OT::ChainContextFormat2::would_apply\28OT::hb_would_apply_context_t*\29\20const
+551:OT::ChainContextFormat3::would_apply\28OT::hb_would_apply_context_t*\29\20const
+552:OT::hb_would_apply_context_t::return_t\20OT::ExtensionFormat1